builder: mozilla-inbound_ubuntu64_vm-debug_test-mochitest-devtools-chrome-4 slave: tst-linux64-spot-1338 starttime: 1446846052.49 results: success (0) buildid: 20151106131334 builduid: 727647c13b4a4a45a27aab1074020cae revision: c99a26fcff8f7ecb57b379e2bbe909c3844c2b69 ========= Started set props: master (results: 0, elapsed: 0 secs) (at 2015-11-06 13:40:52.490841) ========= master: http://buildbot-master54.bb.releng.usw2.mozilla.com:8201/ ========= Finished set props: master (results: 0, elapsed: 0 secs) (at 2015-11-06 13:40:52.491283) ========= ========= Started set props: basedir (results: 0, elapsed: 0 secs) (at 2015-11-06 13:40:52.491590) ========= bash -c pwd in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['bash', '-c', 'pwd'] environment: HOME=/home/cltbld LANG=en_US.UTF-8 LOGNAME=cltbld MAIL=/var/mail/cltbld NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games PWD=/builds/slave/test SHELL=/bin/bash SHLVL=1 TERM=linux TMOUT=86400 USER=cltbld XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634 _=/tools/buildbot/bin/python using PTY: False /builds/slave/test program finished with exit code 0 elapsedTime=0.023087 basedir: '/builds/slave/test' ========= master_lag: 0.09 ========= ========= Finished set props: basedir (results: 0, elapsed: 0 secs) (at 2015-11-06 13:40:52.602378) ========= ========= Started downloading to buildprops.json (results: 0, elapsed: 6 secs) (at 2015-11-06 13:40:52.602668) ========= ========= Finished downloading to buildprops.json (results: 0, elapsed: 6 secs) (at 2015-11-06 13:40:59.161962) ========= ========= Started 'rm -rf ...' (results: 0, elapsed: 1 secs) (at 2015-11-06 13:40:59.162335) ========= rm -rf properties in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['rm', '-rf', 'properties'] environment: HOME=/home/cltbld LANG=en_US.UTF-8 LOGNAME=cltbld MAIL=/var/mail/cltbld NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games PWD=/builds/slave/test SHELL=/bin/bash SHLVL=1 TERM=linux TMOUT=86400 USER=cltbld XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634 _=/tools/buildbot/bin/python using PTY: False program finished with exit code 0 elapsedTime=0.020347 ========= master_lag: 1.13 ========= ========= Finished 'rm -rf ...' (results: 0, elapsed: 1 secs) (at 2015-11-06 13:41:00.315311) ========= ========= Started set props: script_repo_url (results: 0, elapsed: 0 secs) (at 2015-11-06 13:41:00.315643) ========= script_repo_url: https://hg.mozilla.org/build/mozharness ========= Finished set props: script_repo_url (results: 0, elapsed: 0 secs) (at 2015-11-06 13:41:00.316017) ========= ========= Started 'bash -c ...' (results: 0, elapsed: 0 secs) (at 2015-11-06 13:41:00.316325) ========= bash -c 'wget -Oarchiver_client.py --no-check-certificate --tries=10 --waitretry=3 https://hg.mozilla.org/build/tools/raw-file/default/buildfarm/utils/archiver_client.py' in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['bash', '-c', 'wget -Oarchiver_client.py --no-check-certificate --tries=10 --waitretry=3 https://hg.mozilla.org/build/tools/raw-file/default/buildfarm/utils/archiver_client.py'] environment: HOME=/home/cltbld LANG=en_US.UTF-8 LOGNAME=cltbld MAIL=/var/mail/cltbld NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games PWD=/builds/slave/test SHELL=/bin/bash SHLVL=1 TERM=linux TMOUT=86400 USER=cltbld XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634 _=/tools/buildbot/bin/python using PTY: False --2015-11-06 13:41:00-- https://hg.mozilla.org/build/tools/raw-file/default/buildfarm/utils/archiver_client.py Resolving hg.mozilla.org (hg.mozilla.org)... 63.245.215.102, 63.245.215.25 Connecting to hg.mozilla.org (hg.mozilla.org)|63.245.215.102|:443... connected. HTTP request sent, awaiting response... 200 Script output follows Length: 12141 (12K) [text/x-python] Saving to: `archiver_client.py' 0K .......... . 100% 11.7M=0.001s 2015-11-06 13:41:00 (11.7 MB/s) - `archiver_client.py' saved [12141/12141] program finished with exit code 0 elapsedTime=0.333079 ========= master_lag: 0.04 ========= ========= Finished 'bash -c ...' (results: 0, elapsed: 0 secs) (at 2015-11-06 13:41:00.687154) ========= ========= Started 'rm -rf ...' (results: 0, elapsed: 0 secs) (at 2015-11-06 13:41:00.687489) ========= rm -rf scripts in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['rm', '-rf', 'scripts'] environment: HOME=/home/cltbld LANG=en_US.UTF-8 LOGNAME=cltbld MAIL=/var/mail/cltbld NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games PWD=/builds/slave/test SHELL=/bin/bash SHLVL=1 TERM=linux TMOUT=86400 USER=cltbld XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634 _=/tools/buildbot/bin/python using PTY: False program finished with exit code 0 elapsedTime=0.034211 ========= master_lag: 0.04 ========= ========= Finished 'rm -rf ...' (results: 0, elapsed: 0 secs) (at 2015-11-06 13:41:00.757483) ========= ========= Started 'bash -c ...' (results: 0, elapsed: 0 secs) (at 2015-11-06 13:41:00.757848) ========= bash -c 'python archiver_client.py mozharness --repo integration/mozilla-inbound --rev c99a26fcff8f7ecb57b379e2bbe909c3844c2b69 --destination scripts --debug' in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['bash', '-c', u'python archiver_client.py mozharness --repo integration/mozilla-inbound --rev c99a26fcff8f7ecb57b379e2bbe909c3844c2b69 --destination scripts --debug'] environment: HOME=/home/cltbld LANG=en_US.UTF-8 LOGNAME=cltbld MAIL=/var/mail/cltbld NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games PWD=/builds/slave/test SHELL=/bin/bash SHLVL=1 TERM=linux TMOUT=86400 USER=cltbld XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634 _=/tools/buildbot/bin/python using PTY: False 2015-11-06 13:41:00,857 truncating revision to first 12 chars 2015-11-06 13:41:00,858 Setting DEBUG logging. 2015-11-06 13:41:00,858 attempt 1/10 2015-11-06 13:41:00,858 Getting archive location from https://api.pub.build.mozilla.org/archiver/hgmo/integration/mozilla-inbound/c99a26fcff8f?&preferred_region=us-west-2&suffix=tar.gz&subdir=testing/mozharness 2015-11-06 13:41:01,197 unpacking tar archive at: mozilla-inbound-c99a26fcff8f/testing/mozharness/ program finished with exit code 0 elapsedTime=0.626859 ========= master_lag: 0.04 ========= ========= Finished 'bash -c ...' (results: 0, elapsed: 0 secs) (at 2015-11-06 13:41:01.426199) ========= ========= Started downloading to oauth.txt (results: 0, elapsed: 0 secs) (at 2015-11-06 13:41:01.426708) ========= ========= Finished downloading to oauth.txt (results: 0, elapsed: 0 secs) (at 2015-11-06 13:41:01.463416) ========= ========= Started tinderboxprint_script_revlink (results: 0, elapsed: 0 secs) (at 2015-11-06 13:41:01.463896) ========= TinderboxPrint: script_revlink: https://hg.mozilla.org/build/mozharness/rev/production ========= Finished tinderboxprint_script_revlink (results: 0, elapsed: 0 secs) (at 2015-11-06 13:41:01.464406) ========= ========= Started '/tools/buildbot/bin/python scripts/scripts/desktop_unittest.py ...' (results: 0, elapsed: 29 mins, 55 secs) (at 2015-11-06 13:41:01.464704) ========= /tools/buildbot/bin/python scripts/scripts/desktop_unittest.py --cfg unittests/linux_unittest.py --mochitest-suite mochitest-devtools-chrome-chunked --total-chunks 8 --this-chunk 4 --blob-upload-branch mozilla-inbound --download-symbols true in dir /builds/slave/test/. (timeout 1800 secs) (maxTime 4800 secs) watching logfiles {} argv: ['/tools/buildbot/bin/python', 'scripts/scripts/desktop_unittest.py', '--cfg', 'unittests/linux_unittest.py', '--mochitest-suite', 'mochitest-devtools-chrome-chunked', '--total-chunks', '8', '--this-chunk', '4', '--blob-upload-branch', 'mozilla-inbound', '--download-symbols', 'true'] environment: CCACHE_DIR=/builds/ccache CCACHE_UMASK=002 DISPLAY=:0 HOME=/home/cltbld LANG=en_US.UTF-8 LOGNAME=cltbld MAIL=/var/mail/cltbld MOZ_HIDE_RESULTS_TABLE=1 MOZ_NODE_PATH=/usr/bin/node MOZ_NO_REMOTE=1 NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript NO_FAIL_ON_TEST_ERRORS=1 PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games PROPERTIES_FILE=/builds/slave/test/buildprops.json PWD=/builds/slave/test SHELL=/bin/bash SHLVL=1 TERM=linux TMOUT=86400 USER=cltbld XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634 _=/tools/buildbot/bin/python using PTY: False 13:41:01 INFO - MultiFileLogger online at 20151106 13:41:01 in /builds/slave/test 13:41:01 INFO - Run as scripts/scripts/desktop_unittest.py --cfg unittests/linux_unittest.py --mochitest-suite mochitest-devtools-chrome-chunked --total-chunks 8 --this-chunk 4 --blob-upload-branch mozilla-inbound --download-symbols true 13:41:01 INFO - Dumping config to /builds/slave/test/logs/localconfig.json. 13:41:01 INFO - {'all_cppunittest_suites': {'cppunittest': {'tests': ('tests/cppunittest',)}}, 13:41:01 INFO - 'all_gtest_suites': {'gtest': ()}, 13:41:01 INFO - 'all_jittest_suites': {'jittest': (), 13:41:01 INFO - 'jittest-chunked': (), 13:41:01 INFO - 'jittest1': ('--total-chunks=2', '--this-chunk=1'), 13:41:01 INFO - 'jittest2': ('--total-chunks=2', '--this-chunk=2')}, 13:41:01 INFO - 'all_mochitest_suites': {'a11y': ('--a11y',), 13:41:01 INFO - 'browser-chrome': ('--browser-chrome',), 13:41:01 INFO - 'browser-chrome-addons': ('--browser-chrome', 13:41:01 INFO - '--chunk-by-runtime', 13:41:01 INFO - '--tag=addons'), 13:41:01 INFO - 'browser-chrome-chunked': ('--browser-chrome', 13:41:01 INFO - '--chunk-by-runtime'), 13:41:01 INFO - 'chrome': ('--chrome',), 13:41:01 INFO - 'chrome-chunked': ('--chrome', '--chunk-by-dir=4'), 13:41:01 INFO - 'jetpack-addon': ('--jetpack-addon',), 13:41:01 INFO - 'jetpack-package': ('--jetpack-package',), 13:41:01 INFO - 'mochitest-devtools-chrome': ('--browser-chrome', 13:41:01 INFO - '--subsuite=devtools'), 13:41:01 INFO - 'mochitest-devtools-chrome-chunked': ('--browser-chrome', 13:41:01 INFO - '--subsuite=devtools', 13:41:01 INFO - '--chunk-by-runtime'), 13:41:01 INFO - 'mochitest-gl': ('--subsuite=webgl',), 13:41:01 INFO - 'mochitest-push': ('--subsuite=push',), 13:41:01 INFO - 'plain': (), 13:41:01 INFO - 'plain-chunked': ('--chunk-by-dir=4',)}, 13:41:01 INFO - 'all_mozbase_suites': {'mozbase': ()}, 13:41:01 INFO - 'all_reftest_suites': {'crashtest': {'options': ('--suite=crashtest',), 13:41:01 INFO - 'tests': ('tests/reftest/tests/testing/crashtest/crashtests.list',)}, 13:41:01 INFO - 'crashtest-ipc': {'env': {'MOZ_DISABLE_CONTEXT_SHARING_GLX': '1', 13:41:01 INFO - 'MOZ_OMTC_ENABLED': '1'}, 13:41:01 INFO - 'options': ('--suite=crashtest', 13:41:01 INFO - '--setpref=browser.tabs.remote=true', 13:41:01 INFO - '--setpref=browser.tabs.remote.autostart=true', 13:41:01 INFO - '--setpref=layers.offmainthreadcomposition.testing.enabled=true', 13:41:01 INFO - '--setpref=layers.async-pan-zoom.enabled=true'), 13:41:01 INFO - 'tests': ('tests/reftest/tests/testing/crashtest/crashtests.list',)}, 13:41:01 INFO - 'jsreftest': {'options': ('--extra-profile-file=tests/jsreftest/tests/user.js', 13:41:01 INFO - '--suite=jstestbrowser'), 13:41:01 INFO - 'tests': ('tests/jsreftest/tests/jstests.list',)}, 13:41:01 INFO - 'reftest': {'options': ('--suite=reftest',), 13:41:01 INFO - 'tests': ('tests/reftest/tests/layout/reftests/reftest.list',)}, 13:41:01 INFO - 'reftest-ipc': {'env': {'MOZ_DISABLE_CONTEXT_SHARING_GLX': '1', 13:41:01 INFO - 'MOZ_OMTC_ENABLED': '1'}, 13:41:01 INFO - 'options': ('--suite=reftest', 13:41:01 INFO - '--setpref=browser.tabs.remote=true', 13:41:01 INFO - '--setpref=browser.tabs.remote.autostart=true', 13:41:01 INFO - '--setpref=layers.offmainthreadcomposition.testing.enabled=true', 13:41:01 INFO - '--setpref=layers.async-pan-zoom.enabled=true'), 13:41:01 INFO - 'tests': ('tests/reftest/tests/layout/reftests/reftest-sanity/reftest.list',)}, 13:41:01 INFO - 'reftest-no-accel': {'options': ('--suite=reftest', 13:41:01 INFO - '--setpref=layers.acceleration.force-enabled=disabled'), 13:41:01 INFO - 'tests': ('tests/reftest/tests/layout/reftests/reftest.list',)}}, 13:41:01 INFO - 'all_webapprt_suites': {'chrome': ('--webapprt-chrome', 13:41:01 INFO - '--browser-arg=-test-mode'), 13:41:01 INFO - 'content': ('--webapprt-content',)}, 13:41:01 INFO - 'all_xpcshell_suites': {'xpcshell': {'options': ('--xpcshell=%(abs_app_dir)s/xpcshell', 13:41:01 INFO - '--manifest=tests/xpcshell/tests/all-test-dirs.list'), 13:41:01 INFO - 'tests': ()}, 13:41:01 INFO - 'xpcshell-addons': {'options': ('--xpcshell=%(abs_app_dir)s/xpcshell', 13:41:01 INFO - '--tag=addons', 13:41:01 INFO - '--manifest=tests/xpcshell/tests/all-test-dirs.list'), 13:41:01 INFO - 'tests': ()}}, 13:41:01 INFO - 'append_to_log': False, 13:41:01 INFO - 'base_work_dir': '/builds/slave/test', 13:41:01 INFO - 'binary_path': '/builds/slave/test/build/firefox/firefox-bin', 13:41:01 INFO - 'blob_upload_branch': 'mozilla-inbound', 13:41:01 INFO - 'blob_uploader_auth_file': '/builds/slave/test/oauth.txt', 13:41:01 INFO - 'buildbot_json_path': 'buildprops.json', 13:41:01 INFO - 'buildbot_max_log_size': 52428800, 13:41:01 INFO - 'code_coverage': False, 13:41:01 INFO - 'config_files': ('unittests/linux_unittest.py',), 13:41:01 INFO - 'default_blob_upload_servers': ('https://blobupload.elasticbeanstalk.com',), 13:41:01 INFO - 'download_minidump_stackwalk': True, 13:41:01 INFO - 'download_symbols': 'true', 13:41:01 INFO - 'e10s': False, 13:41:01 INFO - 'exe_suffix': '', 13:41:01 INFO - 'exes': {'python': '/tools/buildbot/bin/python', 13:41:01 INFO - 'tooltool.py': '/tools/tooltool.py', 13:41:01 INFO - 'virtualenv': ('/tools/buildbot/bin/python', 13:41:01 INFO - '/tools/misc-python/virtualenv.py')}, 13:41:01 INFO - 'find_links': ('http://pypi.pvt.build.mozilla.org/pub', 13:41:01 INFO - 'http://pypi.pub.build.mozilla.org/pub'), 13:41:01 INFO - 'installer_path': '/builds/slave/test/build/installer.tar.bz2', 13:41:01 INFO - 'log_level': 'info', 13:41:01 INFO - 'log_to_console': True, 13:41:01 INFO - 'minidump_save_path': '%(abs_work_dir)s/../minidumps', 13:41:01 INFO - 'minidump_stackwalk_path': 'linux64-minidump_stackwalk', 13:41:01 INFO - 'minidump_tooltool_manifest_path': 'config/tooltool-manifests/linux64/releng.manifest', 13:41:01 INFO - 'minimum_tests_zip_dirs': ('bin/*', 13:41:01 INFO - 'certs/*', 13:41:01 INFO - 'modules/*', 13:41:01 INFO - 'mozbase/*', 13:41:01 INFO - 'config/*'), 13:41:01 INFO - 'no_random': False, 13:41:01 INFO - 'opt_config_files': (), 13:41:01 INFO - 'pip_index': False, 13:41:01 INFO - 'preflight_run_cmd_suites': ({'architectures': ('32bit', '64bit'), 13:41:01 INFO - 'cmd': ('xset', 's', 'off', 's', 'reset'), 13:41:01 INFO - 'enabled': True, 13:41:01 INFO - 'halt_on_failure': False, 13:41:01 INFO - 'name': 'disable_screen_saver'}, 13:41:01 INFO - {'architectures': ('32bit',), 13:41:01 INFO - 'cmd': ('python', 13:41:01 INFO - '../scripts/external_tools/mouse_and_screen_resolution.py', 13:41:01 INFO - '--configuration-url', 13:41:01 INFO - 'https://hg.mozilla.org/%(branch)s/raw-file/%(revision)s/testing/machine-configuration.json'), 13:41:01 INFO - 'enabled': False, 13:41:01 INFO - 'halt_on_failure': True, 13:41:01 INFO - 'name': 'run mouse & screen adjustment script'}), 13:41:01 INFO - 'require_test_zip': True, 13:41:01 INFO - 'run_all_suites': False, 13:41:01 INFO - 'run_cmd_checks_enabled': True, 13:41:01 INFO - 'run_file_names': {'cppunittest': 'runcppunittests.py', 13:41:01 INFO - 'gtest': 'rungtests.py', 13:41:01 INFO - 'jittest': 'jit_test.py', 13:41:01 INFO - 'mochitest': 'runtests.py', 13:41:01 INFO - 'mozbase': 'test.py', 13:41:01 INFO - 'mozmill': 'runtestlist.py', 13:41:01 INFO - 'reftest': 'runreftest.py', 13:41:01 INFO - 'webapprt': 'runtests.py', 13:41:01 INFO - 'xpcshell': 'runxpcshelltests.py'}, 13:41:01 INFO - 'specific_tests_zip_dirs': {'cppunittest': ('cppunittest/*',), 13:41:01 INFO - 'gtest': ('gtest/*',), 13:41:01 INFO - 'jittest': ('jit-test/*',), 13:41:01 INFO - 'mochitest': ('mochitest/*',), 13:41:01 INFO - 'mozbase': ('mozbase/*',), 13:41:01 INFO - 'mozmill': ('mozmill/*',), 13:41:01 INFO - 'reftest': ('reftest/*', 'jsreftest/*'), 13:41:01 INFO - 'webapprt': ('mochitest/*',), 13:41:01 INFO - 'xpcshell': ('xpcshell/*',)}, 13:41:01 INFO - 'specified_mochitest_suites': ('mochitest-devtools-chrome-chunked',), 13:41:01 INFO - 'strict_content_sandbox': False, 13:41:01 INFO - 'suite_definitions': {'cppunittest': {'options': ('--symbols-path=%(symbols_path)s', 13:41:01 INFO - '--xre-path=%(abs_app_dir)s'), 13:41:01 INFO - 'run_filename': 'runcppunittests.py', 13:41:01 INFO - 'testsdir': 'cppunittest'}, 13:41:01 INFO - 'gtest': {'options': ('--xre-path=%(abs_res_dir)s', 13:41:01 INFO - '--cwd=%(gtest_dir)s', 13:41:01 INFO - '--symbols-path=%(symbols_path)s', 13:41:01 INFO - '%(binary_path)s'), 13:41:01 INFO - 'run_filename': 'rungtests.py'}, 13:41:01 INFO - 'jittest': {'options': ('tests/bin/js', 13:41:01 INFO - '--no-slow', 13:41:01 INFO - '--no-progress', 13:41:01 INFO - '--format=automation', 13:41:01 INFO - '--jitflags=all'), 13:41:01 INFO - 'run_filename': 'jit_test.py', 13:41:01 INFO - 'testsdir': 'jit-test/jit-test'}, 13:41:01 INFO - 'luciddream-b2gdt': {'options': ('--startup-timeout=300', 13:41:01 INFO - '--log-raw=%(raw_log_file)s', 13:41:01 INFO - '--log-errorsummary=%(error_summary_file)s', 13:41:01 INFO - '--browser-path=%(browser_path)s', 13:41:01 INFO - '--b2g-desktop-path=%(fxos_desktop_path)s', 13:41:01 INFO - '--gaia-profile=%(gaia_profile)s', 13:41:01 INFO - '%(test_manifest)s')}, 13:41:01 INFO - 'luciddream-emulator': {'options': ('--startup-timeout=300', 13:41:01 INFO - '--log-raw=%(raw_log_file)s', 13:41:01 INFO - '--log-errorsummary=%(error_summary_file)s', 13:41:01 INFO - '--browser-path=%(browser_path)s', 13:41:01 INFO - '--b2gpath=%(emulator_path)s', 13:41:01 INFO - '%(test_manifest)s')}, 13:41:01 INFO - 'mochitest': {'options': ('--appname=%(binary_path)s', 13:41:01 INFO - '--utility-path=tests/bin', 13:41:01 INFO - '--extra-profile-file=tests/bin/plugins', 13:41:01 INFO - '--symbols-path=%(symbols_path)s', 13:41:01 INFO - '--certificate-path=tests/certs', 13:41:01 INFO - '--setpref=webgl.force-enabled=true', 13:41:01 INFO - '--quiet', 13:41:01 INFO - '--log-raw=%(raw_log_file)s', 13:41:01 INFO - '--log-errorsummary=%(error_summary_file)s', 13:41:01 INFO - '--use-test-media-devices', 13:41:01 INFO - '--screenshot-on-fail'), 13:41:01 INFO - 'run_filename': 'runtests.py', 13:41:01 INFO - 'testsdir': 'mochitest'}, 13:41:01 INFO - 'mozbase': {'options': ('-b', '%(binary_path)s'), 13:41:01 INFO - 'run_filename': 'test.py', 13:41:01 INFO - 'testsdir': 'mozbase'}, 13:41:01 INFO - 'mozmill': {'options': ('--binary=%(binary_path)s', 13:41:01 INFO - '--testing-modules-dir=test/modules', 13:41:01 INFO - '--symbols-path=%(symbols_path)s'), 13:41:01 INFO - 'run_filename': 'runtestlist.py', 13:41:01 INFO - 'testsdir': 'mozmill'}, 13:41:01 INFO - 'reftest': {'options': ('--appname=%(binary_path)s', 13:41:01 INFO - '--utility-path=tests/bin', 13:41:01 INFO - '--extra-profile-file=tests/bin/plugins', 13:41:01 INFO - '--symbols-path=%(symbols_path)s'), 13:41:01 INFO - 'run_filename': 'runreftest.py', 13:41:01 INFO - 'testsdir': 'reftest'}, 13:41:01 INFO - 'webapprt': {'options': ('--app=%(app_path)s', 13:41:01 INFO - '--utility-path=tests/bin', 13:41:01 INFO - '--extra-profile-file=tests/bin/plugins', 13:41:01 INFO - '--symbols-path=%(symbols_path)s', 13:41:01 INFO - '--certificate-path=tests/certs', 13:41:01 INFO - '--console-level=INFO', 13:41:01 INFO - '--testing-modules-dir=tests/modules', 13:41:01 INFO - '--quiet'), 13:41:01 INFO - 'run_filename': 'runtests.py', 13:41:01 INFO - 'testsdir': 'mochitest'}, 13:41:01 INFO - 'xpcshell': {'options': ('--symbols-path=%(symbols_path)s', 13:41:01 INFO - '--test-plugin-path=%(test_plugin_path)s', 13:41:01 INFO - '--log-raw=%(raw_log_file)s', 13:41:01 INFO - '--log-errorsummary=%(error_summary_file)s', 13:41:01 INFO - '--utility-path=tests/bin'), 13:41:01 INFO - 'run_filename': 'runxpcshelltests.py', 13:41:01 INFO - 'testsdir': 'xpcshell'}}, 13:41:01 INFO - 'this_chunk': '4', 13:41:01 INFO - 'tooltool_cache': '/builds/tooltool_cache', 13:41:01 INFO - 'total_chunks': '8', 13:41:01 INFO - 'vcs_output_timeout': 1000, 13:41:01 INFO - 'virtualenv_path': 'venv', 13:41:01 INFO - 'volatile_config': {'actions': None, 'add_actions': None, 'no_actions': None}, 13:41:01 INFO - 'work_dir': 'build', 13:41:01 INFO - 'xpcshell_name': 'xpcshell'} 13:41:01 INFO - ##### 13:41:01 INFO - ##### Running clobber step. 13:41:01 INFO - ##### 13:41:01 INFO - Running pre-action listener: _resource_record_pre_action 13:41:01 INFO - Running main action method: clobber 13:41:01 INFO - rmtree: /builds/slave/test/build 13:41:01 INFO - retry: Calling rmtree with args: ('/builds/slave/test/build',), kwargs: {}, attempt #1 13:41:03 INFO - Running post-action listener: _resource_record_post_action 13:41:03 INFO - ##### 13:41:03 INFO - ##### Running read-buildbot-config step. 13:41:03 INFO - ##### 13:41:03 INFO - Running pre-action listener: _resource_record_pre_action 13:41:03 INFO - Running main action method: read_buildbot_config 13:41:03 INFO - Using buildbot properties: 13:41:03 INFO - { 13:41:03 INFO - "properties": { 13:41:03 INFO - "buildnumber": 126, 13:41:03 INFO - "product": "firefox", 13:41:03 INFO - "script_repo_revision": "production", 13:41:03 INFO - "branch": "mozilla-inbound", 13:41:03 INFO - "repository": "", 13:41:03 INFO - "buildername": "Ubuntu VM 12.04 x64 mozilla-inbound debug test mochitest-devtools-chrome-4", 13:41:03 INFO - "buildid": "20151106131334", 13:41:03 INFO - "slavename": "tst-linux64-spot-1338", 13:41:03 INFO - "pgo_build": "False", 13:41:03 INFO - "basedir": "/builds/slave/test", 13:41:03 INFO - "project": "", 13:41:03 INFO - "platform": "linux64", 13:41:03 INFO - "master": "http://buildbot-master54.bb.releng.usw2.mozilla.com:8201/", 13:41:03 INFO - "slavebuilddir": "test", 13:41:03 INFO - "scheduler": "tests-mozilla-inbound-ubuntu64_vm-debug-unittest", 13:41:03 INFO - "repo_path": "integration/mozilla-inbound", 13:41:03 INFO - "moz_repo_path": "", 13:41:03 INFO - "stage_platform": "linux64", 13:41:03 INFO - "builduid": "727647c13b4a4a45a27aab1074020cae", 13:41:03 INFO - "revision": "c99a26fcff8f7ecb57b379e2bbe909c3844c2b69" 13:41:03 INFO - }, 13:41:03 INFO - "sourcestamp": { 13:41:03 INFO - "repository": "", 13:41:03 INFO - "hasPatch": false, 13:41:03 INFO - "project": "", 13:41:03 INFO - "branch": "mozilla-inbound-linux64-debug-unittest", 13:41:03 INFO - "changes": [ 13:41:03 INFO - { 13:41:03 INFO - "category": null, 13:41:03 INFO - "files": [ 13:41:03 INFO - { 13:41:03 INFO - "url": null, 13:41:03 INFO - "name": "https://queue.taskcluster.net/v1/task/gHPtl8QhT_OExLvlWTWaZg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.tar.bz2" 13:41:03 INFO - }, 13:41:03 INFO - { 13:41:03 INFO - "url": null, 13:41:03 INFO - "name": "https://queue.taskcluster.net/v1/task/gHPtl8QhT_OExLvlWTWaZg/artifacts/public/build/test_packages.json" 13:41:03 INFO - } 13:41:03 INFO - ], 13:41:03 INFO - "repository": "", 13:41:03 INFO - "rev": "bf3b50448aa1d9d3c7e48744a8d3dd918e27c8d0", 13:41:03 INFO - "who": "ahalberstadt@mozilla.com", 13:41:03 INFO - "when": 1446846015, 13:41:03 INFO - "number": 6632722, 13:41:03 INFO - "comments": "Bug 1220789 - Generalize |mach build-doc| for any arbitrary sphinx projects; rename to |mach doc|, r=gps\n\nNow, running |mach doc | will generate the sphinx based docs of the project and open them\nin the default browser. Mulitple doc paths can be supplied at a time. E.g:\n./mach doc testing/mozbase", 13:41:03 INFO - "project": "", 13:41:03 INFO - "at": "Fri 06 Nov 2015 13:40:15", 13:41:03 INFO - "branch": "mozilla-inbound-linux64-debug-unittest", 13:41:03 INFO - "revlink": "", 13:41:03 INFO - "properties": [ 13:41:03 INFO - [ 13:41:03 INFO - "buildid", 13:41:03 INFO - "20151106131333", 13:41:03 INFO - "Change" 13:41:03 INFO - ], 13:41:03 INFO - [ 13:41:03 INFO - "builduid", 13:41:03 INFO - "2fff5064efd042cba21e3ed22133a323", 13:41:03 INFO - "Change" 13:41:03 INFO - ], 13:41:03 INFO - [ 13:41:03 INFO - "pgo_build", 13:41:03 INFO - "False", 13:41:03 INFO - "Change" 13:41:03 INFO - ] 13:41:03 INFO - ], 13:41:03 INFO - "revision": "bf3b50448aa1d9d3c7e48744a8d3dd918e27c8d0" 13:41:03 INFO - }, 13:41:03 INFO - { 13:41:03 INFO - "category": null, 13:41:03 INFO - "files": [ 13:41:03 INFO - { 13:41:03 INFO - "url": null, 13:41:03 INFO - "name": "https://queue.taskcluster.net/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.tar.bz2" 13:41:03 INFO - }, 13:41:03 INFO - { 13:41:03 INFO - "url": null, 13:41:03 INFO - "name": "https://queue.taskcluster.net/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/test_packages.json" 13:41:03 INFO - } 13:41:03 INFO - ], 13:41:03 INFO - "repository": "", 13:41:03 INFO - "rev": "c99a26fcff8f7ecb57b379e2bbe909c3844c2b69", 13:41:03 INFO - "who": "eisaacson@mozilla.com", 13:41:03 INFO - "when": 1446845992, 13:41:03 INFO - "number": 6632717, 13:41:03 INFO - "comments": "Bug 1003439 - Enable speech synthesis in desktop by default. r=smaug", 13:41:03 INFO - "project": "", 13:41:03 INFO - "at": "Fri 06 Nov 2015 13:39:52", 13:41:03 INFO - "branch": "mozilla-inbound-linux64-debug-unittest", 13:41:03 INFO - "revlink": "", 13:41:03 INFO - "properties": [ 13:41:03 INFO - [ 13:41:03 INFO - "buildid", 13:41:03 INFO - "20151106131334", 13:41:03 INFO - "Change" 13:41:03 INFO - ], 13:41:03 INFO - [ 13:41:03 INFO - "builduid", 13:41:03 INFO - "727647c13b4a4a45a27aab1074020cae", 13:41:03 INFO - "Change" 13:41:03 INFO - ], 13:41:03 INFO - [ 13:41:03 INFO - "pgo_build", 13:41:03 INFO - "False", 13:41:03 INFO - "Change" 13:41:03 INFO - ] 13:41:03 INFO - ], 13:41:03 INFO - "revision": "c99a26fcff8f7ecb57b379e2bbe909c3844c2b69" 13:41:03 INFO - } 13:41:03 INFO - ], 13:41:03 INFO - "revision": "c99a26fcff8f7ecb57b379e2bbe909c3844c2b69" 13:41:03 INFO - } 13:41:03 INFO - } 13:41:03 INFO - Found installer url https://queue.taskcluster.net/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.tar.bz2. 13:41:03 INFO - Found a test packages url https://queue.taskcluster.net/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/test_packages.json. 13:41:03 INFO - Running post-action listener: _resource_record_post_action 13:41:03 INFO - ##### 13:41:03 INFO - ##### Running download-and-extract step. 13:41:03 INFO - ##### 13:41:03 INFO - Running pre-action listener: _resource_record_pre_action 13:41:03 INFO - Running main action method: download_and_extract 13:41:03 INFO - mkdir: /builds/slave/test/build/tests 13:41:03 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:41:03 INFO - https://queue.taskcluster.net/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/test_packages.json matches https://queue.taskcluster.net 13:41:03 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.usw2.mozilla.com/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/test_packages.json 13:41:03 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.usw2.mozilla.com/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/test_packages.json 13:41:03 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.usw2.mozilla.com/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/test_packages.json to /builds/slave/test/build/test_packages.json 13:41:03 INFO - retry: Calling _download_file with args: (), kwargs: {'url': 'http://queue.taskcluster.net.proxxy1.srv.releng.usw2.mozilla.com/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/test_packages.json', 'file_name': '/builds/slave/test/build/test_packages.json'}, attempt #1 13:41:04 INFO - Downloaded 1302 bytes. 13:41:04 INFO - Reading from file /builds/slave/test/build/test_packages.json 13:41:04 INFO - Using the following test package requirements: 13:41:04 INFO - {u'common': [u'firefox-45.0a1.en-US.linux-x86_64.common.tests.zip'], 13:41:04 INFO - u'cppunittest': [u'firefox-45.0a1.en-US.linux-x86_64.common.tests.zip', 13:41:04 INFO - u'firefox-45.0a1.en-US.linux-x86_64.cppunittest.tests.zip'], 13:41:04 INFO - u'jittest': [u'firefox-45.0a1.en-US.linux-x86_64.common.tests.zip', 13:41:04 INFO - u'jsshell-linux-x86_64.zip'], 13:41:04 INFO - u'mochitest': [u'firefox-45.0a1.en-US.linux-x86_64.common.tests.zip', 13:41:04 INFO - u'firefox-45.0a1.en-US.linux-x86_64.mochitest.tests.zip'], 13:41:04 INFO - u'mozbase': [u'firefox-45.0a1.en-US.linux-x86_64.common.tests.zip'], 13:41:04 INFO - u'reftest': [u'firefox-45.0a1.en-US.linux-x86_64.common.tests.zip', 13:41:04 INFO - u'firefox-45.0a1.en-US.linux-x86_64.reftest.tests.zip'], 13:41:04 INFO - u'talos': [u'firefox-45.0a1.en-US.linux-x86_64.common.tests.zip', 13:41:04 INFO - u'firefox-45.0a1.en-US.linux-x86_64.talos.tests.zip'], 13:41:04 INFO - u'web-platform': [u'firefox-45.0a1.en-US.linux-x86_64.common.tests.zip', 13:41:04 INFO - u'firefox-45.0a1.en-US.linux-x86_64.web-platform.tests.zip'], 13:41:04 INFO - u'webapprt': [u'firefox-45.0a1.en-US.linux-x86_64.common.tests.zip'], 13:41:04 INFO - u'xpcshell': [u'firefox-45.0a1.en-US.linux-x86_64.common.tests.zip', 13:41:04 INFO - u'firefox-45.0a1.en-US.linux-x86_64.xpcshell.tests.zip']} 13:41:04 INFO - Downloading packages: [u'firefox-45.0a1.en-US.linux-x86_64.common.tests.zip', u'firefox-45.0a1.en-US.linux-x86_64.mochitest.tests.zip'] for test suite category: mochitest 13:41:04 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:41:04 INFO - https://queue.taskcluster.net/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.common.tests.zip matches https://queue.taskcluster.net 13:41:04 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.usw2.mozilla.com/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.common.tests.zip 13:41:04 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.usw2.mozilla.com/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.common.tests.zip 13:41:04 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.usw2.mozilla.com/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.common.tests.zip to /builds/slave/test/build/firefox-45.0a1.en-US.linux-x86_64.common.tests.zip 13:41:04 INFO - retry: Calling _download_file with args: (), kwargs: {'url': u'http://queue.taskcluster.net.proxxy1.srv.releng.usw2.mozilla.com/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.common.tests.zip', 'file_name': u'/builds/slave/test/build/firefox-45.0a1.en-US.linux-x86_64.common.tests.zip'}, attempt #1 13:41:06 INFO - Downloaded 21697466 bytes. 13:41:06 INFO - Running command: ['unzip', '-q', '-o', u'/builds/slave/test/build/firefox-45.0a1.en-US.linux-x86_64.common.tests.zip', 'bin/*', 'certs/*', 'modules/*', 'mozbase/*', 'config/*', 'mochitest/*'] in /builds/slave/test/build/tests 13:41:06 INFO - Copy/paste: unzip -q -o /builds/slave/test/build/firefox-45.0a1.en-US.linux-x86_64.common.tests.zip bin/* certs/* modules/* mozbase/* config/* mochitest/* 13:41:06 INFO - Calling ['unzip', '-q', '-o', u'/builds/slave/test/build/firefox-45.0a1.en-US.linux-x86_64.common.tests.zip', 'bin/*', 'certs/*', 'modules/*', 'mozbase/*', 'config/*', 'mochitest/*'] with output_timeout 1760 13:41:06 INFO - caution: filename not matched: mochitest/* 13:41:06 INFO - Return code: 11 13:41:06 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:41:06 INFO - https://queue.taskcluster.net/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.mochitest.tests.zip matches https://queue.taskcluster.net 13:41:06 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.usw2.mozilla.com/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.mochitest.tests.zip 13:41:06 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.usw2.mozilla.com/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.mochitest.tests.zip 13:41:06 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.usw2.mozilla.com/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.mochitest.tests.zip to /builds/slave/test/build/firefox-45.0a1.en-US.linux-x86_64.mochitest.tests.zip 13:41:06 INFO - retry: Calling _download_file with args: (), kwargs: {'url': u'http://queue.taskcluster.net.proxxy1.srv.releng.usw2.mozilla.com/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.mochitest.tests.zip', 'file_name': u'/builds/slave/test/build/firefox-45.0a1.en-US.linux-x86_64.mochitest.tests.zip'}, attempt #1 13:41:09 INFO - Downloaded 62187577 bytes. 13:41:09 INFO - Running command: ['unzip', '-q', '-o', u'/builds/slave/test/build/firefox-45.0a1.en-US.linux-x86_64.mochitest.tests.zip', 'bin/*', 'certs/*', 'modules/*', 'mozbase/*', 'config/*', 'mochitest/*'] in /builds/slave/test/build/tests 13:41:09 INFO - Copy/paste: unzip -q -o /builds/slave/test/build/firefox-45.0a1.en-US.linux-x86_64.mochitest.tests.zip bin/* certs/* modules/* mozbase/* config/* mochitest/* 13:41:09 INFO - Calling ['unzip', '-q', '-o', u'/builds/slave/test/build/firefox-45.0a1.en-US.linux-x86_64.mochitest.tests.zip', 'bin/*', 'certs/*', 'modules/*', 'mozbase/*', 'config/*', 'mochitest/*'] with output_timeout 1760 13:41:13 INFO - caution: filename not matched: bin/* 13:41:13 INFO - caution: filename not matched: certs/* 13:41:13 INFO - caution: filename not matched: modules/* 13:41:13 INFO - caution: filename not matched: mozbase/* 13:41:13 INFO - caution: filename not matched: config/* 13:41:13 INFO - Return code: 11 13:41:13 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:41:13 INFO - https://queue.taskcluster.net/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.tar.bz2 matches https://queue.taskcluster.net 13:41:13 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.usw2.mozilla.com/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.tar.bz2 13:41:13 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.usw2.mozilla.com/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.tar.bz2 13:41:13 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.usw2.mozilla.com/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.tar.bz2 to /builds/slave/test/build/installer.tar.bz2 13:41:13 INFO - retry: Calling _download_file with args: (), kwargs: {'url': 'http://queue.taskcluster.net.proxxy1.srv.releng.usw2.mozilla.com/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.tar.bz2', 'file_name': '/builds/slave/test/build/installer.tar.bz2'}, attempt #1 13:41:15 INFO - Downloaded 57376895 bytes. 13:41:15 INFO - Setting buildbot property build_url to https://queue.taskcluster.net/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.tar.bz2 13:41:15 INFO - mkdir: /builds/slave/test/properties 13:41:15 INFO - Writing buildbot properties ['build_url'] to /builds/slave/test/properties/build_url 13:41:15 INFO - Writing to file /builds/slave/test/properties/build_url 13:41:15 INFO - Contents: 13:41:15 INFO - build_url:https://queue.taskcluster.net/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.tar.bz2 13:41:15 INFO - mkdir: /builds/slave/test/build/symbols 13:41:15 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:41:15 INFO - https://queue.taskcluster.net/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.crashreporter-symbols.zip matches https://queue.taskcluster.net 13:41:15 INFO - URL Candidate: http://queue.taskcluster.net.proxxy1.srv.releng.usw2.mozilla.com/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.crashreporter-symbols.zip 13:41:15 INFO - trying http://queue.taskcluster.net.proxxy1.srv.releng.usw2.mozilla.com/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.crashreporter-symbols.zip 13:41:15 INFO - Downloading http://queue.taskcluster.net.proxxy1.srv.releng.usw2.mozilla.com/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.crashreporter-symbols.zip to /builds/slave/test/build/symbols/firefox-45.0a1.en-US.linux-x86_64.crashreporter-symbols.zip 13:41:15 INFO - retry: Calling _download_file with args: (), kwargs: {'url': 'http://queue.taskcluster.net.proxxy1.srv.releng.usw2.mozilla.com/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.crashreporter-symbols.zip', 'file_name': '/builds/slave/test/build/symbols/firefox-45.0a1.en-US.linux-x86_64.crashreporter-symbols.zip'}, attempt #1 13:41:17 INFO - Downloaded 45635750 bytes. 13:41:17 INFO - Setting buildbot property symbols_url to https://queue.taskcluster.net/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.crashreporter-symbols.zip 13:41:17 INFO - Writing buildbot properties ['symbols_url'] to /builds/slave/test/properties/symbols_url 13:41:17 INFO - Writing to file /builds/slave/test/properties/symbols_url 13:41:17 INFO - Contents: 13:41:17 INFO - symbols_url:https://queue.taskcluster.net/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.crashreporter-symbols.zip 13:41:17 INFO - Running command: ['unzip', '-q', '/builds/slave/test/build/symbols/firefox-45.0a1.en-US.linux-x86_64.crashreporter-symbols.zip'] in /builds/slave/test/build/symbols 13:41:17 INFO - Copy/paste: unzip -q /builds/slave/test/build/symbols/firefox-45.0a1.en-US.linux-x86_64.crashreporter-symbols.zip 13:41:20 INFO - Return code: 0 13:41:20 INFO - Running post-action listener: _resource_record_post_action 13:41:20 INFO - Running post-action listener: set_extra_try_arguments 13:41:20 INFO - ##### 13:41:20 INFO - ##### Running create-virtualenv step. 13:41:20 INFO - ##### 13:41:20 INFO - Running pre-action listener: _install_mozbase 13:41:20 INFO - Running pre-action listener: _pre_create_virtualenv 13:41:20 INFO - Running pre-action listener: _resource_record_pre_action 13:41:20 INFO - Running main action method: create_virtualenv 13:41:20 INFO - Creating virtualenv /builds/slave/test/build/venv 13:41:20 INFO - Running command: ['/tools/buildbot/bin/python', '/tools/misc-python/virtualenv.py', '--no-site-packages', '--distribute', '/builds/slave/test/build/venv'] in /builds/slave/test/build 13:41:20 INFO - Copy/paste: /tools/buildbot/bin/python /tools/misc-python/virtualenv.py --no-site-packages --distribute /builds/slave/test/build/venv 13:41:21 INFO - The --no-site-packages flag is deprecated; it is now the default behavior. 13:41:21 INFO - Using real prefix '/usr' 13:41:21 INFO - New python executable in /builds/slave/test/build/venv/bin/python 13:41:23 INFO - Installing distribute.............................................................................................................................................................................................done. 13:41:27 INFO - Installing pip.................done. 13:41:27 INFO - Return code: 0 13:41:27 INFO - Installing psutil>=0.7.1 into virtualenv /builds/slave/test/build/venv 13:41:27 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:41:27 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 13:41:27 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub 13:41:27 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:41:27 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 13:41:27 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub 13:41:27 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'psutil>=0.7.1']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x297b1f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7fcf0d6d2e40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x2ab2aa0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2aaf150>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0ab0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0d30>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1 13:41:27 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'psutil>=0.7.1'] in /builds/slave/test/build 13:41:27 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub psutil>=0.7.1 13:41:27 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 13:41:27 INFO - 'CCACHE_UMASK': '002', 13:41:27 INFO - 'DISPLAY': ':0', 13:41:27 INFO - 'HOME': '/home/cltbld', 13:41:27 INFO - 'LANG': 'en_US.UTF-8', 13:41:27 INFO - 'LOGNAME': 'cltbld', 13:41:27 INFO - 'MAIL': '/var/mail/cltbld', 13:41:27 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 13:41:27 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 13:41:27 INFO - 'MOZ_NO_REMOTE': '1', 13:41:27 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 13:41:27 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 13:41:27 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 13:41:27 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 13:41:27 INFO - 'PWD': '/builds/slave/test', 13:41:27 INFO - 'SHELL': '/bin/bash', 13:41:27 INFO - 'SHLVL': '1', 13:41:27 INFO - 'TERM': 'linux', 13:41:27 INFO - 'TMOUT': '86400', 13:41:27 INFO - 'USER': 'cltbld', 13:41:27 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 13:41:27 INFO - '_': '/tools/buildbot/bin/python'} 13:41:27 INFO - Ignoring indexes: https://pypi.python.org/simple/ 13:41:27 INFO - Downloading/unpacking psutil>=0.7.1 13:41:27 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 13:41:27 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 13:41:27 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com has it available 13:41:27 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com has it available 13:41:27 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 13:41:27 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 13:41:31 INFO - Creating supposed download cache at /builds/slave/test/build/venv/cache 13:41:31 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fpsutil-3.1.1.tar.gz 13:41:31 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/psutil/setup.py) egg_info for package psutil 13:41:31 INFO - warning: no previously-included files matching '*' found under directory 'docs/_build' 13:41:31 INFO - warning: manifest_maker: MANIFEST.in, line 18: 'recursive-include' expects ... 13:41:31 INFO - Installing collected packages: psutil 13:41:31 INFO - Running setup.py install for psutil 13:41:31 INFO - building 'psutil._psutil_linux' extension 13:41:31 INFO - gcc -pthread -fno-strict-aliasing -DNDEBUG -g -fwrapv -O2 -Wall -Wstrict-prototypes -fPIC -DPSUTIL_VERSION=311 -I/usr/include/python2.7 -c psutil/_psutil_linux.c -o build/temp.linux-x86_64-2.7/psutil/_psutil_linux.o 13:41:32 INFO - gcc -pthread -shared -Wl,-O1 -Wl,-Bsymbolic-functions -Wl,-Bsymbolic-functions -Wl,-z,relro build/temp.linux-x86_64-2.7/psutil/_psutil_linux.o -o build/lib.linux-x86_64-2.7/psutil/_psutil_linux.so 13:41:32 INFO - building 'psutil._psutil_posix' extension 13:41:32 INFO - gcc -pthread -fno-strict-aliasing -DNDEBUG -g -fwrapv -O2 -Wall -Wstrict-prototypes -fPIC -I/usr/include/python2.7 -c psutil/_psutil_posix.c -o build/temp.linux-x86_64-2.7/psutil/_psutil_posix.o 13:41:32 INFO - gcc -pthread -shared -Wl,-O1 -Wl,-Bsymbolic-functions -Wl,-Bsymbolic-functions -Wl,-z,relro build/temp.linux-x86_64-2.7/psutil/_psutil_posix.o -o build/lib.linux-x86_64-2.7/psutil/_psutil_posix.so 13:41:32 INFO - warning: no previously-included files matching '*' found under directory 'docs/_build' 13:41:32 INFO - warning: manifest_maker: MANIFEST.in, line 18: 'recursive-include' expects ... 13:41:32 INFO - Successfully installed psutil 13:41:32 INFO - Cleaning up... 13:41:33 INFO - Return code: 0 13:41:33 INFO - Installing mozsystemmonitor==0.0.0 into virtualenv /builds/slave/test/build/venv 13:41:33 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:41:33 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 13:41:33 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub 13:41:33 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:41:33 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 13:41:33 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub 13:41:33 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'mozsystemmonitor==0.0.0']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x297b1f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7fcf0d6d2e40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x2ab2aa0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2aaf150>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0ab0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0d30>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1 13:41:33 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'mozsystemmonitor==0.0.0'] in /builds/slave/test/build 13:41:33 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub mozsystemmonitor==0.0.0 13:41:33 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 13:41:33 INFO - 'CCACHE_UMASK': '002', 13:41:33 INFO - 'DISPLAY': ':0', 13:41:33 INFO - 'HOME': '/home/cltbld', 13:41:33 INFO - 'LANG': 'en_US.UTF-8', 13:41:33 INFO - 'LOGNAME': 'cltbld', 13:41:33 INFO - 'MAIL': '/var/mail/cltbld', 13:41:33 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 13:41:33 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 13:41:33 INFO - 'MOZ_NO_REMOTE': '1', 13:41:33 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 13:41:33 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 13:41:33 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 13:41:33 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 13:41:33 INFO - 'PWD': '/builds/slave/test', 13:41:33 INFO - 'SHELL': '/bin/bash', 13:41:33 INFO - 'SHLVL': '1', 13:41:33 INFO - 'TERM': 'linux', 13:41:33 INFO - 'TMOUT': '86400', 13:41:33 INFO - 'USER': 'cltbld', 13:41:33 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 13:41:33 INFO - '_': '/tools/buildbot/bin/python'} 13:41:33 INFO - Ignoring indexes: https://pypi.python.org/simple/ 13:41:33 INFO - Downloading/unpacking mozsystemmonitor==0.0.0 13:41:33 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 13:41:33 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 13:41:33 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com has it available 13:41:33 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com has it available 13:41:33 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 13:41:33 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 13:41:36 INFO - Downloading mozsystemmonitor-0.0.tar.gz 13:41:36 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fmozsystemmonitor-0.0.tar.gz 13:41:36 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/mozsystemmonitor/setup.py) egg_info for package mozsystemmonitor 13:41:36 INFO - Requirement already satisfied (use --upgrade to upgrade): psutil>=0.7.1 in ./venv/lib/python2.7/site-packages (from mozsystemmonitor==0.0.0) 13:41:36 INFO - Installing collected packages: mozsystemmonitor 13:41:36 INFO - Running setup.py install for mozsystemmonitor 13:41:37 INFO - Successfully installed mozsystemmonitor 13:41:37 INFO - Cleaning up... 13:41:37 INFO - Return code: 0 13:41:37 INFO - Installing blobuploader==1.2.4 into virtualenv /builds/slave/test/build/venv 13:41:37 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:41:37 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 13:41:37 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub 13:41:37 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:41:37 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 13:41:37 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub 13:41:37 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'blobuploader==1.2.4']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x297b1f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7fcf0d6d2e40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x2ab2aa0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2aaf150>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0ab0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0d30>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1 13:41:37 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'blobuploader==1.2.4'] in /builds/slave/test/build 13:41:37 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub blobuploader==1.2.4 13:41:37 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 13:41:37 INFO - 'CCACHE_UMASK': '002', 13:41:37 INFO - 'DISPLAY': ':0', 13:41:37 INFO - 'HOME': '/home/cltbld', 13:41:37 INFO - 'LANG': 'en_US.UTF-8', 13:41:37 INFO - 'LOGNAME': 'cltbld', 13:41:37 INFO - 'MAIL': '/var/mail/cltbld', 13:41:37 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 13:41:37 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 13:41:37 INFO - 'MOZ_NO_REMOTE': '1', 13:41:37 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 13:41:37 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 13:41:37 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 13:41:37 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 13:41:37 INFO - 'PWD': '/builds/slave/test', 13:41:37 INFO - 'SHELL': '/bin/bash', 13:41:37 INFO - 'SHLVL': '1', 13:41:37 INFO - 'TERM': 'linux', 13:41:37 INFO - 'TMOUT': '86400', 13:41:37 INFO - 'USER': 'cltbld', 13:41:37 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 13:41:37 INFO - '_': '/tools/buildbot/bin/python'} 13:41:37 INFO - Ignoring indexes: https://pypi.python.org/simple/ 13:41:37 INFO - Downloading/unpacking blobuploader==1.2.4 13:41:37 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 13:41:37 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 13:41:37 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com has it available 13:41:37 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com has it available 13:41:37 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 13:41:37 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 13:41:40 INFO - Downloading blobuploader-1.2.4.tar.gz 13:41:40 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fblobuploader-1.2.4.tar.gz 13:41:40 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/blobuploader/setup.py) egg_info for package blobuploader 13:41:41 INFO - Downloading/unpacking requests==1.2.3. (from blobuploader==1.2.4) 13:41:41 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 13:41:41 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 13:41:41 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com has it available 13:41:41 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com has it available 13:41:41 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 13:41:41 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 13:41:41 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Frequests-1.2.3.tar.gz 13:41:41 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/requests/setup.py) egg_info for package requests 13:41:41 INFO - Downloading/unpacking docopt==0.6.1 (from blobuploader==1.2.4) 13:41:41 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 13:41:41 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 13:41:41 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com has it available 13:41:41 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com has it available 13:41:41 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 13:41:41 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 13:41:42 INFO - Downloading docopt-0.6.1.tar.gz 13:41:42 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fdocopt-0.6.1.tar.gz 13:41:42 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/docopt/setup.py) egg_info for package docopt 13:41:42 INFO - Installing collected packages: blobuploader, requests, docopt 13:41:42 INFO - Running setup.py install for blobuploader 13:41:42 INFO - changing mode of build/scripts-2.7/blobberc.py from 664 to 775 13:41:42 INFO - changing mode of /builds/slave/test/build/venv/bin/blobberc.py to 775 13:41:42 INFO - Running setup.py install for requests 13:41:43 INFO - Running setup.py install for docopt 13:41:43 INFO - Successfully installed blobuploader requests docopt 13:41:43 INFO - Cleaning up... 13:41:43 INFO - Return code: 0 13:41:43 INFO - Installing None into virtualenv /builds/slave/test/build/venv 13:41:43 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:41:43 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 13:41:43 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub 13:41:43 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:41:43 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 13:41:43 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub 13:41:43 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--no-deps', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x297b1f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7fcf0d6d2e40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x2ab2aa0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2aaf150>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0ab0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0d30>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build/tests/config', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1 13:41:43 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--no-deps', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub'] in /builds/slave/test/build/tests/config 13:41:43 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --no-deps --download-cache /builds/slave/test/build/venv/cache --timeout 120 -r /builds/slave/test/build/tests/config/mozbase_requirements.txt --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub 13:41:43 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 13:41:43 INFO - 'CCACHE_UMASK': '002', 13:41:43 INFO - 'DISPLAY': ':0', 13:41:43 INFO - 'HOME': '/home/cltbld', 13:41:43 INFO - 'LANG': 'en_US.UTF-8', 13:41:43 INFO - 'LOGNAME': 'cltbld', 13:41:43 INFO - 'MAIL': '/var/mail/cltbld', 13:41:43 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 13:41:43 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 13:41:43 INFO - 'MOZ_NO_REMOTE': '1', 13:41:43 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 13:41:43 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 13:41:43 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 13:41:43 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 13:41:43 INFO - 'PWD': '/builds/slave/test', 13:41:43 INFO - 'SHELL': '/bin/bash', 13:41:43 INFO - 'SHLVL': '1', 13:41:43 INFO - 'TERM': 'linux', 13:41:43 INFO - 'TMOUT': '86400', 13:41:43 INFO - 'USER': 'cltbld', 13:41:43 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 13:41:43 INFO - '_': '/tools/buildbot/bin/python'} 13:41:44 INFO - Ignoring indexes: https://pypi.python.org/simple/ 13:41:44 INFO - Unpacking /builds/slave/test/build/tests/mozbase/manifestparser 13:41:44 INFO - Running setup.py (path:/tmp/pip-UK_OwQ-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/manifestparser 13:41:44 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozcrash 13:41:44 INFO - Running setup.py (path:/tmp/pip-Gw8RUo-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozcrash 13:41:44 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdebug 13:41:44 INFO - Running setup.py (path:/tmp/pip-_KCA3B-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdebug 13:41:44 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdevice 13:41:44 INFO - Running setup.py (path:/tmp/pip-vMPKoO-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdevice 13:41:44 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozfile 13:41:44 INFO - Running setup.py (path:/tmp/pip-FO_Oqs-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozfile 13:41:44 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozhttpd 13:41:44 INFO - Running setup.py (path:/tmp/pip-fbLUys-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozhttpd 13:41:44 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinfo 13:41:44 INFO - Running setup.py (path:/tmp/pip-TsTPJe-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinfo 13:41:44 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinstall 13:41:44 INFO - Running setup.py (path:/tmp/pip-1wOc4C-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinstall 13:41:45 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozleak 13:41:45 INFO - Running setup.py (path:/tmp/pip-lm9gKt-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozleak 13:41:45 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozlog 13:41:45 INFO - Running setup.py (path:/tmp/pip-u3o0re-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozlog 13:41:45 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moznetwork 13:41:45 INFO - Running setup.py (path:/tmp/pip-n0r2y7-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moznetwork 13:41:45 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprocess 13:41:45 INFO - Running setup.py (path:/tmp/pip-YS2QxE-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprocess 13:41:45 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprofile 13:41:45 INFO - Running setup.py (path:/tmp/pip-9S_wyX-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprofile 13:41:45 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozrunner 13:41:45 INFO - Running setup.py (path:/tmp/pip-qE0yE6-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozrunner 13:41:45 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozscreenshot 13:41:45 INFO - Running setup.py (path:/tmp/pip-cJWkxd-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozscreenshot 13:41:46 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moztest 13:41:46 INFO - Running setup.py (path:/tmp/pip-Q3nRhP-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moztest 13:41:46 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozversion 13:41:46 INFO - Running setup.py (path:/tmp/pip-Qzkz6d-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozversion 13:41:46 INFO - Installing collected packages: manifestparser, mozcrash, mozdebug, mozdevice, mozfile, mozhttpd, mozinfo, mozInstall, mozleak, mozlog, moznetwork, mozprocess, mozprofile, mozrunner, mozscreenshot, moztest, mozversion 13:41:46 INFO - Running setup.py install for manifestparser 13:41:46 INFO - Installing manifestparser script to /builds/slave/test/build/venv/bin 13:41:46 INFO - Running setup.py install for mozcrash 13:41:46 INFO - Running setup.py install for mozdebug 13:41:46 INFO - Running setup.py install for mozdevice 13:41:47 INFO - Installing sutini script to /builds/slave/test/build/venv/bin 13:41:47 INFO - Installing dm script to /builds/slave/test/build/venv/bin 13:41:47 INFO - Running setup.py install for mozfile 13:41:47 INFO - Running setup.py install for mozhttpd 13:41:47 INFO - Installing mozhttpd script to /builds/slave/test/build/venv/bin 13:41:47 INFO - Running setup.py install for mozinfo 13:41:47 INFO - Installing mozinfo script to /builds/slave/test/build/venv/bin 13:41:47 INFO - Running setup.py install for mozInstall 13:41:47 INFO - Installing moz_remove_from_system script to /builds/slave/test/build/venv/bin 13:41:47 INFO - Installing mozuninstall script to /builds/slave/test/build/venv/bin 13:41:47 INFO - Installing mozinstall script to /builds/slave/test/build/venv/bin 13:41:47 INFO - Installing moz_add_to_system script to /builds/slave/test/build/venv/bin 13:41:47 INFO - Running setup.py install for mozleak 13:41:48 INFO - Running setup.py install for mozlog 13:41:48 INFO - Installing structlog script to /builds/slave/test/build/venv/bin 13:41:48 INFO - Running setup.py install for moznetwork 13:41:48 INFO - Installing moznetwork script to /builds/slave/test/build/venv/bin 13:41:48 INFO - Running setup.py install for mozprocess 13:41:48 INFO - Running setup.py install for mozprofile 13:41:49 INFO - Installing mozprofile script to /builds/slave/test/build/venv/bin 13:41:49 INFO - Installing diff-profiles script to /builds/slave/test/build/venv/bin 13:41:49 INFO - Installing view-profile script to /builds/slave/test/build/venv/bin 13:41:49 INFO - Running setup.py install for mozrunner 13:41:49 INFO - Installing mozrunner script to /builds/slave/test/build/venv/bin 13:41:49 INFO - Running setup.py install for mozscreenshot 13:41:49 INFO - Running setup.py install for moztest 13:41:49 INFO - Running setup.py install for mozversion 13:41:49 INFO - Installing mozversion script to /builds/slave/test/build/venv/bin 13:41:49 INFO - Successfully installed manifestparser mozcrash mozdebug mozdevice mozfile mozhttpd mozinfo mozInstall mozleak mozlog moznetwork mozprocess mozprofile mozrunner mozscreenshot moztest mozversion 13:41:49 INFO - Cleaning up... 13:41:49 INFO - Return code: 0 13:41:49 INFO - Installing None into virtualenv /builds/slave/test/build/venv 13:41:49 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:41:49 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 13:41:49 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub 13:41:49 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:41:49 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 13:41:49 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub 13:41:49 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x297b1f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7fcf0d6d2e40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x2ab2aa0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2aaf150>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0ab0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0d30>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build/tests/config', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1 13:41:49 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub'] in /builds/slave/test/build/tests/config 13:41:49 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 -r /builds/slave/test/build/tests/config/mozbase_requirements.txt --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub 13:41:49 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 13:41:49 INFO - 'CCACHE_UMASK': '002', 13:41:49 INFO - 'DISPLAY': ':0', 13:41:49 INFO - 'HOME': '/home/cltbld', 13:41:49 INFO - 'LANG': 'en_US.UTF-8', 13:41:49 INFO - 'LOGNAME': 'cltbld', 13:41:49 INFO - 'MAIL': '/var/mail/cltbld', 13:41:49 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 13:41:49 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 13:41:49 INFO - 'MOZ_NO_REMOTE': '1', 13:41:49 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 13:41:49 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 13:41:49 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 13:41:49 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 13:41:49 INFO - 'PWD': '/builds/slave/test', 13:41:49 INFO - 'SHELL': '/bin/bash', 13:41:49 INFO - 'SHLVL': '1', 13:41:49 INFO - 'TERM': 'linux', 13:41:49 INFO - 'TMOUT': '86400', 13:41:49 INFO - 'USER': 'cltbld', 13:41:49 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 13:41:49 INFO - '_': '/tools/buildbot/bin/python'} 13:41:50 INFO - Ignoring indexes: https://pypi.python.org/simple/ 13:41:50 INFO - Unpacking /builds/slave/test/build/tests/mozbase/manifestparser 13:41:50 INFO - Running setup.py (path:/tmp/pip-fSFY9n-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/manifestparser 13:41:50 INFO - Requirement already satisfied (use --upgrade to upgrade): manifestparser==1.1 from file:///builds/slave/test/build/tests/mozbase/manifestparser in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 1)) 13:41:50 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozcrash 13:41:50 INFO - Running setup.py (path:/tmp/pip-I0l1h0-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozcrash 13:41:50 INFO - Requirement already satisfied (use --upgrade to upgrade): mozcrash==0.16 from file:///builds/slave/test/build/tests/mozbase/mozcrash in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 13:41:50 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdebug 13:41:50 INFO - Running setup.py (path:/tmp/pip-w7daRr-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdebug 13:41:50 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdebug==0.1 from file:///builds/slave/test/build/tests/mozbase/mozdebug in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3)) 13:41:50 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdevice 13:41:50 INFO - Running setup.py (path:/tmp/pip-osFm8X-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdevice 13:41:50 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdevice==0.47 from file:///builds/slave/test/build/tests/mozbase/mozdevice in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 13:41:50 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozfile 13:41:50 INFO - Running setup.py (path:/tmp/pip-nUPyQe-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozfile 13:41:51 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile==1.2 from file:///builds/slave/test/build/tests/mozbase/mozfile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 5)) 13:41:51 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozhttpd 13:41:51 INFO - Running setup.py (path:/tmp/pip-GE4i52-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozhttpd 13:41:51 INFO - Requirement already satisfied (use --upgrade to upgrade): mozhttpd==0.7 from file:///builds/slave/test/build/tests/mozbase/mozhttpd in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 6)) 13:41:51 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinfo 13:41:51 INFO - Running setup.py (path:/tmp/pip-xmbY6d-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinfo 13:41:51 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo==0.9 from file:///builds/slave/test/build/tests/mozbase/mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 7)) 13:41:51 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinstall 13:41:51 INFO - Running setup.py (path:/tmp/pip-M0OISz-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinstall 13:41:51 INFO - Requirement already satisfied (use --upgrade to upgrade): mozInstall==1.12 from file:///builds/slave/test/build/tests/mozbase/mozinstall in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 8)) 13:41:51 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozleak 13:41:51 INFO - Running setup.py (path:/tmp/pip-839alc-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozleak 13:41:51 INFO - Requirement already satisfied (use --upgrade to upgrade): mozleak==0.1 from file:///builds/slave/test/build/tests/mozbase/mozleak in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 9)) 13:41:51 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozlog 13:41:51 INFO - Running setup.py (path:/tmp/pip-GGpvIw-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozlog 13:41:51 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog==3.0 from file:///builds/slave/test/build/tests/mozbase/mozlog in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10)) 13:41:51 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moznetwork 13:41:51 INFO - Running setup.py (path:/tmp/pip-5JkDVD-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moznetwork 13:41:51 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork==0.27 from file:///builds/slave/test/build/tests/mozbase/moznetwork in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 11)) 13:41:51 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprocess 13:41:51 INFO - Running setup.py (path:/tmp/pip-YxyhCe-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprocess 13:41:52 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess==0.22 from file:///builds/slave/test/build/tests/mozbase/mozprocess in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 12)) 13:41:52 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprofile 13:41:52 INFO - Running setup.py (path:/tmp/pip-HcdS7l-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprofile 13:41:52 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprofile==0.27 from file:///builds/slave/test/build/tests/mozbase/mozprofile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 13)) 13:41:52 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozrunner 13:41:52 INFO - Running setup.py (path:/tmp/pip-Ouabs0-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozrunner 13:41:52 INFO - Requirement already satisfied (use --upgrade to upgrade): mozrunner==6.11 from file:///builds/slave/test/build/tests/mozbase/mozrunner in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 14)) 13:41:52 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozscreenshot 13:41:52 INFO - Running setup.py (path:/tmp/pip-oEcxGE-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozscreenshot 13:41:52 INFO - Requirement already satisfied (use --upgrade to upgrade): mozscreenshot==0.1 from file:///builds/slave/test/build/tests/mozbase/mozscreenshot in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 15)) 13:41:52 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moztest 13:41:52 INFO - Running setup.py (path:/tmp/pip-ohmTCl-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moztest 13:41:52 INFO - Requirement already satisfied (use --upgrade to upgrade): moztest==0.7 from file:///builds/slave/test/build/tests/mozbase/moztest in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 16)) 13:41:52 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozversion 13:41:52 INFO - Running setup.py (path:/tmp/pip-f9ieVU-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozversion 13:41:52 INFO - Requirement already satisfied (use --upgrade to upgrade): mozversion==1.4 from file:///builds/slave/test/build/tests/mozbase/mozversion in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 17)) 13:41:52 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile>=1.0 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozcrash==0.16->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 13:41:52 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog>=3.0 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozcrash==0.16->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 13:41:52 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdebug==0.1->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3)) 13:41:52 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork>=0.24 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdevice==0.47->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 13:41:52 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess>=0.19 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdevice==0.47->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 13:41:52 INFO - Downloading/unpacking blessings>=1.3 (from mozlog==3.0->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10)) 13:41:52 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 13:41:52 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 13:41:52 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com has it available 13:41:52 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com has it available 13:41:52 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 13:41:52 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 13:41:56 INFO - Downloading blessings-1.5.1.tar.gz 13:41:56 INFO - Storing download in cache at /builds/slave/test/build/venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fblessings-1.5.1.tar.gz 13:41:56 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/blessings/setup.py) egg_info for package blessings 13:41:56 INFO - Installing collected packages: blessings 13:41:56 INFO - Running setup.py install for blessings 13:41:56 INFO - Successfully installed blessings 13:41:56 INFO - Cleaning up... 13:41:56 INFO - Return code: 0 13:41:56 INFO - Installing pip>=1.5 into virtualenv /builds/slave/test/build/venv 13:41:56 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:41:56 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 13:41:56 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub 13:41:56 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:41:56 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 13:41:56 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub 13:41:56 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'pip>=1.5']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x297b1f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7fcf0d6d2e40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x2ab2aa0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2aaf150>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0ab0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0d30>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1 13:41:56 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'pip>=1.5'] in /builds/slave/test/build 13:41:56 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub pip>=1.5 13:41:56 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 13:41:56 INFO - 'CCACHE_UMASK': '002', 13:41:56 INFO - 'DISPLAY': ':0', 13:41:56 INFO - 'HOME': '/home/cltbld', 13:41:56 INFO - 'LANG': 'en_US.UTF-8', 13:41:56 INFO - 'LOGNAME': 'cltbld', 13:41:56 INFO - 'MAIL': '/var/mail/cltbld', 13:41:56 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 13:41:56 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 13:41:56 INFO - 'MOZ_NO_REMOTE': '1', 13:41:56 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 13:41:56 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 13:41:56 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 13:41:56 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 13:41:56 INFO - 'PWD': '/builds/slave/test', 13:41:56 INFO - 'SHELL': '/bin/bash', 13:41:56 INFO - 'SHLVL': '1', 13:41:56 INFO - 'TERM': 'linux', 13:41:56 INFO - 'TMOUT': '86400', 13:41:56 INFO - 'USER': 'cltbld', 13:41:56 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 13:41:56 INFO - '_': '/tools/buildbot/bin/python'} 13:41:57 INFO - Ignoring indexes: https://pypi.python.org/simple/ 13:41:57 INFO - Requirement already satisfied (use --upgrade to upgrade): pip>=1.5 in ./venv/lib/python2.7/site-packages/pip-1.5.5-py2.7.egg 13:41:57 INFO - Cleaning up... 13:41:57 INFO - Return code: 0 13:41:57 INFO - Installing psutil==3.1.1 into virtualenv /builds/slave/test/build/venv 13:41:57 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:41:57 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 13:41:57 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub 13:41:57 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:41:57 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 13:41:57 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub 13:41:57 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'psutil==3.1.1']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x297b1f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7fcf0d6d2e40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x2ab2aa0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2aaf150>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0ab0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0d30>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1 13:41:57 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'psutil==3.1.1'] in /builds/slave/test/build 13:41:57 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub psutil==3.1.1 13:41:57 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 13:41:57 INFO - 'CCACHE_UMASK': '002', 13:41:57 INFO - 'DISPLAY': ':0', 13:41:57 INFO - 'HOME': '/home/cltbld', 13:41:57 INFO - 'LANG': 'en_US.UTF-8', 13:41:57 INFO - 'LOGNAME': 'cltbld', 13:41:57 INFO - 'MAIL': '/var/mail/cltbld', 13:41:57 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 13:41:57 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 13:41:57 INFO - 'MOZ_NO_REMOTE': '1', 13:41:57 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 13:41:57 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 13:41:57 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 13:41:57 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 13:41:57 INFO - 'PWD': '/builds/slave/test', 13:41:57 INFO - 'SHELL': '/bin/bash', 13:41:57 INFO - 'SHLVL': '1', 13:41:57 INFO - 'TERM': 'linux', 13:41:57 INFO - 'TMOUT': '86400', 13:41:57 INFO - 'USER': 'cltbld', 13:41:57 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 13:41:57 INFO - '_': '/tools/buildbot/bin/python'} 13:41:57 INFO - Ignoring indexes: https://pypi.python.org/simple/ 13:41:57 INFO - Requirement already satisfied (use --upgrade to upgrade): psutil==3.1.1 in ./venv/lib/python2.7/site-packages 13:41:57 INFO - Cleaning up... 13:41:57 INFO - Return code: 0 13:41:57 INFO - Installing mock into virtualenv /builds/slave/test/build/venv 13:41:57 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:41:57 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 13:41:57 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub 13:41:57 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:41:57 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 13:41:57 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub 13:41:57 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'mock']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x297b1f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7fcf0d6d2e40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x2ab2aa0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2aaf150>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0ab0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0d30>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1 13:41:57 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'mock'] in /builds/slave/test/build 13:41:57 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub mock 13:41:57 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 13:41:57 INFO - 'CCACHE_UMASK': '002', 13:41:57 INFO - 'DISPLAY': ':0', 13:41:57 INFO - 'HOME': '/home/cltbld', 13:41:57 INFO - 'LANG': 'en_US.UTF-8', 13:41:57 INFO - 'LOGNAME': 'cltbld', 13:41:57 INFO - 'MAIL': '/var/mail/cltbld', 13:41:57 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 13:41:57 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 13:41:57 INFO - 'MOZ_NO_REMOTE': '1', 13:41:57 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 13:41:57 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 13:41:57 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 13:41:57 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 13:41:57 INFO - 'PWD': '/builds/slave/test', 13:41:57 INFO - 'SHELL': '/bin/bash', 13:41:57 INFO - 'SHLVL': '1', 13:41:57 INFO - 'TERM': 'linux', 13:41:57 INFO - 'TMOUT': '86400', 13:41:57 INFO - 'USER': 'cltbld', 13:41:57 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 13:41:57 INFO - '_': '/tools/buildbot/bin/python'} 13:41:57 INFO - Ignoring indexes: https://pypi.python.org/simple/ 13:41:57 INFO - Downloading/unpacking mock 13:41:57 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 13:41:57 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 13:41:57 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com has it available 13:41:57 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com has it available 13:41:57 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 13:41:57 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 13:42:01 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fmock-1.0.1.tar.gz 13:42:01 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/mock/setup.py) egg_info for package mock 13:42:01 INFO - warning: no files found matching '*.png' under directory 'docs' 13:42:01 INFO - warning: no files found matching '*.css' under directory 'docs' 13:42:01 INFO - warning: no files found matching '*.html' under directory 'docs' 13:42:01 INFO - warning: no files found matching '*.js' under directory 'docs' 13:42:01 INFO - Installing collected packages: mock 13:42:01 INFO - Running setup.py install for mock 13:42:02 INFO - warning: no files found matching '*.png' under directory 'docs' 13:42:02 INFO - warning: no files found matching '*.css' under directory 'docs' 13:42:02 INFO - warning: no files found matching '*.html' under directory 'docs' 13:42:02 INFO - warning: no files found matching '*.js' under directory 'docs' 13:42:02 INFO - Successfully installed mock 13:42:02 INFO - Cleaning up... 13:42:02 INFO - Return code: 0 13:42:02 INFO - Installing simplejson into virtualenv /builds/slave/test/build/venv 13:42:02 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:42:02 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 13:42:02 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub 13:42:02 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:42:02 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 13:42:02 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub 13:42:02 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'simplejson']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x297b1f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7fcf0d6d2e40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x2ab2aa0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2aaf150>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0ab0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0d30>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1 13:42:02 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub', 'simplejson'] in /builds/slave/test/build 13:42:02 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub simplejson 13:42:02 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 13:42:02 INFO - 'CCACHE_UMASK': '002', 13:42:02 INFO - 'DISPLAY': ':0', 13:42:02 INFO - 'HOME': '/home/cltbld', 13:42:02 INFO - 'LANG': 'en_US.UTF-8', 13:42:02 INFO - 'LOGNAME': 'cltbld', 13:42:02 INFO - 'MAIL': '/var/mail/cltbld', 13:42:02 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 13:42:02 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 13:42:02 INFO - 'MOZ_NO_REMOTE': '1', 13:42:02 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 13:42:02 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 13:42:02 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 13:42:02 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 13:42:02 INFO - 'PWD': '/builds/slave/test', 13:42:02 INFO - 'SHELL': '/bin/bash', 13:42:02 INFO - 'SHLVL': '1', 13:42:02 INFO - 'TERM': 'linux', 13:42:02 INFO - 'TMOUT': '86400', 13:42:02 INFO - 'USER': 'cltbld', 13:42:02 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 13:42:02 INFO - '_': '/tools/buildbot/bin/python'} 13:42:02 INFO - Ignoring indexes: https://pypi.python.org/simple/ 13:42:02 INFO - Downloading/unpacking simplejson 13:42:02 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 13:42:02 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 13:42:02 INFO - http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com has it available 13:42:02 INFO - http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com has it available 13:42:02 INFO - http://pypi.pvt.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pvt.build.mozilla.org has it available 13:42:02 INFO - http://pypi.pub.build.mozilla.org/pub uses an insecure transport scheme (http). Consider using https if pypi.pub.build.mozilla.org has it available 13:42:06 INFO - Storing download in cache at ./venv/cache/http%3A%2F%2Fpypi.pvt.build.mozilla.org%2Fpub%2Fsimplejson-3.3.0.tar.gz 13:42:06 INFO - Running setup.py (path:/builds/slave/test/build/venv/build/simplejson/setup.py) egg_info for package simplejson 13:42:06 INFO - Installing collected packages: simplejson 13:42:06 INFO - Running setup.py install for simplejson 13:42:06 INFO - building 'simplejson._speedups' extension 13:42:06 INFO - gcc -pthread -fno-strict-aliasing -DNDEBUG -g -fwrapv -O2 -Wall -Wstrict-prototypes -fPIC -I/usr/include/python2.7 -c simplejson/_speedups.c -o build/temp.linux-x86_64-2.7/simplejson/_speedups.o 13:42:08 INFO - gcc -pthread -shared -Wl,-O1 -Wl,-Bsymbolic-functions -Wl,-Bsymbolic-functions -Wl,-z,relro build/temp.linux-x86_64-2.7/simplejson/_speedups.o -o build/lib.linux-x86_64-2.7/simplejson/_speedups.so 13:42:08 INFO - Successfully installed simplejson 13:42:08 INFO - Cleaning up... 13:42:08 INFO - Return code: 0 13:42:08 INFO - Installing None into virtualenv /builds/slave/test/build/venv 13:42:08 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:42:08 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 13:42:08 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub 13:42:08 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:42:08 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 13:42:08 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub 13:42:08 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--no-deps', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x297b1f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7fcf0d6d2e40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x2ab2aa0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2aaf150>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0ab0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0d30>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build/tests/config', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1 13:42:08 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--no-deps', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub'] in /builds/slave/test/build/tests/config 13:42:08 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --no-deps --download-cache /builds/slave/test/build/venv/cache --timeout 120 -r /builds/slave/test/build/tests/config/mozbase_requirements.txt --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub 13:42:08 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 13:42:08 INFO - 'CCACHE_UMASK': '002', 13:42:08 INFO - 'DISPLAY': ':0', 13:42:08 INFO - 'HOME': '/home/cltbld', 13:42:08 INFO - 'LANG': 'en_US.UTF-8', 13:42:08 INFO - 'LOGNAME': 'cltbld', 13:42:08 INFO - 'MAIL': '/var/mail/cltbld', 13:42:08 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 13:42:08 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 13:42:08 INFO - 'MOZ_NO_REMOTE': '1', 13:42:08 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 13:42:08 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 13:42:08 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 13:42:08 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 13:42:08 INFO - 'PWD': '/builds/slave/test', 13:42:08 INFO - 'SHELL': '/bin/bash', 13:42:08 INFO - 'SHLVL': '1', 13:42:08 INFO - 'TERM': 'linux', 13:42:08 INFO - 'TMOUT': '86400', 13:42:08 INFO - 'USER': 'cltbld', 13:42:08 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 13:42:08 INFO - '_': '/tools/buildbot/bin/python'} 13:42:08 INFO - Ignoring indexes: https://pypi.python.org/simple/ 13:42:08 INFO - Unpacking /builds/slave/test/build/tests/mozbase/manifestparser 13:42:09 INFO - Running setup.py (path:/tmp/pip-6CLWue-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/manifestparser 13:42:09 INFO - Requirement already satisfied (use --upgrade to upgrade): manifestparser==1.1 from file:///builds/slave/test/build/tests/mozbase/manifestparser in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 1)) 13:42:09 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozcrash 13:42:09 INFO - Running setup.py (path:/tmp/pip-hOIiUf-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozcrash 13:42:09 INFO - Requirement already satisfied (use --upgrade to upgrade): mozcrash==0.16 from file:///builds/slave/test/build/tests/mozbase/mozcrash in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 13:42:09 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdebug 13:42:09 INFO - Running setup.py (path:/tmp/pip-iCDtBt-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdebug 13:42:09 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdebug==0.1 from file:///builds/slave/test/build/tests/mozbase/mozdebug in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3)) 13:42:09 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdevice 13:42:09 INFO - Running setup.py (path:/tmp/pip-S1Umaw-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdevice 13:42:09 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdevice==0.47 from file:///builds/slave/test/build/tests/mozbase/mozdevice in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 13:42:09 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozfile 13:42:09 INFO - Running setup.py (path:/tmp/pip-LUoaX2-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozfile 13:42:09 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile==1.2 from file:///builds/slave/test/build/tests/mozbase/mozfile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 5)) 13:42:09 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozhttpd 13:42:09 INFO - Running setup.py (path:/tmp/pip-FofZmI-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozhttpd 13:42:09 INFO - Requirement already satisfied (use --upgrade to upgrade): mozhttpd==0.7 from file:///builds/slave/test/build/tests/mozbase/mozhttpd in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 6)) 13:42:09 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinfo 13:42:09 INFO - Running setup.py (path:/tmp/pip-9XS25z-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinfo 13:42:09 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo==0.9 from file:///builds/slave/test/build/tests/mozbase/mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 7)) 13:42:09 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinstall 13:42:09 INFO - Running setup.py (path:/tmp/pip-UABNTj-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinstall 13:42:10 INFO - Requirement already satisfied (use --upgrade to upgrade): mozInstall==1.12 from file:///builds/slave/test/build/tests/mozbase/mozinstall in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 8)) 13:42:10 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozleak 13:42:10 INFO - Running setup.py (path:/tmp/pip-r9VJCp-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozleak 13:42:10 INFO - Requirement already satisfied (use --upgrade to upgrade): mozleak==0.1 from file:///builds/slave/test/build/tests/mozbase/mozleak in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 9)) 13:42:10 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozlog 13:42:10 INFO - Running setup.py (path:/tmp/pip-QwckDO-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozlog 13:42:10 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog==3.0 from file:///builds/slave/test/build/tests/mozbase/mozlog in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10)) 13:42:10 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moznetwork 13:42:10 INFO - Running setup.py (path:/tmp/pip-omheoR-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moznetwork 13:42:10 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork==0.27 from file:///builds/slave/test/build/tests/mozbase/moznetwork in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 11)) 13:42:10 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprocess 13:42:10 INFO - Running setup.py (path:/tmp/pip-EC5Een-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprocess 13:42:10 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess==0.22 from file:///builds/slave/test/build/tests/mozbase/mozprocess in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 12)) 13:42:10 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprofile 13:42:10 INFO - Running setup.py (path:/tmp/pip-33mB_y-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprofile 13:42:10 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprofile==0.27 from file:///builds/slave/test/build/tests/mozbase/mozprofile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 13)) 13:42:10 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozrunner 13:42:10 INFO - Running setup.py (path:/tmp/pip-C6Y_dG-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozrunner 13:42:10 INFO - Requirement already satisfied (use --upgrade to upgrade): mozrunner==6.11 from file:///builds/slave/test/build/tests/mozbase/mozrunner in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 14)) 13:42:11 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozscreenshot 13:42:11 INFO - Running setup.py (path:/tmp/pip-yiyBnI-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozscreenshot 13:42:11 INFO - Requirement already satisfied (use --upgrade to upgrade): mozscreenshot==0.1 from file:///builds/slave/test/build/tests/mozbase/mozscreenshot in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 15)) 13:42:11 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moztest 13:42:11 INFO - Running setup.py (path:/tmp/pip-GCrbNa-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moztest 13:42:11 INFO - Requirement already satisfied (use --upgrade to upgrade): moztest==0.7 from file:///builds/slave/test/build/tests/mozbase/moztest in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 16)) 13:42:11 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozversion 13:42:11 INFO - Running setup.py (path:/tmp/pip-oJimji-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozversion 13:42:11 INFO - Requirement already satisfied (use --upgrade to upgrade): mozversion==1.4 from file:///builds/slave/test/build/tests/mozbase/mozversion in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 17)) 13:42:11 INFO - Cleaning up... 13:42:11 INFO - Return code: 0 13:42:11 INFO - Installing None into virtualenv /builds/slave/test/build/venv 13:42:11 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:42:11 INFO - http://pypi.pvt.build.mozilla.org/pub matches http://pypi.pvt.build.mozilla.org 13:42:11 INFO - URL Candidate: http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub 13:42:11 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:42:11 INFO - http://pypi.pub.build.mozilla.org/pub matches http://pypi.pub.build.mozilla.org 13:42:11 INFO - URL Candidate: http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub 13:42:11 INFO - retry: Calling run_command with args: [['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub']], kwargs: {'error_level': 'warning', 'error_list': [{'substr': 'not found or a compiler error:', 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x297b1f0>, 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x7fcf0d6d2e40>, 'level': 'warning'}, {'regex': <_sre.SRE_Pattern object at 0x2ab2aa0>, 'level': 'debug'}, {'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2aaf150>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0ab0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0d30>, 'level': 'critical'}], 'cwd': '/builds/slave/test/build/tests/config', 'env': {'TMOUT': '86400', 'LOGNAME': 'cltbld', 'USER': 'cltbld', 'HOME': '/home/cltbld', 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 'DISPLAY': ':0', 'CCACHE_UMASK': '002', 'LANG': 'en_US.UTF-8', 'TERM': 'linux', 'SHELL': '/bin/bash', 'MOZ_NODE_PATH': '/usr/bin/node', 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 'SHLVL': '1', 'NO_FAIL_ON_TEST_ERRORS': '1', 'MOZ_NO_REMOTE': '1', 'MOZ_HIDE_RESULTS_TABLE': '1', 'MAIL': '/var/mail/cltbld', '_': '/tools/buildbot/bin/python', 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 'PWD': '/builds/slave/test', 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 'CCACHE_DIR': '/builds/ccache'}}, attempt #1 13:42:11 INFO - Running command: ['/builds/slave/test/build/venv/bin/pip', 'install', '--download-cache', '/builds/slave/test/build/venv/cache', '--timeout', '120', '-r', '/builds/slave/test/build/tests/config/mozbase_requirements.txt', '--no-index', '--find-links', 'http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub', '--find-links', 'http://pypi.pvt.build.mozilla.org/pub', '--find-links', 'http://pypi.pub.build.mozilla.org/pub'] in /builds/slave/test/build/tests/config 13:42:11 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip install --download-cache /builds/slave/test/build/venv/cache --timeout 120 -r /builds/slave/test/build/tests/config/mozbase_requirements.txt --no-index --find-links http://pypi.pvt.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub --find-links http://pypi.pub.build.mozilla.org.proxxy1.srv.releng.usw2.mozilla.com/pub --find-links http://pypi.pvt.build.mozilla.org/pub --find-links http://pypi.pub.build.mozilla.org/pub 13:42:11 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 13:42:11 INFO - 'CCACHE_UMASK': '002', 13:42:11 INFO - 'DISPLAY': ':0', 13:42:11 INFO - 'HOME': '/home/cltbld', 13:42:11 INFO - 'LANG': 'en_US.UTF-8', 13:42:11 INFO - 'LOGNAME': 'cltbld', 13:42:11 INFO - 'MAIL': '/var/mail/cltbld', 13:42:11 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 13:42:11 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 13:42:11 INFO - 'MOZ_NO_REMOTE': '1', 13:42:11 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 13:42:11 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 13:42:11 INFO - 'PATH': '/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 13:42:11 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 13:42:11 INFO - 'PWD': '/builds/slave/test', 13:42:11 INFO - 'SHELL': '/bin/bash', 13:42:11 INFO - 'SHLVL': '1', 13:42:11 INFO - 'TERM': 'linux', 13:42:11 INFO - 'TMOUT': '86400', 13:42:11 INFO - 'USER': 'cltbld', 13:42:11 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 13:42:11 INFO - '_': '/tools/buildbot/bin/python'} 13:42:11 INFO - Ignoring indexes: https://pypi.python.org/simple/ 13:42:11 INFO - Unpacking /builds/slave/test/build/tests/mozbase/manifestparser 13:42:11 INFO - Running setup.py (path:/tmp/pip-8LFoxf-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/manifestparser 13:42:12 INFO - Requirement already satisfied (use --upgrade to upgrade): manifestparser==1.1 from file:///builds/slave/test/build/tests/mozbase/manifestparser in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 1)) 13:42:12 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozcrash 13:42:12 INFO - Running setup.py (path:/tmp/pip-4Q8BpH-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozcrash 13:42:12 INFO - Requirement already satisfied (use --upgrade to upgrade): mozcrash==0.16 from file:///builds/slave/test/build/tests/mozbase/mozcrash in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 13:42:12 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdebug 13:42:12 INFO - Running setup.py (path:/tmp/pip-EyMdQ0-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdebug 13:42:12 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdebug==0.1 from file:///builds/slave/test/build/tests/mozbase/mozdebug in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3)) 13:42:12 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozdevice 13:42:12 INFO - Running setup.py (path:/tmp/pip-CVIXj0-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozdevice 13:42:12 INFO - Requirement already satisfied (use --upgrade to upgrade): mozdevice==0.47 from file:///builds/slave/test/build/tests/mozbase/mozdevice in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 13:42:12 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozfile 13:42:12 INFO - Running setup.py (path:/tmp/pip-JGImT4-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozfile 13:42:12 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile==1.2 from file:///builds/slave/test/build/tests/mozbase/mozfile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 5)) 13:42:12 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozhttpd 13:42:12 INFO - Running setup.py (path:/tmp/pip-y0E7wE-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozhttpd 13:42:12 INFO - Requirement already satisfied (use --upgrade to upgrade): mozhttpd==0.7 from file:///builds/slave/test/build/tests/mozbase/mozhttpd in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 6)) 13:42:12 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinfo 13:42:12 INFO - Running setup.py (path:/tmp/pip-5ylWic-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinfo 13:42:12 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo==0.9 from file:///builds/slave/test/build/tests/mozbase/mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 7)) 13:42:12 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozinstall 13:42:12 INFO - Running setup.py (path:/tmp/pip-xK47qd-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozinstall 13:42:13 INFO - Requirement already satisfied (use --upgrade to upgrade): mozInstall==1.12 from file:///builds/slave/test/build/tests/mozbase/mozinstall in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 8)) 13:42:13 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozleak 13:42:13 INFO - Running setup.py (path:/tmp/pip-213gDU-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozleak 13:42:13 INFO - Requirement already satisfied (use --upgrade to upgrade): mozleak==0.1 from file:///builds/slave/test/build/tests/mozbase/mozleak in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 9)) 13:42:13 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozlog 13:42:13 INFO - Running setup.py (path:/tmp/pip-l2Smsl-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozlog 13:42:13 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog==3.0 from file:///builds/slave/test/build/tests/mozbase/mozlog in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10)) 13:42:13 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moznetwork 13:42:13 INFO - Running setup.py (path:/tmp/pip-Y_0THn-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moznetwork 13:42:13 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork==0.27 from file:///builds/slave/test/build/tests/mozbase/moznetwork in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 11)) 13:42:13 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprocess 13:42:13 INFO - Running setup.py (path:/tmp/pip-sstAkP-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprocess 13:42:13 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess==0.22 from file:///builds/slave/test/build/tests/mozbase/mozprocess in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 12)) 13:42:13 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozprofile 13:42:13 INFO - Running setup.py (path:/tmp/pip-bUfLfX-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozprofile 13:42:13 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprofile==0.27 from file:///builds/slave/test/build/tests/mozbase/mozprofile in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 13)) 13:42:13 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozrunner 13:42:13 INFO - Running setup.py (path:/tmp/pip-_FDQsb-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozrunner 13:42:13 INFO - Requirement already satisfied (use --upgrade to upgrade): mozrunner==6.11 from file:///builds/slave/test/build/tests/mozbase/mozrunner in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 14)) 13:42:13 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozscreenshot 13:42:13 INFO - Running setup.py (path:/tmp/pip-rLACXs-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozscreenshot 13:42:14 INFO - Requirement already satisfied (use --upgrade to upgrade): mozscreenshot==0.1 from file:///builds/slave/test/build/tests/mozbase/mozscreenshot in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 15)) 13:42:14 INFO - Unpacking /builds/slave/test/build/tests/mozbase/moztest 13:42:14 INFO - Running setup.py (path:/tmp/pip-vzyiwc-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/moztest 13:42:14 INFO - Requirement already satisfied (use --upgrade to upgrade): moztest==0.7 from file:///builds/slave/test/build/tests/mozbase/moztest in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 16)) 13:42:14 INFO - Unpacking /builds/slave/test/build/tests/mozbase/mozversion 13:42:14 INFO - Running setup.py (path:/tmp/pip-MqA6yw-build/setup.py) egg_info for package from file:///builds/slave/test/build/tests/mozbase/mozversion 13:42:14 INFO - Requirement already satisfied (use --upgrade to upgrade): mozversion==1.4 from file:///builds/slave/test/build/tests/mozbase/mozversion in /builds/slave/test/build/venv/lib/python2.7/site-packages (from -r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 17)) 13:42:14 INFO - Requirement already satisfied (use --upgrade to upgrade): mozfile>=1.0 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozcrash==0.16->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 13:42:14 INFO - Requirement already satisfied (use --upgrade to upgrade): mozlog>=3.0 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozcrash==0.16->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 2)) 13:42:14 INFO - Requirement already satisfied (use --upgrade to upgrade): mozinfo in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdebug==0.1->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 3)) 13:42:14 INFO - Requirement already satisfied (use --upgrade to upgrade): moznetwork>=0.24 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdevice==0.47->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 13:42:14 INFO - Requirement already satisfied (use --upgrade to upgrade): mozprocess>=0.19 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozdevice==0.47->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 4)) 13:42:14 INFO - Requirement already satisfied (use --upgrade to upgrade): blessings>=1.3 in /builds/slave/test/build/venv/lib/python2.7/site-packages (from mozlog==3.0->-r /builds/slave/test/build/tests/config/mozbase_requirements.txt (line 10)) 13:42:14 INFO - Cleaning up... 13:42:14 INFO - Return code: 0 13:42:14 INFO - Done creating virtualenv /builds/slave/test/build/venv. 13:42:14 INFO - Getting output from command: ['/builds/slave/test/build/venv/bin/pip', 'freeze'] 13:42:14 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip freeze 13:42:14 INFO - Reading from file tmpfile_stdout 13:42:14 INFO - Current package versions: 13:42:14 INFO - argparse == 1.2.1 13:42:14 INFO - blessings == 1.5.1 13:42:14 INFO - blobuploader == 1.2.4 13:42:14 INFO - docopt == 0.6.1 13:42:14 INFO - manifestparser == 1.1 13:42:14 INFO - mock == 1.0.1 13:42:14 INFO - mozInstall == 1.12 13:42:14 INFO - mozcrash == 0.16 13:42:14 INFO - mozdebug == 0.1 13:42:14 INFO - mozdevice == 0.47 13:42:14 INFO - mozfile == 1.2 13:42:14 INFO - mozhttpd == 0.7 13:42:14 INFO - mozinfo == 0.9 13:42:14 INFO - mozleak == 0.1 13:42:14 INFO - mozlog == 3.0 13:42:14 INFO - moznetwork == 0.27 13:42:14 INFO - mozprocess == 0.22 13:42:14 INFO - mozprofile == 0.27 13:42:14 INFO - mozrunner == 6.11 13:42:14 INFO - mozscreenshot == 0.1 13:42:14 INFO - mozsystemmonitor == 0.0 13:42:14 INFO - moztest == 0.7 13:42:14 INFO - mozversion == 1.4 13:42:14 INFO - psutil == 3.1.1 13:42:14 INFO - requests == 1.2.3 13:42:14 INFO - simplejson == 3.3.0 13:42:14 INFO - wsgiref == 0.1.2 13:42:14 INFO - Running post-action listener: _resource_record_post_action 13:42:14 INFO - Running post-action listener: _start_resource_monitoring 13:42:14 INFO - Starting resource monitoring. 13:42:14 INFO - ##### 13:42:14 INFO - ##### Running install step. 13:42:14 INFO - ##### 13:42:14 INFO - Running pre-action listener: _resource_record_pre_action 13:42:14 INFO - Running main action method: install 13:42:14 INFO - Getting output from command: ['/builds/slave/test/build/venv/bin/pip', 'freeze'] 13:42:14 INFO - Copy/paste: /builds/slave/test/build/venv/bin/pip freeze 13:42:15 INFO - Reading from file tmpfile_stdout 13:42:15 INFO - Detecting whether we're running mozinstall >=1.0... 13:42:15 INFO - Getting output from command: ['/builds/slave/test/build/venv/bin/mozinstall', '-h'] 13:42:15 INFO - Copy/paste: /builds/slave/test/build/venv/bin/mozinstall -h 13:42:15 INFO - Reading from file tmpfile_stdout 13:42:15 INFO - Output received: 13:42:15 INFO - Usage: mozinstall [options] installer 13:42:15 INFO - Options: 13:42:15 INFO - -h, --help show this help message and exit 13:42:15 INFO - -d DEST, --destination=DEST 13:42:15 INFO - Directory to install application into. [default: 13:42:15 INFO - "/builds/slave/test"] 13:42:15 INFO - --app=APP Application being installed. [default: firefox] 13:42:15 INFO - mkdir: /builds/slave/test/build/application 13:42:15 INFO - Getting output from command: ['/builds/slave/test/build/venv/bin/mozinstall', '/builds/slave/test/build/installer.tar.bz2', '--destination', '/builds/slave/test/build/application'] 13:42:15 INFO - Copy/paste: /builds/slave/test/build/venv/bin/mozinstall /builds/slave/test/build/installer.tar.bz2 --destination /builds/slave/test/build/application 13:42:38 INFO - Reading from file tmpfile_stdout 13:42:38 INFO - Output received: 13:42:38 INFO - /builds/slave/test/build/application/firefox/firefox 13:42:38 INFO - Running post-action listener: _resource_record_post_action 13:42:38 INFO - ##### 13:42:38 INFO - ##### Running run-tests step. 13:42:38 INFO - ##### 13:42:38 INFO - Running pre-action listener: _resource_record_pre_action 13:42:38 INFO - Running pre-action listener: _set_gcov_prefix 13:42:38 INFO - Running main action method: run_tests 13:42:38 INFO - Running pre test command disable_screen_saver with 'xset s off s reset' 13:42:38 INFO - Running command: ['xset', 's', 'off', 's', 'reset'] in /builds/slave/test/build 13:42:38 INFO - Copy/paste: xset s off s reset 13:42:38 INFO - Return code: 0 13:42:38 INFO - #### Running mochitest suites 13:42:38 INFO - grabbing minidump binary from tooltool 13:42:38 INFO - proxxy config: {'regions': ['.use1.', '.usw2.', '.scl3'], 'instances': ['proxxy1.srv.releng.use1.mozilla.com', 'proxxy1.srv.releng.usw2.mozilla.com', 'proxxy1.srv.releng.scl3.mozilla.com'], 'urls': [('http://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp.mozilla.org', 'ftp.mozilla.org'), ('https://ftp-ssl.mozilla.org', 'ftp.mozilla.org'), ('http://pvtbuilds.pvt.build.mozilla.org', 'pvtbuilds.mozilla.org'), ('http://pypi.pvt.build.mozilla.org', 'pypi.pvt.build.mozilla.org'), ('http://pypi.pub.build.mozilla.org', 'pypi.pub.build.mozilla.org'), ('https://queue.taskcluster.net', 'queue.taskcluster.net')]} 13:42:38 INFO - retry: Calling run_command with args: (['/tools/tooltool.py', '--url', 'https://api.pub.build.mozilla.org/tooltool/', '--authentication-file', '/builds/relengapi.tok', 'fetch', '-m', '/builds/slave/test/build/tests/config/tooltool-manifests/linux64/releng.manifest', '-o', '-c', '/builds/tooltool_cache'],), kwargs: {'error_list': [{'substr': 'command not found', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2aaf150>, 'level': 'warning'}, {'substr': 'Traceback (most recent call last)', 'level': 'error'}, {'substr': 'SyntaxError: ', 'level': 'error'}, {'substr': 'TypeError: ', 'level': 'error'}, {'substr': 'NameError: ', 'level': 'error'}, {'substr': 'ZeroDivisionError: ', 'level': 'error'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0ab0>, 'level': 'critical'}, {'regex': <_sre.SRE_Pattern object at 0x2ab0d30>, 'level': 'critical'}, {'substr': 'ERROR - ', 'level': 'error'}], 'cwd': '/builds/slave/test/build', 'privileged': False}, attempt #1 13:42:38 INFO - Running command: ['/tools/tooltool.py', '--url', 'https://api.pub.build.mozilla.org/tooltool/', '--authentication-file', '/builds/relengapi.tok', 'fetch', '-m', '/builds/slave/test/build/tests/config/tooltool-manifests/linux64/releng.manifest', '-o', '-c', '/builds/tooltool_cache'] in /builds/slave/test/build 13:42:38 INFO - Copy/paste: /tools/tooltool.py --url https://api.pub.build.mozilla.org/tooltool/ --authentication-file /builds/relengapi.tok fetch -m /builds/slave/test/build/tests/config/tooltool-manifests/linux64/releng.manifest -o -c /builds/tooltool_cache 13:42:38 INFO - INFO - File linux64-minidump_stackwalk retrieved from local cache /builds/tooltool_cache 13:42:38 INFO - Return code: 0 13:42:38 INFO - Chmoding /builds/slave/test/build/linux64-minidump_stackwalk to 0755 13:42:38 INFO - mkdir: /builds/slave/test/build/blobber_upload_dir 13:42:38 INFO - ENV: MOZ_UPLOAD_DIR is now /builds/slave/test/build/blobber_upload_dir 13:42:38 INFO - ENV: MINIDUMP_STACKWALK is now /builds/slave/test/build/linux64-minidump_stackwalk 13:42:38 INFO - ENV: MINIDUMP_SAVE_PATH is now /builds/slave/test/build/blobber_upload_dir 13:42:38 INFO - Running command: ['/builds/slave/test/build/venv/bin/python', '-u', '/builds/slave/test/build/tests/mochitest/runtests.py', '--total-chunks', '8', '--this-chunk', '4', '--appname=/builds/slave/test/build/application/firefox/firefox', '--utility-path=tests/bin', '--extra-profile-file=tests/bin/plugins', '--symbols-path=/builds/slave/test/build/symbols', '--certificate-path=tests/certs', '--setpref=webgl.force-enabled=true', '--quiet', '--log-raw=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_raw.log', '--log-errorsummary=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_errorsummary.log', '--use-test-media-devices', '--screenshot-on-fail', '--browser-chrome', '--subsuite=devtools', '--chunk-by-runtime'] in /builds/slave/test/build 13:42:38 INFO - Copy/paste: /builds/slave/test/build/venv/bin/python -u /builds/slave/test/build/tests/mochitest/runtests.py --total-chunks 8 --this-chunk 4 --appname=/builds/slave/test/build/application/firefox/firefox --utility-path=tests/bin --extra-profile-file=tests/bin/plugins --symbols-path=/builds/slave/test/build/symbols --certificate-path=tests/certs --setpref=webgl.force-enabled=true --quiet --log-raw=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_raw.log --log-errorsummary=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_errorsummary.log --use-test-media-devices --screenshot-on-fail --browser-chrome --subsuite=devtools --chunk-by-runtime 13:42:38 INFO - Using env: {'CCACHE_DIR': '/builds/ccache', 13:42:38 INFO - 'CCACHE_UMASK': '002', 13:42:38 INFO - 'DISPLAY': ':0', 13:42:38 INFO - 'HOME': '/home/cltbld', 13:42:38 INFO - 'LANG': 'en_US.UTF-8', 13:42:38 INFO - 'LOGNAME': 'cltbld', 13:42:38 INFO - 'MAIL': '/var/mail/cltbld', 13:42:38 INFO - 'MINIDUMP_SAVE_PATH': '/builds/slave/test/build/blobber_upload_dir', 13:42:38 INFO - 'MINIDUMP_STACKWALK': '/builds/slave/test/build/linux64-minidump_stackwalk', 13:42:38 INFO - 'MOZ_HIDE_RESULTS_TABLE': '1', 13:42:38 INFO - 'MOZ_NODE_PATH': '/usr/bin/node', 13:42:38 INFO - 'MOZ_NO_REMOTE': '1', 13:42:38 INFO - 'MOZ_UPLOAD_DIR': '/builds/slave/test/build/blobber_upload_dir', 13:42:38 INFO - 'NODE_PATH': '/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript', 13:42:38 INFO - 'NO_FAIL_ON_TEST_ERRORS': '1', 13:42:38 INFO - 'PATH': '/builds/slave/test/build/venv/bin:/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games', 13:42:38 INFO - 'PROPERTIES_FILE': '/builds/slave/test/buildprops.json', 13:42:38 INFO - 'PWD': '/builds/slave/test', 13:42:38 INFO - 'SHELL': '/bin/bash', 13:42:38 INFO - 'SHLVL': '1', 13:42:38 INFO - 'TERM': 'linux', 13:42:38 INFO - 'TMOUT': '86400', 13:42:38 INFO - 'USER': 'cltbld', 13:42:38 INFO - 'XDG_SESSION_COOKIE': '9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634', 13:42:38 INFO - '_': '/tools/buildbot/bin/python'} 13:42:38 INFO - Calling ['/builds/slave/test/build/venv/bin/python', '-u', '/builds/slave/test/build/tests/mochitest/runtests.py', '--total-chunks', '8', '--this-chunk', '4', '--appname=/builds/slave/test/build/application/firefox/firefox', '--utility-path=tests/bin', '--extra-profile-file=tests/bin/plugins', '--symbols-path=/builds/slave/test/build/symbols', '--certificate-path=tests/certs', '--setpref=webgl.force-enabled=true', '--quiet', '--log-raw=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_raw.log', '--log-errorsummary=/builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_errorsummary.log', '--use-test-media-devices', '--screenshot-on-fail', '--browser-chrome', '--subsuite=devtools', '--chunk-by-runtime'] with output_timeout 1000 13:42:38 INFO - /builds/slave/test/build/venv/local/lib/python2.7/site-packages/mozrunner/utils.py:20: UserWarning: Module moznetwork was already imported from /builds/slave/test/build/tests/mochitest/moznetwork.py, but /builds/slave/test/build/venv/lib/python2.7/site-packages is being added to sys.path 13:42:38 INFO - import pkg_resources 13:42:38 INFO - Checking for orphan ssltunnel processes... 13:42:38 INFO - Checking for orphan xpcshell processes... 13:42:39 INFO - SUITE-START | Running 229 tests 13:42:39 INFO - TEST-START | devtools/client/sourceeditor/test/browser_vimemacs.js 13:42:39 INFO - TEST-SKIP | devtools/client/sourceeditor/test/browser_vimemacs.js | took 1ms 13:42:39 INFO - TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_623749_ctrl_a_select_all_winnt.js 13:42:39 INFO - TEST-SKIP | devtools/client/webconsole/test/browser_webconsole_bug_623749_ctrl_a_select_all_winnt.js | took 0ms 13:42:39 INFO - TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_762593_insecure_passwords_web_console_warning.js 13:42:39 INFO - TEST-SKIP | devtools/client/webconsole/test/browser_webconsole_bug_762593_insecure_passwords_web_console_warning.js | took 0ms 13:42:39 INFO - TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_804845_ctrl_key_nav.js 13:42:39 INFO - TEST-SKIP | devtools/client/webconsole/test/browser_webconsole_bug_804845_ctrl_key_nav.js | took 1ms 13:42:39 INFO - dir: devtools/client/jsonview/test 13:42:39 INFO - Setting pipeline to PAUSED ... 13:42:39 INFO - libv4l2: error getting pixformat: Invalid argument 13:42:39 INFO - Pipeline is PREROLLING ... 13:42:39 INFO - Pipeline is PREROLLED ... 13:42:39 INFO - Setting pipeline to PLAYING ... 13:42:39 INFO - New clock: GstSystemClock 13:42:39 INFO - Got EOS from element "pipeline0". 13:42:39 INFO - Execution ended after 32117118 ns. 13:42:39 INFO - Setting pipeline to PAUSED ... 13:42:39 INFO - Setting pipeline to READY ... 13:42:39 INFO - Setting pipeline to NULL ... 13:42:39 INFO - Freeing pipeline ... 13:42:39 INFO - 23 13:42:40 INFO - pk12util: PKCS12 IMPORT SUCCESSFUL 13:42:40 INFO - MochitestServer : launching [u'/builds/slave/test/build/tests/bin/xpcshell', '-g', '/builds/slave/test/build/application/firefox', '-v', '170', '-f', '/builds/slave/test/build/tests/bin/components/httpd.js', '-e', "const _PROFILE_PATH = '/tmp/tmpiwMPLV.mozrunner'; const _SERVER_PORT = '8888'; const _SERVER_ADDR = '127.0.0.1'; const _TEST_PREFIX = undefined; const _DISPLAY_RESULTS = false;", '-f', '/builds/slave/test/build/tests/mochitest/server.js'] 13:42:40 INFO - runtests.py | Server pid: 1925 13:42:40 INFO - runtests.py | Websocket server pid: 1928 13:42:40 INFO - runtests.py | SSL tunnel pid: 1931 13:42:41 INFO - runtests.py | Running tests: start. 13:42:41 INFO - runtests.py | Application pid: 1953 13:42:41 INFO - TEST-INFO | started process Main app process 13:42:41 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmpiwMPLV.mozrunner/runtests_leaks.log 13:42:44 INFO - ++DOCSHELL 0x7fe66c585800 == 1 [pid = 1953] [id = 1] 13:42:44 INFO - ++DOMWINDOW == 1 (0x7fe66c5e6800) [pid = 1953] [serial = 1] [outer = (nil)] 13:42:44 INFO - [1953] WARNING: Hardware Vsync support not yet implemented. Falling back to software timers: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/thebes/gfxPlatform.cpp, line 2084 13:42:44 INFO - ++DOMWINDOW == 2 (0x7fe66c5e9800) [pid = 1953] [serial = 2] [outer = 0x7fe66c5e6800] 13:42:44 INFO - LoadPlugin() /tmp/tmpiwMPLV.mozrunner/plugins/libnptestjava.so returned 7fe666e17790 13:42:44 INFO - LoadPlugin() /tmp/tmpiwMPLV.mozrunner/plugins/libnpsecondtest.so returned 7fe666e17b80 13:42:44 INFO - LoadPlugin() /tmp/tmpiwMPLV.mozrunner/plugins/libnptest.so returned 7fe666e17eb0 13:42:44 INFO - LoadPlugin() /tmp/tmpiwMPLV.mozrunner/plugins/libnpswftest.so returned 7fe666e17fa0 13:42:44 INFO - LoadPlugin() /tmp/tmpiwMPLV.mozrunner/plugins/libnpthirdtest.so returned 7fe666ea5310 13:42:45 INFO - LoadPlugin() /usr/lib/mozilla/plugins/librhythmbox-itms-detection-plugin.so returned 7fe666ea5670 13:42:45 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-cone-plugin.so returned 7fe666ea74f0 13:42:45 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-mully-plugin.so returned 7fe666eac490 13:42:45 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-gmp-plugin.so returned 7fe666eac790 13:42:45 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-narrowspace-plugin.so returned 7fe666eacac0 13:42:45 INFO - ++DOCSHELL 0x7fe660564800 == 2 [pid = 1953] [id = 2] 13:42:45 INFO - ++DOMWINDOW == 3 (0x7fe66c741800) [pid = 1953] [serial = 3] [outer = (nil)] 13:42:45 INFO - ++DOMWINDOW == 4 (0x7fe66c742400) [pid = 1953] [serial = 4] [outer = 0x7fe66c741800] 13:42:46 INFO - ++DOMWINDOW == 5 (0x7fe6604b8000) [pid = 1953] [serial = 5] [outer = 0x7fe66c5e6800] 13:42:47 INFO - [1953] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:42:48 INFO - ++DOCSHELL 0x7fe65c062000 == 3 [pid = 1953] [id = 3] 13:42:48 INFO - ++DOMWINDOW == 6 (0x7fe65cb9a000) [pid = 1953] [serial = 6] [outer = (nil)] 13:42:48 INFO - ++DOCSHELL 0x7fe65c062800 == 4 [pid = 1953] [id = 4] 13:42:48 INFO - ++DOMWINDOW == 7 (0x7fe65cb9a800) [pid = 1953] [serial = 7] [outer = (nil)] 13:42:48 INFO - [1953] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 13:42:49 INFO - ++DOCSHELL 0x7fe65a4b0000 == 5 [pid = 1953] [id = 5] 13:42:49 INFO - ++DOMWINDOW == 8 (0x7fe65a55dc00) [pid = 1953] [serial = 8] [outer = (nil)] 13:42:49 INFO - [1953] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 13:42:49 INFO - ++DOMWINDOW == 9 (0x7fe6598fb400) [pid = 1953] [serial = 9] [outer = 0x7fe65a55dc00] 13:42:49 INFO - ++DOMWINDOW == 10 (0x7fe659324400) [pid = 1953] [serial = 10] [outer = 0x7fe65cb9a000] 13:42:49 INFO - ++DOMWINDOW == 11 (0x7fe659324c00) [pid = 1953] [serial = 11] [outer = 0x7fe65cb9a800] 13:42:49 INFO - ++DOMWINDOW == 12 (0x7fe659326800) [pid = 1953] [serial = 12] [outer = 0x7fe65a55dc00] 13:42:51 INFO - ++DOMWINDOW == 13 (0x7fe6588ee800) [pid = 1953] [serial = 13] [outer = 0x7fe65a55dc00] 13:42:51 INFO - ++DOCSHELL 0x7fe66cbf8800 == 6 [pid = 1953] [id = 6] 13:42:51 INFO - ++DOMWINDOW == 14 (0x7fe65850f400) [pid = 1953] [serial = 14] [outer = (nil)] 13:42:51 INFO - ++DOMWINDOW == 15 (0x7fe658510000) [pid = 1953] [serial = 15] [outer = 0x7fe65850f400] 13:42:53 INFO - 0 INFO *** Start BrowserChrome Test Results *** 13:42:53 INFO - ++DOCSHELL 0x7fe6538a7000 == 7 [pid = 1953] [id = 7] 13:42:53 INFO - ++DOMWINDOW == 16 (0x7fe653842800) [pid = 1953] [serial = 16] [outer = (nil)] 13:42:53 INFO - ++DOMWINDOW == 17 (0x7fe653844800) [pid = 1953] [serial = 17] [outer = 0x7fe653842800] 13:42:53 INFO - 1 INFO checking window state 13:42:53 INFO - 2 INFO TEST-INFO | (browser-test.js) | Console message: [JavaScript Error: "DEPRECATION WARNING: FUEL is deprecated, you should use the add-on SDK instead. 13:42:53 INFO - You may find more details about this deprecation at: https://developer.mozilla.org/Add-ons/SDK/ 13:42:53 INFO - jar:file:///builds/slave/test/build/application/firefox/browser/omni.ja!/components/fuelApplication.js 1458 Application 13:42:53 INFO - jar:file:///builds/slave/test/build/application/firefox/browser/omni.ja!/components/fuelApplication.js 726 af_ci 13:42:53 INFO - chrome://mochikit/content/browser-test.js 254 Tester_start 13:42:53 INFO - chrome://mochikit/content/browser-harness.xul 255 createTester/] 13:43:18 INFO - --DOMWINDOW == 22 (0x7fe66c5e7000) [pid = 1953] [serial = 28] [outer = (nil)] [url = about:blank] 13:43:18 INFO - --DOMWINDOW == 21 (0x7fe6588eec00) [pid = 1953] [serial = 27] [outer = (nil)] [url = about:blank] 13:43:18 INFO - --DOMWINDOW == 20 (0x7fe6604b7400) [pid = 1953] [serial = 26] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 13:43:18 INFO - --DOMWINDOW == 19 (0x7fe659740c00) [pid = 1953] [serial = 52] [outer = (nil)] [url = about:blank] 13:43:18 INFO - --DOMWINDOW == 18 (0x7fe65942bc00) [pid = 1953] [serial = 50] [outer = (nil)] [url = about:blank] 13:43:18 INFO - --DOMWINDOW == 17 (0x7fe64dfb2400) [pid = 1953] [serial = 49] [outer = (nil)] [url = about:blank] 13:43:18 INFO - --DOMWINDOW == 16 (0x7fe6532db800) [pid = 1953] [serial = 22] [outer = (nil)] [url = about:newtab] 13:43:18 INFO - --DOMWINDOW == 15 (0x7fe6536ea800) [pid = 1953] [serial = 18] [outer = (nil)] [url = about:newtab] 13:43:18 INFO - --DOMWINDOW == 14 (0x7fe65973c800) [pid = 1953] [serial = 51] [outer = (nil)] [url = http://example.com/browser/devtools/client/jsonview/test/valid_json.json] 13:43:18 INFO - --DOMWINDOW == 13 (0x7fe64dfb2c00) [pid = 1953] [serial = 46] [outer = (nil)] [url = http://example.com/browser/devtools/client/jsonview/test/invalid_json.json] 13:43:18 INFO - --DOMWINDOW == 12 (0x7fe64de98800) [pid = 1953] [serial = 44] [outer = (nil)] [url = about:blank] 13:43:23 INFO - Completed ShutdownLeaks collections in process 1953 13:43:23 INFO - JavaScript error: resource://gre/modules/PerformanceStats.jsm, line 208: NS_ERROR_NOT_AVAILABLE: Component returned failure code: 0x80040111 (NS_ERROR_NOT_AVAILABLE) [nsIPerformanceStatsService.isMonitoringJank] 13:43:24 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 13:43:24 INFO - --DOCSHELL 0x7fe66cbf8800 == 5 [pid = 1953] [id = 6] 13:43:24 INFO - --DOCSHELL 0x7fe66c585800 == 4 [pid = 1953] [id = 1] 13:43:25 INFO - --DOCSHELL 0x7fe65c062000 == 3 [pid = 1953] [id = 3] 13:43:25 INFO - --DOCSHELL 0x7fe65c062800 == 2 [pid = 1953] [id = 4] 13:43:25 INFO - --DOCSHELL 0x7fe658521800 == 1 [pid = 1953] [id = 22] 13:43:25 INFO - --DOCSHELL 0x7fe660564800 == 0 [pid = 1953] [id = 2] 13:43:25 INFO - JavaScript error: resource://gre/modules/PerformanceStats.jsm, line 492: Error: forget() called twice 13:43:25 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 13:43:26 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 13:43:26 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 13:43:26 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 13:43:26 INFO - [1953] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 769 13:43:27 INFO - --DOMWINDOW == 11 (0x7fe6536eac00) [pid = 1953] [serial = 58] [outer = 0x7fe65cb9a000] [url = about:blank] 13:43:27 INFO - --DOMWINDOW == 10 (0x7fe658275800) [pid = 1953] [serial = 59] [outer = 0x7fe65cb9a800] [url = about:blank] 13:43:27 INFO - --DOMWINDOW == 9 (0x7fe65cb9a800) [pid = 1953] [serial = 7] [outer = (nil)] [url = about:blank] 13:43:27 INFO - --DOMWINDOW == 8 (0x7fe65cb9a000) [pid = 1953] [serial = 6] [outer = (nil)] [url = about:blank] 13:43:28 INFO - --DOMWINDOW == 7 (0x7fe66c742400) [pid = 1953] [serial = 4] [outer = (nil)] [url = about:blank] 13:43:28 INFO - --DOMWINDOW == 6 (0x7fe66c5e6800) [pid = 1953] [serial = 1] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 13:43:28 INFO - --DOMWINDOW == 5 (0x7fe66c741800) [pid = 1953] [serial = 3] [outer = (nil)] [url = chrome://browser/content/browser.xul] 13:43:28 INFO - --DOMWINDOW == 4 (0x7fe65973b400) [pid = 1953] [serial = 55] [outer = (nil)] [url = about:blank] 13:43:28 INFO - --DOMWINDOW == 3 (0x7fe659734c00) [pid = 1953] [serial = 54] [outer = (nil)] [url = about:blank] 13:43:28 INFO - --DOMWINDOW == 2 (0x7fe658510000) [pid = 1953] [serial = 15] [outer = (nil)] [url = about:blank] 13:43:28 INFO - --DOMWINDOW == 1 (0x7fe65850f400) [pid = 1953] [serial = 14] [outer = (nil)] [url = chrome://mochikit/content/browser-harness.xul] 13:43:28 INFO - --DOMWINDOW == 0 (0x7fe6604b8000) [pid = 1953] [serial = 5] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 13:43:28 INFO - [1953] WARNING: OOPDeinit() without successful OOPInit(): file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/crashreporter/nsExceptionHandler.cpp, line 2792 13:43:28 INFO - nsStringStats 13:43:28 INFO - => mAllocCount: 135672 13:43:28 INFO - => mReallocCount: 11230 13:43:28 INFO - => mFreeCount: 135672 13:43:28 INFO - => mShareCount: 138175 13:43:28 INFO - => mAdoptCount: 8855 13:43:28 INFO - => mAdoptFreeCount: 8855 13:43:28 INFO - => Process ID: 1953, Thread ID: 140628167976768 13:43:28 INFO - TEST-INFO | Main app process: exit 0 13:43:28 INFO - runtests.py | Application ran for: 0:00:47.682799 13:43:28 INFO - zombiecheck | Reading PID log: /tmp/tmpS3tfJbpidlog 13:43:28 INFO - Stopping web server 13:43:28 INFO - Stopping web socket server 13:43:28 INFO - Stopping ssltunnel 13:43:28 INFO - TEST-INFO | leakcheck | default process: leak threshold set at 0 bytes 13:43:28 INFO - TEST-INFO | leakcheck | plugin process: leak threshold set at 0 bytes 13:43:28 INFO - TEST-INFO | leakcheck | tab process: leak threshold set at 10000 bytes 13:43:28 INFO - TEST-INFO | leakcheck | geckomediaplugin process: leak threshold set at 20000 bytes 13:43:28 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, default process 1953 13:43:28 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 13:43:28 INFO - | | Per-Inst Leaked| Total Rem| 13:43:28 INFO - 0 |TOTAL | 26 0| 2679232 0| 13:43:28 INFO - nsTraceRefcnt::DumpStatistics: 1343 entries 13:43:28 INFO - TEST-PASS | leakcheck | default process: no leaks detected! 13:43:28 INFO - runtests.py | Running tests: end. 13:43:28 INFO - 15 INFO checking window state 13:43:28 INFO - 16 INFO TEST-START | Shutdown 13:43:28 INFO - 17 INFO Browser Chrome Test Summary 13:43:28 INFO - 18 INFO Passed: 16 13:43:28 INFO - 19 INFO Failed: 0 13:43:28 INFO - 20 INFO Todo: 0 13:43:28 INFO - 21 INFO *** End BrowserChrome Test Results *** 13:43:28 INFO - dir: devtools/client/sourceeditor/test 13:43:29 INFO - Setting pipeline to PAUSED ... 13:43:29 INFO - Pipeline is PREROLLING ... 13:43:29 INFO - Pipeline is PREROLLED ... 13:43:29 INFO - Setting pipeline to PLAYING ... 13:43:29 INFO - New clock: GstSystemClock 13:43:29 INFO - Got EOS from element "pipeline0". 13:43:29 INFO - Execution ended after 32826270 ns. 13:43:29 INFO - Setting pipeline to PAUSED ... 13:43:29 INFO - Setting pipeline to READY ... 13:43:29 INFO - Setting pipeline to NULL ... 13:43:29 INFO - Freeing pipeline ... 13:43:29 INFO - pk12util: PKCS12 IMPORT SUCCESSFUL 13:43:29 INFO - MochitestServer : launching [u'/builds/slave/test/build/tests/bin/xpcshell', '-g', '/builds/slave/test/build/application/firefox', '-v', '170', '-f', '/builds/slave/test/build/tests/bin/components/httpd.js', '-e', "const _PROFILE_PATH = '/tmp/tmprRtGnM.mozrunner'; const _SERVER_PORT = '8888'; const _SERVER_ADDR = '127.0.0.1'; const _TEST_PREFIX = undefined; const _DISPLAY_RESULTS = false;", '-f', '/builds/slave/test/build/tests/mochitest/server.js'] 13:43:29 INFO - runtests.py | Server pid: 2059 13:43:29 INFO - runtests.py | Websocket server pid: 2062 13:43:29 INFO - runtests.py | SSL tunnel pid: 2065 13:43:30 INFO - runtests.py | Running tests: start. 13:43:30 INFO - runtests.py | Application pid: 2087 13:43:30 INFO - TEST-INFO | started process Main app process 13:43:30 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmprRtGnM.mozrunner/runtests_leaks.log 13:43:33 INFO - ++DOCSHELL 0x7f6181985800 == 1 [pid = 2087] [id = 1] 13:43:33 INFO - ++DOMWINDOW == 1 (0x7f61819c6800) [pid = 2087] [serial = 1] [outer = (nil)] 13:43:33 INFO - [2087] WARNING: Hardware Vsync support not yet implemented. Falling back to software timers: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/thebes/gfxPlatform.cpp, line 2084 13:43:33 INFO - ++DOMWINDOW == 2 (0x7f61819c9800) [pid = 2087] [serial = 2] [outer = 0x7f61819c6800] 13:43:34 INFO - LoadPlugin() /tmp/tmprRtGnM.mozrunner/plugins/libnptestjava.so returned 7f617c20b790 13:43:34 INFO - LoadPlugin() /tmp/tmprRtGnM.mozrunner/plugins/libnpsecondtest.so returned 7f617c20bb80 13:43:34 INFO - LoadPlugin() /tmp/tmprRtGnM.mozrunner/plugins/libnptest.so returned 7f617c20beb0 13:43:34 INFO - LoadPlugin() /tmp/tmprRtGnM.mozrunner/plugins/libnpswftest.so returned 7f617c20bfa0 13:43:34 INFO - LoadPlugin() /tmp/tmprRtGnM.mozrunner/plugins/libnpthirdtest.so returned 7f6185dcb310 13:43:34 INFO - LoadPlugin() /usr/lib/mozilla/plugins/librhythmbox-itms-detection-plugin.so returned 7f6185dcb670 13:43:34 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-cone-plugin.so returned 7f6185dcc4f0 13:43:34 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-mully-plugin.so returned 7f617c2ae490 13:43:34 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-gmp-plugin.so returned 7f617c2ae790 13:43:34 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-narrowspace-plugin.so returned 7f617c2aeac0 13:43:34 INFO - ++DOCSHELL 0x7f6175941800 == 2 [pid = 2087] [id = 2] 13:43:34 INFO - ++DOMWINDOW == 3 (0x7f6181b3f800) [pid = 2087] [serial = 3] [outer = (nil)] 13:43:34 INFO - ++DOMWINDOW == 4 (0x7f6181b40400) [pid = 2087] [serial = 4] [outer = 0x7f6181b3f800] 13:43:34 INFO - ++DOMWINDOW == 5 (0x7f6175882400) [pid = 2087] [serial = 5] [outer = 0x7f61819c6800] 13:43:36 INFO - [2087] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:43:36 INFO - ++DOCSHELL 0x7f617145b000 == 3 [pid = 2087] [id = 3] 13:43:36 INFO - ++DOMWINDOW == 6 (0x7f61713f4000) [pid = 2087] [serial = 6] [outer = (nil)] 13:43:36 INFO - ++DOCSHELL 0x7f617145b800 == 4 [pid = 2087] [id = 4] 13:43:36 INFO - ++DOMWINDOW == 7 (0x7f61713f4800) [pid = 2087] [serial = 7] [outer = (nil)] 13:43:37 INFO - [2087] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 13:43:37 INFO - ++DOCSHELL 0x7f616f8b0800 == 5 [pid = 2087] [id = 5] 13:43:37 INFO - ++DOMWINDOW == 8 (0x7f616f968c00) [pid = 2087] [serial = 8] [outer = (nil)] 13:43:37 INFO - [2087] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 13:43:37 INFO - ++DOMWINDOW == 9 (0x7f616eb0e400) [pid = 2087] [serial = 9] [outer = 0x7f616f968c00] 13:43:38 INFO - ++DOMWINDOW == 10 (0x7f616e738c00) [pid = 2087] [serial = 10] [outer = 0x7f61713f4000] 13:43:38 INFO - ++DOMWINDOW == 11 (0x7f616e739400) [pid = 2087] [serial = 11] [outer = 0x7f61713f4800] 13:43:38 INFO - ++DOMWINDOW == 12 (0x7f616e73b000) [pid = 2087] [serial = 12] [outer = 0x7f616f968c00] 13:43:39 INFO - ++DOMWINDOW == 13 (0x7f616da0ec00) [pid = 2087] [serial = 13] [outer = 0x7f616f968c00] 13:43:39 INFO - ++DOCSHELL 0x7f616d945000 == 6 [pid = 2087] [id = 6] 13:43:39 INFO - ++DOMWINDOW == 14 (0x7f616daf9c00) [pid = 2087] [serial = 14] [outer = (nil)] 13:43:39 INFO - ++DOMWINDOW == 15 (0x7f616dafa800) [pid = 2087] [serial = 15] [outer = 0x7f616daf9c00] 13:43:41 INFO - ++DOCSHELL 0x7f6168a04000 == 7 [pid = 2087] [id = 7] 13:43:41 INFO - ++DOMWINDOW == 16 (0x7f6168c59400) [pid = 2087] [serial = 16] [outer = (nil)] 13:43:42 INFO - ++DOMWINDOW == 17 (0x7f6168c5b400) [pid = 2087] [serial = 17] [outer = 0x7f6168c59400] 13:43:42 INFO - ++DOCSHELL 0x7f6168a0d000 == 8 [pid = 2087] [id = 8] 13:43:42 INFO - ++DOMWINDOW == 18 (0x7f616d67f400) [pid = 2087] [serial = 18] [outer = (nil)] 13:43:42 INFO - ++DOMWINDOW == 19 (0x7f616e242800) [pid = 2087] [serial = 19] [outer = 0x7f616d67f400] 13:43:42 INFO - 22 INFO TEST-START | devtools/client/sourceeditor/test/browser_codemirror.js 13:43:42 INFO - ++DOCSHELL 0x7f616889a000 == 9 [pid = 2087] [id = 9] 13:43:42 INFO - ++DOMWINDOW == 20 (0x7f61688b6400) [pid = 2087] [serial = 20] [outer = (nil)] 13:43:42 INFO - ++DOMWINDOW == 21 (0x7f61688b9000) [pid = 2087] [serial = 21] [outer = 0x7f61688b6400] 13:43:42 INFO - ++DOMWINDOW == 22 (0x7f6168412000) [pid = 2087] [serial = 22] [outer = 0x7f616d67f400] 13:43:42 INFO - ++DOMWINDOW == 23 (0x7f616841c400) [pid = 2087] [serial = 23] [outer = 0x7f61688b6400] 13:43:42 INFO - Chrome file doesn't exist: /builds/slave/test/build/tests/mochitest/browser/devtools/client/sourceeditor/test/codemirror/cm_mode_test.css 13:43:44 INFO - [2087] WARNING: GetDefaultCharsetForLocale: need to add multi locale support: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/intl/locale/unix/nsUNIXCharset.cpp, line 101 13:43:44 INFO - ++DOCSHELL 0x7f616d7ed000 == 10 [pid = 2087] [id = 10] 13:43:44 INFO - ++DOMWINDOW == 24 (0x7f616fcecc00) [pid = 2087] [serial = 24] [outer = (nil)] 13:43:45 INFO - ++DOMWINDOW == 25 (0x7f6171189000) [pid = 2087] [serial = 25] [outer = 0x7f616fcecc00] 13:43:45 INFO - ++DOMWINDOW == 26 (0x7f6173976400) [pid = 2087] [serial = 26] [outer = 0x7f616fcecc00] 13:43:45 INFO - ++DOCSHELL 0x7f616e96a000 == 11 [pid = 2087] [id = 11] 13:43:45 INFO - ++DOMWINDOW == 27 (0x7f616da0f000) [pid = 2087] [serial = 27] [outer = (nil)] 13:43:45 INFO - ++DOMWINDOW == 28 (0x7f6175824400) [pid = 2087] [serial = 28] [outer = 0x7f616da0f000] 13:43:45 INFO - [2087] WARNING: Could not get disk status from nsIDiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/uriloader/prefetch/nsOfflineCacheUpdateService.cpp, line 319 13:43:54 INFO - --DOCSHELL 0x7f616f8b0800 == 10 [pid = 2087] [id = 5] 13:43:54 INFO - [2087] ###!!! ASSERTION: frame still referencing style context: 'mFrameRefCnt == 0', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/style/nsStyleContext.cpp, line 1437 13:44:48 INFO - #01: nsStyleContext::ClearCachedInheritedStyleDataOnDescendants(unsigned int) [layout/style/nsStyleContext.cpp:1429] 13:44:48 INFO - #02: mozilla::ClearCachedInheritedStyleDataOnDescendants [mfbt/RefPtr.h:34] 13:44:48 INFO - #03: mozilla::RestyleManager::ComputeAndProcessStyleChange(nsIFrame*, nsChangeHint, mozilla::RestyleTracker&, nsRestyleHint, mozilla::RestyleHintData const&) [xpcom/glue/nsTArray.h:2084] 13:44:48 INFO - #04: mozilla::RestyleManager::RestyleElement(mozilla::dom::Element*, nsIFrame*, nsChangeHint, mozilla::RestyleTracker&, nsRestyleHint, mozilla::RestyleHintData const&) [layout/base/RestyleManager.cpp:1038] 13:44:48 INFO - #05: mozilla::RestyleTracker::ProcessOneRestyle(mozilla::dom::Element*, nsRestyleHint, nsChangeHint, mozilla::RestyleHintData const&) [layout/base/RestyleTracker.cpp:195] 13:44:48 INFO - #06: mozilla::RestyleTracker::DoProcessRestyles() [layout/base/RestyleTracker.cpp:354] 13:44:48 INFO - #07: mozilla::RestyleManager::ProcessPendingRestyles() [layout/base/RestyleManager.cpp:1771] 13:44:48 INFO - #08: PresShell::FlushPendingNotifications(mozilla::ChangesToFlush) [layout/base/nsPresShell.cpp:4087] 13:44:48 INFO - #09: PresShell::FlushPendingNotifications(mozFlushType) [layout/base/nsPresShell.cpp:3969] 13:44:48 INFO - #10: mozilla::EventStateManager::PreHandleEvent(nsPresContext*, mozilla::WidgetEvent*, nsIFrame*, nsIContent*, nsEventStatus*) [dom/events/EventStateManager.cpp:670] 13:44:48 INFO - #11: PresShell::HandleEventInternal(mozilla::WidgetEvent*, nsEventStatus*) [layout/base/nsPresShell.cpp:7917] 13:44:48 INFO - #12: PresShell::HandlePositionedEvent(nsIFrame*, mozilla::WidgetGUIEvent*, nsEventStatus*) [layout/base/nsPresShell.cpp:7766] 13:44:48 INFO - #13: PresShell::HandleEvent(nsIFrame*, mozilla::WidgetGUIEvent*, bool, nsEventStatus*, nsIContent**) [layout/base/nsPresShell.cpp:7550] 13:44:48 INFO - #14: nsViewManager::DispatchEvent(mozilla::WidgetGUIEvent*, nsView*, nsEventStatus*) [view/nsViewManager.cpp:798] 13:44:48 INFO - #15: PresShell::DispatchSynthMouseMove(mozilla::WidgetGUIEvent*, bool) [layout/base/nsPresShell.cpp:3663] 13:44:48 INFO - #16: PresShell::ProcessSynthMouseMoveEvent(bool) [layout/base/nsPresShell.cpp:5586] 13:44:48 INFO - #17: PresShell::nsSynthMouseMoveEvent::WillRefresh(mozilla::TimeStamp) [layout/base/nsPresShell.h:649] 13:44:48 INFO - #18: nsRefreshDriver::Tick(long, mozilla::TimeStamp) [layout/base/nsRefreshDriver.cpp:1565] 13:44:48 INFO - #19: mozilla::RefreshDriverTimer::Tick(long, mozilla::TimeStamp) [layout/base/nsRefreshDriver.cpp:187] 13:44:48 INFO - #20: mozilla::VsyncRefreshDriverTimer::RefreshDriverVsyncObserver::TickRefreshDriver(mozilla::TimeStamp) [layout/base/nsRefreshDriver.cpp:408] 13:44:48 INFO - #21: nsRunnableMethodImpl::Run() [xpcom/glue/nsThreadUtils.h:873] 13:44:48 INFO - #22: nsThread::ProcessNextEvent(bool, bool*) [xpcom/threads/nsThread.cpp:964] 13:44:48 INFO - #23: NS_ProcessNextEvent(nsIThread*, bool) [xpcom/glue/nsThreadUtils.cpp:297] 13:44:48 INFO - #24: mozilla::ipc::MessagePump::Run(base::MessagePump::Delegate*) [ipc/glue/MessagePump.cpp:96] 13:44:48 INFO - #25: MessageLoop::RunInternal() [ipc/chromium/src/base/message_loop.cc:235] 13:44:48 INFO - #26: MessageLoop::Run() [ipc/chromium/src/base/message_loop.cc:520] 13:44:48 INFO - #27: nsBaseAppShell::Run() [widget/nsBaseAppShell.cpp:158] 13:44:48 INFO - #28: nsAppStartup::Run() [toolkit/components/startup/nsAppStartup.cpp:282] 13:44:48 INFO - #29: XREMain::XRE_mainRun() [toolkit/xre/nsAppRunner.cpp:4299] 13:44:48 INFO - #30: XREMain::XRE_main(int, char**, nsXREAppData const*) [toolkit/xre/nsAppRunner.cpp:4391] 13:44:48 INFO - #31: XRE_main [toolkit/xre/nsAppRunner.cpp:4494] 13:44:48 INFO - #32: do_main [browser/app/nsBrowserApp.cpp:212] 13:44:48 INFO - #33: main [browser/app/nsBrowserApp.cpp:354] 13:44:48 INFO - #34: libc.so.6 + 0x2176d 13:44:48 INFO - #35: _start 13:44:48 INFO - MEMORY STAT vsizeMaxContiguous not supported in this build configuration. 13:44:48 INFO - MEMORY STAT | vsize 976MB | residentFast 270MB | heapAllocated 92MB 13:44:48 INFO - 23 INFO TEST-OK | devtools/client/sourceeditor/test/browser_codemirror.js | took 12679ms 13:44:48 INFO - ++DOCSHELL 0x7f61644c8800 == 11 [pid = 2087] [id = 12] 13:44:48 INFO - ++DOMWINDOW == 29 (0x7f6168413000) [pid = 2087] [serial = 29] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 30 (0x7f616da0d800) [pid = 2087] [serial = 30] [outer = 0x7f6168413000] 13:44:48 INFO - 24 INFO TEST-START | devtools/client/sourceeditor/test/browser_css_autocompletion.js 13:44:48 INFO - ++DOCSHELL 0x7f6174561800 == 12 [pid = 2087] [id = 13] 13:44:48 INFO - ++DOMWINDOW == 31 (0x7f6181bce400) [pid = 2087] [serial = 31] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 32 (0x7f6181bd8400) [pid = 2087] [serial = 32] [outer = 0x7f6181bce400] 13:44:48 INFO - MEMORY STAT | vsize 980MB | residentFast 282MB | heapAllocated 106MB 13:44:48 INFO - 25 INFO TEST-OK | devtools/client/sourceeditor/test/browser_css_autocompletion.js | took 4654ms 13:44:48 INFO - ++DOCSHELL 0x7f61864a7800 == 13 [pid = 2087] [id = 14] 13:44:48 INFO - ++DOMWINDOW == 33 (0x7f6163c4e400) [pid = 2087] [serial = 33] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 34 (0x7f616e261000) [pid = 2087] [serial = 34] [outer = 0x7f6163c4e400] 13:44:48 INFO - 26 INFO TEST-START | devtools/client/sourceeditor/test/browser_css_getInfo.js 13:44:48 INFO - ++DOCSHELL 0x7f6171040800 == 14 [pid = 2087] [id = 15] 13:44:48 INFO - ++DOMWINDOW == 35 (0x7f6163c65800) [pid = 2087] [serial = 35] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 36 (0x7f6163c67800) [pid = 2087] [serial = 36] [outer = 0x7f6163c65800] 13:44:48 INFO - MEMORY STAT | vsize 982MB | residentFast 285MB | heapAllocated 109MB 13:44:48 INFO - 27 INFO TEST-OK | devtools/client/sourceeditor/test/browser_css_getInfo.js | took 1899ms 13:44:48 INFO - ++DOCSHELL 0x7f616399c800 == 15 [pid = 2087] [id = 16] 13:44:48 INFO - ++DOMWINDOW == 37 (0x7f6163981400) [pid = 2087] [serial = 37] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 38 (0x7f6163987800) [pid = 2087] [serial = 38] [outer = 0x7f6163981400] 13:44:48 INFO - 28 INFO TEST-START | devtools/client/sourceeditor/test/browser_css_statemachine.js 13:44:48 INFO - ++DOCSHELL 0x7f61639ad000 == 16 [pid = 2087] [id = 17] 13:44:48 INFO - ++DOMWINDOW == 39 (0x7f6163726400) [pid = 2087] [serial = 39] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 40 (0x7f6163728800) [pid = 2087] [serial = 40] [outer = 0x7f6163726400] 13:44:48 INFO - MEMORY STAT | vsize 986MB | residentFast 290MB | heapAllocated 111MB 13:44:48 INFO - 29 INFO TEST-OK | devtools/client/sourceeditor/test/browser_css_statemachine.js | took 1842ms 13:44:48 INFO - ++DOCSHELL 0x7f6163679000 == 17 [pid = 2087] [id = 18] 13:44:48 INFO - ++DOMWINDOW == 41 (0x7f61636a7000) [pid = 2087] [serial = 41] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 42 (0x7f61636a9000) [pid = 2087] [serial = 42] [outer = 0x7f61636a7000] 13:44:48 INFO - 30 INFO TEST-START | devtools/client/sourceeditor/test/browser_detectindent.js 13:44:48 INFO - ++DOCSHELL 0x7f616367e000 == 18 [pid = 2087] [id = 19] 13:44:48 INFO - ++DOMWINDOW == 43 (0x7f616343bc00) [pid = 2087] [serial = 43] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 44 (0x7f616343c800) [pid = 2087] [serial = 44] [outer = 0x7f616343bc00] 13:44:48 INFO - ++DOCSHELL 0x7f6163495000 == 19 [pid = 2087] [id = 20] 13:44:48 INFO - ++DOMWINDOW == 45 (0x7f61636ac000) [pid = 2087] [serial = 45] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 46 (0x7f616343fc00) [pid = 2087] [serial = 46] [outer = 0x7f61636ac000] 13:44:48 INFO - --DOCSHELL 0x7f616367e000 == 18 [pid = 2087] [id = 19] 13:44:48 INFO - MEMORY STAT | vsize 999MB | residentFast 302MB | heapAllocated 119MB 13:44:48 INFO - 31 INFO TEST-OK | devtools/client/sourceeditor/test/browser_detectindent.js | took 3064ms 13:44:48 INFO - ++DOCSHELL 0x7f6162c1c000 == 19 [pid = 2087] [id = 21] 13:44:48 INFO - ++DOMWINDOW == 47 (0x7f6162bee000) [pid = 2087] [serial = 47] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 48 (0x7f6162caac00) [pid = 2087] [serial = 48] [outer = 0x7f6162bee000] 13:44:48 INFO - --DOCSHELL 0x7f6163495000 == 18 [pid = 2087] [id = 20] 13:44:48 INFO - 32 INFO TEST-START | devtools/client/sourceeditor/test/browser_editor_addons.js 13:44:48 INFO - ++DOCSHELL 0x7f6162c10000 == 19 [pid = 2087] [id = 22] 13:44:48 INFO - ++DOMWINDOW == 49 (0x7f6162be7800) [pid = 2087] [serial = 49] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 50 (0x7f6162be8800) [pid = 2087] [serial = 50] [outer = 0x7f6162be7800] 13:44:48 INFO - --DOMWINDOW == 49 (0x7f6168c59400) [pid = 2087] [serial = 16] [outer = (nil)] [url = about:blank] 13:44:48 INFO - --DOMWINDOW == 48 (0x7f616f968c00) [pid = 2087] [serial = 8] [outer = (nil)] [url = about:blank] 13:44:48 INFO - --DOMWINDOW == 47 (0x7f6163726400) [pid = 2087] [serial = 39] [outer = (nil)] [url = data:text/html;charset=UTF-8,%3C!DOCTYPE%20html%3E%0A%3Chtml%3E%0A%20%3Chead%3E%0A%20%20%3Ctitle%3ECSS%20State%20machine%20tests.%3C%2Ftitle%3E%0A%20%20%3Cstyle%20type%3D'text%2Fcss'%3E%0A%23progress%20%7B%0A%20%20width%3A%20500px%3B%20height%3A%2030px%3B%0A%20%20border%3A%201px%20solid%20black%3B%0A%20%20position%3A%20relative%0A%7D%0A%23progress%20div%20%7B%0A%20%20width%3A%200%25%3B%20height%3A%20100%25%3B%0A%20%20background%3A%20green%3B%0A%20%20position%3A%20absolute%3B%0A%20%20z-index%3A%20-1%3B%20top%3A%200%0A%7D%0A%23progress.failed%20div%20%7B%0A%20%20background%3A%20red%20!important%3B%0A%7D%0A%23progress.failed%3Aafter%20%7B%0A%20%20content%3A%20'Some%20tests%20failed'%3B%0A%20%20color%3A%20white%0A%7D%0A%23progress%3Abefore%20%7B%0A%20%20content%3A%20'Running%20test%20'%20attr(data-progress)%20'%20of%2067'%3B%0A%20%20color%3A%20white%3B%0A%20%20text-shadow%3A%200%200%202px%20darkgreen%3B%0A%7D%0A%20%20%3C%2Fstyle%3E%0A%20%3C%2Fhead%3E%0A%20%3Cbody%3E%0A%20%20%3Ch2%3EState%2] 13:44:48 INFO - --DOMWINDOW == 46 (0x7f6163981400) [pid = 2087] [serial = 37] [outer = (nil)] [url = about:blank] 13:44:48 INFO - --DOMWINDOW == 45 (0x7f6163c65800) [pid = 2087] [serial = 35] [outer = (nil)] [url = data:text/html;charset=UTF-8,%3C!DOCTYPE%20html%3E%0A%3Chtml%3E%0A%20%3Chead%3E%0A%20%20%3Ctitle%3ECSS%20contextual%20information%20tests.%3C%2Ftitle%3E%0A%20%20%3Cstyle%20type%3D'text%2Fcss'%3E%0A%23progress%20%7B%0A%20%20width%3A%20500px%3B%20height%3A%2030px%3B%0A%20%20border%3A%201px%20solid%20black%3B%0A%20%20position%3A%20relative%0A%7D%0A%23progress%20div%20%7B%0A%20%20width%3A%200%25%3B%20height%3A%20100%25%3B%0A%20%20background%3A%20green%3B%0A%20%20position%3A%20absolute%3B%0A%20%20z-index%3A%20-1%3B%20top%3A%200%0A%7D%0A%23progress.failed%20div%20%7B%0A%20%20background%3A%20red%20!important%3B%0A%7D%0A%23progress.failed%3Aafter%20%7B%0A%20%20content%3A%20'Some%20tests%20failed'%3B%0A%20%20color%3A%20white%0A%7D%0A%23progress%3Abefore%20%7B%0A%20%20content%3A%20'Running%20test%20'%20attr(data-progress)%20'%20of%2012'%3B%0A%20%20color%3A%20white%3B%0A%20%20text-shadow%3A%200%200%202px%20darkgreen%3B%0A%7D%0A%20%20%3C%2Fstyle%3E%0A%20%3C%2Fhead%3E%0A%20%3Cbody%3E%0A%20%20%3Ch2%] 13:44:48 INFO - --DOMWINDOW == 44 (0x7f6163c4e400) [pid = 2087] [serial = 33] [outer = (nil)] [url = about:blank] 13:44:48 INFO - --DOMWINDOW == 43 (0x7f6181bce400) [pid = 2087] [serial = 31] [outer = (nil)] [url = data:text/html;charset=UTF-8,%3C!DOCTYPE%20html%3E%0A%3Chtml%3E%0A%20%3Chead%3E%0A%20%20%3Ctitle%3ECSS%20State%20machine%20tests.%3C%2Ftitle%3E%0A%20%20%3Cstyle%20type%3D'text%2Fcss'%3E%0A%23progress%20%7B%0A%20%20width%3A%20500px%3B%20height%3A%2030px%3B%0A%20%20border%3A%201px%20solid%20black%3B%0A%20%20position%3A%20relative%0A%7D%0A%23progress%20div%20%7B%0A%20%20width%3A%200%25%3B%20height%3A%20100%25%3B%0A%20%20background%3A%20green%3B%0A%20%20position%3A%20absolute%3B%0A%20%20z-index%3A%20-1%3B%20top%3A%200%0A%7D%0A%23progress.failed%20div%20%7B%0A%20%20background%3A%20red%20!important%3B%0A%7D%0A%23progress.failed%3Aafter%20%7B%0A%20%20content%3A%20'Some%20tests%20failed'%3B%0A%20%20color%3A%20white%0A%7D%0A%23progress%3Abefore%20%7B%0A%20%20content%3A%20'Running%20test%20'%20attr(data-progress)%20'%20of%2017'%3B%0A%20%20color%3A%20white%3B%0A%20%20text-shadow%3A%200%200%202px%20darkgreen%3B%0A%7D%0A%20%20%3C%2Fstyle%3E%0A%20%3C%2Fhead%3E%0A%20%3Cbody%3E%0A%20%20%3Ch2%3EState%2] 13:44:48 INFO - --DOMWINDOW == 42 (0x7f6168413000) [pid = 2087] [serial = 29] [outer = (nil)] [url = about:blank] 13:44:48 INFO - --DOMWINDOW == 41 (0x7f6168c5b400) [pid = 2087] [serial = 17] [outer = (nil)] [url = about:blank] 13:44:48 INFO - --DOMWINDOW == 40 (0x7f6171189000) [pid = 2087] [serial = 25] [outer = (nil)] [url = about:blank] 13:44:48 INFO - --DOMWINDOW == 39 (0x7f61819c9800) [pid = 2087] [serial = 2] [outer = (nil)] [url = about:blank] 13:44:48 INFO - --DOMWINDOW == 38 (0x7f6163728800) [pid = 2087] [serial = 40] [outer = (nil)] [url = about:blank] 13:44:48 INFO - --DOMWINDOW == 37 (0x7f6163987800) [pid = 2087] [serial = 38] [outer = (nil)] [url = about:blank] 13:44:48 INFO - --DOMWINDOW == 36 (0x7f6163c67800) [pid = 2087] [serial = 36] [outer = (nil)] [url = about:blank] 13:44:48 INFO - --DOMWINDOW == 35 (0x7f616e261000) [pid = 2087] [serial = 34] [outer = (nil)] [url = about:blank] 13:44:48 INFO - --DOMWINDOW == 34 (0x7f6181bd8400) [pid = 2087] [serial = 32] [outer = (nil)] [url = about:blank] 13:44:48 INFO - --DOMWINDOW == 33 (0x7f616e73b000) [pid = 2087] [serial = 12] [outer = (nil)] [url = about:blank] 13:44:48 INFO - --DOMWINDOW == 32 (0x7f616da0d800) [pid = 2087] [serial = 30] [outer = (nil)] [url = about:blank] 13:44:48 INFO - --DOMWINDOW == 31 (0x7f616eb0e400) [pid = 2087] [serial = 9] [outer = (nil)] [url = about:blank] 13:44:48 INFO - --DOMWINDOW == 30 (0x7f61688b9000) [pid = 2087] [serial = 21] [outer = (nil)] [url = about:blank] 13:44:48 INFO - --DOMWINDOW == 29 (0x7f616e242800) [pid = 2087] [serial = 19] [outer = (nil)] [url = about:blank] 13:44:48 INFO - --DOMWINDOW == 28 (0x7f616da0ec00) [pid = 2087] [serial = 13] [outer = (nil)] [url = about:blank] 13:44:48 INFO - ++DOCSHELL 0x7f616348d800 == 20 [pid = 2087] [id = 23] 13:44:48 INFO - ++DOMWINDOW == 29 (0x7f6162ca8400) [pid = 2087] [serial = 51] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 30 (0x7f6162ca9c00) [pid = 2087] [serial = 52] [outer = 0x7f6162ca8400] 13:44:48 INFO - --DOCSHELL 0x7f6162c10000 == 19 [pid = 2087] [id = 22] 13:44:48 INFO - MEMORY STAT | vsize 1004MB | residentFast 291MB | heapAllocated 93MB 13:44:48 INFO - 33 INFO TEST-OK | devtools/client/sourceeditor/test/browser_editor_addons.js | took 3366ms 13:44:48 INFO - ++DOCSHELL 0x7f6162c09000 == 20 [pid = 2087] [id = 24] 13:44:48 INFO - ++DOMWINDOW == 31 (0x7f6162ca4000) [pid = 2087] [serial = 53] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 32 (0x7f6162d1b800) [pid = 2087] [serial = 54] [outer = 0x7f6162ca4000] 13:44:48 INFO - 34 INFO TEST-START | devtools/client/sourceeditor/test/browser_editor_autocomplete_basic.js 13:44:48 INFO - ++DOCSHELL 0x7f6162c13800 == 21 [pid = 2087] [id = 25] 13:44:48 INFO - ++DOMWINDOW == 33 (0x7f6163637400) [pid = 2087] [serial = 55] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 34 (0x7f6163639000) [pid = 2087] [serial = 56] [outer = 0x7f6163637400] 13:44:48 INFO - ++DOCSHELL 0x7f61637b8000 == 22 [pid = 2087] [id = 26] 13:44:48 INFO - ++DOMWINDOW == 35 (0x7f61636a9c00) [pid = 2087] [serial = 57] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 36 (0x7f6163725000) [pid = 2087] [serial = 58] [outer = 0x7f61636a9c00] 13:44:48 INFO - --DOCSHELL 0x7f6162c13800 == 21 [pid = 2087] [id = 25] 13:44:48 INFO - MEMORY STAT | vsize 1002MB | residentFast 305MB | heapAllocated 105MB 13:44:48 INFO - 35 INFO TEST-OK | devtools/client/sourceeditor/test/browser_editor_autocomplete_basic.js | took 7062ms 13:44:48 INFO - ++DOCSHELL 0x7f61637bf000 == 22 [pid = 2087] [id = 27] 13:44:48 INFO - ++DOMWINDOW == 37 (0x7f6163639800) [pid = 2087] [serial = 59] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 38 (0x7f61636a1800) [pid = 2087] [serial = 60] [outer = 0x7f6163639800] 13:44:48 INFO - 36 INFO TEST-START | devtools/client/sourceeditor/test/browser_editor_autocomplete_events.js 13:44:48 INFO - ++DOCSHELL 0x7f6164059800 == 23 [pid = 2087] [id = 28] 13:44:48 INFO - ++DOMWINDOW == 39 (0x7f61670e8800) [pid = 2087] [serial = 61] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 40 (0x7f61670eac00) [pid = 2087] [serial = 62] [outer = 0x7f61670e8800] 13:44:48 INFO - ++DOCSHELL 0x7f61637b7800 == 24 [pid = 2087] [id = 29] 13:44:48 INFO - ++DOMWINDOW == 41 (0x7f61688be400) [pid = 2087] [serial = 63] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 42 (0x7f61688bfc00) [pid = 2087] [serial = 64] [outer = 0x7f61688be400] 13:44:48 INFO - ++DOCSHELL 0x7f61684b8800 == 25 [pid = 2087] [id = 30] 13:44:48 INFO - ++DOMWINDOW == 43 (0x7f61688c1400) [pid = 2087] [serial = 65] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 44 (0x7f6168c5a000) [pid = 2087] [serial = 66] [outer = 0x7f61688c1400] 13:44:48 INFO - --DOCSHELL 0x7f61637b7800 == 24 [pid = 2087] [id = 29] 13:44:48 INFO - MEMORY STAT | vsize 986MB | residentFast 299MB | heapAllocated 110MB 13:44:48 INFO - 37 INFO TEST-OK | devtools/client/sourceeditor/test/browser_editor_autocomplete_events.js | took 5469ms 13:44:48 INFO - ++DOCSHELL 0x7f6168a1e000 == 25 [pid = 2087] [id = 31] 13:44:48 INFO - ++DOMWINDOW == 45 (0x7f6166ca6c00) [pid = 2087] [serial = 67] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 46 (0x7f61688bc000) [pid = 2087] [serial = 68] [outer = 0x7f6166ca6c00] 13:44:48 INFO - 38 INFO TEST-START | devtools/client/sourceeditor/test/browser_editor_autocomplete_js.js 13:44:48 INFO - ++DOCSHELL 0x7f616d7d9800 == 26 [pid = 2087] [id = 32] 13:44:48 INFO - ++DOMWINDOW == 47 (0x7f616e389400) [pid = 2087] [serial = 69] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 48 (0x7f616e4a9c00) [pid = 2087] [serial = 70] [outer = 0x7f616e389400] 13:44:48 INFO - ++DOCSHELL 0x7f616d7eb000 == 27 [pid = 2087] [id = 33] 13:44:48 INFO - ++DOMWINDOW == 49 (0x7f616ecee800) [pid = 2087] [serial = 71] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 50 (0x7f616ecef000) [pid = 2087] [serial = 72] [outer = 0x7f616ecee800] 13:44:48 INFO - --DOCSHELL 0x7f616d7d9800 == 26 [pid = 2087] [id = 32] 13:44:48 INFO - MEMORY STAT | vsize 995MB | residentFast 309MB | heapAllocated 116MB 13:44:48 INFO - 39 INFO TEST-OK | devtools/client/sourceeditor/test/browser_editor_autocomplete_js.js | took 3678ms 13:44:48 INFO - ++DOCSHELL 0x7f616da23800 == 27 [pid = 2087] [id = 34] 13:44:48 INFO - ++DOMWINDOW == 51 (0x7f616dfb8c00) [pid = 2087] [serial = 73] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 52 (0x7f616ece3c00) [pid = 2087] [serial = 74] [outer = 0x7f616dfb8c00] 13:44:48 INFO - 40 INFO TEST-START | devtools/client/sourceeditor/test/browser_editor_basic.js 13:44:48 INFO - ++DOCSHELL 0x7f616eb64000 == 28 [pid = 2087] [id = 35] 13:44:48 INFO - ++DOMWINDOW == 53 (0x7f6173723800) [pid = 2087] [serial = 75] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 54 (0x7f617396cc00) [pid = 2087] [serial = 76] [outer = 0x7f6173723800] 13:44:48 INFO - ++DOCSHELL 0x7f616ffa3000 == 29 [pid = 2087] [id = 36] 13:44:48 INFO - ++DOMWINDOW == 55 (0x7f617c398400) [pid = 2087] [serial = 77] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 56 (0x7f617c39c400) [pid = 2087] [serial = 78] [outer = 0x7f617c398400] 13:44:48 INFO - --DOCSHELL 0x7f616eb64000 == 28 [pid = 2087] [id = 35] 13:44:48 INFO - MEMORY STAT | vsize 1001MB | residentFast 317MB | heapAllocated 122MB 13:44:48 INFO - 41 INFO TEST-OK | devtools/client/sourceeditor/test/browser_editor_basic.js | took 2745ms 13:44:48 INFO - ++DOCSHELL 0x7f616ffaf000 == 29 [pid = 2087] [id = 37] 13:44:48 INFO - ++DOMWINDOW == 57 (0x7f6173a31c00) [pid = 2087] [serial = 79] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 58 (0x7f6175b9e800) [pid = 2087] [serial = 80] [outer = 0x7f6173a31c00] 13:44:48 INFO - 42 INFO TEST-START | devtools/client/sourceeditor/test/browser_editor_cursor.js 13:44:48 INFO - ++DOCSHELL 0x7f6166c78800 == 30 [pid = 2087] [id = 38] 13:44:48 INFO - ++DOMWINDOW == 59 (0x7f618abf0c00) [pid = 2087] [serial = 81] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 60 (0x7f618abf1800) [pid = 2087] [serial = 82] [outer = 0x7f618abf0c00] 13:44:48 INFO - ++DOCSHELL 0x7f617315c000 == 31 [pid = 2087] [id = 39] 13:44:48 INFO - ++DOMWINDOW == 61 (0x7f6163d65000) [pid = 2087] [serial = 83] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 62 (0x7f6163d67000) [pid = 2087] [serial = 84] [outer = 0x7f6163d65000] 13:44:48 INFO - --DOCSHELL 0x7f6166c78800 == 30 [pid = 2087] [id = 38] 13:44:48 INFO - MEMORY STAT | vsize 1007MB | residentFast 325MB | heapAllocated 127MB 13:44:48 INFO - 43 INFO TEST-OK | devtools/client/sourceeditor/test/browser_editor_cursor.js | took 2347ms 13:44:48 INFO - ++DOCSHELL 0x7f6166c78800 == 31 [pid = 2087] [id = 40] 13:44:48 INFO - ++DOMWINDOW == 63 (0x7f6163d5dc00) [pid = 2087] [serial = 85] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 64 (0x7f6163d68800) [pid = 2087] [serial = 86] [outer = 0x7f6163d5dc00] 13:44:48 INFO - 44 INFO TEST-START | devtools/client/sourceeditor/test/browser_editor_find_again.js 13:44:48 INFO - ++DOCSHELL 0x7f6168892800 == 32 [pid = 2087] [id = 41] 13:44:48 INFO - ++DOMWINDOW == 65 (0x7f616cbbd000) [pid = 2087] [serial = 87] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 66 (0x7f616cbbdc00) [pid = 2087] [serial = 88] [outer = 0x7f616cbbd000] 13:44:48 INFO - ++DOCSHELL 0x7f61821b3000 == 33 [pid = 2087] [id = 42] 13:44:48 INFO - ++DOMWINDOW == 67 (0x7f6172dc0800) [pid = 2087] [serial = 89] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 68 (0x7f6172de8800) [pid = 2087] [serial = 90] [outer = 0x7f6172dc0800] 13:44:48 INFO - --DOCSHELL 0x7f6168892800 == 32 [pid = 2087] [id = 41] 13:44:48 INFO - MEMORY STAT | vsize 1015MB | residentFast 335MB | heapAllocated 133MB 13:44:48 INFO - 45 INFO TEST-OK | devtools/client/sourceeditor/test/browser_editor_find_again.js | took 3486ms 13:44:48 INFO - ++DOCSHELL 0x7f6161c4f800 == 33 [pid = 2087] [id = 43] 13:44:48 INFO - ++DOMWINDOW == 69 (0x7f6164072400) [pid = 2087] [serial = 91] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 70 (0x7f6164074800) [pid = 2087] [serial = 92] [outer = 0x7f6164072400] 13:44:48 INFO - 46 INFO TEST-START | devtools/client/sourceeditor/test/browser_editor_goto_line.js 13:44:48 INFO - ++DOCSHELL 0x7f6161c58800 == 34 [pid = 2087] [id = 44] 13:44:48 INFO - ++DOMWINDOW == 71 (0x7f616407a400) [pid = 2087] [serial = 93] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 72 (0x7f616407b000) [pid = 2087] [serial = 94] [outer = 0x7f616407a400] 13:44:48 INFO - ++DOCSHELL 0x7f6161c66800 == 35 [pid = 2087] [id = 45] 13:44:48 INFO - ++DOMWINDOW == 73 (0x7f616cbc4c00) [pid = 2087] [serial = 95] [outer = (nil)] 13:44:48 INFO - ++DOMWINDOW == 74 (0x7f6161a6b400) [pid = 2087] [serial = 96] [outer = 0x7f616cbc4c00] 13:44:48 INFO - --DOCSHELL 0x7f616348d800 == 34 [pid = 2087] [id = 23] 13:44:48 INFO - --DOCSHELL 0x7f6162c09000 == 33 [pid = 2087] [id = 24] 13:44:48 INFO - --DOCSHELL 0x7f61864a7800 == 32 [pid = 2087] [id = 14] 13:44:48 INFO - --DOCSHELL 0x7f616889a000 == 31 [pid = 2087] [id = 9] 13:44:48 INFO - --DOCSHELL 0x7f6171040800 == 30 [pid = 2087] [id = 15] 13:44:48 INFO - --DOCSHELL 0x7f6174561800 == 29 [pid = 2087] [id = 13] 13:44:48 INFO - --DOCSHELL 0x7f61637bf000 == 28 [pid = 2087] [id = 27] 13:44:48 INFO - --DOCSHELL 0x7f61639ad000 == 27 [pid = 2087] [id = 17] 13:44:48 INFO - --DOCSHELL 0x7f6164059800 == 26 [pid = 2087] [id = 28] 13:44:48 INFO - --DOCSHELL 0x7f6163679000 == 25 [pid = 2087] [id = 18] 13:44:48 INFO - --DOCSHELL 0x7f6168a1e000 == 24 [pid = 2087] [id = 31] 13:44:48 INFO - --DOCSHELL 0x7f616399c800 == 23 [pid = 2087] [id = 16] 13:44:48 INFO - --DOCSHELL 0x7f616da23800 == 22 [pid = 2087] [id = 34] 13:44:48 INFO - --DOCSHELL 0x7f6162c1c000 == 21 [pid = 2087] [id = 21] 13:44:48 INFO - --DOCSHELL 0x7f61644c8800 == 20 [pid = 2087] [id = 12] 13:44:48 INFO - --DOCSHELL 0x7f616ffaf000 == 19 [pid = 2087] [id = 37] 13:44:48 INFO - --DOCSHELL 0x7f6166c78800 == 18 [pid = 2087] [id = 40] 13:44:48 INFO - --DOCSHELL 0x7f6168a04000 == 17 [pid = 2087] [id = 7] 13:44:49 INFO - --DOCSHELL 0x7f6161c58800 == 16 [pid = 2087] [id = 44] 13:44:49 INFO - MEMORY STAT | vsize 1007MB | residentFast 319MB | heapAllocated 126MB 13:44:49 INFO - 47 INFO TEST-OK | devtools/client/sourceeditor/test/browser_editor_goto_line.js | took 6327ms 13:44:49 INFO - ++DOCSHELL 0x7f6162c19800 == 17 [pid = 2087] [id = 46] 13:44:49 INFO - ++DOMWINDOW == 75 (0x7f6161a71c00) [pid = 2087] [serial = 97] [outer = (nil)] 13:44:49 INFO - ++DOMWINDOW == 76 (0x7f6161c03c00) [pid = 2087] [serial = 98] [outer = 0x7f6161a71c00] 13:44:49 INFO - 48 INFO TEST-START | devtools/client/sourceeditor/test/browser_editor_history.js 13:44:49 INFO - ++DOCSHELL 0x7f61637b3800 == 18 [pid = 2087] [id = 47] 13:44:49 INFO - ++DOMWINDOW == 77 (0x7f6163e79400) [pid = 2087] [serial = 99] [outer = (nil)] 13:44:49 INFO - ++DOMWINDOW == 78 (0x7f6163e7a000) [pid = 2087] [serial = 100] [outer = 0x7f6163e79400] 13:44:50 INFO - ++DOCSHELL 0x7f6163cad800 == 19 [pid = 2087] [id = 48] 13:44:50 INFO - ++DOMWINDOW == 79 (0x7f6164021000) [pid = 2087] [serial = 101] [outer = (nil)] 13:44:50 INFO - ++DOMWINDOW == 80 (0x7f6164022c00) [pid = 2087] [serial = 102] [outer = 0x7f6164021000] 13:44:50 INFO - --DOCSHELL 0x7f61637b3800 == 18 [pid = 2087] [id = 47] 13:44:50 INFO - MEMORY STAT | vsize 1008MB | residentFast 324MB | heapAllocated 131MB 13:44:50 INFO - 49 INFO TEST-OK | devtools/client/sourceeditor/test/browser_editor_history.js | took 1041ms 13:44:50 INFO - ++DOCSHELL 0x7f61637b5000 == 19 [pid = 2087] [id = 49] 13:44:50 INFO - ++DOMWINDOW == 81 (0x7f6163e7b400) [pid = 2087] [serial = 103] [outer = (nil)] 13:44:50 INFO - ++DOMWINDOW == 82 (0x7f6164020000) [pid = 2087] [serial = 104] [outer = 0x7f6163e7b400] 13:44:51 INFO - 50 INFO TEST-START | devtools/client/sourceeditor/test/browser_editor_markers.js 13:44:51 INFO - ++DOCSHELL 0x7f61637c3800 == 20 [pid = 2087] [id = 50] 13:44:51 INFO - ++DOMWINDOW == 83 (0x7f6166ca8000) [pid = 2087] [serial = 105] [outer = (nil)] 13:44:51 INFO - ++DOMWINDOW == 84 (0x7f6166ca8c00) [pid = 2087] [serial = 106] [outer = 0x7f6166ca8000] 13:44:51 INFO - ++DOCSHELL 0x7f6166b18800 == 21 [pid = 2087] [id = 51] 13:44:51 INFO - ++DOMWINDOW == 85 (0x7f61670f5000) [pid = 2087] [serial = 107] [outer = (nil)] 13:44:51 INFO - ++DOMWINDOW == 86 (0x7f6168413000) [pid = 2087] [serial = 108] [outer = 0x7f61670f5000] 13:44:51 INFO - --DOCSHELL 0x7f61637c3800 == 20 [pid = 2087] [id = 50] 13:44:52 INFO - MEMORY STAT | vsize 1011MB | residentFast 329MB | heapAllocated 136MB 13:44:52 INFO - 51 INFO TEST-OK | devtools/client/sourceeditor/test/browser_editor_markers.js | took 1031ms 13:44:52 INFO - ++DOCSHELL 0x7f6161817800 == 21 [pid = 2087] [id = 52] 13:44:52 INFO - ++DOMWINDOW == 87 (0x7f61670ef400) [pid = 2087] [serial = 109] [outer = (nil)] 13:44:52 INFO - ++DOMWINDOW == 88 (0x7f61670f4800) [pid = 2087] [serial = 110] [outer = 0x7f61670ef400] 13:44:52 INFO - 52 INFO TEST-START | devtools/client/sourceeditor/test/browser_editor_movelines.js 13:44:52 INFO - ++DOCSHELL 0x7f6168678000 == 22 [pid = 2087] [id = 53] 13:44:52 INFO - ++DOMWINDOW == 89 (0x7f616e24ac00) [pid = 2087] [serial = 111] [outer = (nil)] 13:44:52 INFO - ++DOMWINDOW == 90 (0x7f616e265800) [pid = 2087] [serial = 112] [outer = 0x7f616e24ac00] 13:44:52 INFO - ++DOCSHELL 0x7f6168696800 == 23 [pid = 2087] [id = 54] 13:44:52 INFO - ++DOMWINDOW == 91 (0x7f616e8bd000) [pid = 2087] [serial = 113] [outer = (nil)] 13:44:52 INFO - ++DOMWINDOW == 92 (0x7f616e917400) [pid = 2087] [serial = 114] [outer = 0x7f616e8bd000] 13:44:53 INFO - --DOCSHELL 0x7f6168678000 == 22 [pid = 2087] [id = 53] 13:44:54 INFO - MEMORY STAT | vsize 1021MB | residentFast 334MB | heapAllocated 140MB 13:44:54 INFO - 53 INFO TEST-OK | devtools/client/sourceeditor/test/browser_editor_movelines.js | took 1731ms 13:44:54 INFO - ++DOCSHELL 0x7f61634a9000 == 23 [pid = 2087] [id = 55] 13:44:54 INFO - ++DOMWINDOW == 93 (0x7f6160ec1000) [pid = 2087] [serial = 115] [outer = (nil)] 13:44:54 INFO - ++DOMWINDOW == 94 (0x7f6160ec3000) [pid = 2087] [serial = 116] [outer = 0x7f6160ec1000] 13:44:54 INFO - --DOMWINDOW == 93 (0x7f6162bee000) [pid = 2087] [serial = 47] [outer = (nil)] [url = about:blank] 13:44:54 INFO - --DOMWINDOW == 92 (0x7f6162be7800) [pid = 2087] [serial = 49] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=UTF-8,] 13:44:54 INFO - --DOMWINDOW == 91 (0x7f6162ca8400) [pid = 2087] [serial = 51] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:44:54 INFO - --DOMWINDOW == 90 (0x7f61636ac000) [pid = 2087] [serial = 45] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:44:54 INFO - --DOMWINDOW == 89 (0x7f61636a7000) [pid = 2087] [serial = 41] [outer = (nil)] [url = about:blank] 13:44:54 INFO - --DOMWINDOW == 88 (0x7f616343bc00) [pid = 2087] [serial = 43] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=UTF-8,] 13:44:54 INFO - --DOMWINDOW == 87 (0x7f61636a9000) [pid = 2087] [serial = 42] [outer = (nil)] [url = about:blank] 13:44:54 INFO - --DOMWINDOW == 86 (0x7f6162caac00) [pid = 2087] [serial = 48] [outer = (nil)] [url = about:blank] 13:44:54 INFO - --DOMWINDOW == 85 (0x7f61688b6400) [pid = 2087] [serial = 20] [outer = (nil)] [url = chrome://mochitests/content/browser/devtools/client/sourceeditor/test/codemirror/codemirror.html] 13:44:54 INFO - 54 INFO TEST-START | devtools/client/sourceeditor/test/browser_editor_prefs.js 13:44:54 INFO - ++DOCSHELL 0x7f6161816800 == 24 [pid = 2087] [id = 56] 13:44:54 INFO - ++DOMWINDOW == 86 (0x7f6160eca400) [pid = 2087] [serial = 117] [outer = (nil)] 13:44:54 INFO - ++DOMWINDOW == 87 (0x7f6162be7800) [pid = 2087] [serial = 118] [outer = 0x7f6160eca400] 13:44:54 INFO - ++DOCSHELL 0x7f6173306800 == 25 [pid = 2087] [id = 57] 13:44:54 INFO - ++DOMWINDOW == 88 (0x7f616eced000) [pid = 2087] [serial = 119] [outer = (nil)] 13:44:54 INFO - ++DOMWINDOW == 89 (0x7f6163612400) [pid = 2087] [serial = 120] [outer = 0x7f616eced000] 13:44:55 INFO - --DOCSHELL 0x7f6161816800 == 24 [pid = 2087] [id = 56] 13:44:55 INFO - MEMORY STAT | vsize 1025MB | residentFast 344MB | heapAllocated 145MB 13:44:55 INFO - 55 INFO TEST-OK | devtools/client/sourceeditor/test/browser_editor_prefs.js | took 1421ms 13:44:55 INFO - ++DOCSHELL 0x7f6160cdb000 == 25 [pid = 2087] [id = 58] 13:44:55 INFO - ++DOMWINDOW == 90 (0x7f6160ec9800) [pid = 2087] [serial = 121] [outer = (nil)] 13:44:55 INFO - ++DOMWINDOW == 91 (0x7f6160f0fc00) [pid = 2087] [serial = 122] [outer = 0x7f6160ec9800] 13:44:56 INFO - 56 INFO TEST-START | devtools/client/sourceeditor/test/browser_editor_script_injection.js 13:44:56 INFO - ++DOCSHELL 0x7f6160f77800 == 26 [pid = 2087] [id = 59] 13:44:56 INFO - ++DOMWINDOW == 92 (0x7f6163618c00) [pid = 2087] [serial = 123] [outer = (nil)] 13:44:56 INFO - ++DOMWINDOW == 93 (0x7f6163637c00) [pid = 2087] [serial = 124] [outer = 0x7f6163618c00] 13:44:56 INFO - ++DOCSHELL 0x7f6160cc6000 == 27 [pid = 2087] [id = 60] 13:44:56 INFO - ++DOMWINDOW == 94 (0x7f6160ebf800) [pid = 2087] [serial = 125] [outer = (nil)] 13:44:56 INFO - ++DOMWINDOW == 95 (0x7f6160ec6400) [pid = 2087] [serial = 126] [outer = 0x7f6160ebf800] 13:44:57 INFO - --DOCSHELL 0x7f6160f77800 == 26 [pid = 2087] [id = 59] 13:44:57 INFO - MEMORY STAT | vsize 1029MB | residentFast 346MB | heapAllocated 137MB 13:44:57 INFO - 57 INFO TEST-OK | devtools/client/sourceeditor/test/browser_editor_script_injection.js | took 1280ms 13:44:57 INFO - ++DOCSHELL 0x7f6160cd2000 == 27 [pid = 2087] [id = 61] 13:44:57 INFO - ++DOMWINDOW == 96 (0x7f6160ec7400) [pid = 2087] [serial = 127] [outer = (nil)] 13:44:57 INFO - ++DOMWINDOW == 97 (0x7f6160f0bc00) [pid = 2087] [serial = 128] [outer = 0x7f6160ec7400] 13:44:57 INFO - ++DOMWINDOW == 98 (0x7f6161c0ac00) [pid = 2087] [serial = 129] [outer = 0x7f61713f4000] 13:44:57 INFO - ++DOMWINDOW == 99 (0x7f6161e44c00) [pid = 2087] [serial = 130] [outer = 0x7f61713f4800] 13:44:57 INFO - --DOCSHELL 0x7f616d7ed000 == 26 [pid = 2087] [id = 10] 13:44:57 INFO - ++DOMWINDOW == 100 (0x7f6160f02400) [pid = 2087] [serial = 131] [outer = 0x7f61713f4000] 13:44:57 INFO - ++DOMWINDOW == 101 (0x7f6161e46400) [pid = 2087] [serial = 132] [outer = 0x7f61713f4800] 13:45:00 INFO - --DOCSHELL 0x7f616e96a000 == 25 [pid = 2087] [id = 11] 13:45:00 INFO - --DOCSHELL 0x7f6162c19800 == 24 [pid = 2087] [id = 46] 13:45:00 INFO - --DOCSHELL 0x7f6168a0d000 == 23 [pid = 2087] [id = 8] 13:45:00 INFO - --DOCSHELL 0x7f61637b5000 == 22 [pid = 2087] [id = 49] 13:45:00 INFO - --DOCSHELL 0x7f6161817800 == 21 [pid = 2087] [id = 52] 13:45:00 INFO - --DOCSHELL 0x7f6161c4f800 == 20 [pid = 2087] [id = 43] 13:45:00 INFO - --DOCSHELL 0x7f61634a9000 == 19 [pid = 2087] [id = 55] 13:45:00 INFO - --DOCSHELL 0x7f6160cdb000 == 18 [pid = 2087] [id = 58] 13:45:00 INFO - --DOCSHELL 0x7f61637b8000 == 17 [pid = 2087] [id = 26] 13:45:00 INFO - --DOCSHELL 0x7f61684b8800 == 16 [pid = 2087] [id = 30] 13:45:00 INFO - --DOCSHELL 0x7f616d7eb000 == 15 [pid = 2087] [id = 33] 13:45:00 INFO - --DOCSHELL 0x7f616ffa3000 == 14 [pid = 2087] [id = 36] 13:45:00 INFO - --DOCSHELL 0x7f617315c000 == 13 [pid = 2087] [id = 39] 13:45:00 INFO - --DOCSHELL 0x7f61821b3000 == 12 [pid = 2087] [id = 42] 13:45:00 INFO - --DOCSHELL 0x7f6161c66800 == 11 [pid = 2087] [id = 45] 13:45:00 INFO - --DOCSHELL 0x7f6163cad800 == 10 [pid = 2087] [id = 48] 13:45:00 INFO - --DOCSHELL 0x7f6166b18800 == 9 [pid = 2087] [id = 51] 13:45:00 INFO - --DOCSHELL 0x7f6168696800 == 8 [pid = 2087] [id = 54] 13:45:00 INFO - --DOCSHELL 0x7f6173306800 == 7 [pid = 2087] [id = 57] 13:45:00 INFO - --DOCSHELL 0x7f6160cc6000 == 6 [pid = 2087] [id = 60] 13:45:02 INFO - --DOMWINDOW == 100 (0x7f616343fc00) [pid = 2087] [serial = 46] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:02 INFO - --DOMWINDOW == 99 (0x7f616343c800) [pid = 2087] [serial = 44] [outer = (nil)] [url = about:blank] 13:45:02 INFO - --DOMWINDOW == 98 (0x7f6162be8800) [pid = 2087] [serial = 50] [outer = (nil)] [url = about:blank] 13:45:02 INFO - --DOMWINDOW == 97 (0x7f6162ca9c00) [pid = 2087] [serial = 52] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:02 INFO - --DOMWINDOW == 96 (0x7f616841c400) [pid = 2087] [serial = 23] [outer = (nil)] [url = chrome://mochitests/content/browser/devtools/client/sourceeditor/test/codemirror/codemirror.html] 13:45:02 INFO - --DOMWINDOW == 95 (0x7f6161e44c00) [pid = 2087] [serial = 130] [outer = 0x7f61713f4800] [url = about:blank] 13:45:02 INFO - --DOMWINDOW == 94 (0x7f616e739400) [pid = 2087] [serial = 11] [outer = 0x7f61713f4800] [url = about:blank] 13:45:02 INFO - --DOMWINDOW == 93 (0x7f6161c0ac00) [pid = 2087] [serial = 129] [outer = 0x7f61713f4000] [url = about:blank] 13:45:02 INFO - --DOMWINDOW == 92 (0x7f616e738c00) [pid = 2087] [serial = 10] [outer = 0x7f61713f4000] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 91 (0x7f61688bfc00) [pid = 2087] [serial = 64] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 90 (0x7f6163639000) [pid = 2087] [serial = 56] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 89 (0x7f6162be7800) [pid = 2087] [serial = 118] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 88 (0x7f61636a9c00) [pid = 2087] [serial = 57] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 87 (0x7f617c398400) [pid = 2087] [serial = 77] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 86 (0x7f6163d65000) [pid = 2087] [serial = 83] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 85 (0x7f6164021000) [pid = 2087] [serial = 101] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 84 (0x7f616e8bd000) [pid = 2087] [serial = 113] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 83 (0x7f616eced000) [pid = 2087] [serial = 119] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 82 (0x7f6164072400) [pid = 2087] [serial = 91] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 81 (0x7f6172dc0800) [pid = 2087] [serial = 89] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 80 (0x7f6172de8800) [pid = 2087] [serial = 90] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 79 (0x7f616cbbd000) [pid = 2087] [serial = 87] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=UTF-8,] 13:45:04 INFO - --DOMWINDOW == 78 (0x7f616cbbdc00) [pid = 2087] [serial = 88] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 77 (0x7f6163d5dc00) [pid = 2087] [serial = 85] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 76 (0x7f6163d67000) [pid = 2087] [serial = 84] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 75 (0x7f616d67f400) [pid = 2087] [serial = 18] [outer = (nil)] [url = about:newtab] 13:45:04 INFO - --DOMWINDOW == 74 (0x7f618abf0c00) [pid = 2087] [serial = 81] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=UTF-8,] 13:45:04 INFO - --DOMWINDOW == 73 (0x7f618abf1800) [pid = 2087] [serial = 82] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 72 (0x7f61670f5000) [pid = 2087] [serial = 107] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 71 (0x7f6168413000) [pid = 2087] [serial = 108] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 70 (0x7f6160ec9800) [pid = 2087] [serial = 121] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 69 (0x7f6166ca8000) [pid = 2087] [serial = 105] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=UTF-8,] 13:45:04 INFO - --DOMWINDOW == 68 (0x7f6160ec3000) [pid = 2087] [serial = 116] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 67 (0x7f6164022c00) [pid = 2087] [serial = 102] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 66 (0x7f6163e79400) [pid = 2087] [serial = 99] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=UTF-8,] 13:45:04 INFO - --DOMWINDOW == 65 (0x7f6163e7a000) [pid = 2087] [serial = 100] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 64 (0x7f6161a6b400) [pid = 2087] [serial = 96] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 63 (0x7f616cbc4c00) [pid = 2087] [serial = 95] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 62 (0x7f616e917400) [pid = 2087] [serial = 114] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 61 (0x7f616e24ac00) [pid = 2087] [serial = 111] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=UTF-8,] 13:45:04 INFO - --DOMWINDOW == 60 (0x7f6160f0fc00) [pid = 2087] [serial = 122] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 59 (0x7f6160eca400) [pid = 2087] [serial = 117] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=UTF-8,] 13:45:04 INFO - --DOMWINDOW == 58 (0x7f616e265800) [pid = 2087] [serial = 112] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 57 (0x7f6168412000) [pid = 2087] [serial = 22] [outer = (nil)] [url = about:newtab] 13:45:04 INFO - --DOMWINDOW == 56 (0x7f6168c5a000) [pid = 2087] [serial = 66] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 55 (0x7f61688c1400) [pid = 2087] [serial = 65] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 54 (0x7f6160ec1000) [pid = 2087] [serial = 115] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 53 (0x7f61688be400) [pid = 2087] [serial = 63] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=UTF-8,] 13:45:04 INFO - --DOMWINDOW == 52 (0x7f6166ca8c00) [pid = 2087] [serial = 106] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 51 (0x7f6163612400) [pid = 2087] [serial = 120] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 50 (0x7f6161a71c00) [pid = 2087] [serial = 97] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 49 (0x7f6163e7b400) [pid = 2087] [serial = 103] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 48 (0x7f61670ef400) [pid = 2087] [serial = 109] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 47 (0x7f6166ca6c00) [pid = 2087] [serial = 67] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 46 (0x7f616dfb8c00) [pid = 2087] [serial = 73] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 45 (0x7f6173a31c00) [pid = 2087] [serial = 79] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 44 (0x7f61670e8800) [pid = 2087] [serial = 61] [outer = (nil)] [url = data:text/html;charset=UTF-8,] 13:45:04 INFO - --DOMWINDOW == 43 (0x7f6163639800) [pid = 2087] [serial = 59] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 42 (0x7f6162ca4000) [pid = 2087] [serial = 53] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 41 (0x7f6175b9e800) [pid = 2087] [serial = 80] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 40 (0x7f61670eac00) [pid = 2087] [serial = 62] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 39 (0x7f61636a1800) [pid = 2087] [serial = 60] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 38 (0x7f6162d1b800) [pid = 2087] [serial = 54] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 37 (0x7f6160ebf800) [pid = 2087] [serial = 125] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 36 (0x7f6173976400) [pid = 2087] [serial = 26] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 13:45:04 INFO - --DOMWINDOW == 35 (0x7f616fcecc00) [pid = 2087] [serial = 24] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,] 13:45:04 INFO - --DOMWINDOW == 34 (0x7f6175824400) [pid = 2087] [serial = 28] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 33 (0x7f6160ec6400) [pid = 2087] [serial = 126] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 32 (0x7f6163637c00) [pid = 2087] [serial = 124] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 31 (0x7f6163618c00) [pid = 2087] [serial = 123] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=UTF-8,] 13:45:04 INFO - --DOMWINDOW == 30 (0x7f6163637400) [pid = 2087] [serial = 55] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=UTF-8,] 13:45:04 INFO - --DOMWINDOW == 29 (0x7f6163725000) [pid = 2087] [serial = 58] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 28 (0x7f617c39c400) [pid = 2087] [serial = 78] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 27 (0x7f6173723800) [pid = 2087] [serial = 75] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=UTF-8,] 13:45:04 INFO - --DOMWINDOW == 26 (0x7f617396cc00) [pid = 2087] [serial = 76] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 25 (0x7f616ecee800) [pid = 2087] [serial = 71] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 24 (0x7f616ecef000) [pid = 2087] [serial = 72] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:45:04 INFO - --DOMWINDOW == 23 (0x7f616e389400) [pid = 2087] [serial = 69] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=UTF-8,] 13:45:04 INFO - --DOMWINDOW == 22 (0x7f616e4a9c00) [pid = 2087] [serial = 70] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 21 (0x7f616407a400) [pid = 2087] [serial = 93] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=UTF-8,] 13:45:04 INFO - --DOMWINDOW == 20 (0x7f616407b000) [pid = 2087] [serial = 94] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 19 (0x7f6163d68800) [pid = 2087] [serial = 86] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 18 (0x7f6164074800) [pid = 2087] [serial = 92] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 17 (0x7f61688bc000) [pid = 2087] [serial = 68] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 16 (0x7f616ece3c00) [pid = 2087] [serial = 74] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 15 (0x7f616da0f000) [pid = 2087] [serial = 27] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 14 (0x7f6161c03c00) [pid = 2087] [serial = 98] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 13 (0x7f6164020000) [pid = 2087] [serial = 104] [outer = (nil)] [url = about:blank] 13:45:04 INFO - --DOMWINDOW == 12 (0x7f61670f4800) [pid = 2087] [serial = 110] [outer = (nil)] [url = about:blank] 13:45:10 INFO - Completed ShutdownLeaks collections in process 2087 13:45:10 INFO - JavaScript error: resource://gre/modules/PerformanceStats.jsm, line 208: NS_ERROR_NOT_AVAILABLE: Component returned failure code: 0x80040111 (NS_ERROR_NOT_AVAILABLE) [nsIPerformanceStatsService.isMonitoringJank] 13:45:12 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 13:45:12 INFO - --DOCSHELL 0x7f616d945000 == 5 [pid = 2087] [id = 6] 13:45:12 INFO - --DOCSHELL 0x7f6181985800 == 4 [pid = 2087] [id = 1] 13:45:13 INFO - --DOCSHELL 0x7f617145b000 == 3 [pid = 2087] [id = 3] 13:45:13 INFO - --DOCSHELL 0x7f617145b800 == 2 [pid = 2087] [id = 4] 13:45:13 INFO - --DOCSHELL 0x7f6160cd2000 == 1 [pid = 2087] [id = 61] 13:45:13 INFO - --DOCSHELL 0x7f6175941800 == 0 [pid = 2087] [id = 2] 13:45:13 INFO - JavaScript error: resource://gre/modules/PerformanceStats.jsm, line 492: Error: forget() called twice 13:45:13 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 13:45:14 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 13:45:14 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 13:45:14 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 13:45:15 INFO - [2087] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 769 13:45:16 INFO - --DOMWINDOW == 11 (0x7f6161e46400) [pid = 2087] [serial = 132] [outer = 0x7f61713f4800] [url = about:blank] 13:45:16 INFO - --DOMWINDOW == 10 (0x7f6160f02400) [pid = 2087] [serial = 131] [outer = 0x7f61713f4000] [url = about:blank] 13:45:16 INFO - --DOMWINDOW == 9 (0x7f61713f4800) [pid = 2087] [serial = 7] [outer = (nil)] [url = about:blank] 13:45:16 INFO - --DOMWINDOW == 8 (0x7f61713f4000) [pid = 2087] [serial = 6] [outer = (nil)] [url = about:blank] 13:45:18 INFO - --DOMWINDOW == 7 (0x7f6181b40400) [pid = 2087] [serial = 4] [outer = (nil)] [url = about:blank] 13:45:18 INFO - --DOMWINDOW == 6 (0x7f6181b3f800) [pid = 2087] [serial = 3] [outer = (nil)] [url = chrome://browser/content/browser.xul] 13:45:18 INFO - --DOMWINDOW == 5 (0x7f616dafa800) [pid = 2087] [serial = 15] [outer = (nil)] [url = about:blank] 13:45:18 INFO - --DOMWINDOW == 4 (0x7f6160ec7400) [pid = 2087] [serial = 127] [outer = (nil)] [url = about:blank] 13:45:18 INFO - --DOMWINDOW == 3 (0x7f6160f0bc00) [pid = 2087] [serial = 128] [outer = (nil)] [url = about:blank] 13:45:18 INFO - --DOMWINDOW == 2 (0x7f616daf9c00) [pid = 2087] [serial = 14] [outer = (nil)] [url = chrome://mochikit/content/browser-harness.xul] 13:45:18 INFO - --DOMWINDOW == 1 (0x7f61819c6800) [pid = 2087] [serial = 1] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 13:45:18 INFO - --DOMWINDOW == 0 (0x7f6175882400) [pid = 2087] [serial = 5] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 13:45:18 INFO - [2087] WARNING: OOPDeinit() without successful OOPInit(): file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/crashreporter/nsExceptionHandler.cpp, line 2792 13:45:18 INFO - nsStringStats 13:45:18 INFO - => mAllocCount: 229230 13:45:18 INFO - => mReallocCount: 22213 13:45:18 INFO - => mFreeCount: 229230 13:45:18 INFO - => mShareCount: 192366 13:45:18 INFO - => mAdoptCount: 11160 13:45:18 INFO - => mAdoptFreeCount: 11160 13:45:18 INFO - => Process ID: 2087, Thread ID: 140057293367104 13:45:18 INFO - TEST-INFO | Main app process: exit 0 13:45:18 INFO - runtests.py | Application ran for: 0:01:47.919289 13:45:18 INFO - zombiecheck | Reading PID log: /tmp/tmpYrbhAGpidlog 13:45:18 INFO - Stopping web server 13:45:18 INFO - Stopping web socket server 13:45:18 INFO - Stopping ssltunnel 13:45:18 INFO - TEST-INFO | leakcheck | default process: leak threshold set at 0 bytes 13:45:18 INFO - TEST-INFO | leakcheck | plugin process: leak threshold set at 0 bytes 13:45:18 INFO - TEST-INFO | leakcheck | tab process: leak threshold set at 10000 bytes 13:45:18 INFO - TEST-INFO | leakcheck | geckomediaplugin process: leak threshold set at 20000 bytes 13:45:18 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, default process 2087 13:45:18 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 13:45:18 INFO - | | Per-Inst Leaked| Total Rem| 13:45:18 INFO - 0 |TOTAL | 22 0| 7242053 0| 13:45:18 INFO - nsTraceRefcnt::DumpStatistics: 1352 entries 13:45:18 INFO - TEST-PASS | leakcheck | default process: no leaks detected! 13:45:18 INFO - runtests.py | Running tests: end. 13:45:18 INFO - 58 INFO checking window state 13:45:18 INFO - 59 INFO TEST-START | Shutdown 13:45:18 INFO - 60 INFO Browser Chrome Test Summary 13:45:18 INFO - 61 INFO Passed: 456 13:45:18 INFO - 62 INFO Failed: 0 13:45:18 INFO - 63 INFO Todo: 1 13:45:18 INFO - 64 INFO *** End BrowserChrome Test Results *** 13:45:18 INFO - dir: devtools/client/webconsole/test 13:45:19 INFO - Setting pipeline to PAUSED ... 13:45:19 INFO - Pipeline is PREROLLING ... 13:45:19 INFO - Pipeline is PREROLLED ... 13:45:19 INFO - Setting pipeline to PLAYING ... 13:45:19 INFO - New clock: GstSystemClock 13:45:19 INFO - Got EOS from element "pipeline0". 13:45:19 INFO - Execution ended after 32859758 ns. 13:45:19 INFO - Setting pipeline to PAUSED ... 13:45:19 INFO - Setting pipeline to READY ... 13:45:19 INFO - Setting pipeline to NULL ... 13:45:19 INFO - Freeing pipeline ... 13:45:23 INFO - pk12util: PKCS12 IMPORT SUCCESSFUL 13:45:24 INFO - MochitestServer : launching [u'/builds/slave/test/build/tests/bin/xpcshell', '-g', '/builds/slave/test/build/application/firefox', '-v', '170', '-f', '/builds/slave/test/build/tests/bin/components/httpd.js', '-e', "const _PROFILE_PATH = '/tmp/tmp6vwSI9.mozrunner'; const _SERVER_PORT = '8888'; const _SERVER_ADDR = '127.0.0.1'; const _TEST_PREFIX = undefined; const _DISPLAY_RESULTS = false;", '-f', '/builds/slave/test/build/tests/mochitest/server.js'] 13:45:24 INFO - runtests.py | Server pid: 2184 13:45:24 INFO - runtests.py | Websocket server pid: 2202 13:45:25 INFO - runtests.py | SSL tunnel pid: 2205 13:45:25 INFO - runtests.py | Running tests: start. 13:45:26 INFO - runtests.py | Application pid: 2212 13:45:26 INFO - TEST-INFO | started process Main app process 13:45:26 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmp6vwSI9.mozrunner/runtests_leaks.log 13:45:29 INFO - ++DOCSHELL 0x7f4b25786000 == 1 [pid = 2212] [id = 1] 13:45:29 INFO - ++DOMWINDOW == 1 (0x7f4b257e6800) [pid = 2212] [serial = 1] [outer = (nil)] 13:45:29 INFO - [2212] WARNING: Hardware Vsync support not yet implemented. Falling back to software timers: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/thebes/gfxPlatform.cpp, line 2084 13:45:29 INFO - ++DOMWINDOW == 2 (0x7f4b257e9800) [pid = 2212] [serial = 2] [outer = 0x7f4b257e6800] 13:45:30 INFO - LoadPlugin() /tmp/tmp6vwSI9.mozrunner/plugins/libnptestjava.so returned 7f4b200177c0 13:45:30 INFO - LoadPlugin() /tmp/tmp6vwSI9.mozrunner/plugins/libnpsecondtest.so returned 7f4b20017bb0 13:45:30 INFO - LoadPlugin() /tmp/tmp6vwSI9.mozrunner/plugins/libnptest.so returned 7f4b20017ee0 13:45:30 INFO - LoadPlugin() /tmp/tmp6vwSI9.mozrunner/plugins/libnpswftest.so returned 7f4b20017fd0 13:45:30 INFO - LoadPlugin() /tmp/tmp6vwSI9.mozrunner/plugins/libnpthirdtest.so returned 7f4b200a5340 13:45:30 INFO - LoadPlugin() /usr/lib/mozilla/plugins/librhythmbox-itms-detection-plugin.so returned 7f4b200a56a0 13:45:30 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-cone-plugin.so returned 7f4b200a7520 13:45:30 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-mully-plugin.so returned 7f4b200ac4c0 13:45:30 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-gmp-plugin.so returned 7f4b200ac7c0 13:45:30 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-narrowspace-plugin.so returned 7f4b200acaf0 13:45:30 INFO - ++DOCSHELL 0x7f4b19742000 == 2 [pid = 2212] [id = 2] 13:45:30 INFO - ++DOMWINDOW == 3 (0x7f4b2593f800) [pid = 2212] [serial = 3] [outer = (nil)] 13:45:30 INFO - ++DOMWINDOW == 4 (0x7f4b25940400) [pid = 2212] [serial = 4] [outer = 0x7f4b2593f800] 13:45:30 INFO - ++DOMWINDOW == 5 (0x7f4b196d8400) [pid = 2212] [serial = 5] [outer = 0x7f4b257e6800] 13:45:32 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:45:32 INFO - ++DOCSHELL 0x7f4b15b60000 == 3 [pid = 2212] [id = 3] 13:45:32 INFO - ++DOMWINDOW == 6 (0x7f4b15847c00) [pid = 2212] [serial = 6] [outer = (nil)] 13:45:32 INFO - ++DOCSHELL 0x7f4b15b60800 == 4 [pid = 2212] [id = 4] 13:45:32 INFO - ++DOMWINDOW == 7 (0x7f4b15848400) [pid = 2212] [serial = 7] [outer = (nil)] 13:45:33 INFO - [2212] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 13:45:33 INFO - ++DOCSHELL 0x7f4b141f8000 == 5 [pid = 2212] [id = 5] 13:45:33 INFO - ++DOMWINDOW == 8 (0x7f4b14059c00) [pid = 2212] [serial = 8] [outer = (nil)] 13:45:33 INFO - [2212] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 13:45:33 INFO - ++DOMWINDOW == 9 (0x7f4b133fc400) [pid = 2212] [serial = 9] [outer = 0x7f4b14059c00] 13:45:34 INFO - ++DOMWINDOW == 10 (0x7f4b12e36c00) [pid = 2212] [serial = 10] [outer = 0x7f4b15847c00] 13:45:34 INFO - ++DOMWINDOW == 11 (0x7f4b12e37400) [pid = 2212] [serial = 11] [outer = 0x7f4b15848400] 13:45:34 INFO - ++DOMWINDOW == 12 (0x7f4b12e39000) [pid = 2212] [serial = 12] [outer = 0x7f4b14059c00] 13:45:35 INFO - ++DOMWINDOW == 13 (0x7f4b12148c00) [pid = 2212] [serial = 13] [outer = 0x7f4b14059c00] 13:45:35 INFO - ++DOCSHELL 0x7f4b1205b000 == 6 [pid = 2212] [id = 6] 13:45:35 INFO - ++DOMWINDOW == 14 (0x7f4b12051800) [pid = 2212] [serial = 14] [outer = (nil)] 13:45:35 INFO - ++DOMWINDOW == 15 (0x7f4b123d3800) [pid = 2212] [serial = 15] [outer = 0x7f4b12051800] 13:45:38 INFO - ++DOCSHELL 0x7f4b0c829000 == 7 [pid = 2212] [id = 7] 13:45:38 INFO - ++DOMWINDOW == 16 (0x7f4b0ca87800) [pid = 2212] [serial = 16] [outer = (nil)] 13:45:38 INFO - ++DOMWINDOW == 17 (0x7f4b0ca89800) [pid = 2212] [serial = 17] [outer = 0x7f4b0ca87800] 13:45:38 INFO - ++DOCSHELL 0x7f4b12a11000 == 8 [pid = 2212] [id = 8] 13:45:38 INFO - ++DOMWINDOW == 18 (0x7f4b0c8f6c00) [pid = 2212] [serial = 18] [outer = (nil)] 13:45:38 INFO - ++DOMWINDOW == 19 (0x7f4b0c8f9000) [pid = 2212] [serial = 19] [outer = 0x7f4b0c8f6c00] 13:45:38 INFO - 65 INFO TEST-START | devtools/client/webconsole/test/browser_bug1045902_console_csp_ignore_reflected_xss_message.js 13:45:38 INFO - ++DOCSHELL 0x7f4b1241e800 == 9 [pid = 2212] [id = 9] 13:45:38 INFO - ++DOMWINDOW == 20 (0x7f4b0c4dfc00) [pid = 2212] [serial = 20] [outer = (nil)] 13:45:38 INFO - ++DOMWINDOW == 21 (0x7f4b0c4e2400) [pid = 2212] [serial = 21] [outer = 0x7f4b0c4dfc00] 13:45:38 INFO - ++DOMWINDOW == 22 (0x7f4b0c4e8c00) [pid = 2212] [serial = 22] [outer = 0x7f4b0c8f6c00] 13:45:39 INFO - ++DOCSHELL 0x7f4b0c021000 == 10 [pid = 2212] [id = 10] 13:45:39 INFO - ++DOMWINDOW == 23 (0x7f4b0c1a9000) [pid = 2212] [serial = 23] [outer = (nil)] 13:45:39 INFO - ++DOMWINDOW == 24 (0x7f4b0c421000) [pid = 2212] [serial = 24] [outer = 0x7f4b0c1a9000] 13:45:39 INFO - [2212] WARNING: GetDefaultCharsetForLocale: need to add multi locale support: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/intl/locale/unix/nsUNIXCharset.cpp, line 101 13:45:40 INFO - ++DOMWINDOW == 25 (0x7f4b14052000) [pid = 2212] [serial = 25] [outer = 0x7f4b0c1a9000] 13:45:41 INFO - ++DOCSHELL 0x7f4b14521000 == 11 [pid = 2212] [id = 11] 13:45:41 INFO - ++DOMWINDOW == 26 (0x7f4b1722b000) [pid = 2212] [serial = 26] [outer = (nil)] 13:45:41 INFO - ++DOMWINDOW == 27 (0x7f4b17230800) [pid = 2212] [serial = 27] [outer = 0x7f4b1722b000] 13:45:42 INFO - ++DOCSHELL 0x7f4b1589b800 == 12 [pid = 2212] [id = 12] 13:45:42 INFO - ++DOMWINDOW == 28 (0x7f4b09bed000) [pid = 2212] [serial = 28] [outer = (nil)] 13:45:42 INFO - ++DOMWINDOW == 29 (0x7f4b099b9c00) [pid = 2212] [serial = 29] [outer = 0x7f4b09bed000] 13:45:43 INFO - ++DOMWINDOW == 30 (0x7f4b09524000) [pid = 2212] [serial = 30] [outer = 0x7f4b09bed000] 13:45:43 INFO - ++DOCSHELL 0x7f4b14522000 == 13 [pid = 2212] [id = 13] 13:45:43 INFO - ++DOMWINDOW == 31 (0x7f4b0952c400) [pid = 2212] [serial = 31] [outer = (nil)] 13:45:43 INFO - ++DOMWINDOW == 32 (0x7f4b0952f000) [pid = 2212] [serial = 32] [outer = 0x7f4b0952c400] 13:45:43 INFO - [2212] WARNING: Could not get disk status from nsIDiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/uriloader/prefetch/nsOfflineCacheUpdateService.cpp, line 319 13:45:44 INFO - ++DOMWINDOW == 33 (0x7f4b07d5d800) [pid = 2212] [serial = 33] [outer = 0x7f4b0c4dfc00] 13:45:44 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:45:45 INFO - console.log: 13:45:44.444 GET http://example.com/browser/devtools/client/webconsole/test/test_bug1045902_console_csp_ignore_reflected_xss_message.html [HTTP/1.1 200 OK 49ms] 13:45:45 INFO - 13:45:44.562 Content Security Policy: Not supporting directive 'reflected-xss'. Directive and values will be ignored.1 13:45:45 INFO - [2212] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 13:45:46 INFO - --DOCSHELL 0x7f4b14521000 == 12 [pid = 2212] [id = 11] 13:45:46 INFO - --DOMWINDOW == 32 (0x7f4b12148c00) [pid = 2212] [serial = 13] [outer = (nil)] [url = about:blank] 13:45:46 INFO - --DOMWINDOW == 31 (0x7f4b12e39000) [pid = 2212] [serial = 12] [outer = (nil)] [url = about:blank] 13:45:46 INFO - --DOMWINDOW == 30 (0x7f4b14059c00) [pid = 2212] [serial = 8] [outer = (nil)] [url = about:blank] 13:45:46 INFO - --DOMWINDOW == 29 (0x7f4b133fc400) [pid = 2212] [serial = 9] [outer = (nil)] [url = about:blank] 13:45:46 INFO - --DOMWINDOW == 28 (0x7f4b099b9c00) [pid = 2212] [serial = 29] [outer = (nil)] [url = about:blank] 13:45:46 INFO - --DOMWINDOW == 27 (0x7f4b257e9800) [pid = 2212] [serial = 2] [outer = (nil)] [url = about:blank] 13:45:46 INFO - --DOMWINDOW == 26 (0x7f4b0c421000) [pid = 2212] [serial = 24] [outer = (nil)] [url = about:blank] 13:45:46 INFO - --DOMWINDOW == 25 (0x7f4b0c8f9000) [pid = 2212] [serial = 19] [outer = (nil)] [url = about:blank] 13:45:47 INFO - MEMORY STAT vsizeMaxContiguous not supported in this build configuration. 13:45:47 INFO - MEMORY STAT | vsize 971MB | residentFast 280MB | heapAllocated 93MB 13:45:47 INFO - 66 INFO TEST-OK | devtools/client/webconsole/test/browser_bug1045902_console_csp_ignore_reflected_xss_message.js | took 8605ms 13:45:47 INFO - ++DOCSHELL 0x7f4b07d8b800 == 13 [pid = 2212] [id = 14] 13:45:47 INFO - ++DOMWINDOW == 26 (0x7f4b09580800) [pid = 2212] [serial = 34] [outer = (nil)] 13:45:47 INFO - ++DOMWINDOW == 27 (0x7f4b09e54000) [pid = 2212] [serial = 35] [outer = 0x7f4b09580800] 13:45:47 INFO - 67 INFO TEST-START | devtools/client/webconsole/test/browser_bug664688_sandbox_update_after_navigation.js 13:45:47 INFO - ++DOCSHELL 0x7f4b0c838800 == 14 [pid = 2212] [id = 15] 13:45:47 INFO - ++DOMWINDOW == 28 (0x7f4b09e60000) [pid = 2212] [serial = 36] [outer = (nil)] 13:45:47 INFO - ++DOMWINDOW == 29 (0x7f4b0a044400) [pid = 2212] [serial = 37] [outer = 0x7f4b09e60000] 13:45:47 INFO - ++DOMWINDOW == 30 (0x7f4b0a9cf800) [pid = 2212] [serial = 38] [outer = 0x7f4b09e60000] 13:45:47 INFO - ++DOCSHELL 0x7f4b0c397000 == 15 [pid = 2212] [id = 16] 13:45:47 INFO - ++DOMWINDOW == 31 (0x7f4b0a860800) [pid = 2212] [serial = 39] [outer = (nil)] 13:45:47 INFO - ++DOMWINDOW == 32 (0x7f4b0c1acc00) [pid = 2212] [serial = 40] [outer = 0x7f4b0a860800] 13:45:47 INFO - ++DOMWINDOW == 33 (0x7f4b0c8f9000) [pid = 2212] [serial = 41] [outer = 0x7f4b0a860800] 13:45:48 INFO - ++DOCSHELL 0x7f4b12391000 == 16 [pid = 2212] [id = 17] 13:45:48 INFO - ++DOMWINDOW == 34 (0x7f4b12099c00) [pid = 2212] [serial = 42] [outer = (nil)] 13:45:48 INFO - ++DOMWINDOW == 35 (0x7f4b120a1c00) [pid = 2212] [serial = 43] [outer = 0x7f4b12099c00] 13:45:50 INFO - ++DOMWINDOW == 36 (0x7f4b087e9000) [pid = 2212] [serial = 44] [outer = 0x7f4b09e60000] 13:45:50 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:45:50 INFO - [2212] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 13:45:52 INFO - --DOCSHELL 0x7f4b0c829000 == 15 [pid = 2212] [id = 7] 13:45:52 INFO - --DOCSHELL 0x7f4b141f8000 == 14 [pid = 2212] [id = 5] 13:45:52 INFO - --DOCSHELL 0x7f4b12391000 == 13 [pid = 2212] [id = 17] 13:45:52 INFO - --DOCSHELL 0x7f4b1241e800 == 12 [pid = 2212] [id = 9] 13:45:52 INFO - --DOCSHELL 0x7f4b0c021000 == 11 [pid = 2212] [id = 10] 13:45:52 INFO - --DOMWINDOW == 35 (0x7f4b0c1a9000) [pid = 2212] [serial = 23] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:45:52 INFO - --DOMWINDOW == 34 (0x7f4b0c4e2400) [pid = 2212] [serial = 21] [outer = (nil)] [url = about:blank] 13:45:52 INFO - --DOMWINDOW == 33 (0x7f4b0c4dfc00) [pid = 2212] [serial = 20] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test_bug1045902_console_csp_ignore_reflected_xss_message.html] 13:45:52 INFO - --DOMWINDOW == 32 (0x7f4b0c1acc00) [pid = 2212] [serial = 40] [outer = (nil)] [url = about:blank] 13:45:52 INFO - --DOMWINDOW == 31 (0x7f4b0ca89800) [pid = 2212] [serial = 17] [outer = (nil)] [url = about:blank] 13:45:52 INFO - --DOMWINDOW == 30 (0x7f4b0a044400) [pid = 2212] [serial = 37] [outer = (nil)] [url = about:blank] 13:45:52 INFO - --DOMWINDOW == 29 (0x7f4b0ca87800) [pid = 2212] [serial = 16] [outer = (nil)] [url = about:blank] 13:45:52 INFO - --DOMWINDOW == 28 (0x7f4b1722b000) [pid = 2212] [serial = 26] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:45:52 INFO - --DOMWINDOW == 27 (0x7f4b07d5d800) [pid = 2212] [serial = 33] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test_bug1045902_console_csp_ignore_reflected_xss_message.html] 13:45:52 INFO - MEMORY STAT | vsize 972MB | residentFast 278MB | heapAllocated 93MB 13:45:52 INFO - 68 INFO TEST-OK | devtools/client/webconsole/test/browser_bug664688_sandbox_update_after_navigation.js | took 5627ms 13:45:52 INFO - ++DOCSHELL 0x7f4b07c59800 == 12 [pid = 2212] [id = 18] 13:45:52 INFO - ++DOMWINDOW == 28 (0x7f4b09583800) [pid = 2212] [serial = 45] [outer = (nil)] 13:45:52 INFO - ++DOMWINDOW == 29 (0x7f4b09bb6c00) [pid = 2212] [serial = 46] [outer = 0x7f4b09583800] 13:45:53 INFO - 69 INFO TEST-START | devtools/client/webconsole/test/browser_bug_638949_copy_link_location.js 13:45:53 INFO - ++DOCSHELL 0x7f4b0f7b1000 == 13 [pid = 2212] [id = 19] 13:45:53 INFO - ++DOMWINDOW == 30 (0x7f4b0a046000) [pid = 2212] [serial = 47] [outer = (nil)] 13:45:53 INFO - ++DOMWINDOW == 31 (0x7f4b0a665400) [pid = 2212] [serial = 48] [outer = 0x7f4b0a046000] 13:45:53 INFO - ++DOMWINDOW == 32 (0x7f4b0a9ce400) [pid = 2212] [serial = 49] [outer = 0x7f4b0a046000] 13:45:53 INFO - ++DOCSHELL 0x7f4b0c392800 == 14 [pid = 2212] [id = 20] 13:45:53 INFO - ++DOMWINDOW == 33 (0x7f4b0ac0ac00) [pid = 2212] [serial = 50] [outer = (nil)] 13:45:53 INFO - ++DOMWINDOW == 34 (0x7f4b0c1ac000) [pid = 2212] [serial = 51] [outer = 0x7f4b0ac0ac00] 13:45:53 INFO - ++DOMWINDOW == 35 (0x7f4b0c8ee800) [pid = 2212] [serial = 52] [outer = 0x7f4b0ac0ac00] 13:45:54 INFO - ++DOCSHELL 0x7f4b129a7000 == 15 [pid = 2212] [id = 21] 13:45:54 INFO - ++DOMWINDOW == 36 (0x7f4b11db2400) [pid = 2212] [serial = 53] [outer = (nil)] 13:45:54 INFO - ++DOMWINDOW == 37 (0x7f4b11db9400) [pid = 2212] [serial = 54] [outer = 0x7f4b11db2400] 13:45:56 INFO - ++DOMWINDOW == 38 (0x7f4b124c2000) [pid = 2212] [serial = 55] [outer = 0x7f4b0a046000] 13:45:56 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:45:57 INFO - --DOCSHELL 0x7f4b07d8b800 == 14 [pid = 2212] [id = 14] 13:45:57 INFO - --DOCSHELL 0x7f4b0c397000 == 13 [pid = 2212] [id = 16] 13:45:57 INFO - --DOCSHELL 0x7f4b0c838800 == 12 [pid = 2212] [id = 15] 13:45:57 INFO - --DOCSHELL 0x7f4b0c392800 == 11 [pid = 2212] [id = 20] 13:45:57 INFO - --DOCSHELL 0x7f4b129a7000 == 10 [pid = 2212] [id = 21] 13:45:57 INFO - --DOMWINDOW == 37 (0x7f4b14052000) [pid = 2212] [serial = 25] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:45:57 INFO - --DOMWINDOW == 36 (0x7f4b17230800) [pid = 2212] [serial = 27] [outer = (nil)] [url = about:blank] 13:45:57 INFO - --DOMWINDOW == 35 (0x7f4b09e54000) [pid = 2212] [serial = 35] [outer = (nil)] [url = about:blank] 13:45:57 INFO - --DOMWINDOW == 34 (0x7f4b0a665400) [pid = 2212] [serial = 48] [outer = (nil)] [url = about:blank] 13:45:57 INFO - --DOMWINDOW == 33 (0x7f4b0c1ac000) [pid = 2212] [serial = 51] [outer = (nil)] [url = about:blank] 13:45:57 INFO - --DOMWINDOW == 32 (0x7f4b0a860800) [pid = 2212] [serial = 39] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:45:57 INFO - --DOMWINDOW == 31 (0x7f4b12099c00) [pid = 2212] [serial = 42] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:45:57 INFO - --DOMWINDOW == 30 (0x7f4b09580800) [pid = 2212] [serial = 34] [outer = (nil)] [url = about:blank] 13:45:57 INFO - --DOMWINDOW == 29 (0x7f4b09e60000) [pid = 2212] [serial = 36] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:45:57 INFO - --DOMWINDOW == 28 (0x7f4b0a9cf800) [pid = 2212] [serial = 38] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:45:57 INFO - --DOMWINDOW == 27 (0x7f4b087e9000) [pid = 2212] [serial = 44] [outer = (nil)] [url = http://example.org/browser/devtools/client/webconsole/test/test-console.html] 13:45:58 INFO - MEMORY STAT | vsize 1063MB | residentFast 275MB | heapAllocated 93MB 13:45:58 INFO - 70 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_638949_copy_link_location.js | took 5007ms 13:45:58 INFO - ++DOCSHELL 0x7f4b0c396000 == 11 [pid = 2212] [id = 22] 13:45:58 INFO - ++DOMWINDOW == 28 (0x7f4b09621800) [pid = 2212] [serial = 56] [outer = (nil)] 13:45:58 INFO - ++DOMWINDOW == 29 (0x7f4b09bc0400) [pid = 2212] [serial = 57] [outer = 0x7f4b09621800] 13:45:58 INFO - 71 INFO TEST-START | devtools/client/webconsole/test/browser_bug_862916_console_dir_and_filter_off.js 13:45:58 INFO - ++DOCSHELL 0x7f4b0c83e000 == 12 [pid = 2212] [id = 23] 13:45:58 INFO - ++DOMWINDOW == 30 (0x7f4b0a666c00) [pid = 2212] [serial = 58] [outer = (nil)] 13:45:58 INFO - ++DOMWINDOW == 31 (0x7f4b0a66a400) [pid = 2212] [serial = 59] [outer = 0x7f4b0a666c00] 13:45:58 INFO - ++DOCSHELL 0x7f4b07d89800 == 13 [pid = 2212] [id = 24] 13:45:58 INFO - ++DOMWINDOW == 32 (0x7f4b0a045000) [pid = 2212] [serial = 60] [outer = (nil)] 13:45:58 INFO - ++DOMWINDOW == 33 (0x7f4b0a9dbc00) [pid = 2212] [serial = 61] [outer = 0x7f4b0a045000] 13:45:58 INFO - ++DOMWINDOW == 34 (0x7f4b0c4e4000) [pid = 2212] [serial = 62] [outer = 0x7f4b0a045000] 13:45:59 INFO - ++DOCSHELL 0x7f4b12413000 == 14 [pid = 2212] [id = 25] 13:45:59 INFO - ++DOMWINDOW == 35 (0x7f4b0f98bc00) [pid = 2212] [serial = 63] [outer = (nil)] 13:45:59 INFO - ++DOMWINDOW == 36 (0x7f4b0f98cc00) [pid = 2212] [serial = 64] [outer = 0x7f4b0f98bc00] 13:46:00 INFO - DevToolsUtils.dbg_assert is deprecated! Use DevToolsUtils.assert instead! 13:46:00 INFO - dbg_assert@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:449:13 13:46:00 INFO - ObjectActor@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/object.js:57:1 13:46:00 INFO - WCA_objectGrip@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:451:17 13:46:00 INFO - createValueGrip@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/object.js:1913:1 13:46:00 INFO - WCA_createValueGrip@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:410:12 13:46:00 INFO - WCA_prepareConsoleMessageForRemote/result.arguments<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1546:14 13:46:00 INFO - WCA_prepareConsoleMessageForRemote@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1544:24 13:46:00 INFO - WCA_onConsoleAPICall@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1352:16 13:46:00 INFO - CAL_observe@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/utils.js:977:5 13:46:00 INFO - CS_recordEvent@resource://gre/components/ConsoleAPIStorage.js:137:5 13:46:00 INFO - @debugger eval code:1:31 13:46:00 INFO - WCA_evalWithDebugger@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1231:16 13:46:00 INFO - WCA_onEvaluateJS@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:832:20 13:46:00 INFO - WCA_onEvaluateJSAsync@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:802:20 13:46:00 INFO - DSC_onPacket@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/main.js:1606:15 13:46:00 INFO - LocalDebuggerTransport.prototype.send/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/transport/transport.js:569:11 13:46:00 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 13:46:00 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 13:46:00 INFO - console.warn: DevToolsUtils.dbg_assert is deprecated! Use DevToolsUtils.assert instead! 13:46:00 INFO - dbg_assert@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:449:13 13:46:00 INFO - ObjectActor@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/object.js:57:1 13:46:00 INFO - WCA_objectGrip@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:451:17 13:46:00 INFO - createValueGrip@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/object.js:1913:1 13:46:00 INFO - WCA_createValueGrip@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:410:12 13:46:00 INFO - WCA_prepareConsoleMessageForRemote/result.arguments<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1546:14 13:46:00 INFO - WCA_prepareConsoleMessageForRemote@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1544:24 13:46:00 INFO - WCA_onConsoleAPICall@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1352:16 13:46:00 INFO - CAL_observe@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/utils.js:977:5 13:46:00 INFO - CS_recordEvent@resource://gre/components/ConsoleAPIStorage.js:137:5 13:46:00 INFO - @debugger eval code:1:31 13:46:00 INFO - WCA_evalWithDebugger@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:1231:16 13:46:00 INFO - WCA_onEvaluateJS@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:832:20 13:46:00 INFO - WCA_onEvaluateJSAsync@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:802:20 13:46:00 INFO - DSC_onPacket@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/main.js:1606:15 13:46:00 INFO - LocalDebuggerTransport.prototype.send/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/transport/transport.js:569:11 13:46:00 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 13:46:00 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 13:46:00 INFO - ++DOCSHELL 0x7f4b12a20800 == 15 [pid = 2212] [id = 26] 13:46:00 INFO - ++DOMWINDOW == 37 (0x7f4b14477800) [pid = 2212] [serial = 65] [outer = (nil)] 13:46:00 INFO - ++DOMWINDOW == 38 (0x7f4b14881c00) [pid = 2212] [serial = 66] [outer = 0x7f4b14477800] 13:46:01 INFO - [2212] WARNING: NS_ENSURE_SUCCESS(rv, nullptr) failed with result 0x80570027: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/js/xpconnect/wrappers/WrapperFactory.cpp, line 274 13:46:02 INFO - [2212] WARNING: CacheStorage not supported on untrusted origins.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/cache/CacheStorage.cpp, line 173 13:46:02 INFO - [2212] WARNING: IndexedDB is not permitted in a third-party window.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/indexedDB/IDBFactory.cpp, line 142 13:46:09 INFO - --DOCSHELL 0x7f4b12a20800 == 14 [pid = 2212] [id = 26] 13:46:12 INFO - --DOCSHELL 0x7f4b07c59800 == 13 [pid = 2212] [id = 18] 13:46:12 INFO - --DOCSHELL 0x7f4b0f7b1000 == 12 [pid = 2212] [id = 19] 13:46:12 INFO - --DOCSHELL 0x7f4b07d89800 == 11 [pid = 2212] [id = 24] 13:46:12 INFO - --DOCSHELL 0x7f4b12413000 == 10 [pid = 2212] [id = 25] 13:46:12 INFO - --DOMWINDOW == 37 (0x7f4b0c8f9000) [pid = 2212] [serial = 41] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:46:12 INFO - --DOMWINDOW == 36 (0x7f4b120a1c00) [pid = 2212] [serial = 43] [outer = (nil)] [url = about:blank] 13:46:12 INFO - --DOMWINDOW == 35 (0x7f4b0a9ce400) [pid = 2212] [serial = 49] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?_date=1446846353155] 13:46:12 INFO - --DOMWINDOW == 34 (0x7f4b09bb6c00) [pid = 2212] [serial = 46] [outer = (nil)] [url = about:blank] 13:46:12 INFO - --DOMWINDOW == 33 (0x7f4b0a9dbc00) [pid = 2212] [serial = 61] [outer = (nil)] [url = about:blank] 13:46:12 INFO - --DOMWINDOW == 32 (0x7f4b0ac0ac00) [pid = 2212] [serial = 50] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:46:12 INFO - --DOMWINDOW == 31 (0x7f4b11db2400) [pid = 2212] [serial = 53] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:46:12 INFO - --DOMWINDOW == 30 (0x7f4b09583800) [pid = 2212] [serial = 45] [outer = (nil)] [url = about:blank] 13:46:12 INFO - --DOMWINDOW == 29 (0x7f4b0a046000) [pid = 2212] [serial = 47] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?_date=1446846353155] 13:46:12 INFO - --DOMWINDOW == 28 (0x7f4b124c2000) [pid = 2212] [serial = 55] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?_date=1446846353155] 13:46:12 INFO - MEMORY STAT | vsize 1079MB | residentFast 295MB | heapAllocated 102MB 13:46:12 INFO - 72 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_862916_console_dir_and_filter_off.js | took 14262ms 13:46:12 INFO - ++DOCSHELL 0x7f4b0a7d2000 == 11 [pid = 2212] [id = 27] 13:46:12 INFO - ++DOMWINDOW == 29 (0x7f4b0a046800) [pid = 2212] [serial = 67] [outer = (nil)] 13:46:12 INFO - ++DOMWINDOW == 30 (0x7f4b0a669400) [pid = 2212] [serial = 68] [outer = 0x7f4b0a046800] 13:46:12 INFO - 73 INFO TEST-START | devtools/client/webconsole/test/browser_bug_865288_repeat_different_objects.js 13:46:12 INFO - ++DOCSHELL 0x7f4b0f7a0800 == 12 [pid = 2212] [id = 28] 13:46:12 INFO - ++DOMWINDOW == 31 (0x7f4b0c8f3800) [pid = 2212] [serial = 69] [outer = (nil)] 13:46:12 INFO - ++DOMWINDOW == 32 (0x7f4b0ca88000) [pid = 2212] [serial = 70] [outer = 0x7f4b0c8f3800] 13:46:13 INFO - ++DOMWINDOW == 33 (0x7f4b0f7dbc00) [pid = 2212] [serial = 71] [outer = 0x7f4b0c8f3800] 13:46:13 INFO - ++DOCSHELL 0x7f4b07d82000 == 13 [pid = 2212] [id = 29] 13:46:13 INFO - ++DOMWINDOW == 34 (0x7f4b11ee9000) [pid = 2212] [serial = 72] [outer = (nil)] 13:46:13 INFO - ++DOMWINDOW == 35 (0x7f4b1204c800) [pid = 2212] [serial = 73] [outer = 0x7f4b11ee9000] 13:46:13 INFO - ++DOMWINDOW == 36 (0x7f4b120a3400) [pid = 2212] [serial = 74] [outer = 0x7f4b11ee9000] 13:46:13 INFO - ++DOCSHELL 0x7f4b141f8000 == 14 [pid = 2212] [id = 30] 13:46:13 INFO - ++DOMWINDOW == 37 (0x7f4b12ab5000) [pid = 2212] [serial = 75] [outer = (nil)] 13:46:13 INFO - ++DOMWINDOW == 38 (0x7f4b12ab6000) [pid = 2212] [serial = 76] [outer = 0x7f4b12ab5000] 13:46:15 INFO - ++DOCSHELL 0x7f4b14955800 == 15 [pid = 2212] [id = 31] 13:46:15 INFO - ++DOMWINDOW == 39 (0x7f4b1300ec00) [pid = 2212] [serial = 77] [outer = (nil)] 13:46:15 INFO - ++DOMWINDOW == 40 (0x7f4b13fd2000) [pid = 2212] [serial = 78] [outer = 0x7f4b1300ec00] 13:46:17 INFO - --DOCSHELL 0x7f4b0c396000 == 14 [pid = 2212] [id = 22] 13:46:17 INFO - --DOCSHELL 0x7f4b07d82000 == 13 [pid = 2212] [id = 29] 13:46:17 INFO - --DOCSHELL 0x7f4b0c83e000 == 12 [pid = 2212] [id = 23] 13:46:17 INFO - --DOCSHELL 0x7f4b141f8000 == 11 [pid = 2212] [id = 30] 13:46:17 INFO - --DOCSHELL 0x7f4b14955800 == 10 [pid = 2212] [id = 31] 13:46:17 INFO - --DOMWINDOW == 39 (0x7f4b0c8ee800) [pid = 2212] [serial = 52] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:46:17 INFO - --DOMWINDOW == 38 (0x7f4b11db9400) [pid = 2212] [serial = 54] [outer = (nil)] [url = about:blank] 13:46:18 INFO - --DOMWINDOW == 37 (0x7f4b14477800) [pid = 2212] [serial = 65] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:46:18 INFO - --DOMWINDOW == 36 (0x7f4b0a045000) [pid = 2212] [serial = 60] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:46:18 INFO - --DOMWINDOW == 35 (0x7f4b0f98bc00) [pid = 2212] [serial = 63] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:46:18 INFO - --DOMWINDOW == 34 (0x7f4b0a666c00) [pid = 2212] [serial = 58] [outer = (nil)] [url = data:text/html;charset=utf8,

test%20for%20bug%20862916] 13:46:18 INFO - --DOMWINDOW == 33 (0x7f4b09621800) [pid = 2212] [serial = 56] [outer = (nil)] [url = about:blank] 13:46:18 INFO - --DOMWINDOW == 32 (0x7f4b09bc0400) [pid = 2212] [serial = 57] [outer = (nil)] [url = about:blank] 13:46:18 INFO - --DOMWINDOW == 31 (0x7f4b0ca88000) [pid = 2212] [serial = 70] [outer = (nil)] [url = about:blank] 13:46:18 INFO - --DOMWINDOW == 30 (0x7f4b1204c800) [pid = 2212] [serial = 73] [outer = (nil)] [url = about:blank] 13:46:18 INFO - MEMORY STAT | vsize 1078MB | residentFast 290MB | heapAllocated 100MB 13:46:18 INFO - 74 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_865288_repeat_different_objects.js | took 5474ms 13:46:18 INFO - ++DOCSHELL 0x7f4b0c38e000 == 11 [pid = 2212] [id = 32] 13:46:18 INFO - ++DOMWINDOW == 31 (0x7f4b09bc0c00) [pid = 2212] [serial = 79] [outer = (nil)] 13:46:18 INFO - ++DOMWINDOW == 32 (0x7f4b09e5c000) [pid = 2212] [serial = 80] [outer = 0x7f4b09bc0c00] 13:46:18 INFO - 75 INFO TEST-START | devtools/client/webconsole/test/browser_bug_865871_variables_view_close_on_esc_key.js 13:46:18 INFO - ++DOCSHELL 0x7f4b0f7b8000 == 12 [pid = 2212] [id = 33] 13:46:18 INFO - ++DOMWINDOW == 33 (0x7f4b09bb5000) [pid = 2212] [serial = 81] [outer = (nil)] 13:46:18 INFO - ++DOMWINDOW == 34 (0x7f4b0a861000) [pid = 2212] [serial = 82] [outer = 0x7f4b09bb5000] 13:46:18 INFO - ++DOMWINDOW == 35 (0x7f4b0ab80000) [pid = 2212] [serial = 83] [outer = 0x7f4b09bb5000] 13:46:19 INFO - ++DOCSHELL 0x7f4b0c841800 == 13 [pid = 2212] [id = 34] 13:46:19 INFO - ++DOMWINDOW == 36 (0x7f4b0c4e2400) [pid = 2212] [serial = 84] [outer = (nil)] 13:46:19 INFO - ++DOMWINDOW == 37 (0x7f4b0c4e4800) [pid = 2212] [serial = 85] [outer = 0x7f4b0c4e2400] 13:46:19 INFO - ++DOMWINDOW == 38 (0x7f4b0ca84400) [pid = 2212] [serial = 86] [outer = 0x7f4b0c4e2400] 13:46:19 INFO - ++DOCSHELL 0x7f4b12071000 == 14 [pid = 2212] [id = 35] 13:46:19 INFO - ++DOMWINDOW == 39 (0x7f4b0f97f400) [pid = 2212] [serial = 87] [outer = (nil)] 13:46:19 INFO - ++DOMWINDOW == 40 (0x7f4b0f988400) [pid = 2212] [serial = 88] [outer = 0x7f4b0f97f400] 13:46:21 INFO - ++DOCSHELL 0x7f4b141f6800 == 15 [pid = 2212] [id = 36] 13:46:21 INFO - ++DOMWINDOW == 41 (0x7f4b12e39c00) [pid = 2212] [serial = 89] [outer = (nil)] 13:46:21 INFO - ++DOMWINDOW == 42 (0x7f4b09bb5400) [pid = 2212] [serial = 90] [outer = 0x7f4b12e39c00] 13:46:21 INFO - ++DOCSHELL 0x7f4b0a7cb000 == 16 [pid = 2212] [id = 37] 13:46:21 INFO - ++DOMWINDOW == 43 (0x7f4b07d5b800) [pid = 2212] [serial = 91] [outer = (nil)] 13:46:21 INFO - ++DOMWINDOW == 44 (0x7f4b099c0400) [pid = 2212] [serial = 92] [outer = 0x7f4b07d5b800] 13:46:23 INFO - --DOCSHELL 0x7f4b0f7a0800 == 15 [pid = 2212] [id = 28] 13:46:23 INFO - --DOCSHELL 0x7f4b0a7d2000 == 14 [pid = 2212] [id = 27] 13:46:23 INFO - --DOCSHELL 0x7f4b0c841800 == 13 [pid = 2212] [id = 34] 13:46:23 INFO - --DOCSHELL 0x7f4b12071000 == 12 [pid = 2212] [id = 35] 13:46:23 INFO - --DOCSHELL 0x7f4b141f6800 == 11 [pid = 2212] [id = 36] 13:46:23 INFO - --DOCSHELL 0x7f4b0a7cb000 == 10 [pid = 2212] [id = 37] 13:46:23 INFO - --DOMWINDOW == 43 (0x7f4b0a66a400) [pid = 2212] [serial = 59] [outer = (nil)] [url = about:blank] 13:46:23 INFO - --DOMWINDOW == 42 (0x7f4b0c4e4000) [pid = 2212] [serial = 62] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:46:23 INFO - --DOMWINDOW == 41 (0x7f4b0f98cc00) [pid = 2212] [serial = 64] [outer = (nil)] [url = about:blank] 13:46:23 INFO - --DOMWINDOW == 40 (0x7f4b14881c00) [pid = 2212] [serial = 66] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:46:24 INFO - --DOMWINDOW == 39 (0x7f4b12e39c00) [pid = 2212] [serial = 89] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:46:24 INFO - --DOMWINDOW == 38 (0x7f4b0a669400) [pid = 2212] [serial = 68] [outer = (nil)] [url = about:blank] 13:46:24 INFO - --DOMWINDOW == 37 (0x7f4b0a861000) [pid = 2212] [serial = 82] [outer = (nil)] [url = about:blank] 13:46:24 INFO - --DOMWINDOW == 36 (0x7f4b0c4e4800) [pid = 2212] [serial = 85] [outer = (nil)] [url = about:blank] 13:46:24 INFO - --DOMWINDOW == 35 (0x7f4b11ee9000) [pid = 2212] [serial = 72] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:46:24 INFO - --DOMWINDOW == 34 (0x7f4b12ab5000) [pid = 2212] [serial = 75] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:46:24 INFO - --DOMWINDOW == 33 (0x7f4b0a046800) [pid = 2212] [serial = 67] [outer = (nil)] [url = about:blank] 13:46:24 INFO - --DOMWINDOW == 32 (0x7f4b0c8f3800) [pid = 2212] [serial = 69] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-repeated-messages.html] 13:46:24 INFO - --DOMWINDOW == 31 (0x7f4b1300ec00) [pid = 2212] [serial = 77] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:46:24 INFO - --DOMWINDOW == 30 (0x7f4b0f7dbc00) [pid = 2212] [serial = 71] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-repeated-messages.html] 13:46:24 INFO - MEMORY STAT | vsize 1063MB | residentFast 269MB | heapAllocated 93MB 13:46:24 INFO - 76 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_865871_variables_view_close_on_esc_key.js | took 5729ms 13:46:24 INFO - ++DOCSHELL 0x7f4b0a7d2800 == 11 [pid = 2212] [id = 38] 13:46:24 INFO - ++DOMWINDOW == 31 (0x7f4b09625c00) [pid = 2212] [serial = 93] [outer = (nil)] 13:46:24 INFO - ++DOMWINDOW == 32 (0x7f4b09bbdc00) [pid = 2212] [serial = 94] [outer = 0x7f4b09625c00] 13:46:24 INFO - 77 INFO TEST-START | devtools/client/webconsole/test/browser_bug_869003_inspect_cross_domain_object.js 13:46:24 INFO - ++DOCSHELL 0x7f4b0c665800 == 12 [pid = 2212] [id = 39] 13:46:24 INFO - ++DOMWINDOW == 33 (0x7f4b0a668400) [pid = 2212] [serial = 95] [outer = (nil)] 13:46:24 INFO - ++DOMWINDOW == 34 (0x7f4b0a66bc00) [pid = 2212] [serial = 96] [outer = 0x7f4b0a668400] 13:46:24 INFO - ++DOCSHELL 0x7f4b07d9a800 == 13 [pid = 2212] [id = 40] 13:46:24 INFO - ++DOMWINDOW == 35 (0x7f4b0a860800) [pid = 2212] [serial = 97] [outer = (nil)] 13:46:24 INFO - ++DOMWINDOW == 36 (0x7f4b0c1a8800) [pid = 2212] [serial = 98] [outer = 0x7f4b0a860800] 13:46:25 INFO - ++DOMWINDOW == 37 (0x7f4b0ca81c00) [pid = 2212] [serial = 99] [outer = 0x7f4b0a860800] 13:46:25 INFO - ++DOCSHELL 0x7f4b12071000 == 14 [pid = 2212] [id = 41] 13:46:25 INFO - ++DOMWINDOW == 38 (0x7f4b0f98cc00) [pid = 2212] [serial = 100] [outer = (nil)] 13:46:25 INFO - ++DOMWINDOW == 39 (0x7f4b0f98dc00) [pid = 2212] [serial = 101] [outer = 0x7f4b0f98cc00] 13:46:27 INFO - ++DOMWINDOW == 40 (0x7f4b0f710800) [pid = 2212] [serial = 102] [outer = 0x7f4b0a668400] 13:46:27 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:46:27 INFO - ++DOCSHELL 0x7f4b116d1800 == 15 [pid = 2212] [id = 42] 13:46:27 INFO - ++DOMWINDOW == 41 (0x7f4b0a863c00) [pid = 2212] [serial = 103] [outer = (nil)] 13:46:27 INFO - ++DOMWINDOW == 42 (0x7f4b1214b400) [pid = 2212] [serial = 104] [outer = 0x7f4b0a863c00] 13:46:27 INFO - ++DOMWINDOW == 43 (0x7f4b12973c00) [pid = 2212] [serial = 105] [outer = 0x7f4b0a863c00] 13:46:27 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:46:28 INFO - ++DOCSHELL 0x7f4b0a7d3000 == 16 [pid = 2212] [id = 43] 13:46:28 INFO - ++DOMWINDOW == 44 (0x7f4b09584400) [pid = 2212] [serial = 106] [outer = (nil)] 13:46:28 INFO - ++DOMWINDOW == 45 (0x7f4b09bb6000) [pid = 2212] [serial = 107] [outer = 0x7f4b09584400] 13:46:29 INFO - --DOCSHELL 0x7f4b07d9a800 == 15 [pid = 2212] [id = 40] 13:46:29 INFO - --DOCSHELL 0x7f4b12071000 == 14 [pid = 2212] [id = 41] 13:46:29 INFO - --DOCSHELL 0x7f4b0a7d3000 == 13 [pid = 2212] [id = 43] 13:46:29 INFO - --DOCSHELL 0x7f4b0f7b8000 == 12 [pid = 2212] [id = 33] 13:46:29 INFO - --DOCSHELL 0x7f4b0c38e000 == 11 [pid = 2212] [id = 32] 13:46:30 INFO - --DOMWINDOW == 44 (0x7f4b09bb5400) [pid = 2212] [serial = 90] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:46:30 INFO - --DOMWINDOW == 43 (0x7f4b120a3400) [pid = 2212] [serial = 74] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:46:30 INFO - --DOMWINDOW == 42 (0x7f4b12ab6000) [pid = 2212] [serial = 76] [outer = (nil)] [url = about:blank] 13:46:30 INFO - --DOMWINDOW == 41 (0x7f4b13fd2000) [pid = 2212] [serial = 78] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:46:30 INFO - --DOMWINDOW == 40 (0x7f4b1214b400) [pid = 2212] [serial = 104] [outer = (nil)] [url = about:blank] 13:46:30 INFO - --DOMWINDOW == 39 (0x7f4b09e5c000) [pid = 2212] [serial = 80] [outer = (nil)] [url = about:blank] 13:46:30 INFO - --DOMWINDOW == 38 (0x7f4b0c1a8800) [pid = 2212] [serial = 98] [outer = (nil)] [url = about:blank] 13:46:30 INFO - --DOMWINDOW == 37 (0x7f4b0f97f400) [pid = 2212] [serial = 87] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:46:30 INFO - --DOMWINDOW == 36 (0x7f4b0c4e2400) [pid = 2212] [serial = 84] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:46:30 INFO - --DOMWINDOW == 35 (0x7f4b09bc0c00) [pid = 2212] [serial = 79] [outer = (nil)] [url = about:blank] 13:46:30 INFO - --DOMWINDOW == 34 (0x7f4b09bb5000) [pid = 2212] [serial = 81] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 13:46:30 INFO - --DOMWINDOW == 33 (0x7f4b07d5b800) [pid = 2212] [serial = 91] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:46:30 INFO - --DOCSHELL 0x7f4b116d1800 == 10 [pid = 2212] [id = 42] 13:46:30 INFO - --DOMWINDOW == 32 (0x7f4b0ab80000) [pid = 2212] [serial = 83] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 13:46:30 INFO - MEMORY STAT | vsize 1064MB | residentFast 267MB | heapAllocated 93MB 13:46:30 INFO - 78 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_869003_inspect_cross_domain_object.js | took 6089ms 13:46:30 INFO - ++DOCSHELL 0x7f4b094a1800 == 11 [pid = 2212] [id = 44] 13:46:30 INFO - ++DOMWINDOW == 33 (0x7f4b0a668800) [pid = 2212] [serial = 108] [outer = (nil)] 13:46:30 INFO - ++DOMWINDOW == 34 (0x7f4b0a85f000) [pid = 2212] [serial = 109] [outer = 0x7f4b0a668800] 13:46:30 INFO - 79 INFO TEST-START | devtools/client/webconsole/test/browser_bug_871156_ctrlw_close_tab.js 13:46:30 INFO - ++DOCSHELL 0x7f4b116e5800 == 12 [pid = 2212] [id = 45] 13:46:30 INFO - ++DOMWINDOW == 35 (0x7f4b0c1ab000) [pid = 2212] [serial = 110] [outer = (nil)] 13:46:30 INFO - ++DOMWINDOW == 36 (0x7f4b0c4e0800) [pid = 2212] [serial = 111] [outer = 0x7f4b0c1ab000] 13:46:31 INFO - ++DOCSHELL 0x7f4b116e2800 == 13 [pid = 2212] [id = 46] 13:46:31 INFO - ++DOMWINDOW == 37 (0x7f4b0c4e2c00) [pid = 2212] [serial = 112] [outer = (nil)] 13:46:31 INFO - ++DOMWINDOW == 38 (0x7f4b0f97f400) [pid = 2212] [serial = 113] [outer = 0x7f4b0c4e2c00] 13:46:31 INFO - ++DOMWINDOW == 39 (0x7f4b11db1c00) [pid = 2212] [serial = 114] [outer = 0x7f4b0c4e2c00] 13:46:31 INFO - ++DOCSHELL 0x7f4b13255800 == 14 [pid = 2212] [id = 47] 13:46:31 INFO - ++DOMWINDOW == 40 (0x7f4b126e1400) [pid = 2212] [serial = 115] [outer = (nil)] 13:46:31 INFO - ++DOMWINDOW == 41 (0x7f4b126e4000) [pid = 2212] [serial = 116] [outer = 0x7f4b126e1400] 13:46:34 INFO - --DOCSHELL 0x7f4b0c665800 == 13 [pid = 2212] [id = 39] 13:46:34 INFO - --DOCSHELL 0x7f4b0a7d2800 == 12 [pid = 2212] [id = 38] 13:46:34 INFO - --DOCSHELL 0x7f4b13255800 == 11 [pid = 2212] [id = 47] 13:46:34 INFO - --DOMWINDOW == 40 (0x7f4b099c0400) [pid = 2212] [serial = 92] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:46:34 INFO - --DOMWINDOW == 39 (0x7f4b0ca84400) [pid = 2212] [serial = 86] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:46:34 INFO - --DOMWINDOW == 38 (0x7f4b0f988400) [pid = 2212] [serial = 88] [outer = (nil)] [url = about:blank] 13:46:34 INFO - --DOMWINDOW == 37 (0x7f4b0c4e0800) [pid = 2212] [serial = 111] [outer = (nil)] [url = about:blank] 13:46:34 INFO - --DOMWINDOW == 36 (0x7f4b0c1ab000) [pid = 2212] [serial = 110] [outer = (nil)] [url = data:text/html;charset=utf8,bug871156

hello%20world] 13:46:34 INFO - --DOMWINDOW == 35 (0x7f4b0f97f400) [pid = 2212] [serial = 113] [outer = (nil)] [url = about:blank] 13:46:34 INFO - --DOMWINDOW == 34 (0x7f4b09bbdc00) [pid = 2212] [serial = 94] [outer = (nil)] [url = about:blank] 13:46:34 INFO - --DOMWINDOW == 33 (0x7f4b0a66bc00) [pid = 2212] [serial = 96] [outer = (nil)] [url = about:blank] 13:46:34 INFO - --DOMWINDOW == 32 (0x7f4b0f98cc00) [pid = 2212] [serial = 100] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:46:34 INFO - --DOMWINDOW == 31 (0x7f4b09584400) [pid = 2212] [serial = 106] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:46:34 INFO - --DOMWINDOW == 30 (0x7f4b0a860800) [pid = 2212] [serial = 97] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:46:34 INFO - --DOMWINDOW == 29 (0x7f4b09625c00) [pid = 2212] [serial = 93] [outer = (nil)] [url = about:blank] 13:46:34 INFO - --DOMWINDOW == 28 (0x7f4b0a668400) [pid = 2212] [serial = 95] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-869003-top-window.html] 13:46:34 INFO - --DOMWINDOW == 27 (0x7f4b0a863c00) [pid = 2212] [serial = 103] [outer = (nil)] [url = http://example.org/browser/devtools/client/webconsole/test/test-bug-869003-iframe.html] 13:46:34 INFO - --DOMWINDOW == 26 (0x7f4b0f710800) [pid = 2212] [serial = 102] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-869003-top-window.html] 13:46:34 INFO - --DOMWINDOW == 25 (0x7f4b12973c00) [pid = 2212] [serial = 105] [outer = (nil)] [url = http://example.org/browser/devtools/client/webconsole/test/test-bug-869003-iframe.html] 13:46:34 INFO - ++DOCSHELL 0x7f4b0c396000 == 12 [pid = 2212] [id = 48] 13:46:34 INFO - ++DOMWINDOW == 26 (0x7f4b09bc0400) [pid = 2212] [serial = 117] [outer = (nil)] 13:46:34 INFO - ++DOMWINDOW == 27 (0x7f4b09bc2000) [pid = 2212] [serial = 118] [outer = 0x7f4b09bc0400] 13:46:35 INFO - MEMORY STAT | vsize 1065MB | residentFast 267MB | heapAllocated 95MB 13:46:35 INFO - 80 INFO TEST-OK | devtools/client/webconsole/test/browser_bug_871156_ctrlw_close_tab.js | took 5060ms 13:46:36 INFO - ++DOCSHELL 0x7f4b12e58800 == 13 [pid = 2212] [id = 49] 13:46:36 INFO - ++DOMWINDOW == 28 (0x7f4b0c4e5c00) [pid = 2212] [serial = 119] [outer = (nil)] 13:46:36 INFO - ++DOMWINDOW == 29 (0x7f4b11db0400) [pid = 2212] [serial = 120] [outer = 0x7f4b0c4e5c00] 13:46:36 INFO - 81 INFO TEST-START | devtools/client/webconsole/test/browser_cached_messages.js 13:46:36 INFO - ++DOCSHELL 0x7f4b0c83e000 == 14 [pid = 2212] [id = 50] 13:46:36 INFO - ++DOMWINDOW == 30 (0x7f4b1260fc00) [pid = 2212] [serial = 121] [outer = (nil)] 13:46:36 INFO - ++DOMWINDOW == 31 (0x7f4b126e1c00) [pid = 2212] [serial = 122] [outer = 0x7f4b1260fc00] 13:46:36 INFO - ++DOMWINDOW == 32 (0x7f4b12973c00) [pid = 2212] [serial = 123] [outer = 0x7f4b1260fc00] 13:46:36 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-webconsole-error-observer.html, line 15: TypeError: foo.bazBug611032 is not a function 13:46:36 INFO - ++DOCSHELL 0x7f4b0f7b7000 == 15 [pid = 2212] [id = 51] 13:46:36 INFO - ++DOMWINDOW == 33 (0x7f4b143f0400) [pid = 2212] [serial = 124] [outer = (nil)] 13:46:36 INFO - ++DOMWINDOW == 34 (0x7f4b14506c00) [pid = 2212] [serial = 125] [outer = 0x7f4b143f0400] 13:46:37 INFO - ++DOMWINDOW == 35 (0x7f4b12f23000) [pid = 2212] [serial = 126] [outer = 0x7f4b143f0400] 13:46:37 INFO - ++DOCSHELL 0x7f4b19758800 == 16 [pid = 2212] [id = 52] 13:46:37 INFO - ++DOMWINDOW == 36 (0x7f4b20045800) [pid = 2212] [serial = 127] [outer = (nil)] 13:46:37 INFO - ++DOMWINDOW == 37 (0x7f4b2004e000) [pid = 2212] [serial = 128] [outer = 0x7f4b20045800] 13:46:40 INFO - --DOCSHELL 0x7f4b0c396000 == 15 [pid = 2212] [id = 48] 13:46:40 INFO - --DOCSHELL 0x7f4b116e2800 == 14 [pid = 2212] [id = 46] 13:46:40 INFO - --DOCSHELL 0x7f4b116e5800 == 13 [pid = 2212] [id = 45] 13:46:40 INFO - --DOCSHELL 0x7f4b19758800 == 12 [pid = 2212] [id = 52] 13:46:40 INFO - --DOCSHELL 0x7f4b094a1800 == 11 [pid = 2212] [id = 44] 13:46:40 INFO - --DOMWINDOW == 36 (0x7f4b09bb6000) [pid = 2212] [serial = 107] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:46:40 INFO - --DOMWINDOW == 35 (0x7f4b0f98dc00) [pid = 2212] [serial = 101] [outer = (nil)] [url = about:blank] 13:46:40 INFO - --DOMWINDOW == 34 (0x7f4b0ca81c00) [pid = 2212] [serial = 99] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:46:40 INFO - --DOMWINDOW == 33 (0x7f4b0a85f000) [pid = 2212] [serial = 109] [outer = (nil)] [url = about:blank] 13:46:40 INFO - --DOMWINDOW == 32 (0x7f4b126e1c00) [pid = 2212] [serial = 122] [outer = (nil)] [url = about:blank] 13:46:40 INFO - --DOMWINDOW == 31 (0x7f4b14506c00) [pid = 2212] [serial = 125] [outer = (nil)] [url = about:blank] 13:46:40 INFO - --DOMWINDOW == 30 (0x7f4b09bc0400) [pid = 2212] [serial = 117] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:46:40 INFO - --DOMWINDOW == 29 (0x7f4b0c4e2c00) [pid = 2212] [serial = 112] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:46:40 INFO - --DOMWINDOW == 28 (0x7f4b126e1400) [pid = 2212] [serial = 115] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:46:40 INFO - --DOMWINDOW == 27 (0x7f4b0a668800) [pid = 2212] [serial = 108] [outer = (nil)] [url = about:blank] 13:46:40 INFO - ++DOCSHELL 0x7f4b09499800 == 12 [pid = 2212] [id = 53] 13:46:40 INFO - ++DOMWINDOW == 28 (0x7f4b09532c00) [pid = 2212] [serial = 129] [outer = (nil)] 13:46:40 INFO - ++DOMWINDOW == 29 (0x7f4b09589c00) [pid = 2212] [serial = 130] [outer = 0x7f4b09532c00] 13:46:40 INFO - ++DOMWINDOW == 30 (0x7f4b0a668800) [pid = 2212] [serial = 131] [outer = 0x7f4b09532c00] 13:46:40 INFO - ++DOCSHELL 0x7f4b116dc000 == 13 [pid = 2212] [id = 54] 13:46:40 INFO - ++DOMWINDOW == 31 (0x7f4b1209c400) [pid = 2212] [serial = 132] [outer = (nil)] 13:46:40 INFO - ++DOMWINDOW == 32 (0x7f4b120a3400) [pid = 2212] [serial = 133] [outer = 0x7f4b1209c400] 13:46:43 INFO - --DOCSHELL 0x7f4b116dc000 == 12 [pid = 2212] [id = 54] 13:46:43 INFO - --DOCSHELL 0x7f4b0f7b7000 == 11 [pid = 2212] [id = 51] 13:46:43 INFO - --DOMWINDOW == 31 (0x7f4b09bc2000) [pid = 2212] [serial = 118] [outer = (nil)] [url = about:blank] 13:46:43 INFO - --DOMWINDOW == 30 (0x7f4b126e4000) [pid = 2212] [serial = 116] [outer = (nil)] [url = about:blank] 13:46:43 INFO - --DOMWINDOW == 29 (0x7f4b11db1c00) [pid = 2212] [serial = 114] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:46:43 INFO - --DOMWINDOW == 28 (0x7f4b09589c00) [pid = 2212] [serial = 130] [outer = (nil)] [url = about:blank] 13:46:43 INFO - --DOMWINDOW == 27 (0x7f4b143f0400) [pid = 2212] [serial = 124] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:46:43 INFO - --DOMWINDOW == 26 (0x7f4b20045800) [pid = 2212] [serial = 127] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:46:43 INFO - MEMORY STAT | vsize 1065MB | residentFast 267MB | heapAllocated 95MB 13:46:43 INFO - 82 INFO TEST-OK | devtools/client/webconsole/test/browser_cached_messages.js | took 7649ms 13:46:43 INFO - ++DOCSHELL 0x7f4b0c390800 == 12 [pid = 2212] [id = 55] 13:46:43 INFO - ++DOMWINDOW == 27 (0x7f4b09bbf000) [pid = 2212] [serial = 134] [outer = (nil)] 13:46:43 INFO - ++DOMWINDOW == 28 (0x7f4b0a65f000) [pid = 2212] [serial = 135] [outer = 0x7f4b09bbf000] 13:46:44 INFO - 83 INFO TEST-START | devtools/client/webconsole/test/browser_console.js 13:46:44 INFO - ++DOCSHELL 0x7f4b0f9b3000 == 13 [pid = 2212] [id = 56] 13:46:44 INFO - ++DOMWINDOW == 29 (0x7f4b0ac07c00) [pid = 2212] [serial = 136] [outer = (nil)] 13:46:44 INFO - ++DOMWINDOW == 30 (0x7f4b0c4e2c00) [pid = 2212] [serial = 137] [outer = 0x7f4b0ac07c00] 13:46:44 INFO - ++DOMWINDOW == 31 (0x7f4b0f987800) [pid = 2212] [serial = 138] [outer = 0x7f4b0ac07c00] 13:46:44 INFO - ++DOCSHELL 0x7f4b12e63800 == 14 [pid = 2212] [id = 57] 13:46:44 INFO - ++DOMWINDOW == 32 (0x7f4b12bcc800) [pid = 2212] [serial = 139] [outer = (nil)] 13:46:44 INFO - ++DOMWINDOW == 33 (0x7f4b12bd0000) [pid = 2212] [serial = 140] [outer = 0x7f4b12bcc800] 13:46:46 INFO - JavaScript error: chrome://mochitests/content/browser/devtools/client/webconsole/test/browser_console.js, line 38: ReferenceError: foobarExceptionBug587757 is not defined 13:46:46 INFO - console.log: xhr loaded, status is: 200 13:46:46 INFO - console.log: xhr error loaded, status is: 404 13:46:47 INFO - MEMORY STAT | vsize 1068MB | residentFast 272MB | heapAllocated 101MB 13:46:47 INFO - 84 INFO TEST-OK | devtools/client/webconsole/test/browser_console.js | took 3249ms 13:46:47 INFO - ++DOCSHELL 0x7f4b14c37800 == 15 [pid = 2212] [id = 58] 13:46:47 INFO - ++DOMWINDOW == 34 (0x7f4b123c6c00) [pid = 2212] [serial = 141] [outer = (nil)] 13:46:47 INFO - ++DOMWINDOW == 35 (0x7f4b12bd1800) [pid = 2212] [serial = 142] [outer = 0x7f4b123c6c00] 13:46:47 INFO - 85 INFO TEST-START | devtools/client/webconsole/test/browser_console_addonsdk_loader_exception.js 13:46:47 INFO - ++DOCSHELL 0x7f4b094a2800 == 16 [pid = 2212] [id = 59] 13:46:47 INFO - ++DOMWINDOW == 36 (0x7f4b09584400) [pid = 2212] [serial = 143] [outer = (nil)] 13:46:48 INFO - ++DOMWINDOW == 37 (0x7f4b09bb4400) [pid = 2212] [serial = 144] [outer = 0x7f4b09584400] 13:46:48 INFO - ++DOCSHELL 0x7f4b0c3a4800 == 17 [pid = 2212] [id = 60] 13:46:48 INFO - ++DOMWINDOW == 38 (0x7f4b07d68c00) [pid = 2212] [serial = 145] [outer = (nil)] 13:46:48 INFO - ++DOMWINDOW == 39 (0x7f4b11dbb400) [pid = 2212] [serial = 146] [outer = 0x7f4b07d68c00] 13:46:49 INFO - ++DOMWINDOW == 40 (0x7f4b1487ac00) [pid = 2212] [serial = 147] [outer = 0x7f4b07d68c00] 13:46:49 INFO - ++DOCSHELL 0x7f4b20079800 == 18 [pid = 2212] [id = 61] 13:46:49 INFO - ++DOMWINDOW == 41 (0x7f4b09526800) [pid = 2212] [serial = 148] [outer = (nil)] 13:46:49 INFO - ++DOMWINDOW == 42 (0x7f4b20106000) [pid = 2212] [serial = 149] [outer = 0x7f4b09526800] 13:46:51 INFO - ++DOCSHELL 0x7f4b29c19800 == 19 [pid = 2212] [id = 62] 13:46:51 INFO - ++DOMWINDOW == 43 (0x7f4b2b050800) [pid = 2212] [serial = 150] [outer = (nil)] 13:46:51 INFO - ++DOMWINDOW == 44 (0x7f4b2b055000) [pid = 2212] [serial = 151] [outer = 0x7f4b2b050800] 13:46:51 INFO - JavaScript error: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/toolbox.js, line 199: TypeError: this._toolPanels is not iterable 13:46:53 INFO - --DOCSHELL 0x7f4b0c83e000 == 18 [pid = 2212] [id = 50] 13:46:53 INFO - --DOCSHELL 0x7f4b09499800 == 17 [pid = 2212] [id = 53] 13:46:53 INFO - --DOCSHELL 0x7f4b0c390800 == 16 [pid = 2212] [id = 55] 13:46:53 INFO - --DOCSHELL 0x7f4b0f9b3000 == 15 [pid = 2212] [id = 56] 13:46:53 INFO - --DOCSHELL 0x7f4b12e58800 == 14 [pid = 2212] [id = 49] 13:46:53 INFO - --DOCSHELL 0x7f4b12e63800 == 13 [pid = 2212] [id = 57] 13:46:53 INFO - --DOMWINDOW == 43 (0x7f4b12f23000) [pid = 2212] [serial = 126] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:46:53 INFO - --DOMWINDOW == 42 (0x7f4b2004e000) [pid = 2212] [serial = 128] [outer = (nil)] [url = about:blank] 13:46:53 INFO - --DOMWINDOW == 41 (0x7f4b1209c400) [pid = 2212] [serial = 132] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:46:53 INFO - --DOMWINDOW == 40 (0x7f4b09532c00) [pid = 2212] [serial = 129] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:46:53 INFO - --DOMWINDOW == 39 (0x7f4b0c4e5c00) [pid = 2212] [serial = 119] [outer = (nil)] [url = about:blank] 13:46:53 INFO - --DOMWINDOW == 38 (0x7f4b1260fc00) [pid = 2212] [serial = 121] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-webconsole-error-observer.html] 13:46:53 INFO - --DOMWINDOW == 37 (0x7f4b11dbb400) [pid = 2212] [serial = 146] [outer = (nil)] [url = about:blank] 13:46:53 INFO - --DOMWINDOW == 36 (0x7f4b0c4e2c00) [pid = 2212] [serial = 137] [outer = (nil)] [url = about:blank] 13:46:53 INFO - --DOMWINDOW == 35 (0x7f4b0ac07c00) [pid = 2212] [serial = 136] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?1446846404179] 13:46:53 INFO - --DOMWINDOW == 34 (0x7f4b09bbf000) [pid = 2212] [serial = 134] [outer = (nil)] [url = about:blank] 13:46:53 INFO - --DOMWINDOW == 33 (0x7f4b12bcc800) [pid = 2212] [serial = 139] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:46:53 INFO - --DOMWINDOW == 32 (0x7f4b0a65f000) [pid = 2212] [serial = 135] [outer = (nil)] [url = about:blank] 13:46:53 INFO - --DOMWINDOW == 31 (0x7f4b11db0400) [pid = 2212] [serial = 120] [outer = (nil)] [url = about:blank] 13:46:53 INFO - --DOMWINDOW == 30 (0x7f4b12973c00) [pid = 2212] [serial = 123] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-webconsole-error-observer.html] 13:46:54 INFO - MEMORY STAT | vsize 1068MB | residentFast 275MB | heapAllocated 97MB 13:46:54 INFO - 86 INFO TEST-OK | devtools/client/webconsole/test/browser_console_addonsdk_loader_exception.js | took 6210ms 13:46:54 INFO - ++DOCSHELL 0x7f4b0abd8000 == 14 [pid = 2212] [id = 63] 13:46:54 INFO - ++DOMWINDOW == 31 (0x7f4b09e60000) [pid = 2212] [serial = 152] [outer = (nil)] 13:46:54 INFO - ++DOMWINDOW == 32 (0x7f4b0a863c00) [pid = 2212] [serial = 153] [outer = 0x7f4b09e60000] 13:46:54 INFO - 87 INFO TEST-START | devtools/client/webconsole/test/browser_console_clear_on_reload.js 13:46:54 INFO - ++DOCSHELL 0x7f4b11d1d800 == 15 [pid = 2212] [id = 64] 13:46:54 INFO - ++DOMWINDOW == 33 (0x7f4b0c8ec400) [pid = 2212] [serial = 154] [outer = (nil)] 13:46:54 INFO - ++DOMWINDOW == 34 (0x7f4b0ca7fc00) [pid = 2212] [serial = 155] [outer = 0x7f4b0c8ec400] 13:46:54 INFO - ++DOMWINDOW == 35 (0x7f4b11eef800) [pid = 2212] [serial = 156] [outer = 0x7f4b0c8ec400] 13:46:54 INFO - ++DOCSHELL 0x7f4b0c38d800 == 16 [pid = 2212] [id = 65] 13:46:54 INFO - ++DOMWINDOW == 36 (0x7f4b1214ac00) [pid = 2212] [serial = 157] [outer = (nil)] 13:46:54 INFO - ++DOMWINDOW == 37 (0x7f4b123cf400) [pid = 2212] [serial = 158] [outer = 0x7f4b1214ac00] 13:46:55 INFO - ++DOMWINDOW == 38 (0x7f4b12bb4400) [pid = 2212] [serial = 159] [outer = 0x7f4b1214ac00] 13:46:55 INFO - ++DOCSHELL 0x7f4b15609000 == 17 [pid = 2212] [id = 66] 13:46:55 INFO - ++DOMWINDOW == 39 (0x7f4b15a76000) [pid = 2212] [serial = 160] [outer = (nil)] 13:46:55 INFO - ++DOMWINDOW == 40 (0x7f4b15aa4400) [pid = 2212] [serial = 161] [outer = 0x7f4b15a76000] 13:46:57 INFO - ++DOCSHELL 0x7f4b116e5800 == 18 [pid = 2212] [id = 67] 13:46:57 INFO - ++DOMWINDOW == 41 (0x7f4b29b51c00) [pid = 2212] [serial = 162] [outer = (nil)] 13:46:57 INFO - ++DOMWINDOW == 42 (0x7f4b0a045400) [pid = 2212] [serial = 163] [outer = 0x7f4b29b51c00] 13:46:58 INFO - ++DOCSHELL 0x7f4b12e68800 == 19 [pid = 2212] [id = 68] 13:46:58 INFO - ++DOMWINDOW == 43 (0x7f4b11db1c00) [pid = 2212] [serial = 164] [outer = (nil)] 13:46:58 INFO - ++DOMWINDOW == 44 (0x7f4b1214a800) [pid = 2212] [serial = 165] [outer = 0x7f4b11db1c00] 13:46:58 INFO - ++DOMWINDOW == 45 (0x7f4b12bb0000) [pid = 2212] [serial = 166] [outer = 0x7f4b0c8ec400] 13:46:59 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:47:00 INFO - --DOCSHELL 0x7f4b29c19800 == 18 [pid = 2212] [id = 62] 13:47:00 INFO - --DOCSHELL 0x7f4b20079800 == 17 [pid = 2212] [id = 61] 13:47:00 INFO - --DOCSHELL 0x7f4b094a2800 == 16 [pid = 2212] [id = 59] 13:47:00 INFO - --DOCSHELL 0x7f4b0c38d800 == 15 [pid = 2212] [id = 65] 13:47:00 INFO - --DOCSHELL 0x7f4b14c37800 == 14 [pid = 2212] [id = 58] 13:47:00 INFO - --DOCSHELL 0x7f4b15609000 == 13 [pid = 2212] [id = 66] 13:47:00 INFO - --DOCSHELL 0x7f4b0c3a4800 == 12 [pid = 2212] [id = 60] 13:47:00 INFO - --DOCSHELL 0x7f4b116e5800 == 11 [pid = 2212] [id = 67] 13:47:00 INFO - --DOCSHELL 0x7f4b12e68800 == 10 [pid = 2212] [id = 68] 13:47:00 INFO - --DOMWINDOW == 44 (0x7f4b0a668800) [pid = 2212] [serial = 131] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:47:00 INFO - --DOMWINDOW == 43 (0x7f4b0f987800) [pid = 2212] [serial = 138] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?1446846404179] 13:47:00 INFO - --DOMWINDOW == 42 (0x7f4b12bd0000) [pid = 2212] [serial = 140] [outer = (nil)] [url = about:blank] 13:47:00 INFO - --DOMWINDOW == 41 (0x7f4b120a3400) [pid = 2212] [serial = 133] [outer = (nil)] [url = about:blank] 13:47:00 INFO - --DOMWINDOW == 40 (0x7f4b12bd1800) [pid = 2212] [serial = 142] [outer = (nil)] [url = about:blank] 13:47:00 INFO - --DOMWINDOW == 39 (0x7f4b09bb4400) [pid = 2212] [serial = 144] [outer = (nil)] [url = about:blank] 13:47:00 INFO - --DOMWINDOW == 38 (0x7f4b0ca7fc00) [pid = 2212] [serial = 155] [outer = (nil)] [url = about:blank] 13:47:00 INFO - --DOMWINDOW == 37 (0x7f4b2b050800) [pid = 2212] [serial = 150] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:47:00 INFO - --DOMWINDOW == 36 (0x7f4b123cf400) [pid = 2212] [serial = 158] [outer = (nil)] [url = about:blank] 13:47:00 INFO - --DOMWINDOW == 35 (0x7f4b07d68c00) [pid = 2212] [serial = 145] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:47:00 INFO - --DOMWINDOW == 34 (0x7f4b09526800) [pid = 2212] [serial = 148] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:47:00 INFO - --DOMWINDOW == 33 (0x7f4b09584400) [pid = 2212] [serial = 143] [outer = (nil)] [url = data:text/html;charset=utf8,

hello%20world%20from%20bug%20866950] 13:47:00 INFO - --DOMWINDOW == 32 (0x7f4b123c6c00) [pid = 2212] [serial = 141] [outer = (nil)] [url = about:blank] 13:47:01 INFO - MEMORY STAT | vsize 1067MB | residentFast 274MB | heapAllocated 97MB 13:47:01 INFO - 88 INFO TEST-OK | devtools/client/webconsole/test/browser_console_clear_on_reload.js | took 6804ms 13:47:01 INFO - ++DOCSHELL 0x7f4b0c3a5800 == 11 [pid = 2212] [id = 69] 13:47:01 INFO - ++DOMWINDOW == 33 (0x7f4b09e59000) [pid = 2212] [serial = 167] [outer = (nil)] 13:47:01 INFO - ++DOMWINDOW == 34 (0x7f4b0a667000) [pid = 2212] [serial = 168] [outer = 0x7f4b09e59000] 13:47:01 INFO - 89 INFO TEST-START | devtools/client/webconsole/test/browser_console_click_focus.js 13:47:01 INFO - ++DOCSHELL 0x7f4b11d22000 == 12 [pid = 2212] [id = 70] 13:47:01 INFO - ++DOMWINDOW == 35 (0x7f4b0ac03000) [pid = 2212] [serial = 169] [outer = (nil)] 13:47:01 INFO - ++DOMWINDOW == 36 (0x7f4b0c1a9800) [pid = 2212] [serial = 170] [outer = 0x7f4b0ac03000] 13:47:01 INFO - ++DOMWINDOW == 37 (0x7f4b0ca81400) [pid = 2212] [serial = 171] [outer = 0x7f4b0ac03000] 13:47:01 INFO - ++DOCSHELL 0x7f4b0c837000 == 13 [pid = 2212] [id = 71] 13:47:01 INFO - ++DOMWINDOW == 38 (0x7f4b0f7e0c00) [pid = 2212] [serial = 172] [outer = (nil)] 13:47:01 INFO - ++DOMWINDOW == 39 (0x7f4b0f989800) [pid = 2212] [serial = 173] [outer = 0x7f4b0f7e0c00] 13:47:02 INFO - ++DOMWINDOW == 40 (0x7f4b12605800) [pid = 2212] [serial = 174] [outer = 0x7f4b0f7e0c00] 13:47:02 INFO - ++DOCSHELL 0x7f4b14c37800 == 14 [pid = 2212] [id = 72] 13:47:02 INFO - ++DOMWINDOW == 41 (0x7f4b12b21c00) [pid = 2212] [serial = 175] [outer = (nil)] 13:47:02 INFO - ++DOMWINDOW == 42 (0x7f4b12bb0800) [pid = 2212] [serial = 176] [outer = 0x7f4b12b21c00] 13:47:05 INFO - --DOCSHELL 0x7f4b11d1d800 == 13 [pid = 2212] [id = 64] 13:47:05 INFO - --DOCSHELL 0x7f4b14c37800 == 12 [pid = 2212] [id = 72] 13:47:05 INFO - --DOMWINDOW == 41 (0x7f4b1487ac00) [pid = 2212] [serial = 147] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:47:05 INFO - --DOMWINDOW == 40 (0x7f4b20106000) [pid = 2212] [serial = 149] [outer = (nil)] [url = about:blank] 13:47:05 INFO - --DOMWINDOW == 39 (0x7f4b2b055000) [pid = 2212] [serial = 151] [outer = (nil)] [url = about:blank] 13:47:05 INFO - --DOMWINDOW == 38 (0x7f4b0f989800) [pid = 2212] [serial = 173] [outer = (nil)] [url = about:blank] 13:47:05 INFO - --DOMWINDOW == 37 (0x7f4b0a863c00) [pid = 2212] [serial = 153] [outer = (nil)] [url = about:blank] 13:47:05 INFO - --DOMWINDOW == 36 (0x7f4b0c1a9800) [pid = 2212] [serial = 170] [outer = (nil)] [url = about:blank] 13:47:05 INFO - --DOMWINDOW == 35 (0x7f4b1214ac00) [pid = 2212] [serial = 157] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:47:05 INFO - --DOMWINDOW == 34 (0x7f4b15a76000) [pid = 2212] [serial = 160] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:47:05 INFO - --DOMWINDOW == 33 (0x7f4b09e60000) [pid = 2212] [serial = 152] [outer = (nil)] [url = about:blank] 13:47:05 INFO - --DOMWINDOW == 32 (0x7f4b0c8ec400) [pid = 2212] [serial = 154] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:47:05 INFO - --DOMWINDOW == 31 (0x7f4b11db1c00) [pid = 2212] [serial = 164] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:47:05 INFO - --DOMWINDOW == 30 (0x7f4b29b51c00) [pid = 2212] [serial = 162] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:47:05 INFO - --DOMWINDOW == 29 (0x7f4b11eef800) [pid = 2212] [serial = 156] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:47:05 INFO - --DOMWINDOW == 28 (0x7f4b12bb0000) [pid = 2212] [serial = 166] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:47:05 INFO - MEMORY STAT | vsize 1102MB | residentFast 274MB | heapAllocated 96MB 13:47:05 INFO - 90 INFO TEST-OK | devtools/client/webconsole/test/browser_console_click_focus.js | took 4547ms 13:47:06 INFO - ++DOCSHELL 0x7f4b116d2000 == 13 [pid = 2212] [id = 73] 13:47:06 INFO - ++DOMWINDOW == 29 (0x7f4b09bc0400) [pid = 2212] [serial = 177] [outer = (nil)] 13:47:06 INFO - ++DOMWINDOW == 30 (0x7f4b0a045000) [pid = 2212] [serial = 178] [outer = 0x7f4b09bc0400] 13:47:06 INFO - 91 INFO TEST-START | devtools/client/webconsole/test/browser_console_consolejsm_output.js 13:47:06 INFO - console.log: bug861338-log-cached 13:47:06 INFO - ++DOCSHELL 0x7f4b12e68800 == 14 [pid = 2212] [id = 74] 13:47:06 INFO - ++DOMWINDOW == 31 (0x7f4b0c4e5c00) [pid = 2212] [serial = 179] [outer = (nil)] 13:47:06 INFO - ++DOMWINDOW == 32 (0x7f4b0c4e7000) [pid = 2212] [serial = 180] [outer = 0x7f4b0c4e5c00] 13:47:07 INFO - console.time: 'foobarTimer' @ Fri Nov 06 2015 13:47:07 GMT-0800 (PST) 13:47:07 INFO - console.log: bug851231-log 13:47:07 INFO - console.info: bug851231-info 13:47:07 INFO - console.warn: bug851231-warn 13:47:07 INFO - console.error: 13:47:07 INFO - bug851231-error 13:47:07 INFO - Object 13:47:07 INFO - - bug851231prop = bug851231value 13:47:07 INFO - console.debug: 13:47:07 INFO - bug851231-debug 13:47:07 INFO - console.dir: 13:47:07 INFO - XULDocument 13:47:07 INFO - - location = Location {"href":"chrome://browser/content/browser.xul","origin":"chrome://browser","protocol":"chrome:","username":"","password":"","host":"browser","hostname":"browser","port":"","pathname":"/content/browser.xul","search":"","hash":""} 13:47:07 INFO - console.trace: 13:47:07 INFO - _onsolejsm_output.js 42 testTrace 13:47:07 INFO - _onsolejsm_output.js 54 13:47:07 INFO - _re/modules/Task.jsm 314 TaskImpl_run 13:47:07 INFO - _/Promise-backend.js 934 Handler.prototype.process 13:47:07 INFO - _/Promise-backend.js 813 this.PromiseWalker.walkerLoop 13:47:07 INFO - console.timeEnd: 'foobarTimer' 54ms 13:47:07 INFO - ++DOCSHELL 0x7f4b129ac800 == 15 [pid = 2212] [id = 75] 13:47:07 INFO - ++DOMWINDOW == 33 (0x7f4b12ba9400) [pid = 2212] [serial = 181] [outer = (nil)] 13:47:07 INFO - ++DOMWINDOW == 34 (0x7f4b12bac800) [pid = 2212] [serial = 182] [outer = 0x7f4b12ba9400] 13:47:07 INFO - ++DOCSHELL 0x7f4b16ec1800 == 16 [pid = 2212] [id = 76] 13:47:07 INFO - ++DOMWINDOW == 35 (0x7f4b07d7ec00) [pid = 2212] [serial = 183] [outer = (nil)] 13:47:07 INFO - ++DOMWINDOW == 36 (0x7f4b1776fc00) [pid = 2212] [serial = 184] [outer = 0x7f4b07d7ec00] 13:47:07 INFO - [2212] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3476 13:47:09 INFO - console.error: Log Prefix: 13:47:09 INFO - Testing a prefix 13:47:09 INFO - ++DOCSHELL 0x7f4b12e57000 == 17 [pid = 2212] [id = 77] 13:47:09 INFO - ++DOMWINDOW == 37 (0x7f4b0ca86000) [pid = 2212] [serial = 185] [outer = (nil)] 13:47:09 INFO - ++DOMWINDOW == 38 (0x7f4b0ca8a800) [pid = 2212] [serial = 186] [outer = 0x7f4b0ca86000] 13:47:10 INFO - console.error: 13:47:10 INFO - Error should be shown 13:47:10 INFO - ++DOCSHELL 0x7f4b141e9000 == 18 [pid = 2212] [id = 78] 13:47:10 INFO - ++DOMWINDOW == 39 (0x7f4b11ee9000) [pid = 2212] [serial = 187] [outer = (nil)] 13:47:10 INFO - ++DOMWINDOW == 40 (0x7f4b11ef1400) [pid = 2212] [serial = 188] [outer = 0x7f4b11ee9000] 13:47:11 INFO - console.error: 13:47:11 INFO - Error should be shown 13:47:11 INFO - console.warn: Warn should be shown due to the initial pref value 13:47:11 INFO - console.info: info should be shown due to the pref change being observed 13:47:11 INFO - console.error: 13:47:11 INFO - Should be shown due to defaulting to error 13:47:11 INFO - ++DOCSHELL 0x7f4b14c4e000 == 19 [pid = 2212] [id = 79] 13:47:11 INFO - ++DOMWINDOW == 41 (0x7f4b1294ec00) [pid = 2212] [serial = 189] [outer = (nil)] 13:47:11 INFO - ++DOMWINDOW == 42 (0x7f4b12bae800) [pid = 2212] [serial = 190] [outer = 0x7f4b1294ec00] 13:47:12 INFO - MEMORY STAT | vsize 1105MB | residentFast 281MB | heapAllocated 104MB 13:47:12 INFO - 92 INFO TEST-OK | devtools/client/webconsole/test/browser_console_consolejsm_output.js | took 6766ms 13:47:13 INFO - ++DOCSHELL 0x7f4b0f7a8000 == 20 [pid = 2212] [id = 80] 13:47:13 INFO - ++DOMWINDOW == 43 (0x7f4b149ed800) [pid = 2212] [serial = 191] [outer = (nil)] 13:47:13 INFO - ++DOMWINDOW == 44 (0x7f4b1960d800) [pid = 2212] [serial = 192] [outer = 0x7f4b149ed800] 13:47:13 INFO - 93 INFO TEST-START | devtools/client/webconsole/test/browser_console_copy_command.js 13:47:13 INFO - ++DOCSHELL 0x7f4b29c33800 == 21 [pid = 2212] [id = 81] 13:47:13 INFO - ++DOMWINDOW == 45 (0x7f4b25915400) [pid = 2212] [serial = 193] [outer = (nil)] 13:47:13 INFO - ++DOMWINDOW == 46 (0x7f4b25f5c000) [pid = 2212] [serial = 194] [outer = 0x7f4b25915400] 13:47:13 INFO - ++DOCSHELL 0x7f4b2b13f000 == 22 [pid = 2212] [id = 82] 13:47:13 INFO - ++DOMWINDOW == 47 (0x7f4b29b5cc00) [pid = 2212] [serial = 195] [outer = (nil)] 13:47:13 INFO - ++DOMWINDOW == 48 (0x7f4b2a425c00) [pid = 2212] [serial = 196] [outer = 0x7f4b29b5cc00] 13:47:13 INFO - ++DOMWINDOW == 49 (0x7f4b2a5f1000) [pid = 2212] [serial = 197] [outer = 0x7f4b29b5cc00] 13:47:14 INFO - ++DOCSHELL 0x7f4b2a4e1800 == 23 [pid = 2212] [id = 83] 13:47:14 INFO - ++DOMWINDOW == 50 (0x7f4b2b64bc00) [pid = 2212] [serial = 198] [outer = (nil)] 13:47:14 INFO - ++DOMWINDOW == 51 (0x7f4b2b64f400) [pid = 2212] [serial = 199] [outer = 0x7f4b2b64bc00] 13:47:16 INFO - MEMORY STAT | vsize 1106MB | residentFast 289MB | heapAllocated 110MB 13:47:16 INFO - 94 INFO TEST-OK | devtools/client/webconsole/test/browser_console_copy_command.js | took 3577ms 13:47:16 INFO - ++DOCSHELL 0x7f4b07c29800 == 24 [pid = 2212] [id = 84] 13:47:16 INFO - ++DOMWINDOW == 52 (0x7f4b29dc8400) [pid = 2212] [serial = 200] [outer = (nil)] 13:47:16 INFO - ++DOMWINDOW == 53 (0x7f4b29dcb000) [pid = 2212] [serial = 201] [outer = 0x7f4b29dc8400] 13:47:17 INFO - 95 INFO TEST-START | devtools/client/webconsole/test/browser_console_copy_entire_message_context_menu.js 13:47:17 INFO - ++DOCSHELL 0x7f4b07c21800 == 25 [pid = 2212] [id = 85] 13:47:17 INFO - ++DOMWINDOW == 54 (0x7f4b2a06ec00) [pid = 2212] [serial = 202] [outer = (nil)] 13:47:17 INFO - ++DOMWINDOW == 55 (0x7f4b2a569400) [pid = 2212] [serial = 203] [outer = 0x7f4b2a06ec00] 13:47:17 INFO - ++DOMWINDOW == 56 (0x7f4b2b156400) [pid = 2212] [serial = 204] [outer = 0x7f4b2a06ec00] 13:47:17 INFO - ++DOCSHELL 0x7f4b2c10f800 == 26 [pid = 2212] [id = 86] 13:47:17 INFO - ++DOMWINDOW == 57 (0x7f4b0fbafc00) [pid = 2212] [serial = 205] [outer = (nil)] 13:47:17 INFO - ++DOMWINDOW == 58 (0x7f4b0fbb0800) [pid = 2212] [serial = 206] [outer = 0x7f4b0fbafc00] 13:47:18 INFO - ++DOMWINDOW == 59 (0x7f4b0fbb3400) [pid = 2212] [serial = 207] [outer = 0x7f4b0fbafc00] 13:47:18 INFO - ++DOCSHELL 0x7f4b2c122800 == 27 [pid = 2212] [id = 87] 13:47:18 INFO - ++DOMWINDOW == 60 (0x7f4b2e9e8400) [pid = 2212] [serial = 208] [outer = (nil)] 13:47:18 INFO - ++DOMWINDOW == 61 (0x7f4b2e9e9400) [pid = 2212] [serial = 209] [outer = 0x7f4b2e9e8400] 13:47:21 INFO - --DOCSHELL 0x7f4b0c837000 == 26 [pid = 2212] [id = 71] 13:47:22 INFO - --DOCSHELL 0x7f4b129ac800 == 25 [pid = 2212] [id = 75] 13:47:22 INFO - --DOCSHELL 0x7f4b0f7a8000 == 24 [pid = 2212] [id = 80] 13:47:22 INFO - --DOCSHELL 0x7f4b29c33800 == 23 [pid = 2212] [id = 81] 13:47:22 INFO - --DOCSHELL 0x7f4b2b13f000 == 22 [pid = 2212] [id = 82] 13:47:22 INFO - --DOCSHELL 0x7f4b11d22000 == 21 [pid = 2212] [id = 70] 13:47:22 INFO - --DOCSHELL 0x7f4b2a4e1800 == 20 [pid = 2212] [id = 83] 13:47:22 INFO - --DOCSHELL 0x7f4b2c10f800 == 19 [pid = 2212] [id = 86] 13:47:22 INFO - --DOCSHELL 0x7f4b2c122800 == 18 [pid = 2212] [id = 87] 13:47:22 INFO - --DOCSHELL 0x7f4b116d2000 == 17 [pid = 2212] [id = 73] 13:47:22 INFO - --DOCSHELL 0x7f4b0c3a5800 == 16 [pid = 2212] [id = 69] 13:47:22 INFO - --DOCSHELL 0x7f4b0abd8000 == 15 [pid = 2212] [id = 63] 13:47:22 INFO - --DOCSHELL 0x7f4b16ec1800 == 14 [pid = 2212] [id = 76] 13:47:22 INFO - --DOCSHELL 0x7f4b12e68800 == 13 [pid = 2212] [id = 74] 13:47:22 INFO - --DOCSHELL 0x7f4b12e57000 == 12 [pid = 2212] [id = 77] 13:47:22 INFO - --DOCSHELL 0x7f4b141e9000 == 11 [pid = 2212] [id = 78] 13:47:22 INFO - --DOCSHELL 0x7f4b14c4e000 == 10 [pid = 2212] [id = 79] 13:47:22 INFO - --DOMWINDOW == 60 (0x7f4b1214a800) [pid = 2212] [serial = 165] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:47:22 INFO - --DOMWINDOW == 59 (0x7f4b0a045400) [pid = 2212] [serial = 163] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:47:22 INFO - --DOMWINDOW == 58 (0x7f4b15aa4400) [pid = 2212] [serial = 161] [outer = (nil)] [url = about:blank] 13:47:22 INFO - --DOMWINDOW == 57 (0x7f4b12bb4400) [pid = 2212] [serial = 159] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:47:22 INFO - --DOMWINDOW == 56 (0x7f4b0c4e5c00) [pid = 2212] [serial = 179] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:47:22 INFO - --DOMWINDOW == 55 (0x7f4b07d7ec00) [pid = 2212] [serial = 183] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:47:22 INFO - --DOMWINDOW == 54 (0x7f4b12b21c00) [pid = 2212] [serial = 175] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:47:22 INFO - --DOMWINDOW == 53 (0x7f4b0f7e0c00) [pid = 2212] [serial = 172] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:47:22 INFO - --DOMWINDOW == 52 (0x7f4b09e59000) [pid = 2212] [serial = 167] [outer = (nil)] [url = about:blank] 13:47:22 INFO - --DOMWINDOW == 51 (0x7f4b0ac03000) [pid = 2212] [serial = 169] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:47:22 INFO - --DOMWINDOW == 50 (0x7f4b12ba9400) [pid = 2212] [serial = 181] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:47:22 INFO - --DOMWINDOW == 49 (0x7f4b0a045000) [pid = 2212] [serial = 178] [outer = (nil)] [url = about:blank] 13:47:22 INFO - --DOMWINDOW == 48 (0x7f4b0ca86000) [pid = 2212] [serial = 185] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:47:22 INFO - --DOMWINDOW == 47 (0x7f4b09bc0400) [pid = 2212] [serial = 177] [outer = (nil)] [url = about:blank] 13:47:22 INFO - --DOMWINDOW == 46 (0x7f4b11ee9000) [pid = 2212] [serial = 187] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:47:22 INFO - --DOMWINDOW == 45 (0x7f4b25f5c000) [pid = 2212] [serial = 194] [outer = (nil)] [url = about:blank] 13:47:22 INFO - --DOMWINDOW == 44 (0x7f4b2a425c00) [pid = 2212] [serial = 196] [outer = (nil)] [url = about:blank] 13:47:22 INFO - --DOMWINDOW == 43 (0x7f4b2a569400) [pid = 2212] [serial = 203] [outer = (nil)] [url = about:blank] 13:47:22 INFO - --DOMWINDOW == 42 (0x7f4b149ed800) [pid = 2212] [serial = 191] [outer = (nil)] [url = about:blank] 13:47:22 INFO - --DOMWINDOW == 41 (0x7f4b25915400) [pid = 2212] [serial = 193] [outer = (nil)] [url = data:text/html;charset=utf-8,%20%20

%20%20%20%20

Testing%20copy%20command

%20%20%20%20

This%20is%20some%20example%20text

%20%20%20%20Lorem%20ipsum%20dolor%20sit%20amet,%20consectetur%20adipisicing%20elit,%20sed%20do%20eiusmod%20tempor%20incididunt%20ut%20labore%20et%20dolore%20magna%20aliqua.%20Ut%20enim%20ad%20minim%20veniam,%20quis%20nostrud%20exercitation%20ullamco%20laboris%20nisi%20ut%20aliquip%20ex%20ea%20commodo%20consequat.%20Duis%20aute%20irure%20dolor%20in%20reprehenderit%20in%20voluptate%20velit%20esse%20cillum%20dolore%20eu%20fugiat%20nulla%20pariatur.%20Excepteur%20sint%20occaecat%20cupidatat%20non%20proident,%20sunt%20in%20culpa%20qui%20officia%20deserunt%20mollit%20anim%20id%20est%20laborum.Fri%20Nov%2006%202015%2013:47:13%20GMT-0800%20(PST)

%20%20
%20%20

] 13:47:22 INFO - --DOMWINDOW == 40 (0x7f4b1960d800) [pid = 2212] [serial = 192] [outer = (nil)] [url = about:blank] 13:47:22 INFO - --DOMWINDOW == 39 (0x7f4b1294ec00) [pid = 2212] [serial = 189] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:47:22 INFO - --DOMWINDOW == 38 (0x7f4b0a667000) [pid = 2212] [serial = 168] [outer = (nil)] [url = about:blank] 13:47:22 INFO - --DOMWINDOW == 37 (0x7f4b0fbb0800) [pid = 2212] [serial = 206] [outer = (nil)] [url = about:blank] 13:47:22 INFO - --DOMWINDOW == 36 (0x7f4b2b64bc00) [pid = 2212] [serial = 198] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:47:22 INFO - --DOMWINDOW == 35 (0x7f4b29b5cc00) [pid = 2212] [serial = 195] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:47:22 INFO - --DOMWINDOW == 34 (0x7f4b0ca81400) [pid = 2212] [serial = 171] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:47:23 INFO - MEMORY STAT | vsize 1096MB | residentFast 276MB | heapAllocated 98MB 13:47:23 INFO - 96 INFO TEST-OK | devtools/client/webconsole/test/browser_console_copy_entire_message_context_menu.js | took 5858ms 13:47:23 INFO - ++DOCSHELL 0x7f4b07c19800 == 11 [pid = 2212] [id = 88] 13:47:23 INFO - ++DOMWINDOW == 35 (0x7f4b0984fc00) [pid = 2212] [serial = 210] [outer = (nil)] 13:47:23 INFO - ++DOMWINDOW == 36 (0x7f4b099bf400) [pid = 2212] [serial = 211] [outer = 0x7f4b0984fc00] 13:47:23 INFO - 97 INFO TEST-START | devtools/client/webconsole/test/browser_console_dead_objects.js 13:47:23 INFO - ++DOCSHELL 0x7f4b0c3a3800 == 12 [pid = 2212] [id = 89] 13:47:23 INFO - ++DOMWINDOW == 37 (0x7f4b0a045400) [pid = 2212] [serial = 212] [outer = (nil)] 13:47:23 INFO - ++DOMWINDOW == 38 (0x7f4b0a664c00) [pid = 2212] [serial = 213] [outer = 0x7f4b0a045400] 13:47:23 INFO - ++DOCSHELL 0x7f4b0c832800 == 13 [pid = 2212] [id = 90] 13:47:23 INFO - ++DOMWINDOW == 39 (0x7f4b0c4e2c00) [pid = 2212] [serial = 214] [outer = (nil)] 13:47:23 INFO - ++DOMWINDOW == 40 (0x7f4b0c4e4800) [pid = 2212] [serial = 215] [outer = 0x7f4b0c4e2c00] 13:47:25 INFO - ++DOCSHELL 0x7f4b1241a000 == 14 [pid = 2212] [id = 91] 13:47:25 INFO - ++DOMWINDOW == 41 (0x7f4b0c8f3800) [pid = 2212] [serial = 216] [outer = (nil)] 13:47:25 INFO - ++DOMWINDOW == 42 (0x7f4b0c8f6800) [pid = 2212] [serial = 217] [outer = 0x7f4b0c8f3800] 13:47:25 INFO - MEMORY STAT | vsize 1098MB | residentFast 282MB | heapAllocated 104MB 13:47:25 INFO - 98 INFO TEST-OK | devtools/client/webconsole/test/browser_console_dead_objects.js | took 2501ms 13:47:25 INFO - ++DOCSHELL 0x7f4b0c83e000 == 15 [pid = 2212] [id = 92] 13:47:25 INFO - ++DOMWINDOW == 43 (0x7f4b0ca85800) [pid = 2212] [serial = 218] [outer = (nil)] 13:47:25 INFO - ++DOMWINDOW == 44 (0x7f4b0f70c000) [pid = 2212] [serial = 219] [outer = 0x7f4b0ca85800] 13:47:26 INFO - 99 INFO TEST-START | devtools/client/webconsole/test/browser_console_error_source_click.js 13:47:26 INFO - ++DOCSHELL 0x7f4b0f7bd800 == 16 [pid = 2212] [id = 93] 13:47:26 INFO - ++DOMWINDOW == 45 (0x7f4b0984f000) [pid = 2212] [serial = 220] [outer = (nil)] 13:47:26 INFO - ++DOMWINDOW == 46 (0x7f4b12778000) [pid = 2212] [serial = 221] [outer = 0x7f4b0984f000] 13:47:26 INFO - ++DOCSHELL 0x7f4b0c399000 == 17 [pid = 2212] [id = 94] 13:47:26 INFO - ++DOMWINDOW == 47 (0x7f4b0c4e3800) [pid = 2212] [serial = 222] [outer = (nil)] 13:47:26 INFO - ++DOMWINDOW == 48 (0x7f4b0c8f1c00) [pid = 2212] [serial = 223] [outer = 0x7f4b0c4e3800] 13:47:27 INFO - JavaScript error: data:text/html;charset=utf8,

hello%20world%20from%20bug%20877778%20click!, line 1: ReferenceError: foobar is not defined 13:47:28 INFO - MEMORY STAT | vsize 1099MB | residentFast 283MB | heapAllocated 104MB 13:47:28 INFO - 100 INFO TEST-OK | devtools/client/webconsole/test/browser_console_error_source_click.js | took 2275ms 13:47:28 INFO - ++DOCSHELL 0x7f4b07c2b000 == 18 [pid = 2212] [id = 95] 13:47:28 INFO - ++DOMWINDOW == 49 (0x7f4b0a863400) [pid = 2212] [serial = 224] [outer = (nil)] 13:47:28 INFO - ++DOMWINDOW == 50 (0x7f4b0fbb0800) [pid = 2212] [serial = 225] [outer = 0x7f4b0a863400] 13:47:28 INFO - 101 INFO TEST-START | devtools/client/webconsole/test/browser_console_filters.js 13:47:28 INFO - ++DOCSHELL 0x7f4b13062000 == 19 [pid = 2212] [id = 96] 13:47:28 INFO - ++DOMWINDOW == 51 (0x7f4b1296f800) [pid = 2212] [serial = 226] [outer = (nil)] 13:47:28 INFO - ++DOMWINDOW == 52 (0x7f4b12bb4c00) [pid = 2212] [serial = 227] [outer = 0x7f4b1296f800] 13:47:29 INFO - ++DOCSHELL 0x7f4b141fa000 == 20 [pid = 2212] [id = 97] 13:47:29 INFO - ++DOMWINDOW == 53 (0x7f4b14a9b400) [pid = 2212] [serial = 228] [outer = (nil)] 13:47:29 INFO - ++DOMWINDOW == 54 (0x7f4b15941400) [pid = 2212] [serial = 229] [outer = 0x7f4b14a9b400] 13:47:29 INFO - ++DOMWINDOW == 55 (0x7f4b1594cc00) [pid = 2212] [serial = 230] [outer = 0x7f4b14a9b400] 13:47:29 INFO - ++DOCSHELL 0x7f4b1496e800 == 21 [pid = 2212] [id = 98] 13:47:29 INFO - ++DOMWINDOW == 56 (0x7f4b1ea9b400) [pid = 2212] [serial = 231] [outer = (nil)] 13:47:29 INFO - ++DOMWINDOW == 57 (0x7f4b1eac7000) [pid = 2212] [serial = 232] [outer = 0x7f4b1ea9b400] 13:47:32 INFO - --DOCSHELL 0x7f4b1496e800 == 20 [pid = 2212] [id = 98] 13:47:32 INFO - --DOCSHELL 0x7f4b07c29800 == 19 [pid = 2212] [id = 84] 13:47:32 INFO - --DOCSHELL 0x7f4b07c21800 == 18 [pid = 2212] [id = 85] 13:47:32 INFO - --DOCSHELL 0x7f4b1241a000 == 17 [pid = 2212] [id = 91] 13:47:32 INFO - --DOCSHELL 0x7f4b0c832800 == 16 [pid = 2212] [id = 90] 13:47:32 INFO - --DOMWINDOW == 56 (0x7f4b0c4e7000) [pid = 2212] [serial = 180] [outer = (nil)] [url = about:blank] 13:47:32 INFO - --DOMWINDOW == 55 (0x7f4b12bac800) [pid = 2212] [serial = 182] [outer = (nil)] [url = about:blank] 13:47:32 INFO - --DOMWINDOW == 54 (0x7f4b1776fc00) [pid = 2212] [serial = 184] [outer = (nil)] [url = about:blank] 13:47:32 INFO - --DOMWINDOW == 53 (0x7f4b2b64f400) [pid = 2212] [serial = 199] [outer = (nil)] [url = about:blank] 13:47:32 INFO - --DOMWINDOW == 52 (0x7f4b2a5f1000) [pid = 2212] [serial = 197] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:47:32 INFO - --DOMWINDOW == 51 (0x7f4b12bb0800) [pid = 2212] [serial = 176] [outer = (nil)] [url = about:blank] 13:47:32 INFO - --DOMWINDOW == 50 (0x7f4b12605800) [pid = 2212] [serial = 174] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:47:32 INFO - --DOMWINDOW == 49 (0x7f4b0ca8a800) [pid = 2212] [serial = 186] [outer = (nil)] [url = about:blank] 13:47:32 INFO - --DOMWINDOW == 48 (0x7f4b11ef1400) [pid = 2212] [serial = 188] [outer = (nil)] [url = about:blank] 13:47:32 INFO - --DOMWINDOW == 47 (0x7f4b12bae800) [pid = 2212] [serial = 190] [outer = (nil)] [url = about:blank] 13:47:32 INFO - --DOMWINDOW == 46 (0x7f4b0984f000) [pid = 2212] [serial = 220] [outer = (nil)] [url = data:text/html;charset=utf8,

hello%20world%20from%20bug%20877778%20click!] 13:47:32 INFO - --DOMWINDOW == 45 (0x7f4b2e9e8400) [pid = 2212] [serial = 208] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:47:32 INFO - --DOMWINDOW == 44 (0x7f4b0fbafc00) [pid = 2212] [serial = 205] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:47:32 INFO - --DOMWINDOW == 43 (0x7f4b29dc8400) [pid = 2212] [serial = 200] [outer = (nil)] [url = about:blank] 13:47:32 INFO - --DOMWINDOW == 42 (0x7f4b2a06ec00) [pid = 2212] [serial = 202] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:47:32 INFO - --DOMWINDOW == 41 (0x7f4b0a045400) [pid = 2212] [serial = 212] [outer = (nil)] [url = data:text/html;charset=utf8,

dead%20objects!] 13:47:32 INFO - --DOMWINDOW == 40 (0x7f4b0c4e2c00) [pid = 2212] [serial = 214] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:47:32 INFO - --DOMWINDOW == 39 (0x7f4b0c8f3800) [pid = 2212] [serial = 216] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:47:32 INFO - --DOMWINDOW == 38 (0x7f4b0ca85800) [pid = 2212] [serial = 218] [outer = (nil)] [url = about:blank] 13:47:32 INFO - --DOMWINDOW == 37 (0x7f4b0984fc00) [pid = 2212] [serial = 210] [outer = (nil)] [url = about:blank] 13:47:32 INFO - --DOMWINDOW == 36 (0x7f4b099bf400) [pid = 2212] [serial = 211] [outer = (nil)] [url = about:blank] 13:47:32 INFO - --DOMWINDOW == 35 (0x7f4b0f70c000) [pid = 2212] [serial = 219] [outer = (nil)] [url = about:blank] 13:47:32 INFO - --DOMWINDOW == 34 (0x7f4b29dcb000) [pid = 2212] [serial = 201] [outer = (nil)] [url = about:blank] 13:47:32 INFO - --DOMWINDOW == 33 (0x7f4b0a664c00) [pid = 2212] [serial = 213] [outer = (nil)] [url = about:blank] 13:47:32 INFO - --DOMWINDOW == 32 (0x7f4b15941400) [pid = 2212] [serial = 229] [outer = (nil)] [url = about:blank] 13:47:32 INFO - --DOMWINDOW == 31 (0x7f4b2b156400) [pid = 2212] [serial = 204] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:47:32 INFO - ++DOCSHELL 0x7f4b0949e000 == 17 [pid = 2212] [id = 99] 13:47:32 INFO - ++DOMWINDOW == 32 (0x7f4b099b4c00) [pid = 2212] [serial = 233] [outer = (nil)] 13:47:32 INFO - ++DOMWINDOW == 33 (0x7f4b099be800) [pid = 2212] [serial = 234] [outer = 0x7f4b099b4c00] 13:47:33 INFO - MEMORY STAT | vsize 1103MB | residentFast 284MB | heapAllocated 99MB 13:47:33 INFO - 102 INFO TEST-OK | devtools/client/webconsole/test/browser_console_filters.js | took 5267ms 13:47:33 INFO - ++DOCSHELL 0x7f4b07c1d000 == 18 [pid = 2212] [id = 100] 13:47:33 INFO - ++DOMWINDOW == 34 (0x7f4b0ac05000) [pid = 2212] [serial = 235] [outer = (nil)] 13:47:33 INFO - ++DOMWINDOW == 35 (0x7f4b0c4e6000) [pid = 2212] [serial = 236] [outer = 0x7f4b0ac05000] 13:47:34 INFO - 103 INFO TEST-START | devtools/client/webconsole/test/browser_console_hide_jsterm_when_devtools_chrome_enabled_false.js 13:47:34 INFO - ++DOCSHELL 0x7f4b1262f800 == 19 [pid = 2212] [id = 101] 13:47:34 INFO - ++DOMWINDOW == 36 (0x7f4b0fbba000) [pid = 2212] [serial = 237] [outer = (nil)] 13:47:34 INFO - ++DOMWINDOW == 37 (0x7f4b0fbbbc00) [pid = 2212] [serial = 238] [outer = 0x7f4b0fbba000] 13:47:34 INFO - ++DOCSHELL 0x7f4b0c832800 == 20 [pid = 2212] [id = 102] 13:47:34 INFO - ++DOMWINDOW == 38 (0x7f4b1277b400) [pid = 2212] [serial = 239] [outer = (nil)] 13:47:34 INFO - ++DOMWINDOW == 39 (0x7f4b1277bc00) [pid = 2212] [serial = 240] [outer = 0x7f4b1277b400] 13:47:35 INFO - ++DOCSHELL 0x7f4b0c669800 == 21 [pid = 2212] [id = 103] 13:47:35 INFO - ++DOMWINDOW == 40 (0x7f4b09bf2800) [pid = 2212] [serial = 241] [outer = (nil)] 13:47:35 INFO - ++DOMWINDOW == 41 (0x7f4b0a669c00) [pid = 2212] [serial = 242] [outer = 0x7f4b09bf2800] 13:47:35 INFO - ++DOCSHELL 0x7f4b07c2d800 == 22 [pid = 2212] [id = 104] 13:47:35 INFO - ++DOMWINDOW == 42 (0x7f4b12772400) [pid = 2212] [serial = 243] [outer = (nil)] 13:47:35 INFO - ++DOMWINDOW == 43 (0x7f4b12951000) [pid = 2212] [serial = 244] [outer = 0x7f4b12772400] 13:47:35 INFO - ++DOMWINDOW == 44 (0x7f4b12bb5800) [pid = 2212] [serial = 245] [outer = 0x7f4b12772400] 13:47:36 INFO - ++DOCSHELL 0x7f4b1496b000 == 23 [pid = 2212] [id = 105] 13:47:36 INFO - ++DOMWINDOW == 45 (0x7f4b12e38c00) [pid = 2212] [serial = 246] [outer = (nil)] 13:47:36 INFO - ++DOMWINDOW == 46 (0x7f4b12e3ec00) [pid = 2212] [serial = 247] [outer = 0x7f4b12e38c00] 13:47:38 INFO - ++DOCSHELL 0x7f4b129aa800 == 24 [pid = 2212] [id = 106] 13:47:38 INFO - ++DOMWINDOW == 47 (0x7f4b12e37800) [pid = 2212] [serial = 248] [outer = (nil)] 13:47:38 INFO - ++DOMWINDOW == 48 (0x7f4b12e38800) [pid = 2212] [serial = 249] [outer = 0x7f4b12e37800] 13:47:39 INFO - --DOCSHELL 0x7f4b0c399000 == 23 [pid = 2212] [id = 94] 13:47:39 INFO - --DOCSHELL 0x7f4b0c3a3800 == 22 [pid = 2212] [id = 89] 13:47:39 INFO - --DOCSHELL 0x7f4b07c2b000 == 21 [pid = 2212] [id = 95] 13:47:39 INFO - --DOCSHELL 0x7f4b0f7bd800 == 20 [pid = 2212] [id = 93] 13:47:39 INFO - --DOCSHELL 0x7f4b07c19800 == 19 [pid = 2212] [id = 88] 13:47:39 INFO - --DOCSHELL 0x7f4b0c83e000 == 18 [pid = 2212] [id = 92] 13:47:39 INFO - --DOCSHELL 0x7f4b1496b000 == 17 [pid = 2212] [id = 105] 13:47:39 INFO - --DOCSHELL 0x7f4b13062000 == 16 [pid = 2212] [id = 96] 13:47:39 INFO - --DOCSHELL 0x7f4b141fa000 == 15 [pid = 2212] [id = 97] 13:47:39 INFO - --DOCSHELL 0x7f4b129aa800 == 14 [pid = 2212] [id = 106] 13:47:39 INFO - --DOCSHELL 0x7f4b0949e000 == 13 [pid = 2212] [id = 99] 13:47:39 INFO - --DOMWINDOW == 47 (0x7f4b0fbb3400) [pid = 2212] [serial = 207] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:47:39 INFO - --DOMWINDOW == 46 (0x7f4b0c4e4800) [pid = 2212] [serial = 215] [outer = (nil)] [url = about:blank] 13:47:39 INFO - --DOMWINDOW == 45 (0x7f4b0c8f6800) [pid = 2212] [serial = 217] [outer = (nil)] [url = about:blank] 13:47:39 INFO - --DOMWINDOW == 44 (0x7f4b12778000) [pid = 2212] [serial = 221] [outer = (nil)] [url = about:blank] 13:47:39 INFO - --DOMWINDOW == 43 (0x7f4b2e9e9400) [pid = 2212] [serial = 209] [outer = (nil)] [url = about:blank] 13:47:40 INFO - --DOMWINDOW == 42 (0x7f4b12951000) [pid = 2212] [serial = 244] [outer = (nil)] [url = about:blank] 13:47:40 INFO - --DOMWINDOW == 41 (0x7f4b0fbb0800) [pid = 2212] [serial = 225] [outer = (nil)] [url = about:blank] 13:47:40 INFO - --DOMWINDOW == 40 (0x7f4b12bb4c00) [pid = 2212] [serial = 227] [outer = (nil)] [url = about:blank] 13:47:40 INFO - --DOMWINDOW == 39 (0x7f4b099b4c00) [pid = 2212] [serial = 233] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:47:40 INFO - --DOMWINDOW == 38 (0x7f4b1ea9b400) [pid = 2212] [serial = 231] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:47:40 INFO - --DOMWINDOW == 37 (0x7f4b0c4e3800) [pid = 2212] [serial = 222] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:47:40 INFO - --DOMWINDOW == 36 (0x7f4b14a9b400) [pid = 2212] [serial = 228] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:47:40 INFO - --DOMWINDOW == 35 (0x7f4b0a863400) [pid = 2212] [serial = 224] [outer = (nil)] [url = about:blank] 13:47:40 INFO - --DOMWINDOW == 34 (0x7f4b1296f800) [pid = 2212] [serial = 226] [outer = (nil)] [url = data:text/html;charset=utf8,

browser%20console%20filters] 13:47:40 INFO - ++DOCSHELL 0x7f4b094a0800 == 14 [pid = 2212] [id = 107] 13:47:40 INFO - ++DOMWINDOW == 35 (0x7f4b09bb8000) [pid = 2212] [serial = 250] [outer = (nil)] 13:47:40 INFO - ++DOMWINDOW == 36 (0x7f4b09bb9c00) [pid = 2212] [serial = 251] [outer = 0x7f4b09bb8000] 13:47:40 INFO - ++DOCSHELL 0x7f4b116e2800 == 15 [pid = 2212] [id = 108] 13:47:40 INFO - ++DOMWINDOW == 37 (0x7f4b0ca86000) [pid = 2212] [serial = 252] [outer = (nil)] 13:47:40 INFO - ++DOMWINDOW == 38 (0x7f4b0ca89000) [pid = 2212] [serial = 253] [outer = 0x7f4b0ca86000] 13:47:41 INFO - ++DOCSHELL 0x7f4b12768000 == 16 [pid = 2212] [id = 109] 13:47:41 INFO - ++DOMWINDOW == 39 (0x7f4b11db9800) [pid = 2212] [serial = 254] [outer = (nil)] 13:47:41 INFO - ++DOMWINDOW == 40 (0x7f4b11eea400) [pid = 2212] [serial = 255] [outer = 0x7f4b11db9800] 13:47:41 INFO - ++DOMWINDOW == 41 (0x7f4b0984ac00) [pid = 2212] [serial = 256] [outer = 0x7f4b11db9800] 13:47:41 INFO - ++DOCSHELL 0x7f4b141fa000 == 17 [pid = 2212] [id = 110] 13:47:41 INFO - ++DOMWINDOW == 42 (0x7f4b12bae800) [pid = 2212] [serial = 257] [outer = (nil)] 13:47:41 INFO - ++DOMWINDOW == 43 (0x7f4b12bb4c00) [pid = 2212] [serial = 258] [outer = 0x7f4b12bae800] 13:47:43 INFO - ++DOCSHELL 0x7f4b13067000 == 18 [pid = 2212] [id = 111] 13:47:43 INFO - ++DOMWINDOW == 44 (0x7f4b15944800) [pid = 2212] [serial = 259] [outer = (nil)] 13:47:43 INFO - ++DOMWINDOW == 45 (0x7f4b15945800) [pid = 2212] [serial = 260] [outer = 0x7f4b15944800] 13:47:44 INFO - --DOCSHELL 0x7f4b12768000 == 17 [pid = 2212] [id = 109] 13:47:44 INFO - --DOCSHELL 0x7f4b141fa000 == 16 [pid = 2212] [id = 110] 13:47:44 INFO - --DOCSHELL 0x7f4b13067000 == 15 [pid = 2212] [id = 111] 13:47:44 INFO - --DOCSHELL 0x7f4b07c2d800 == 14 [pid = 2212] [id = 104] 13:47:44 INFO - --DOCSHELL 0x7f4b0c832800 == 13 [pid = 2212] [id = 102] 13:47:44 INFO - --DOCSHELL 0x7f4b1262f800 == 12 [pid = 2212] [id = 101] 13:47:44 INFO - --DOMWINDOW == 44 (0x7f4b1594cc00) [pid = 2212] [serial = 230] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:47:44 INFO - --DOMWINDOW == 43 (0x7f4b1eac7000) [pid = 2212] [serial = 232] [outer = (nil)] [url = about:blank] 13:47:44 INFO - --DOMWINDOW == 42 (0x7f4b0c8f1c00) [pid = 2212] [serial = 223] [outer = (nil)] [url = about:blank] 13:47:44 INFO - --DOMWINDOW == 41 (0x7f4b099be800) [pid = 2212] [serial = 234] [outer = (nil)] [url = about:blank] 13:47:45 INFO - --DOMWINDOW == 40 (0x7f4b11eea400) [pid = 2212] [serial = 255] [outer = (nil)] [url = about:blank] 13:47:45 INFO - --DOMWINDOW == 39 (0x7f4b1277b400) [pid = 2212] [serial = 239] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:47:45 INFO - --DOMWINDOW == 38 (0x7f4b12e37800) [pid = 2212] [serial = 248] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:47:45 INFO - MEMORY STAT | vsize 1096MB | residentFast 270MB | heapAllocated 96MB 13:47:45 INFO - 104 INFO TEST-OK | devtools/client/webconsole/test/browser_console_hide_jsterm_when_devtools_chrome_enabled_false.js | took 11302ms 13:47:45 INFO - ++DOCSHELL 0x7f4b094a9000 == 13 [pid = 2212] [id = 112] 13:47:45 INFO - ++DOMWINDOW == 39 (0x7f4b09bc0400) [pid = 2212] [serial = 261] [outer = (nil)] 13:47:45 INFO - ++DOMWINDOW == 40 (0x7f4b0a667c00) [pid = 2212] [serial = 262] [outer = 0x7f4b09bc0400] 13:47:45 INFO - 105 INFO TEST-START | devtools/client/webconsole/test/browser_console_history_persist.js 13:47:45 INFO - ++DOCSHELL 0x7f4b0c83e000 == 14 [pid = 2212] [id = 113] 13:47:45 INFO - ++DOMWINDOW == 41 (0x7f4b0c1a8400) [pid = 2212] [serial = 263] [outer = (nil)] 13:47:45 INFO - ++DOMWINDOW == 42 (0x7f4b0c4e0800) [pid = 2212] [serial = 264] [outer = 0x7f4b0c1a8400] 13:47:46 INFO - ++DOCSHELL 0x7f4b07c20800 == 15 [pid = 2212] [id = 114] 13:47:46 INFO - ++DOMWINDOW == 43 (0x7f4b09e5f400) [pid = 2212] [serial = 265] [outer = (nil)] 13:47:46 INFO - ++DOMWINDOW == 44 (0x7f4b0a867c00) [pid = 2212] [serial = 266] [outer = 0x7f4b09e5f400] 13:47:46 INFO - ++DOMWINDOW == 45 (0x7f4b0fbae000) [pid = 2212] [serial = 267] [outer = 0x7f4b09e5f400] 13:47:46 INFO - ++DOCSHELL 0x7f4b116ec800 == 16 [pid = 2212] [id = 115] 13:47:46 INFO - ++DOMWINDOW == 46 (0x7f4b0fbb0c00) [pid = 2212] [serial = 268] [outer = (nil)] 13:47:46 INFO - ++DOMWINDOW == 47 (0x7f4b0fbb1400) [pid = 2212] [serial = 269] [outer = 0x7f4b0fbb0c00] 13:47:47 INFO - ++DOCSHELL 0x7f4b12753000 == 17 [pid = 2212] [id = 116] 13:47:47 INFO - ++DOMWINDOW == 48 (0x7f4b1594cc00) [pid = 2212] [serial = 270] [outer = (nil)] 13:47:48 INFO - ++DOMWINDOW == 49 (0x7f4b15aa4c00) [pid = 2212] [serial = 271] [outer = 0x7f4b1594cc00] 13:47:48 INFO - ++DOCSHELL 0x7f4b141e8800 == 18 [pid = 2212] [id = 117] 13:47:48 INFO - ++DOMWINDOW == 50 (0x7f4b14a96400) [pid = 2212] [serial = 272] [outer = (nil)] 13:47:48 INFO - ++DOMWINDOW == 51 (0x7f4b14a97c00) [pid = 2212] [serial = 273] [outer = 0x7f4b14a96400] 13:47:48 INFO - ++DOMWINDOW == 52 (0x7f4b1960ac00) [pid = 2212] [serial = 274] [outer = 0x7f4b14a96400] 13:47:49 INFO - ++DOCSHELL 0x7f4b0949d800 == 19 [pid = 2212] [id = 118] 13:47:49 INFO - ++DOMWINDOW == 53 (0x7f4b09848800) [pid = 2212] [serial = 275] [outer = (nil)] 13:47:49 INFO - ++DOMWINDOW == 54 (0x7f4b0984bc00) [pid = 2212] [serial = 276] [outer = 0x7f4b09848800] 13:47:50 INFO - ++DOCSHELL 0x7f4b15b5f000 == 20 [pid = 2212] [id = 119] 13:47:50 INFO - ++DOMWINDOW == 55 (0x7f4b2591b400) [pid = 2212] [serial = 277] [outer = (nil)] 13:47:50 INFO - ++DOMWINDOW == 56 (0x7f4b2593d000) [pid = 2212] [serial = 278] [outer = 0x7f4b2591b400] 13:47:51 INFO - ++DOCSHELL 0x7f4b199a7800 == 21 [pid = 2212] [id = 120] 13:47:51 INFO - ++DOMWINDOW == 57 (0x7f4b12bd9c00) [pid = 2212] [serial = 279] [outer = (nil)] 13:47:51 INFO - ++DOMWINDOW == 58 (0x7f4b13003400) [pid = 2212] [serial = 280] [outer = 0x7f4b12bd9c00] 13:47:51 INFO - ++DOMWINDOW == 59 (0x7f4b259ce800) [pid = 2212] [serial = 281] [outer = 0x7f4b12bd9c00] 13:47:51 INFO - ++DOCSHELL 0x7f4b25799800 == 22 [pid = 2212] [id = 121] 13:47:51 INFO - ++DOMWINDOW == 60 (0x7f4b29b57000) [pid = 2212] [serial = 282] [outer = (nil)] 13:47:51 INFO - ++DOMWINDOW == 61 (0x7f4b29b57c00) [pid = 2212] [serial = 283] [outer = 0x7f4b29b57000] 13:47:53 INFO - ++DOCSHELL 0x7f4b29c18800 == 23 [pid = 2212] [id = 122] 13:47:53 INFO - ++DOMWINDOW == 62 (0x7f4b29e86c00) [pid = 2212] [serial = 284] [outer = (nil)] 13:47:53 INFO - ++DOMWINDOW == 63 (0x7f4b29e8b400) [pid = 2212] [serial = 285] [outer = 0x7f4b29e86c00] 13:47:53 INFO - ++DOCSHELL 0x7f4b2a29e800 == 24 [pid = 2212] [id = 123] 13:47:53 INFO - ++DOMWINDOW == 64 (0x7f4b257e1800) [pid = 2212] [serial = 286] [outer = (nil)] 13:47:53 INFO - ++DOMWINDOW == 65 (0x7f4b257e2400) [pid = 2212] [serial = 287] [outer = 0x7f4b257e1800] 13:47:54 INFO - ++DOMWINDOW == 66 (0x7f4b2a069c00) [pid = 2212] [serial = 288] [outer = 0x7f4b257e1800] 13:47:54 INFO - ++DOCSHELL 0x7f4b2a4e4000 == 25 [pid = 2212] [id = 124] 13:47:54 INFO - ++DOMWINDOW == 67 (0x7f4b2a5f2c00) [pid = 2212] [serial = 289] [outer = (nil)] 13:47:54 INFO - ++DOMWINDOW == 68 (0x7f4b2a5f5800) [pid = 2212] [serial = 290] [outer = 0x7f4b2a5f2c00] 13:47:55 INFO - ++DOCSHELL 0x7f4b2b073000 == 26 [pid = 2212] [id = 125] 13:47:55 INFO - ++DOMWINDOW == 69 (0x7f4b2b650c00) [pid = 2212] [serial = 291] [outer = (nil)] 13:47:55 INFO - ++DOMWINDOW == 70 (0x7f4b2b6c3c00) [pid = 2212] [serial = 292] [outer = 0x7f4b2b650c00] 13:47:56 INFO - ++DOCSHELL 0x7f4b2c113800 == 27 [pid = 2212] [id = 126] 13:47:56 INFO - ++DOMWINDOW == 71 (0x7f4b2a073400) [pid = 2212] [serial = 293] [outer = (nil)] 13:47:56 INFO - ++DOMWINDOW == 72 (0x7f4b2b6a3000) [pid = 2212] [serial = 294] [outer = 0x7f4b2a073400] 13:47:56 INFO - ++DOMWINDOW == 73 (0x7f4b2e9e7800) [pid = 2212] [serial = 295] [outer = 0x7f4b2a073400] 13:47:56 INFO - ++DOCSHELL 0x7f4b2c122800 == 28 [pid = 2212] [id = 127] 13:47:56 INFO - ++DOMWINDOW == 74 (0x7f4b00f5ec00) [pid = 2212] [serial = 296] [outer = (nil)] 13:47:56 INFO - ++DOMWINDOW == 75 (0x7f4b00f5f800) [pid = 2212] [serial = 297] [outer = 0x7f4b00f5ec00] 13:47:59 INFO - --DOCSHELL 0x7f4b07c1d000 == 27 [pid = 2212] [id = 100] 13:47:59 INFO - --DOCSHELL 0x7f4b0c669800 == 26 [pid = 2212] [id = 103] 13:47:59 INFO - --DOCSHELL 0x7f4b2c122800 == 25 [pid = 2212] [id = 127] 13:47:59 INFO - --DOCSHELL 0x7f4b116e2800 == 24 [pid = 2212] [id = 108] 13:47:59 INFO - --DOCSHELL 0x7f4b094a0800 == 23 [pid = 2212] [id = 107] 13:47:59 INFO - --DOMWINDOW == 74 (0x7f4b1277bc00) [pid = 2212] [serial = 240] [outer = (nil)] [url = about:blank] 13:47:59 INFO - --DOMWINDOW == 73 (0x7f4b12e38800) [pid = 2212] [serial = 249] [outer = (nil)] [url = about:blank] 13:47:59 INFO - --DOMWINDOW == 72 (0x7f4b15944800) [pid = 2212] [serial = 259] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:47:59 INFO - --DOMWINDOW == 71 (0x7f4b09bf2800) [pid = 2212] [serial = 241] [outer = (nil)] [url = data:text/html;charset=utf8,hello%20world] 13:47:59 INFO - --DOMWINDOW == 70 (0x7f4b0ac05000) [pid = 2212] [serial = 235] [outer = (nil)] [url = about:blank] 13:47:59 INFO - --DOMWINDOW == 69 (0x7f4b0ca86000) [pid = 2212] [serial = 252] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:47:59 INFO - --DOMWINDOW == 68 (0x7f4b2b6a3000) [pid = 2212] [serial = 294] [outer = (nil)] [url = about:blank] 13:47:59 INFO - --DOMWINDOW == 67 (0x7f4b0a669c00) [pid = 2212] [serial = 242] [outer = (nil)] [url = about:blank] 13:47:59 INFO - --DOMWINDOW == 66 (0x7f4b0c4e6000) [pid = 2212] [serial = 236] [outer = (nil)] [url = about:blank] 13:47:59 INFO - --DOMWINDOW == 65 (0x7f4b0a867c00) [pid = 2212] [serial = 266] [outer = (nil)] [url = about:blank] 13:47:59 INFO - --DOMWINDOW == 64 (0x7f4b257e2400) [pid = 2212] [serial = 287] [outer = (nil)] [url = about:blank] 13:47:59 INFO - --DOMWINDOW == 63 (0x7f4b13003400) [pid = 2212] [serial = 280] [outer = (nil)] [url = about:blank] 13:47:59 INFO - --DOMWINDOW == 62 (0x7f4b14a97c00) [pid = 2212] [serial = 273] [outer = (nil)] [url = about:blank] 13:47:59 INFO - --DOMWINDOW == 61 (0x7f4b0fbba000) [pid = 2212] [serial = 237] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:47:59 INFO - --DOMWINDOW == 60 (0x7f4b12bae800) [pid = 2212] [serial = 257] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:47:59 INFO - --DOMWINDOW == 59 (0x7f4b12e38c00) [pid = 2212] [serial = 246] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:47:59 INFO - --DOMWINDOW == 58 (0x7f4b09bb8000) [pid = 2212] [serial = 250] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:47:59 INFO - --DOMWINDOW == 57 (0x7f4b11db9800) [pid = 2212] [serial = 254] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:47:59 INFO - --DOMWINDOW == 56 (0x7f4b12772400) [pid = 2212] [serial = 243] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:47:59 INFO - --DOCSHELL 0x7f4b2a4e4000 == 22 [pid = 2212] [id = 124] 13:48:00 INFO - --DOCSHELL 0x7f4b25799800 == 21 [pid = 2212] [id = 121] 13:48:00 INFO - --DOCSHELL 0x7f4b0949d800 == 20 [pid = 2212] [id = 118] 13:48:00 INFO - --DOCSHELL 0x7f4b116ec800 == 19 [pid = 2212] [id = 115] 13:48:01 INFO - MEMORY STAT | vsize 1108MB | residentFast 289MB | heapAllocated 105MB 13:48:01 INFO - 106 INFO TEST-OK | devtools/client/webconsole/test/browser_console_history_persist.js | took 15354ms 13:48:01 INFO - ++DOCSHELL 0x7f4b07c22800 == 20 [pid = 2212] [id = 128] 13:48:01 INFO - ++DOMWINDOW == 57 (0x7f4b07a10c00) [pid = 2212] [serial = 298] [outer = (nil)] 13:48:01 INFO - ++DOMWINDOW == 58 (0x7f4b07a12400) [pid = 2212] [serial = 299] [outer = 0x7f4b07a10c00] 13:48:01 INFO - 107 INFO TEST-START | devtools/client/webconsole/test/browser_console_iframe_messages.js 13:48:01 INFO - ++DOCSHELL 0x7f4b0949e000 == 21 [pid = 2212] [id = 129] 13:48:01 INFO - ++DOMWINDOW == 59 (0x7f4b0984c400) [pid = 2212] [serial = 300] [outer = (nil)] 13:48:01 INFO - ++DOMWINDOW == 60 (0x7f4b09850000) [pid = 2212] [serial = 301] [outer = 0x7f4b0984c400] 13:48:01 INFO - ++DOMWINDOW == 61 (0x7f4b099b9c00) [pid = 2212] [serial = 302] [outer = 0x7f4b0984c400] 13:48:01 INFO - ++DOCSHELL 0x7f4b01919800 == 22 [pid = 2212] [id = 130] 13:48:01 INFO - ++DOMWINDOW == 62 (0x7f4b099c2400) [pid = 2212] [serial = 303] [outer = (nil)] 13:48:01 INFO - ++DOCSHELL 0x7f4b0c679000 == 23 [pid = 2212] [id = 131] 13:48:01 INFO - ++DOMWINDOW == 63 (0x7f4b0a669400) [pid = 2212] [serial = 304] [outer = (nil)] 13:48:01 INFO - ++DOCSHELL 0x7f4b0c82b800 == 24 [pid = 2212] [id = 132] 13:48:01 INFO - ++DOMWINDOW == 64 (0x7f4b0a66a000) [pid = 2212] [serial = 305] [outer = (nil)] 13:48:02 INFO - ++DOMWINDOW == 65 (0x7f4b0a861800) [pid = 2212] [serial = 306] [outer = 0x7f4b099c2400] 13:48:02 INFO - ++DOMWINDOW == 66 (0x7f4b0a045400) [pid = 2212] [serial = 307] [outer = 0x7f4b0a669400] 13:48:02 INFO - ++DOMWINDOW == 67 (0x7f4b0a863c00) [pid = 2212] [serial = 308] [outer = 0x7f4b0a66a000] 13:48:02 INFO - ++DOCSHELL 0x7f4b01921000 == 25 [pid = 2212] [id = 133] 13:48:02 INFO - ++DOMWINDOW == 68 (0x7f4b0c1aa400) [pid = 2212] [serial = 309] [outer = (nil)] 13:48:02 INFO - ++DOMWINDOW == 69 (0x7f4b0c4e2400) [pid = 2212] [serial = 310] [outer = 0x7f4b0c1aa400] 13:48:02 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-iframe2.html, line 5: ReferenceError: blah is not defined 13:48:02 INFO - ++DOCSHELL 0x7f4b0a7d3800 == 26 [pid = 2212] [id = 134] 13:48:02 INFO - ++DOMWINDOW == 70 (0x7f4b0a9d4800) [pid = 2212] [serial = 311] [outer = (nil)] 13:48:02 INFO - ++DOMWINDOW == 71 (0x7f4b0c8f1c00) [pid = 2212] [serial = 312] [outer = 0x7f4b0a9d4800] 13:48:02 INFO - ++DOMWINDOW == 72 (0x7f4b0ab80000) [pid = 2212] [serial = 313] [outer = 0x7f4b0c1aa400] 13:48:02 INFO - ++DOCSHELL 0x7f4b1494f800 == 27 [pid = 2212] [id = 135] 13:48:02 INFO - ++DOMWINDOW == 73 (0x7f4b12773000) [pid = 2212] [serial = 314] [outer = (nil)] 13:48:02 INFO - ++DOMWINDOW == 74 (0x7f4b12774400) [pid = 2212] [serial = 315] [outer = 0x7f4b12773000] 13:48:06 INFO - --DOCSHELL 0x7f4b094a9000 == 26 [pid = 2212] [id = 112] 13:48:06 INFO - --DOCSHELL 0x7f4b1494f800 == 25 [pid = 2212] [id = 135] 13:48:06 INFO - --DOCSHELL 0x7f4b2b073000 == 24 [pid = 2212] [id = 125] 13:48:06 INFO - --DOCSHELL 0x7f4b07c20800 == 23 [pid = 2212] [id = 114] 13:48:06 INFO - --DOCSHELL 0x7f4b29c18800 == 22 [pid = 2212] [id = 122] 13:48:06 INFO - --DOCSHELL 0x7f4b12753000 == 21 [pid = 2212] [id = 116] 13:48:06 INFO - --DOCSHELL 0x7f4b2a29e800 == 20 [pid = 2212] [id = 123] 13:48:06 INFO - --DOCSHELL 0x7f4b0c83e000 == 19 [pid = 2212] [id = 113] 13:48:06 INFO - --DOCSHELL 0x7f4b15b5f000 == 18 [pid = 2212] [id = 119] 13:48:06 INFO - --DOCSHELL 0x7f4b141e8800 == 17 [pid = 2212] [id = 117] 13:48:06 INFO - --DOCSHELL 0x7f4b199a7800 == 16 [pid = 2212] [id = 120] 13:48:06 INFO - --DOCSHELL 0x7f4b2c113800 == 15 [pid = 2212] [id = 126] 13:48:06 INFO - --DOMWINDOW == 73 (0x7f4b0ca89000) [pid = 2212] [serial = 253] [outer = (nil)] [url = about:blank] 13:48:06 INFO - --DOMWINDOW == 72 (0x7f4b09bb9c00) [pid = 2212] [serial = 251] [outer = (nil)] [url = about:blank] 13:48:06 INFO - --DOMWINDOW == 71 (0x7f4b0fbbbc00) [pid = 2212] [serial = 238] [outer = (nil)] [url = about:blank] 13:48:06 INFO - --DOMWINDOW == 70 (0x7f4b15945800) [pid = 2212] [serial = 260] [outer = (nil)] [url = about:blank] 13:48:06 INFO - --DOMWINDOW == 69 (0x7f4b12bb4c00) [pid = 2212] [serial = 258] [outer = (nil)] [url = about:blank] 13:48:06 INFO - --DOMWINDOW == 68 (0x7f4b0984ac00) [pid = 2212] [serial = 256] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:06 INFO - --DOMWINDOW == 67 (0x7f4b12e3ec00) [pid = 2212] [serial = 247] [outer = (nil)] [url = about:blank] 13:48:06 INFO - --DOMWINDOW == 66 (0x7f4b12bb5800) [pid = 2212] [serial = 245] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:06 INFO - --DOMWINDOW == 65 (0x7f4b09850000) [pid = 2212] [serial = 301] [outer = (nil)] [url = about:blank] 13:48:06 INFO - --DOMWINDOW == 64 (0x7f4b0c4e2400) [pid = 2212] [serial = 310] [outer = (nil)] [url = about:blank] 13:48:06 INFO - --DOMWINDOW == 63 (0x7f4b0a667c00) [pid = 2212] [serial = 262] [outer = (nil)] [url = about:blank] 13:48:06 INFO - --DOMWINDOW == 62 (0x7f4b09bc0400) [pid = 2212] [serial = 261] [outer = (nil)] [url = about:blank] 13:48:06 INFO - --DOMWINDOW == 61 (0x7f4b0fbb0c00) [pid = 2212] [serial = 268] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:48:06 INFO - --DOMWINDOW == 60 (0x7f4b09e5f400) [pid = 2212] [serial = 265] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:06 INFO - --DOMWINDOW == 59 (0x7f4b00f5ec00) [pid = 2212] [serial = 296] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:48:06 INFO - --DOMWINDOW == 58 (0x7f4b2a5f2c00) [pid = 2212] [serial = 289] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:48:06 INFO - --DOMWINDOW == 57 (0x7f4b14a96400) [pid = 2212] [serial = 272] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:06 INFO - --DOMWINDOW == 56 (0x7f4b29b57000) [pid = 2212] [serial = 282] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:48:06 INFO - --DOMWINDOW == 55 (0x7f4b12bd9c00) [pid = 2212] [serial = 279] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:06 INFO - --DOMWINDOW == 54 (0x7f4b2a073400) [pid = 2212] [serial = 293] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:06 INFO - --DOMWINDOW == 53 (0x7f4b09848800) [pid = 2212] [serial = 275] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:48:06 INFO - --DOMWINDOW == 52 (0x7f4b257e1800) [pid = 2212] [serial = 286] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:06 INFO - --DOMWINDOW == 51 (0x7f4b2b650c00) [pid = 2212] [serial = 291] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20persisting%20history%20-%20bug%20943306] 13:48:06 INFO - --DOMWINDOW == 50 (0x7f4b29e86c00) [pid = 2212] [serial = 284] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20persisting%20history%20-%20bug%20943306] 13:48:06 INFO - --DOMWINDOW == 49 (0x7f4b2591b400) [pid = 2212] [serial = 277] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20persisting%20history%20-%20bug%20943306] 13:48:06 INFO - --DOMWINDOW == 48 (0x7f4b1594cc00) [pid = 2212] [serial = 270] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20persisting%20history%20-%20bug%20943306] 13:48:06 INFO - --DOMWINDOW == 47 (0x7f4b0c1a8400) [pid = 2212] [serial = 263] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20persisting%20history%20-%20bug%20943306] 13:48:06 INFO - --DOMWINDOW == 46 (0x7f4b2b6c3c00) [pid = 2212] [serial = 292] [outer = (nil)] [url = about:blank] 13:48:06 INFO - --DOMWINDOW == 45 (0x7f4b29e8b400) [pid = 2212] [serial = 285] [outer = (nil)] [url = about:blank] 13:48:06 INFO - --DOMWINDOW == 44 (0x7f4b2593d000) [pid = 2212] [serial = 278] [outer = (nil)] [url = about:blank] 13:48:06 INFO - --DOMWINDOW == 43 (0x7f4b15aa4c00) [pid = 2212] [serial = 271] [outer = (nil)] [url = about:blank] 13:48:06 INFO - --DOMWINDOW == 42 (0x7f4b0c4e0800) [pid = 2212] [serial = 264] [outer = (nil)] [url = about:blank] 13:48:06 INFO - ++DOCSHELL 0x7f4b01763000 == 16 [pid = 2212] [id = 136] 13:48:06 INFO - ++DOMWINDOW == 43 (0x7f4b00f61c00) [pid = 2212] [serial = 316] [outer = (nil)] 13:48:06 INFO - ++DOMWINDOW == 44 (0x7f4b00f63800) [pid = 2212] [serial = 317] [outer = 0x7f4b00f61c00] 13:48:07 INFO - MEMORY STAT | vsize 1106MB | residentFast 286MB | heapAllocated 101MB 13:48:07 INFO - 108 INFO TEST-OK | devtools/client/webconsole/test/browser_console_iframe_messages.js | took 6568ms 13:48:08 INFO - ++DOCSHELL 0x7f4b094a8000 == 17 [pid = 2212] [id = 137] 13:48:08 INFO - ++DOMWINDOW == 45 (0x7f4b09586000) [pid = 2212] [serial = 318] [outer = (nil)] 13:48:08 INFO - ++DOMWINDOW == 46 (0x7f4b099b4800) [pid = 2212] [serial = 319] [outer = 0x7f4b09586000] 13:48:08 INFO - 109 INFO TEST-START | devtools/client/webconsole/test/browser_console_keyboard_accessibility.js 13:48:08 INFO - ++DOCSHELL 0x7f4b0c827000 == 18 [pid = 2212] [id = 138] 13:48:08 INFO - ++DOMWINDOW == 47 (0x7f4b0a861c00) [pid = 2212] [serial = 320] [outer = (nil)] 13:48:08 INFO - ++DOMWINDOW == 48 (0x7f4b0a86ac00) [pid = 2212] [serial = 321] [outer = 0x7f4b0a861c00] 13:48:08 INFO - ++DOMWINDOW == 49 (0x7f4b0c4e1c00) [pid = 2212] [serial = 322] [outer = 0x7f4b0a861c00] 13:48:08 INFO - ++DOCSHELL 0x7f4b0190e000 == 19 [pid = 2212] [id = 139] 13:48:08 INFO - ++DOMWINDOW == 50 (0x7f4b0ca85800) [pid = 2212] [serial = 323] [outer = (nil)] 13:48:08 INFO - ++DOMWINDOW == 51 (0x7f4b0d754000) [pid = 2212] [serial = 324] [outer = 0x7f4b0ca85800] 13:48:08 INFO - ++DOMWINDOW == 52 (0x7f4b00f5e400) [pid = 2212] [serial = 325] [outer = 0x7f4b0ca85800] 13:48:09 INFO - ++DOCSHELL 0x7f4b12761000 == 20 [pid = 2212] [id = 140] 13:48:09 INFO - ++DOMWINDOW == 53 (0x7f4b1276fc00) [pid = 2212] [serial = 326] [outer = (nil)] 13:48:09 INFO - ++DOMWINDOW == 54 (0x7f4b12770c00) [pid = 2212] [serial = 327] [outer = 0x7f4b1276fc00] 13:48:14 INFO - --DOCSHELL 0x7f4b01919800 == 19 [pid = 2212] [id = 130] 13:48:14 INFO - --DOCSHELL 0x7f4b0c679000 == 18 [pid = 2212] [id = 131] 13:48:14 INFO - --DOCSHELL 0x7f4b0c82b800 == 17 [pid = 2212] [id = 132] 13:48:14 INFO - --DOCSHELL 0x7f4b0a7d3800 == 16 [pid = 2212] [id = 134] 13:48:14 INFO - --DOCSHELL 0x7f4b0949e000 == 15 [pid = 2212] [id = 129] 13:48:14 INFO - --DOCSHELL 0x7f4b0190e000 == 14 [pid = 2212] [id = 139] 13:48:14 INFO - --DOCSHELL 0x7f4b07c22800 == 13 [pid = 2212] [id = 128] 13:48:14 INFO - --DOCSHELL 0x7f4b12761000 == 12 [pid = 2212] [id = 140] 13:48:14 INFO - --DOCSHELL 0x7f4b01921000 == 11 [pid = 2212] [id = 133] 13:48:14 INFO - --DOCSHELL 0x7f4b01763000 == 10 [pid = 2212] [id = 136] 13:48:14 INFO - --DOMWINDOW == 53 (0x7f4b00f5f800) [pid = 2212] [serial = 297] [outer = (nil)] [url = about:blank] 13:48:14 INFO - --DOMWINDOW == 52 (0x7f4b2e9e7800) [pid = 2212] [serial = 295] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:14 INFO - --DOMWINDOW == 51 (0x7f4b2a5f5800) [pid = 2212] [serial = 290] [outer = (nil)] [url = about:blank] 13:48:14 INFO - --DOMWINDOW == 50 (0x7f4b2a069c00) [pid = 2212] [serial = 288] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:14 INFO - --DOMWINDOW == 49 (0x7f4b29b57c00) [pid = 2212] [serial = 283] [outer = (nil)] [url = about:blank] 13:48:14 INFO - --DOMWINDOW == 48 (0x7f4b259ce800) [pid = 2212] [serial = 281] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:14 INFO - --DOMWINDOW == 47 (0x7f4b0984bc00) [pid = 2212] [serial = 276] [outer = (nil)] [url = about:blank] 13:48:14 INFO - --DOMWINDOW == 46 (0x7f4b1960ac00) [pid = 2212] [serial = 274] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:14 INFO - --DOMWINDOW == 45 (0x7f4b0fbb1400) [pid = 2212] [serial = 269] [outer = (nil)] [url = about:blank] 13:48:14 INFO - --DOMWINDOW == 44 (0x7f4b0fbae000) [pid = 2212] [serial = 267] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:14 INFO - --DOMWINDOW == 43 (0x7f4b0c1aa400) [pid = 2212] [serial = 309] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:14 INFO - --DOMWINDOW == 42 (0x7f4b12773000) [pid = 2212] [serial = 314] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:48:14 INFO - --DOMWINDOW == 41 (0x7f4b07a10c00) [pid = 2212] [serial = 298] [outer = (nil)] [url = about:blank] 13:48:14 INFO - --DOMWINDOW == 40 (0x7f4b0984c400) [pid = 2212] [serial = 300] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-consoleiframes.html] 13:48:14 INFO - --DOMWINDOW == 39 (0x7f4b099c2400) [pid = 2212] [serial = 303] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe1.html] 13:48:14 INFO - --DOMWINDOW == 38 (0x7f4b0a66a000) [pid = 2212] [serial = 305] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe3.html] 13:48:14 INFO - --DOMWINDOW == 37 (0x7f4b0a9d4800) [pid = 2212] [serial = 311] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe1.html] 13:48:14 INFO - --DOMWINDOW == 36 (0x7f4b0a669400) [pid = 2212] [serial = 304] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe2.html] 13:48:14 INFO - --DOMWINDOW == 35 (0x7f4b00f61c00) [pid = 2212] [serial = 316] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:48:14 INFO - --DOMWINDOW == 34 (0x7f4b07a12400) [pid = 2212] [serial = 299] [outer = (nil)] [url = about:blank] 13:48:14 INFO - --DOMWINDOW == 33 (0x7f4b099b9c00) [pid = 2212] [serial = 302] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-consoleiframes.html] 13:48:14 INFO - --DOMWINDOW == 32 (0x7f4b0a861800) [pid = 2212] [serial = 306] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-iframe1.html] 13:48:14 INFO - --DOMWINDOW == 31 (0x7f4b0a863c00) [pid = 2212] [serial = 308] [outer = (nil)] [url = about:blank] 13:48:14 INFO - --DOMWINDOW == 30 (0x7f4b0c8f1c00) [pid = 2212] [serial = 312] [outer = (nil)] [url = about:blank] 13:48:14 INFO - --DOMWINDOW == 29 (0x7f4b0a86ac00) [pid = 2212] [serial = 321] [outer = (nil)] [url = about:blank] 13:48:14 INFO - --DOMWINDOW == 28 (0x7f4b0d754000) [pid = 2212] [serial = 324] [outer = (nil)] [url = about:blank] 13:48:14 INFO - MEMORY STAT | vsize 1105MB | residentFast 278MB | heapAllocated 96MB 13:48:14 INFO - 110 INFO TEST-OK | devtools/client/webconsole/test/browser_console_keyboard_accessibility.js | took 6588ms 13:48:14 INFO - ++DOCSHELL 0x7f4b01766000 == 11 [pid = 2212] [id = 141] 13:48:14 INFO - ++DOMWINDOW == 29 (0x7f4b00f58800) [pid = 2212] [serial = 328] [outer = (nil)] 13:48:14 INFO - ++DOMWINDOW == 30 (0x7f4b00f5ec00) [pid = 2212] [serial = 329] [outer = 0x7f4b00f58800] 13:48:15 INFO - 111 INFO TEST-START | devtools/client/webconsole/test/browser_console_log_inspectable_object.js 13:48:15 INFO - ++DOCSHELL 0x7f4b01915000 == 12 [pid = 2212] [id = 142] 13:48:15 INFO - ++DOMWINDOW == 31 (0x7f4b019b4000) [pid = 2212] [serial = 330] [outer = (nil)] 13:48:15 INFO - ++DOMWINDOW == 32 (0x7f4b019b8400) [pid = 2212] [serial = 331] [outer = 0x7f4b019b4000] 13:48:15 INFO - ++DOCSHELL 0x7f4b01758800 == 13 [pid = 2212] [id = 143] 13:48:15 INFO - ++DOMWINDOW == 33 (0x7f4b019bb400) [pid = 2212] [serial = 332] [outer = (nil)] 13:48:15 INFO - ++DOMWINDOW == 34 (0x7f4b07a0d800) [pid = 2212] [serial = 333] [outer = 0x7f4b019bb400] 13:48:15 INFO - ++DOMWINDOW == 35 (0x7f4b09529c00) [pid = 2212] [serial = 334] [outer = 0x7f4b019bb400] 13:48:15 INFO - ++DOCSHELL 0x7f4b0a7c1000 == 14 [pid = 2212] [id = 144] 13:48:15 INFO - ++DOMWINDOW == 36 (0x7f4b09bc0c00) [pid = 2212] [serial = 335] [outer = (nil)] 13:48:15 INFO - ++DOMWINDOW == 37 (0x7f4b09bc2400) [pid = 2212] [serial = 336] [outer = 0x7f4b09bc0c00] 13:48:17 INFO - ++DOCSHELL 0x7f4b07c1d800 == 15 [pid = 2212] [id = 145] 13:48:17 INFO - ++DOMWINDOW == 38 (0x7f4b126e8800) [pid = 2212] [serial = 337] [outer = (nil)] 13:48:17 INFO - ++DOMWINDOW == 39 (0x7f4b09bbe400) [pid = 2212] [serial = 338] [outer = 0x7f4b126e8800] 13:48:18 INFO - --DOCSHELL 0x7f4b094a8000 == 14 [pid = 2212] [id = 137] 13:48:18 INFO - --DOCSHELL 0x7f4b0a7c1000 == 13 [pid = 2212] [id = 144] 13:48:18 INFO - --DOCSHELL 0x7f4b07c1d800 == 12 [pid = 2212] [id = 145] 13:48:18 INFO - --DOCSHELL 0x7f4b0c827000 == 11 [pid = 2212] [id = 138] 13:48:19 INFO - --DOMWINDOW == 38 (0x7f4b0a045400) [pid = 2212] [serial = 307] [outer = (nil)] [url = about:blank] 13:48:19 INFO - --DOMWINDOW == 37 (0x7f4b12774400) [pid = 2212] [serial = 315] [outer = (nil)] [url = about:blank] 13:48:19 INFO - --DOMWINDOW == 36 (0x7f4b0ab80000) [pid = 2212] [serial = 313] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:19 INFO - --DOMWINDOW == 35 (0x7f4b00f63800) [pid = 2212] [serial = 317] [outer = (nil)] [url = about:blank] 13:48:19 INFO - --DOMWINDOW == 34 (0x7f4b126e8800) [pid = 2212] [serial = 337] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:48:19 INFO - --DOMWINDOW == 33 (0x7f4b099b4800) [pid = 2212] [serial = 319] [outer = (nil)] [url = about:blank] 13:48:19 INFO - --DOMWINDOW == 32 (0x7f4b07a0d800) [pid = 2212] [serial = 333] [outer = (nil)] [url = about:blank] 13:48:19 INFO - --DOMWINDOW == 31 (0x7f4b0ca85800) [pid = 2212] [serial = 323] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:19 INFO - --DOMWINDOW == 30 (0x7f4b1276fc00) [pid = 2212] [serial = 326] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:48:19 INFO - --DOMWINDOW == 29 (0x7f4b09586000) [pid = 2212] [serial = 318] [outer = (nil)] [url = about:blank] 13:48:19 INFO - --DOMWINDOW == 28 (0x7f4b0a861c00) [pid = 2212] [serial = 320] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:48:19 INFO - --DOMWINDOW == 27 (0x7f4b0c4e1c00) [pid = 2212] [serial = 322] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:48:19 INFO - MEMORY STAT | vsize 1106MB | residentFast 274MB | heapAllocated 95MB 13:48:19 INFO - 112 INFO TEST-OK | devtools/client/webconsole/test/browser_console_log_inspectable_object.js | took 4492ms 13:48:19 INFO - ++DOCSHELL 0x7f4b0176c800 == 12 [pid = 2212] [id = 146] 13:48:19 INFO - ++DOMWINDOW == 28 (0x7f4b00f5e000) [pid = 2212] [serial = 339] [outer = (nil)] 13:48:19 INFO - ++DOMWINDOW == 29 (0x7f4b019b1400) [pid = 2212] [serial = 340] [outer = 0x7f4b00f5e000] 13:48:19 INFO - 113 INFO TEST-START | devtools/client/webconsole/test/browser_console_native_getters.js 13:48:19 INFO - ++DOCSHELL 0x7f4b07c1f800 == 13 [pid = 2212] [id = 147] 13:48:19 INFO - ++DOMWINDOW == 30 (0x7f4b019bd800) [pid = 2212] [serial = 341] [outer = (nil)] 13:48:19 INFO - ++DOMWINDOW == 31 (0x7f4b019bfc00) [pid = 2212] [serial = 342] [outer = 0x7f4b019bd800] 13:48:20 INFO - ++DOCSHELL 0x7f4b01768800 == 14 [pid = 2212] [id = 148] 13:48:20 INFO - ++DOMWINDOW == 32 (0x7f4b07a05400) [pid = 2212] [serial = 343] [outer = (nil)] 13:48:20 INFO - ++DOMWINDOW == 33 (0x7f4b07a10000) [pid = 2212] [serial = 344] [outer = 0x7f4b07a05400] 13:48:20 INFO - ++DOMWINDOW == 34 (0x7f4b09621400) [pid = 2212] [serial = 345] [outer = 0x7f4b07a05400] 13:48:20 INFO - ++DOCSHELL 0x7f4b0c399000 == 15 [pid = 2212] [id = 149] 13:48:20 INFO - ++DOMWINDOW == 35 (0x7f4b09bc0400) [pid = 2212] [serial = 346] [outer = (nil)] 13:48:20 INFO - ++DOMWINDOW == 36 (0x7f4b09bfb400) [pid = 2212] [serial = 347] [outer = 0x7f4b09bc0400] 13:48:22 INFO - ++DOCSHELL 0x7f4b0176f000 == 16 [pid = 2212] [id = 150] 13:48:22 INFO - ++DOMWINDOW == 37 (0x7f4b00f58000) [pid = 2212] [serial = 348] [outer = (nil)] 13:48:22 INFO - ++DOMWINDOW == 38 (0x7f4b019bd400) [pid = 2212] [serial = 349] [outer = 0x7f4b00f58000] 13:48:22 INFO - [2212] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3476 13:48:28 INFO - ++DOCSHELL 0x7f4b1305e000 == 17 [pid = 2212] [id = 151] 13:48:28 INFO - ++DOMWINDOW == 39 (0x7f4b0fbb0c00) [pid = 2212] [serial = 350] [outer = (nil)] 13:48:28 INFO - ++DOMWINDOW == 40 (0x7f4b1294b400) [pid = 2212] [serial = 351] [outer = 0x7f4b0fbb0c00] 13:48:34 INFO - --DOCSHELL 0x7f4b01915000 == 16 [pid = 2212] [id = 142] 13:48:34 INFO - --DOCSHELL 0x7f4b01766000 == 15 [pid = 2212] [id = 141] 13:48:34 INFO - --DOCSHELL 0x7f4b01768800 == 14 [pid = 2212] [id = 148] 13:48:34 INFO - --DOCSHELL 0x7f4b0c399000 == 13 [pid = 2212] [id = 149] 13:48:34 INFO - --DOCSHELL 0x7f4b01758800 == 12 [pid = 2212] [id = 143] 13:48:34 INFO - --DOCSHELL 0x7f4b0176f000 == 11 [pid = 2212] [id = 150] 13:48:34 INFO - --DOCSHELL 0x7f4b1305e000 == 10 [pid = 2212] [id = 151] 13:48:34 INFO - --DOMWINDOW == 39 (0x7f4b00f5e400) [pid = 2212] [serial = 325] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:34 INFO - --DOMWINDOW == 38 (0x7f4b12770c00) [pid = 2212] [serial = 327] [outer = (nil)] [url = about:blank] 13:48:34 INFO - --DOMWINDOW == 37 (0x7f4b09bbe400) [pid = 2212] [serial = 338] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:48:34 INFO - --DOMWINDOW == 36 (0x7f4b00f5ec00) [pid = 2212] [serial = 329] [outer = (nil)] [url = about:blank] 13:48:34 INFO - --DOMWINDOW == 35 (0x7f4b019b8400) [pid = 2212] [serial = 331] [outer = (nil)] [url = about:blank] 13:48:34 INFO - --DOMWINDOW == 34 (0x7f4b07a10000) [pid = 2212] [serial = 344] [outer = (nil)] [url = about:blank] 13:48:34 INFO - --DOMWINDOW == 33 (0x7f4b09bc0c00) [pid = 2212] [serial = 335] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:48:34 INFO - --DOMWINDOW == 32 (0x7f4b00f58800) [pid = 2212] [serial = 328] [outer = (nil)] [url = about:blank] 13:48:34 INFO - --DOMWINDOW == 31 (0x7f4b019bb400) [pid = 2212] [serial = 332] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:34 INFO - --DOMWINDOW == 30 (0x7f4b019b4000) [pid = 2212] [serial = 330] [outer = (nil)] [url = data:text/html;charset=utf8,test%20for%20bug%20676722%20-%20inspectable%20objects%20for%20window.console] 13:48:35 INFO - MEMORY STAT | vsize 1107MB | residentFast 287MB | heapAllocated 106MB 13:48:35 INFO - 114 INFO TEST-OK | devtools/client/webconsole/test/browser_console_native_getters.js | took 15357ms 13:48:35 INFO - ++DOCSHELL 0x7f4b0175c000 == 11 [pid = 2212] [id = 152] 13:48:35 INFO - ++DOMWINDOW == 31 (0x7f4b019b3800) [pid = 2212] [serial = 352] [outer = (nil)] 13:48:35 INFO - ++DOMWINDOW == 32 (0x7f4b019bbc00) [pid = 2212] [serial = 353] [outer = 0x7f4b019b3800] 13:48:35 INFO - 115 INFO TEST-START | devtools/client/webconsole/test/browser_console_navigation_marker.js 13:48:35 INFO - ++DOCSHELL 0x7f4b07c32800 == 12 [pid = 2212] [id = 153] 13:48:35 INFO - ++DOMWINDOW == 33 (0x7f4b07a10800) [pid = 2212] [serial = 354] [outer = (nil)] 13:48:35 INFO - ++DOMWINDOW == 34 (0x7f4b07a13c00) [pid = 2212] [serial = 355] [outer = 0x7f4b07a10800] 13:48:35 INFO - ++DOMWINDOW == 35 (0x7f4b09586800) [pid = 2212] [serial = 356] [outer = 0x7f4b07a10800] 13:48:35 INFO - ++DOCSHELL 0x7f4b01767800 == 13 [pid = 2212] [id = 154] 13:48:35 INFO - ++DOMWINDOW == 36 (0x7f4b0984dc00) [pid = 2212] [serial = 357] [outer = (nil)] 13:48:35 INFO - ++DOMWINDOW == 37 (0x7f4b09850400) [pid = 2212] [serial = 358] [outer = 0x7f4b0984dc00] 13:48:35 INFO - ++DOMWINDOW == 38 (0x7f4b09854c00) [pid = 2212] [serial = 359] [outer = 0x7f4b0984dc00] 13:48:36 INFO - ++DOCSHELL 0x7f4b116e5800 == 14 [pid = 2212] [id = 155] 13:48:36 INFO - ++DOMWINDOW == 39 (0x7f4b0a862000) [pid = 2212] [serial = 360] [outer = (nil)] 13:48:36 INFO - ++DOMWINDOW == 40 (0x7f4b0a865000) [pid = 2212] [serial = 361] [outer = 0x7f4b0a862000] 13:48:38 INFO - ++DOMWINDOW == 41 (0x7f4b09bf6800) [pid = 2212] [serial = 362] [outer = 0x7f4b07a10800] 13:48:38 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:48:40 INFO - --DOCSHELL 0x7f4b01767800 == 13 [pid = 2212] [id = 154] 13:48:40 INFO - --DOCSHELL 0x7f4b116e5800 == 12 [pid = 2212] [id = 155] 13:48:40 INFO - --DOCSHELL 0x7f4b07c1f800 == 11 [pid = 2212] [id = 147] 13:48:40 INFO - --DOCSHELL 0x7f4b0176c800 == 10 [pid = 2212] [id = 146] 13:48:40 INFO - --DOMWINDOW == 40 (0x7f4b09529c00) [pid = 2212] [serial = 334] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:40 INFO - --DOMWINDOW == 39 (0x7f4b09bc2400) [pid = 2212] [serial = 336] [outer = (nil)] [url = about:blank] 13:48:40 INFO - --DOMWINDOW == 38 (0x7f4b0fbb0c00) [pid = 2212] [serial = 350] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:48:40 INFO - --DOMWINDOW == 37 (0x7f4b09bc0400) [pid = 2212] [serial = 346] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:48:40 INFO - --DOMWINDOW == 36 (0x7f4b00f5e000) [pid = 2212] [serial = 339] [outer = (nil)] [url = about:blank] 13:48:40 INFO - --DOMWINDOW == 35 (0x7f4b019bd800) [pid = 2212] [serial = 341] [outer = (nil)] [url = data:text/html;charset=utf8,bug870220

hello%20world

native%20getters!] 13:48:40 INFO - --DOMWINDOW == 34 (0x7f4b09850400) [pid = 2212] [serial = 358] [outer = (nil)] [url = about:blank] 13:48:40 INFO - --DOMWINDOW == 33 (0x7f4b07a05400) [pid = 2212] [serial = 343] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:40 INFO - --DOMWINDOW == 32 (0x7f4b00f58000) [pid = 2212] [serial = 348] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:48:40 INFO - --DOMWINDOW == 31 (0x7f4b019b1400) [pid = 2212] [serial = 340] [outer = (nil)] [url = about:blank] 13:48:40 INFO - --DOMWINDOW == 30 (0x7f4b07a13c00) [pid = 2212] [serial = 355] [outer = (nil)] [url = about:blank] 13:48:41 INFO - MEMORY STAT | vsize 1113MB | residentFast 284MB | heapAllocated 102MB 13:48:41 INFO - 116 INFO TEST-OK | devtools/client/webconsole/test/browser_console_navigation_marker.js | took 5719ms 13:48:41 INFO - ++DOCSHELL 0x7f4b0176c000 == 11 [pid = 2212] [id = 156] 13:48:41 INFO - ++DOMWINDOW == 31 (0x7f4b00f5ac00) [pid = 2212] [serial = 363] [outer = (nil)] 13:48:41 INFO - ++DOMWINDOW == 32 (0x7f4b00f63800) [pid = 2212] [serial = 364] [outer = 0x7f4b00f5ac00] 13:48:41 INFO - 117 INFO TEST-START | devtools/client/webconsole/test/browser_console_nsiconsolemessage.js 13:48:41 INFO - ++DOCSHELL 0x7f4b0191c800 == 12 [pid = 2212] [id = 157] 13:48:41 INFO - ++DOMWINDOW == 33 (0x7f4b07a05400) [pid = 2212] [serial = 365] [outer = (nil)] 13:48:41 INFO - ++DOMWINDOW == 34 (0x7f4b07a0a800) [pid = 2212] [serial = 366] [outer = 0x7f4b07a05400] 13:48:41 INFO - ++DOCSHELL 0x7f4b0175b000 == 13 [pid = 2212] [id = 158] 13:48:41 INFO - ++DOMWINDOW == 35 (0x7f4b07a0c400) [pid = 2212] [serial = 367] [outer = (nil)] 13:48:41 INFO - ++DOMWINDOW == 36 (0x7f4b087e5c00) [pid = 2212] [serial = 368] [outer = 0x7f4b07a0c400] 13:48:41 INFO - ++DOMWINDOW == 37 (0x7f4b0984b800) [pid = 2212] [serial = 369] [outer = 0x7f4b07a0c400] 13:48:42 INFO - ++DOCSHELL 0x7f4b0c827800 == 14 [pid = 2212] [id = 159] 13:48:42 INFO - ++DOMWINDOW == 38 (0x7f4b09e59000) [pid = 2212] [serial = 370] [outer = (nil)] 13:48:42 INFO - ++DOMWINDOW == 39 (0x7f4b0a03d800) [pid = 2212] [serial = 371] [outer = 0x7f4b09e59000] 13:48:44 INFO - --DOCSHELL 0x7f4b0c827800 == 13 [pid = 2212] [id = 159] 13:48:44 INFO - --DOCSHELL 0x7f4b07c32800 == 12 [pid = 2212] [id = 153] 13:48:44 INFO - --DOMWINDOW == 38 (0x7f4b09586800) [pid = 2212] [serial = 356] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:48:44 INFO - --DOMWINDOW == 37 (0x7f4b019bfc00) [pid = 2212] [serial = 342] [outer = (nil)] [url = about:blank] 13:48:44 INFO - --DOMWINDOW == 36 (0x7f4b1294b400) [pid = 2212] [serial = 351] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:48:44 INFO - --DOMWINDOW == 35 (0x7f4b019bd400) [pid = 2212] [serial = 349] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:48:44 INFO - --DOMWINDOW == 34 (0x7f4b09bfb400) [pid = 2212] [serial = 347] [outer = (nil)] [url = about:blank] 13:48:44 INFO - --DOMWINDOW == 33 (0x7f4b09621400) [pid = 2212] [serial = 345] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:44 INFO - --DOMWINDOW == 32 (0x7f4b019bbc00) [pid = 2212] [serial = 353] [outer = (nil)] [url = about:blank] 13:48:44 INFO - --DOMWINDOW == 31 (0x7f4b087e5c00) [pid = 2212] [serial = 368] [outer = (nil)] [url = about:blank] 13:48:44 INFO - --DOMWINDOW == 30 (0x7f4b0a862000) [pid = 2212] [serial = 360] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:48:44 INFO - --DOMWINDOW == 29 (0x7f4b0984dc00) [pid = 2212] [serial = 357] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:44 INFO - --DOMWINDOW == 28 (0x7f4b07a10800) [pid = 2212] [serial = 354] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:48:44 INFO - --DOMWINDOW == 27 (0x7f4b019b3800) [pid = 2212] [serial = 352] [outer = (nil)] [url = about:blank] 13:48:44 INFO - --DOMWINDOW == 26 (0x7f4b09bf6800) [pid = 2212] [serial = 362] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:48:44 INFO - ++DOCSHELL 0x7f4b0176d000 == 13 [pid = 2212] [id = 160] 13:48:44 INFO - ++DOMWINDOW == 27 (0x7f4b00f61800) [pid = 2212] [serial = 372] [outer = (nil)] 13:48:44 INFO - ++DOMWINDOW == 28 (0x7f4b00f62800) [pid = 2212] [serial = 373] [outer = 0x7f4b00f61800] 13:48:45 INFO - MEMORY STAT | vsize 1114MB | residentFast 280MB | heapAllocated 99MB 13:48:45 INFO - 118 INFO TEST-OK | devtools/client/webconsole/test/browser_console_nsiconsolemessage.js | took 4611ms 13:48:45 INFO - ++DOCSHELL 0x7f4b01759000 == 14 [pid = 2212] [id = 161] 13:48:45 INFO - ++DOMWINDOW == 29 (0x7f4b089e9000) [pid = 2212] [serial = 374] [outer = (nil)] 13:48:46 INFO - ++DOMWINDOW == 30 (0x7f4b09848400) [pid = 2212] [serial = 375] [outer = 0x7f4b089e9000] 13:48:46 INFO - 119 INFO TEST-START | devtools/client/webconsole/test/browser_console_open_or_focus.js 13:48:46 INFO - ++DOCSHELL 0x7f4b0c679800 == 15 [pid = 2212] [id = 162] 13:48:46 INFO - ++DOMWINDOW == 31 (0x7f4b09e54400) [pid = 2212] [serial = 376] [outer = (nil)] 13:48:46 INFO - ++DOMWINDOW == 32 (0x7f4b09e55c00) [pid = 2212] [serial = 377] [outer = 0x7f4b09e54400] 13:48:46 INFO - console.log: testmessage 13:48:47 INFO - MEMORY STAT | vsize 1114MB | residentFast 280MB | heapAllocated 100MB 13:48:47 INFO - 120 INFO TEST-OK | devtools/client/webconsole/test/browser_console_open_or_focus.js | took 1146ms 13:48:47 INFO - ++DOCSHELL 0x7f4b01909800 == 16 [pid = 2212] [id = 163] 13:48:47 INFO - ++DOMWINDOW == 33 (0x7f4b019b2400) [pid = 2212] [serial = 378] [outer = (nil)] 13:48:47 INFO - ++DOMWINDOW == 34 (0x7f4b019b8c00) [pid = 2212] [serial = 379] [outer = 0x7f4b019b2400] 13:48:47 INFO - 121 INFO TEST-START | devtools/client/webconsole/test/browser_console_optimized_out_vars.js 13:48:47 INFO - ++DOCSHELL 0x7f4b0a7ca000 == 17 [pid = 2212] [id = 164] 13:48:47 INFO - ++DOMWINDOW == 35 (0x7f4b09e54800) [pid = 2212] [serial = 380] [outer = (nil)] 13:48:47 INFO - ++DOMWINDOW == 36 (0x7f4b0a65f000) [pid = 2212] [serial = 381] [outer = 0x7f4b09e54800] 13:48:47 INFO - ++DOMWINDOW == 37 (0x7f4b0c4e1c00) [pid = 2212] [serial = 382] [outer = 0x7f4b09e54800] 13:48:48 INFO - ++DOCSHELL 0x7f4b0f7b9000 == 18 [pid = 2212] [id = 165] 13:48:48 INFO - ++DOMWINDOW == 38 (0x7f4b0a86a800) [pid = 2212] [serial = 383] [outer = (nil)] 13:48:48 INFO - ++DOMWINDOW == 39 (0x7f4b0fbb3800) [pid = 2212] [serial = 384] [outer = 0x7f4b0a86a800] 13:48:48 INFO - ++DOMWINDOW == 40 (0x7f4b00f65000) [pid = 2212] [serial = 385] [outer = 0x7f4b0a86a800] 13:48:48 INFO - ++DOCSHELL 0x7f4b094a7000 == 19 [pid = 2212] [id = 166] 13:48:48 INFO - ++DOMWINDOW == 41 (0x7f4b07a07000) [pid = 2212] [serial = 386] [outer = (nil)] 13:48:48 INFO - ++DOMWINDOW == 42 (0x7f4b07a0b800) [pid = 2212] [serial = 387] [outer = 0x7f4b07a07000] 13:48:50 INFO - ++DOCSHELL 0x7f4b12e69800 == 20 [pid = 2212] [id = 167] 13:48:50 INFO - ++DOMWINDOW == 43 (0x7f4b00f65400) [pid = 2212] [serial = 388] [outer = (nil)] 13:48:50 INFO - ++DOMWINDOW == 44 (0x7f4b14a96400) [pid = 2212] [serial = 389] [outer = 0x7f4b00f65400] 13:48:51 INFO - ++DOCSHELL 0x7f4b2578e800 == 21 [pid = 2212] [id = 168] 13:48:51 INFO - ++DOMWINDOW == 45 (0x7f4b25fcec00) [pid = 2212] [serial = 390] [outer = (nil)] 13:48:51 INFO - ++DOMWINDOW == 46 (0x7f4b25fd2c00) [pid = 2212] [serial = 391] [outer = 0x7f4b25fcec00] 13:48:53 INFO - --DOCSHELL 0x7f4b01759000 == 20 [pid = 2212] [id = 161] 13:48:53 INFO - --DOCSHELL 0x7f4b0175b000 == 19 [pid = 2212] [id = 158] 13:48:53 INFO - --DOCSHELL 0x7f4b0176d000 == 18 [pid = 2212] [id = 160] 13:48:53 INFO - --DOCSHELL 0x7f4b0c679800 == 17 [pid = 2212] [id = 162] 13:48:54 INFO - --DOCSHELL 0x7f4b0191c800 == 16 [pid = 2212] [id = 157] 13:48:54 INFO - --DOCSHELL 0x7f4b0175c000 == 15 [pid = 2212] [id = 152] 13:48:54 INFO - --DOCSHELL 0x7f4b0176c000 == 14 [pid = 2212] [id = 156] 13:48:55 INFO - --DOMWINDOW == 45 (0x7f4b09854c00) [pid = 2212] [serial = 359] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:55 INFO - --DOMWINDOW == 44 (0x7f4b0a865000) [pid = 2212] [serial = 361] [outer = (nil)] [url = about:blank] 13:48:58 INFO - --DOCSHELL 0x7f4b2578e800 == 13 [pid = 2212] [id = 168] 13:48:58 INFO - --DOCSHELL 0x7f4b12e69800 == 12 [pid = 2212] [id = 167] 13:48:58 INFO - --DOCSHELL 0x7f4b094a7000 == 11 [pid = 2212] [id = 166] 13:48:59 INFO - --DOMWINDOW == 43 (0x7f4b07a0c400) [pid = 2212] [serial = 367] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:48:59 INFO - --DOMWINDOW == 42 (0x7f4b09e59000) [pid = 2212] [serial = 370] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:48:59 INFO - --DOMWINDOW == 41 (0x7f4b09e54400) [pid = 2212] [serial = 376] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:48:59 INFO - --DOMWINDOW == 40 (0x7f4b00f61800) [pid = 2212] [serial = 372] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:48:59 INFO - --DOMWINDOW == 39 (0x7f4b089e9000) [pid = 2212] [serial = 374] [outer = (nil)] [url = about:blank] 13:48:59 INFO - --DOMWINDOW == 38 (0x7f4b00f5ac00) [pid = 2212] [serial = 363] [outer = (nil)] [url = about:blank] 13:48:59 INFO - --DOMWINDOW == 37 (0x7f4b07a05400) [pid = 2212] [serial = 365] [outer = (nil)] [url = data:text/html;charset=utf8,bug859756

hello%20world

nsIConsoleMessages%20ftw!] 13:48:59 INFO - --DOMWINDOW == 36 (0x7f4b09848400) [pid = 2212] [serial = 375] [outer = (nil)] [url = about:blank] 13:48:59 INFO - --DOMWINDOW == 35 (0x7f4b0a65f000) [pid = 2212] [serial = 381] [outer = (nil)] [url = about:blank] 13:48:59 INFO - --DOMWINDOW == 34 (0x7f4b0fbb3800) [pid = 2212] [serial = 384] [outer = (nil)] [url = about:blank] 13:48:59 INFO - --DOMWINDOW == 33 (0x7f4b00f63800) [pid = 2212] [serial = 364] [outer = (nil)] [url = about:blank] 13:48:59 INFO - --DOMWINDOW == 32 (0x7f4b07a0a800) [pid = 2212] [serial = 366] [outer = (nil)] [url = about:blank] 13:48:59 INFO - MEMORY STAT | vsize 1110MB | residentFast 279MB | heapAllocated 107MB 13:48:59 INFO - 122 INFO TEST-OK | devtools/client/webconsole/test/browser_console_optimized_out_vars.js | took 12290ms 13:48:59 INFO - ++DOCSHELL 0x7f4b01912800 == 12 [pid = 2212] [id = 169] 13:48:59 INFO - ++DOMWINDOW == 33 (0x7f4b019bb400) [pid = 2212] [serial = 392] [outer = (nil)] 13:48:59 INFO - ++DOMWINDOW == 34 (0x7f4b07a0cc00) [pid = 2212] [serial = 393] [outer = 0x7f4b019bb400] 13:49:00 INFO - 123 INFO TEST-START | devtools/client/webconsole/test/browser_console_private_browsing.js 13:49:00 INFO - ++DOCSHELL 0x7f4b07c35800 == 13 [pid = 2212] [id = 170] 13:49:00 INFO - ++DOMWINDOW == 35 (0x7f4b00f5cc00) [pid = 2212] [serial = 394] [outer = (nil)] 13:49:00 INFO - ++DOMWINDOW == 36 (0x7f4b089f5400) [pid = 2212] [serial = 395] [outer = 0x7f4b00f5cc00] 13:49:00 INFO - ++DOCSHELL 0x7f4b01758800 == 14 [pid = 2212] [id = 171] 13:49:00 INFO - ++DOMWINDOW == 37 (0x7f4b0984dc00) [pid = 2212] [serial = 396] [outer = (nil)] 13:49:00 INFO - ++DOMWINDOW == 38 (0x7f4b09853800) [pid = 2212] [serial = 397] [outer = 0x7f4b0984dc00] 13:49:00 INFO - ++DOCSHELL 0x7f4b0c83c000 == 15 [pid = 2212] [id = 172] 13:49:00 INFO - ++DOMWINDOW == 39 (0x7f4b0a65fc00) [pid = 2212] [serial = 398] [outer = (nil)] 13:49:00 INFO - ++DOCSHELL 0x7f4b0c841800 == 16 [pid = 2212] [id = 173] 13:49:00 INFO - ++DOMWINDOW == 40 (0x7f4b0a666c00) [pid = 2212] [serial = 399] [outer = (nil)] 13:49:00 INFO - ++DOMWINDOW == 41 (0x7f4b0a669400) [pid = 2212] [serial = 400] [outer = 0x7f4b0a666c00] 13:49:00 INFO - ++DOCSHELL 0x7f4b1274f000 == 17 [pid = 2212] [id = 174] 13:49:00 INFO - ++DOMWINDOW == 42 (0x7f4b0a65f000) [pid = 2212] [serial = 401] [outer = (nil)] 13:49:01 INFO - ++DOMWINDOW == 43 (0x7f4b0fbbb800) [pid = 2212] [serial = 402] [outer = 0x7f4b0a65f000] 13:49:01 INFO - ++DOMWINDOW == 44 (0x7f4b1214a000) [pid = 2212] [serial = 403] [outer = 0x7f4b0a65fc00] 13:49:01 INFO - ++DOMWINDOW == 45 (0x7f4b123c9c00) [pid = 2212] [serial = 404] [outer = 0x7f4b0a666c00] 13:49:01 INFO - ++DOMWINDOW == 46 (0x7f4b12605800) [pid = 2212] [serial = 405] [outer = 0x7f4b0a65f000] 13:49:02 INFO - ++DOMWINDOW == 47 (0x7f4b12bd4c00) [pid = 2212] [serial = 406] [outer = 0x7f4b0a65f000] 13:49:02 INFO - ++DOCSHELL 0x7f4b25fa0000 == 18 [pid = 2212] [id = 175] 13:49:02 INFO - ++DOMWINDOW == 48 (0x7f4b15706c00) [pid = 2212] [serial = 407] [outer = (nil)] 13:49:02 INFO - ++DOMWINDOW == 49 (0x7f4b15947400) [pid = 2212] [serial = 408] [outer = 0x7f4b15706c00] 13:49:02 INFO - ++DOCSHELL 0x7f4b2a4f3800 == 19 [pid = 2212] [id = 176] 13:49:02 INFO - ++DOMWINDOW == 50 (0x7f4b20da6400) [pid = 2212] [serial = 409] [outer = (nil)] 13:49:02 INFO - ++DOMWINDOW == 51 (0x7f4b20dad800) [pid = 2212] [serial = 410] [outer = 0x7f4b20da6400] 13:49:02 INFO - ++DOCSHELL 0x7f4b2a4e1800 == 20 [pid = 2212] [id = 177] 13:49:02 INFO - ++DOMWINDOW == 52 (0x7f4b257e9800) [pid = 2212] [serial = 411] [outer = (nil)] 13:49:02 INFO - ++DOMWINDOW == 53 (0x7f4b25919c00) [pid = 2212] [serial = 412] [outer = 0x7f4b257e9800] 13:49:02 INFO - ++DOMWINDOW == 54 (0x7f4b12e38800) [pid = 2212] [serial = 413] [outer = 0x7f4b257e9800] 13:49:02 INFO - [2212] WARNING: attempt to modify an immutable nsStandardURL: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/base/nsStandardURL.cpp, line 1297 13:49:03 INFO - [2212] WARNING: attempt to modify an immutable nsStandardURL: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/base/nsStandardURL.cpp, line 1297 13:49:03 INFO - ++DOMWINDOW == 55 (0x7f4b29da8800) [pid = 2212] [serial = 414] [outer = 0x7f4b20da6400] 13:49:03 INFO - ++DOCSHELL 0x7f4b2a4f4800 == 21 [pid = 2212] [id = 178] 13:49:03 INFO - ++DOMWINDOW == 56 (0x7f4b29dc1000) [pid = 2212] [serial = 415] [outer = (nil)] 13:49:03 INFO - ++DOMWINDOW == 57 (0x7f4b29dc2000) [pid = 2212] [serial = 416] [outer = 0x7f4b29dc1000] 13:49:05 INFO - JavaScript error: data:text/html;charset=utf8,

hello%20world!%20bug%20874061click, line 1: ReferenceError: fooBazBaz is not defined 13:49:06 INFO - --DOCSHELL 0x7f4b0a7ca000 == 20 [pid = 2212] [id = 164] 13:49:06 INFO - --DOCSHELL 0x7f4b01909800 == 19 [pid = 2212] [id = 163] 13:49:06 INFO - --DOCSHELL 0x7f4b0f7b9000 == 18 [pid = 2212] [id = 165] 13:49:06 INFO - --DOCSHELL 0x7f4b2a4f4800 == 17 [pid = 2212] [id = 178] 13:49:06 INFO - --DOMWINDOW == 56 (0x7f4b0a03d800) [pid = 2212] [serial = 371] [outer = (nil)] [url = about:blank] 13:49:06 INFO - --DOMWINDOW == 55 (0x7f4b0984b800) [pid = 2212] [serial = 369] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:49:06 INFO - --DOMWINDOW == 54 (0x7f4b00f62800) [pid = 2212] [serial = 373] [outer = (nil)] [url = about:blank] 13:49:06 INFO - --DOMWINDOW == 53 (0x7f4b09e55c00) [pid = 2212] [serial = 377] [outer = (nil)] [url = about:blank] 13:49:06 INFO - --DOMWINDOW == 52 (0x7f4b0a669400) [pid = 2212] [serial = 400] [outer = 0x7f4b0a666c00] [url = about:blank] 13:49:06 INFO - ++DOCSHELL 0x7f4aff205000 == 18 [pid = 2212] [id = 179] 13:49:06 INFO - ++DOMWINDOW == 53 (0x7f4b00f28000) [pid = 2212] [serial = 417] [outer = (nil)] 13:49:06 INFO - ++DOMWINDOW == 54 (0x7f4b00f2fc00) [pid = 2212] [serial = 418] [outer = 0x7f4b00f28000] 13:49:07 INFO - --DOMWINDOW == 53 (0x7f4b20dad800) [pid = 2212] [serial = 410] [outer = (nil)] [url = about:blank] 13:49:07 INFO - --DOMWINDOW == 52 (0x7f4b019b8c00) [pid = 2212] [serial = 379] [outer = (nil)] [url = about:blank] 13:49:07 INFO - --DOMWINDOW == 51 (0x7f4b0fbbb800) [pid = 2212] [serial = 402] [outer = (nil)] [url = about:blank] 13:49:07 INFO - --DOMWINDOW == 50 (0x7f4b12605800) [pid = 2212] [serial = 405] [outer = (nil)] [url = about:blank] 13:49:07 INFO - --DOMWINDOW == 49 (0x7f4b25919c00) [pid = 2212] [serial = 412] [outer = (nil)] [url = about:blank] 13:49:07 INFO - --DOMWINDOW == 48 (0x7f4b09e54800) [pid = 2212] [serial = 380] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-closure-optimized-out.html] 13:49:07 INFO - --DOMWINDOW == 47 (0x7f4b07a07000) [pid = 2212] [serial = 386] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:49:07 INFO - --DOMWINDOW == 46 (0x7f4b0a86a800) [pid = 2212] [serial = 383] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:49:07 INFO - --DOMWINDOW == 45 (0x7f4b00f65400) [pid = 2212] [serial = 388] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul] 13:49:07 INFO - --DOMWINDOW == 44 (0x7f4b019b2400) [pid = 2212] [serial = 378] [outer = (nil)] [url = about:blank] 13:49:07 INFO - --DOMWINDOW == 43 (0x7f4b25fcec00) [pid = 2212] [serial = 390] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:49:07 INFO - --DOMWINDOW == 42 (0x7f4b0c4e1c00) [pid = 2212] [serial = 382] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-closure-optimized-out.html] 13:49:07 INFO - ++DOMWINDOW == 43 (0x7f4b07a0dc00) [pid = 2212] [serial = 419] [outer = 0x7f4b00f28000] 13:49:07 INFO - ++DOCSHELL 0x7f4b01907800 == 19 [pid = 2212] [id = 180] 13:49:07 INFO - ++DOMWINDOW == 44 (0x7f4b09bb6800) [pid = 2212] [serial = 420] [outer = (nil)] 13:49:07 INFO - ++DOMWINDOW == 45 (0x7f4b09bb9400) [pid = 2212] [serial = 421] [outer = 0x7f4b09bb6800] 13:49:09 INFO - --DOCSHELL 0x7f4b01907800 == 18 [pid = 2212] [id = 180] 13:49:09 INFO - --DOCSHELL 0x7f4b2a4f3800 == 17 [pid = 2212] [id = 176] 13:49:09 INFO - --DOMWINDOW == 44 (0x7f4b14a96400) [pid = 2212] [serial = 389] [outer = (nil)] [url = about:blank] 13:49:09 INFO - --DOMWINDOW == 43 (0x7f4b07a0b800) [pid = 2212] [serial = 387] [outer = (nil)] [url = about:blank] 13:49:09 INFO - --DOMWINDOW == 42 (0x7f4b00f65000) [pid = 2212] [serial = 385] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:49:09 INFO - --DOMWINDOW == 41 (0x7f4b25fd2c00) [pid = 2212] [serial = 391] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:49:09 INFO - --DOMWINDOW == 40 (0x7f4b00f2fc00) [pid = 2212] [serial = 418] [outer = (nil)] [url = about:blank] 13:49:10 INFO - ++DOCSHELL 0x7f4aff217000 == 18 [pid = 2212] [id = 181] 13:49:10 INFO - ++DOMWINDOW == 41 (0x7f4b019b3800) [pid = 2212] [serial = 422] [outer = (nil)] 13:49:10 INFO - ++DOMWINDOW == 42 (0x7f4b019b4400) [pid = 2212] [serial = 423] [outer = 0x7f4b019b3800] 13:49:10 INFO - JavaScript error: data:text/html;charset=utf8,

hello%20world!%20bug%20874061click, line 1: ReferenceError: fooBazBaz is not defined 13:49:11 INFO - ++DOCSHELL 0x7f4aff20e800 == 19 [pid = 2212] [id = 182] 13:49:11 INFO - ++DOMWINDOW == 43 (0x7f4b07a0ec00) [pid = 2212] [serial = 424] [outer = (nil)] 13:49:11 INFO - ++DOMWINDOW == 44 (0x7f4b07d5e000) [pid = 2212] [serial = 425] [outer = 0x7f4b07a0ec00] 13:49:12 INFO - MEMORY STAT | vsize 1114MB | residentFast 289MB | heapAllocated 110MB 13:49:12 INFO - 124 INFO TEST-OK | devtools/client/webconsole/test/browser_console_private_browsing.js | took 12567ms 13:49:12 INFO - ++DOCSHELL 0x7f4b01764800 == 20 [pid = 2212] [id = 183] 13:49:12 INFO - ++DOMWINDOW == 45 (0x7f4b087e6000) [pid = 2212] [serial = 426] [outer = (nil)] 13:49:12 INFO - ++DOMWINDOW == 46 (0x7f4b0984b000) [pid = 2212] [serial = 427] [outer = 0x7f4b087e6000] 13:49:12 INFO - 125 INFO TEST-START | devtools/client/webconsole/test/browser_console_server_logging.js 13:49:12 INFO - ++DOCSHELL 0x7f4b1757d000 == 21 [pid = 2212] [id = 184] 13:49:12 INFO - ++DOMWINDOW == 47 (0x7f4b0c8f6800) [pid = 2212] [serial = 428] [outer = (nil)] 13:49:13 INFO - ++DOMWINDOW == 48 (0x7f4b120a1800) [pid = 2212] [serial = 429] [outer = 0x7f4b0c8f6800] 13:49:13 INFO - ++DOMWINDOW == 49 (0x7f4b1277cc00) [pid = 2212] [serial = 430] [outer = 0x7f4b0c8f6800] 13:49:13 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:49:13 INFO - ++DOCSHELL 0x7f4b0c832800 == 22 [pid = 2212] [id = 185] 13:49:13 INFO - ++DOMWINDOW == 50 (0x7f4b12bd4400) [pid = 2212] [serial = 431] [outer = (nil)] 13:49:13 INFO - ++DOMWINDOW == 51 (0x7f4b12bd5c00) [pid = 2212] [serial = 432] [outer = 0x7f4b12bd4400] 13:49:13 INFO - ++DOMWINDOW == 52 (0x7f4b12954800) [pid = 2212] [serial = 433] [outer = 0x7f4b12bd4400] 13:49:13 INFO - ++DOCSHELL 0x7f4b19751800 == 23 [pid = 2212] [id = 186] 13:49:13 INFO - ++DOMWINDOW == 53 (0x7f4b25f52400) [pid = 2212] [serial = 434] [outer = (nil)] 13:49:13 INFO - ++DOMWINDOW == 54 (0x7f4b25f5dc00) [pid = 2212] [serial = 435] [outer = 0x7f4b25f52400] 13:49:16 INFO - ++DOMWINDOW == 55 (0x7f4b20046c00) [pid = 2212] [serial = 436] [outer = 0x7f4b0c8f6800] 13:49:16 INFO - [2212] WARNING: Page was shift reloaded, skipping ServiceWorker control: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsDocument.cpp, line 4702 13:49:16 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:49:17 INFO - --DOCSHELL 0x7f4b07c35800 == 22 [pid = 2212] [id = 170] 13:49:17 INFO - --DOCSHELL 0x7f4b19751800 == 21 [pid = 2212] [id = 186] 13:49:17 INFO - --DOCSHELL 0x7f4b01912800 == 20 [pid = 2212] [id = 169] 13:49:17 INFO - --DOCSHELL 0x7f4b01758800 == 19 [pid = 2212] [id = 171] 13:49:17 INFO - --DOCSHELL 0x7f4b1274f000 == 18 [pid = 2212] [id = 174] 13:49:17 INFO - --DOCSHELL 0x7f4b0c83c000 == 17 [pid = 2212] [id = 172] 13:49:17 INFO - --DOCSHELL 0x7f4b0c841800 == 16 [pid = 2212] [id = 173] 13:49:17 INFO - --DOCSHELL 0x7f4b25fa0000 == 15 [pid = 2212] [id = 175] 13:49:17 INFO - --DOCSHELL 0x7f4aff205000 == 14 [pid = 2212] [id = 179] 13:49:17 INFO - --DOCSHELL 0x7f4b2a4e1800 == 13 [pid = 2212] [id = 177] 13:49:17 INFO - --DOCSHELL 0x7f4aff217000 == 12 [pid = 2212] [id = 181] 13:49:17 INFO - --DOCSHELL 0x7f4aff20e800 == 11 [pid = 2212] [id = 182] 13:49:17 INFO - --DOMWINDOW == 54 (0x7f4b123c9c00) [pid = 2212] [serial = 404] [outer = 0x7f4b0a666c00] [url = about:blank] 13:49:17 INFO - --DOMWINDOW == 53 (0x7f4b1214a000) [pid = 2212] [serial = 403] [outer = 0x7f4b0a65fc00] [url = about:blank] 13:49:17 INFO - --DOMWINDOW == 52 (0x7f4b0a65fc00) [pid = 2212] [serial = 398] [outer = (nil)] [url = about:blank] 13:49:17 INFO - --DOMWINDOW == 51 (0x7f4b0a666c00) [pid = 2212] [serial = 399] [outer = (nil)] [url = about:blank] 13:49:18 INFO - --DOMWINDOW == 50 (0x7f4b09bb6800) [pid = 2212] [serial = 420] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:49:18 INFO - --DOMWINDOW == 49 (0x7f4b257e9800) [pid = 2212] [serial = 411] [outer = (nil)] [url = about:privatebrowsing] 13:49:18 INFO - --DOMWINDOW == 48 (0x7f4b07a0cc00) [pid = 2212] [serial = 393] [outer = (nil)] [url = about:blank] 13:49:18 INFO - --DOMWINDOW == 47 (0x7f4b00f28000) [pid = 2212] [serial = 417] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:49:18 INFO - --DOMWINDOW == 46 (0x7f4b20da6400) [pid = 2212] [serial = 409] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:49:18 INFO - --DOMWINDOW == 45 (0x7f4b120a1800) [pid = 2212] [serial = 429] [outer = (nil)] [url = about:blank] 13:49:18 INFO - --DOMWINDOW == 44 (0x7f4b12bd5c00) [pid = 2212] [serial = 432] [outer = (nil)] [url = about:blank] 13:49:18 INFO - --DOMWINDOW == 43 (0x7f4b089f5400) [pid = 2212] [serial = 395] [outer = (nil)] [url = about:blank] 13:49:18 INFO - --DOMWINDOW == 42 (0x7f4b0a65f000) [pid = 2212] [serial = 401] [outer = (nil)] [url = about:privatebrowsing] 13:49:18 INFO - --DOMWINDOW == 41 (0x7f4b019bb400) [pid = 2212] [serial = 392] [outer = (nil)] [url = about:blank] 13:49:18 INFO - --DOMWINDOW == 40 (0x7f4b29dc1000) [pid = 2212] [serial = 415] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:49:18 INFO - --DOMWINDOW == 39 (0x7f4b07a0ec00) [pid = 2212] [serial = 424] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:49:18 INFO - --DOMWINDOW == 38 (0x7f4b15706c00) [pid = 2212] [serial = 407] [outer = (nil)] [url = data:text/html;charset=utf8,

hello%20world!%20bug%20874061click] 13:49:18 INFO - --DOMWINDOW == 37 (0x7f4b019b3800) [pid = 2212] [serial = 422] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:49:18 INFO - --DOMWINDOW == 36 (0x7f4b0984dc00) [pid = 2212] [serial = 396] [outer = (nil)] [url = chrome://browser/content/browser.xul] 13:49:18 INFO - --DOMWINDOW == 35 (0x7f4b00f5cc00) [pid = 2212] [serial = 394] [outer = (nil)] [url = data:text/html;charset=utf8,

hello%20world!%20I%20am%20not%20private!] 13:49:18 INFO - MEMORY STAT | vsize 1116MB | residentFast 288MB | heapAllocated 107MB 13:49:18 INFO - 126 INFO TEST-OK | devtools/client/webconsole/test/browser_console_server_logging.js | took 5436ms 13:49:18 INFO - ++DOCSHELL 0x7f4b01773800 == 12 [pid = 2212] [id = 187] 13:49:18 INFO - ++DOMWINDOW == 36 (0x7f4b07a06c00) [pid = 2212] [serial = 437] [outer = (nil)] 13:49:18 INFO - ++DOMWINDOW == 37 (0x7f4b07a10800) [pid = 2212] [serial = 438] [outer = 0x7f4b07a06c00] 13:49:18 INFO - 127 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view.js 13:49:18 INFO - ++DOCSHELL 0x7f4b0c021000 == 13 [pid = 2212] [id = 188] 13:49:18 INFO - ++DOMWINDOW == 38 (0x7f4b09848800) [pid = 2212] [serial = 439] [outer = (nil)] 13:49:18 INFO - ++DOMWINDOW == 39 (0x7f4b0984c400) [pid = 2212] [serial = 440] [outer = 0x7f4b09848800] 13:49:18 INFO - ++DOMWINDOW == 40 (0x7f4b09bb7c00) [pid = 2212] [serial = 441] [outer = 0x7f4b09848800] 13:49:19 INFO - ++DOCSHELL 0x7f4aff220800 == 14 [pid = 2212] [id = 189] 13:49:19 INFO - ++DOMWINDOW == 41 (0x7f4b0a045400) [pid = 2212] [serial = 442] [outer = (nil)] 13:49:19 INFO - ++DOMWINDOW == 42 (0x7f4b0a65fc00) [pid = 2212] [serial = 443] [outer = 0x7f4b0a045400] 13:49:19 INFO - ++DOMWINDOW == 43 (0x7f4b0c4e0c00) [pid = 2212] [serial = 444] [outer = 0x7f4b0a045400] 13:49:19 INFO - ++DOCSHELL 0x7f4b142ea800 == 15 [pid = 2212] [id = 190] 13:49:19 INFO - ++DOMWINDOW == 44 (0x7f4b0fbb5000) [pid = 2212] [serial = 445] [outer = (nil)] 13:49:19 INFO - ++DOMWINDOW == 45 (0x7f4b0fbb8400) [pid = 2212] [serial = 446] [outer = 0x7f4b0fbb5000] 13:49:21 INFO - ++DOCSHELL 0x7f4b25fa8000 == 16 [pid = 2212] [id = 191] 13:49:21 INFO - ++DOMWINDOW == 46 (0x7f4b25756000) [pid = 2212] [serial = 447] [outer = (nil)] 13:49:21 INFO - ++DOMWINDOW == 47 (0x7f4b25757400) [pid = 2212] [serial = 448] [outer = 0x7f4b25756000] 13:49:24 INFO - --DOCSHELL 0x7f4b0c832800 == 15 [pid = 2212] [id = 185] 13:49:24 INFO - --DOCSHELL 0x7f4aff220800 == 14 [pid = 2212] [id = 189] 13:49:24 INFO - --DOCSHELL 0x7f4b1757d000 == 13 [pid = 2212] [id = 184] 13:49:24 INFO - --DOCSHELL 0x7f4b01764800 == 12 [pid = 2212] [id = 183] 13:49:24 INFO - --DOCSHELL 0x7f4b142ea800 == 11 [pid = 2212] [id = 190] 13:49:24 INFO - --DOCSHELL 0x7f4b25fa8000 == 10 [pid = 2212] [id = 191] 13:49:24 INFO - --DOMWINDOW == 46 (0x7f4b12e38800) [pid = 2212] [serial = 413] [outer = (nil)] [url = about:privatebrowsing] 13:49:24 INFO - --DOMWINDOW == 45 (0x7f4b12bd4c00) [pid = 2212] [serial = 406] [outer = (nil)] [url = about:privatebrowsing] 13:49:24 INFO - --DOMWINDOW == 44 (0x7f4b15947400) [pid = 2212] [serial = 408] [outer = (nil)] [url = about:blank] 13:49:24 INFO - --DOMWINDOW == 43 (0x7f4b09853800) [pid = 2212] [serial = 397] [outer = (nil)] [url = about:blank] 13:49:24 INFO - --DOMWINDOW == 42 (0x7f4b29da8800) [pid = 2212] [serial = 414] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:49:24 INFO - --DOMWINDOW == 41 (0x7f4b29dc2000) [pid = 2212] [serial = 416] [outer = (nil)] [url = about:blank] 13:49:24 INFO - --DOMWINDOW == 40 (0x7f4b07a0dc00) [pid = 2212] [serial = 419] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:49:24 INFO - --DOMWINDOW == 39 (0x7f4b09bb9400) [pid = 2212] [serial = 421] [outer = (nil)] [url = about:blank] 13:49:24 INFO - --DOMWINDOW == 38 (0x7f4b019b4400) [pid = 2212] [serial = 423] [outer = (nil)] [url = about:blank] 13:49:24 INFO - --DOMWINDOW == 37 (0x7f4b07d5e000) [pid = 2212] [serial = 425] [outer = (nil)] [url = about:blank] 13:49:24 INFO - --DOMWINDOW == 36 (0x7f4b0984b000) [pid = 2212] [serial = 427] [outer = (nil)] [url = about:blank] 13:49:24 INFO - --DOMWINDOW == 35 (0x7f4b0984c400) [pid = 2212] [serial = 440] [outer = (nil)] [url = about:blank] 13:49:24 INFO - --DOMWINDOW == 34 (0x7f4b0a65fc00) [pid = 2212] [serial = 443] [outer = (nil)] [url = about:blank] 13:49:24 INFO - --DOMWINDOW == 33 (0x7f4b12bd4400) [pid = 2212] [serial = 431] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:49:24 INFO - --DOMWINDOW == 32 (0x7f4b25f52400) [pid = 2212] [serial = 434] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:49:24 INFO - --DOMWINDOW == 31 (0x7f4b087e6000) [pid = 2212] [serial = 426] [outer = (nil)] [url = about:blank] 13:49:24 INFO - --DOMWINDOW == 30 (0x7f4b0c8f6800) [pid = 2212] [serial = 428] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-server-logging.sjs] 13:49:24 INFO - --DOMWINDOW == 29 (0x7f4b1277cc00) [pid = 2212] [serial = 430] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-server-logging.sjs] 13:49:24 INFO - --DOMWINDOW == 28 (0x7f4b20046c00) [pid = 2212] [serial = 436] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-server-logging.sjs] 13:49:24 INFO - MEMORY STAT | vsize 1115MB | residentFast 286MB | heapAllocated 104MB 13:49:24 INFO - 128 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view.js | took 6151ms 13:49:24 INFO - ++DOCSHELL 0x7f4aff213000 == 11 [pid = 2212] [id = 192] 13:49:24 INFO - ++DOMWINDOW == 29 (0x7f4b00f5e400) [pid = 2212] [serial = 449] [outer = (nil)] 13:49:24 INFO - ++DOMWINDOW == 30 (0x7f4b019b7400) [pid = 2212] [serial = 450] [outer = 0x7f4b00f5e400] 13:49:25 INFO - 129 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_dom_nodes.js 13:49:25 INFO - ++DOCSHELL 0x7f4b0176c800 == 12 [pid = 2212] [id = 193] 13:49:25 INFO - ++DOMWINDOW == 31 (0x7f4b07a0a800) [pid = 2212] [serial = 451] [outer = (nil)] 13:49:25 INFO - ++DOMWINDOW == 32 (0x7f4b07a0f000) [pid = 2212] [serial = 452] [outer = 0x7f4b07a0a800] 13:49:25 INFO - ++DOCSHELL 0x7f4aff221000 == 13 [pid = 2212] [id = 194] 13:49:25 INFO - ++DOMWINDOW == 33 (0x7f4b07a10000) [pid = 2212] [serial = 453] [outer = (nil)] 13:49:25 INFO - ++DOMWINDOW == 34 (0x7f4b09585800) [pid = 2212] [serial = 454] [outer = 0x7f4b07a10000] 13:49:25 INFO - ++DOMWINDOW == 35 (0x7f4b09853800) [pid = 2212] [serial = 455] [outer = 0x7f4b07a10000] 13:49:25 INFO - ++DOCSHELL 0x7f4b0c837800 == 14 [pid = 2212] [id = 195] 13:49:25 INFO - ++DOMWINDOW == 36 (0x7f4b0a863c00) [pid = 2212] [serial = 456] [outer = (nil)] 13:49:25 INFO - ++DOMWINDOW == 37 (0x7f4b0a867c00) [pid = 2212] [serial = 457] [outer = 0x7f4b0a863c00] 13:49:27 INFO - ++DOCSHELL 0x7f4b1494f800 == 15 [pid = 2212] [id = 196] 13:49:27 INFO - ++DOMWINDOW == 38 (0x7f4b0984d400) [pid = 2212] [serial = 458] [outer = (nil)] 13:49:27 INFO - ++DOMWINDOW == 39 (0x7f4b1296f800) [pid = 2212] [serial = 459] [outer = 0x7f4b0984d400] 13:49:28 INFO - --DOCSHELL 0x7f4b01773800 == 14 [pid = 2212] [id = 187] 13:49:28 INFO - --DOCSHELL 0x7f4b0c021000 == 13 [pid = 2212] [id = 188] 13:49:28 INFO - --DOCSHELL 0x7f4b0c837800 == 12 [pid = 2212] [id = 195] 13:49:28 INFO - --DOCSHELL 0x7f4b1494f800 == 11 [pid = 2212] [id = 196] 13:49:29 INFO - --DOMWINDOW == 38 (0x7f4b12954800) [pid = 2212] [serial = 433] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:49:29 INFO - --DOMWINDOW == 37 (0x7f4b25f5dc00) [pid = 2212] [serial = 435] [outer = (nil)] [url = about:blank] 13:49:29 INFO - --DOMWINDOW == 36 (0x7f4b09585800) [pid = 2212] [serial = 454] [outer = (nil)] [url = about:blank] 13:49:29 INFO - --DOMWINDOW == 35 (0x7f4b07a10800) [pid = 2212] [serial = 438] [outer = (nil)] [url = about:blank] 13:49:29 INFO - --DOMWINDOW == 34 (0x7f4b25756000) [pid = 2212] [serial = 447] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:49:29 INFO - --DOMWINDOW == 33 (0x7f4b07a06c00) [pid = 2212] [serial = 437] [outer = (nil)] [url = about:blank] 13:49:29 INFO - --DOMWINDOW == 32 (0x7f4b09848800) [pid = 2212] [serial = 439] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 13:49:29 INFO - --DOMWINDOW == 31 (0x7f4b09bb7c00) [pid = 2212] [serial = 441] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 13:49:29 INFO - MEMORY STAT | vsize 1117MB | residentFast 282MB | heapAllocated 105MB 13:49:29 INFO - 130 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_dom_nodes.js | took 4563ms 13:49:29 INFO - ++DOCSHELL 0x7f4b07c25000 == 12 [pid = 2212] [id = 197] 13:49:29 INFO - ++DOMWINDOW == 32 (0x7f4b07a10c00) [pid = 2212] [serial = 460] [outer = (nil)] 13:49:29 INFO - ++DOMWINDOW == 33 (0x7f4b07d5ec00) [pid = 2212] [serial = 461] [outer = 0x7f4b07a10c00] 13:49:29 INFO - 131 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_dont_sort_non_sortable_classes_properties.js 13:49:29 INFO - ++DOCSHELL 0x7f4b0949a800 == 13 [pid = 2212] [id = 198] 13:49:29 INFO - ++DOMWINDOW == 34 (0x7f4b09625c00) [pid = 2212] [serial = 462] [outer = (nil)] 13:49:29 INFO - ++DOMWINDOW == 35 (0x7f4b09849000) [pid = 2212] [serial = 463] [outer = 0x7f4b09625c00] 13:49:30 INFO - ++DOCSHELL 0x7f4aff20a800 == 14 [pid = 2212] [id = 199] 13:49:30 INFO - ++DOMWINDOW == 36 (0x7f4b0984e800) [pid = 2212] [serial = 464] [outer = (nil)] 13:49:30 INFO - ++DOMWINDOW == 37 (0x7f4b09e54400) [pid = 2212] [serial = 465] [outer = 0x7f4b0984e800] 13:49:30 INFO - ++DOMWINDOW == 38 (0x7f4b07a05000) [pid = 2212] [serial = 466] [outer = 0x7f4b0984e800] 13:49:30 INFO - ++DOCSHELL 0x7f4b141f6800 == 15 [pid = 2212] [id = 200] 13:49:30 INFO - ++DOMWINDOW == 39 (0x7f4b0f7e0800) [pid = 2212] [serial = 467] [outer = (nil)] 13:49:30 INFO - ++DOMWINDOW == 40 (0x7f4b11ef0800) [pid = 2212] [serial = 468] [outer = 0x7f4b0f7e0800] 13:49:32 INFO - ++DOCSHELL 0x7f4b0190a800 == 16 [pid = 2212] [id = 201] 13:49:32 INFO - ++DOMWINDOW == 41 (0x7f4b07d75400) [pid = 2212] [serial = 469] [outer = (nil)] 13:49:32 INFO - ++DOMWINDOW == 42 (0x7f4b09586000) [pid = 2212] [serial = 470] [outer = 0x7f4b07d75400] 13:49:41 INFO - --DOCSHELL 0x7f4aff213000 == 15 [pid = 2212] [id = 192] 13:49:41 INFO - --DOCSHELL 0x7f4b0176c800 == 14 [pid = 2212] [id = 193] 13:49:41 INFO - --DOCSHELL 0x7f4aff20a800 == 13 [pid = 2212] [id = 199] 13:49:41 INFO - --DOCSHELL 0x7f4b141f6800 == 12 [pid = 2212] [id = 200] 13:49:41 INFO - --DOCSHELL 0x7f4aff221000 == 11 [pid = 2212] [id = 194] 13:49:42 INFO - --DOMWINDOW == 41 (0x7f4b25757400) [pid = 2212] [serial = 448] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:49:42 INFO - --DOMWINDOW == 40 (0x7f4b07a0a800) [pid = 2212] [serial = 451] [outer = (nil)] [url = data:text/html;charset=utf-8,%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20Test%20for%20DOM%20nodes%20in%20variables%20view%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%] 13:49:42 INFO - --DOMWINDOW == 39 (0x7f4b00f5e400) [pid = 2212] [serial = 449] [outer = (nil)] [url = about:blank] 13:49:42 INFO - --DOMWINDOW == 38 (0x7f4b0984d400) [pid = 2212] [serial = 458] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:49:42 INFO - --DOMWINDOW == 37 (0x7f4b09e54400) [pid = 2212] [serial = 465] [outer = (nil)] [url = about:blank] 13:49:42 INFO - --DOMWINDOW == 36 (0x7f4b07a0f000) [pid = 2212] [serial = 452] [outer = (nil)] [url = about:blank] 13:49:42 INFO - --DOMWINDOW == 35 (0x7f4b019b7400) [pid = 2212] [serial = 450] [outer = (nil)] [url = about:blank] 13:49:42 INFO - --DOMWINDOW == 34 (0x7f4b0fbb5000) [pid = 2212] [serial = 445] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:49:42 INFO - --DOMWINDOW == 33 (0x7f4b0a863c00) [pid = 2212] [serial = 456] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:49:42 INFO - --DOMWINDOW == 32 (0x7f4b07a10000) [pid = 2212] [serial = 453] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:49:42 INFO - --DOMWINDOW == 31 (0x7f4b0a045400) [pid = 2212] [serial = 442] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:49:42 INFO - MEMORY STAT | vsize 1117MB | residentFast 292MB | heapAllocated 112MB 13:49:42 INFO - 132 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_dont_sort_non_sortable_classes_properties.js | took 12834ms 13:49:42 INFO - ++DOCSHELL 0x7f4aff216000 == 12 [pid = 2212] [id = 202] 13:49:42 INFO - ++DOMWINDOW == 32 (0x7f4b07a04400) [pid = 2212] [serial = 471] [outer = (nil)] 13:49:42 INFO - ++DOMWINDOW == 33 (0x7f4b07a11c00) [pid = 2212] [serial = 472] [outer = 0x7f4b07a04400] 13:49:42 INFO - 133 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_filter.js 13:49:42 INFO - ++DOCSHELL 0x7f4b07c5f000 == 13 [pid = 2212] [id = 203] 13:49:42 INFO - ++DOMWINDOW == 34 (0x7f4b09620c00) [pid = 2212] [serial = 473] [outer = (nil)] 13:49:42 INFO - ++DOMWINDOW == 35 (0x7f4b09849800) [pid = 2212] [serial = 474] [outer = 0x7f4b09620c00] 13:49:43 INFO - ++DOCSHELL 0x7f4aff207000 == 14 [pid = 2212] [id = 204] 13:49:43 INFO - ++DOMWINDOW == 36 (0x7f4b0984b800) [pid = 2212] [serial = 475] [outer = (nil)] 13:49:43 INFO - ++DOMWINDOW == 37 (0x7f4b09bbac00) [pid = 2212] [serial = 476] [outer = 0x7f4b0984b800] 13:49:43 INFO - ++DOMWINDOW == 38 (0x7f4b0a867400) [pid = 2212] [serial = 477] [outer = 0x7f4b0984b800] 13:49:43 INFO - ++DOCSHELL 0x7f4b1276c000 == 15 [pid = 2212] [id = 205] 13:49:43 INFO - ++DOMWINDOW == 39 (0x7f4b0f7dbc00) [pid = 2212] [serial = 478] [outer = (nil)] 13:49:43 INFO - ++DOMWINDOW == 40 (0x7f4b0f981c00) [pid = 2212] [serial = 479] [outer = 0x7f4b0f7dbc00] 13:49:44 INFO - ++DOCSHELL 0x7f4b2a4f6000 == 16 [pid = 2212] [id = 206] 13:49:44 INFO - ++DOMWINDOW == 41 (0x7f4b203cd800) [pid = 2212] [serial = 480] [outer = (nil)] 13:49:44 INFO - ++DOMWINDOW == 42 (0x7f4b20db5000) [pid = 2212] [serial = 481] [outer = 0x7f4b203cd800] 13:49:47 INFO - --DOCSHELL 0x7f4aff207000 == 15 [pid = 2212] [id = 204] 13:49:47 INFO - --DOCSHELL 0x7f4b07c25000 == 14 [pid = 2212] [id = 197] 13:49:47 INFO - --DOCSHELL 0x7f4b0190a800 == 13 [pid = 2212] [id = 201] 13:49:47 INFO - --DOCSHELL 0x7f4b1276c000 == 12 [pid = 2212] [id = 205] 13:49:47 INFO - --DOCSHELL 0x7f4b0949a800 == 11 [pid = 2212] [id = 198] 13:49:47 INFO - --DOCSHELL 0x7f4b2a4f6000 == 10 [pid = 2212] [id = 206] 13:49:47 INFO - --DOMWINDOW == 41 (0x7f4b0c4e0c00) [pid = 2212] [serial = 444] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:49:47 INFO - --DOMWINDOW == 40 (0x7f4b0fbb8400) [pid = 2212] [serial = 446] [outer = (nil)] [url = about:blank] 13:49:47 INFO - --DOMWINDOW == 39 (0x7f4b09853800) [pid = 2212] [serial = 455] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:49:47 INFO - --DOMWINDOW == 38 (0x7f4b0a867c00) [pid = 2212] [serial = 457] [outer = (nil)] [url = about:blank] 13:49:47 INFO - --DOMWINDOW == 37 (0x7f4b1296f800) [pid = 2212] [serial = 459] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:49:47 INFO - --DOMWINDOW == 36 (0x7f4b07d75400) [pid = 2212] [serial = 469] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:49:47 INFO - --DOMWINDOW == 35 (0x7f4b07a10c00) [pid = 2212] [serial = 460] [outer = (nil)] [url = about:blank] 13:49:47 INFO - --DOMWINDOW == 34 (0x7f4b09625c00) [pid = 2212] [serial = 462] [outer = (nil)] [url = data:text/html;charset=utf-8,%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20Test%20document%20for%20bug%20977500%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20

%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20
%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20%20
%20%20%20%20%] 13:49:47 INFO - --DOMWINDOW == 33 (0x7f4b0f7e0800) [pid = 2212] [serial = 467] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:49:47 INFO - --DOMWINDOW == 32 (0x7f4b0984e800) [pid = 2212] [serial = 464] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:49:47 INFO - --DOMWINDOW == 31 (0x7f4b203cd800) [pid = 2212] [serial = 480] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:49:47 INFO - --DOMWINDOW == 30 (0x7f4b07d5ec00) [pid = 2212] [serial = 461] [outer = (nil)] [url = about:blank] 13:49:47 INFO - --DOMWINDOW == 29 (0x7f4b09849000) [pid = 2212] [serial = 463] [outer = (nil)] [url = about:blank] 13:49:47 INFO - --DOMWINDOW == 28 (0x7f4b09bbac00) [pid = 2212] [serial = 476] [outer = (nil)] [url = about:blank] 13:49:48 INFO - MEMORY STAT | vsize 1112MB | residentFast 285MB | heapAllocated 109MB 13:49:48 INFO - 134 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_filter.js | took 5554ms 13:49:48 INFO - ++DOCSHELL 0x7f4aff213800 == 11 [pid = 2212] [id = 207] 13:49:48 INFO - ++DOMWINDOW == 29 (0x7f4b00f5e800) [pid = 2212] [serial = 482] [outer = (nil)] 13:49:48 INFO - ++DOMWINDOW == 30 (0x7f4b019b2400) [pid = 2212] [serial = 483] [outer = 0x7f4b00f5e800] 13:49:48 INFO - 135 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_highlighter.js 13:49:48 INFO - ++DOCSHELL 0x7f4b07c32800 == 12 [pid = 2212] [id = 208] 13:49:48 INFO - ++DOMWINDOW == 31 (0x7f4b07a12c00) [pid = 2212] [serial = 484] [outer = (nil)] 13:49:48 INFO - ++DOMWINDOW == 32 (0x7f4b089f0000) [pid = 2212] [serial = 485] [outer = 0x7f4b07a12c00] 13:49:49 INFO - ++DOMWINDOW == 33 (0x7f4b13011800) [pid = 2212] [serial = 486] [outer = 0x7f4b07a12c00] 13:49:49 INFO - ++DOCSHELL 0x7f4b1274d800 == 13 [pid = 2212] [id = 209] 13:49:49 INFO - ++DOMWINDOW == 34 (0x7f4b099b4800) [pid = 2212] [serial = 487] [outer = (nil)] 13:49:49 INFO - ++DOMWINDOW == 35 (0x7f4b09bb4800) [pid = 2212] [serial = 488] [outer = 0x7f4b099b4800] 13:49:49 INFO - ++DOMWINDOW == 36 (0x7f4b0a85e000) [pid = 2212] [serial = 489] [outer = 0x7f4b099b4800] 13:49:49 INFO - ++DOCSHELL 0x7f4b12a04800 == 14 [pid = 2212] [id = 210] 13:49:49 INFO - ++DOMWINDOW == 37 (0x7f4b0d751400) [pid = 2212] [serial = 490] [outer = (nil)] 13:49:49 INFO - ++DOMWINDOW == 38 (0x7f4b0f702c00) [pid = 2212] [serial = 491] [outer = 0x7f4b0d751400] 13:49:52 INFO - ++DOCSHELL 0x7f4b1ea35000 == 15 [pid = 2212] [id = 211] 13:49:52 INFO - ++DOMWINDOW == 39 (0x7f4b15710000) [pid = 2212] [serial = 492] [outer = (nil)] 13:49:52 INFO - ++DOMWINDOW == 40 (0x7f4b20196800) [pid = 2212] [serial = 493] [outer = 0x7f4b15710000] 13:49:52 INFO - ++DOCSHELL 0x7f4b2b073800 == 16 [pid = 2212] [id = 212] 13:49:52 INFO - ++DOMWINDOW == 41 (0x7f4b2a426000) [pid = 2212] [serial = 494] [outer = (nil)] 13:49:52 INFO - ++DOMWINDOW == 42 (0x7f4b2a564800) [pid = 2212] [serial = 495] [outer = 0x7f4b2a426000] 13:49:53 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 13:49:53 INFO - ++DOCSHELL 0x7f4b2b67d800 == 17 [pid = 2212] [id = 213] 13:49:53 INFO - ++DOMWINDOW == 43 (0x7f4b2b6a6400) [pid = 2212] [serial = 496] [outer = (nil)] 13:49:53 INFO - ++DOMWINDOW == 44 (0x7f4b2b6a9800) [pid = 2212] [serial = 497] [outer = 0x7f4b2b6a6400] 13:49:53 INFO - ++DOCSHELL 0x7f4b2c11a000 == 18 [pid = 2212] [id = 214] 13:49:53 INFO - ++DOMWINDOW == 45 (0x7f4b2e9ec400) [pid = 2212] [serial = 498] [outer = (nil)] 13:49:53 INFO - ++DOCSHELL 0x7f4b2c11a800 == 19 [pid = 2212] [id = 215] 13:49:53 INFO - ++DOMWINDOW == 46 (0x7f4b2e9ed000) [pid = 2212] [serial = 499] [outer = (nil)] 13:49:53 INFO - ++DOCSHELL 0x7f4b2c11b000 == 20 [pid = 2212] [id = 216] 13:49:53 INFO - ++DOMWINDOW == 47 (0x7f4b2e9ed800) [pid = 2212] [serial = 500] [outer = (nil)] 13:49:53 INFO - ++DOCSHELL 0x7f4b2c11b800 == 21 [pid = 2212] [id = 217] 13:49:53 INFO - ++DOMWINDOW == 48 (0x7f4b2e9ee400) [pid = 2212] [serial = 501] [outer = (nil)] 13:49:53 INFO - ++DOCSHELL 0x7f4b2c11c000 == 22 [pid = 2212] [id = 218] 13:49:53 INFO - ++DOMWINDOW == 49 (0x7f4b2e9eec00) [pid = 2212] [serial = 502] [outer = (nil)] 13:49:53 INFO - ++DOMWINDOW == 50 (0x7f4b2e9f0400) [pid = 2212] [serial = 503] [outer = 0x7f4b2e9ec400] 13:49:53 INFO - ++DOMWINDOW == 51 (0x7f4b2e9f1800) [pid = 2212] [serial = 504] [outer = 0x7f4b2e9ed000] 13:49:53 INFO - ++DOMWINDOW == 52 (0x7f4b2e9f3400) [pid = 2212] [serial = 505] [outer = 0x7f4b2e9ed800] 13:49:53 INFO - ++DOMWINDOW == 53 (0x7f4b2e9f5000) [pid = 2212] [serial = 506] [outer = 0x7f4b2e9ee400] 13:49:53 INFO - ++DOMWINDOW == 54 (0x7f4b2ea50400) [pid = 2212] [serial = 507] [outer = 0x7f4b2e9eec00] 13:49:53 INFO - ++DOCSHELL 0x7f4aff27e800 == 23 [pid = 2212] [id = 219] 13:49:53 INFO - ++DOMWINDOW == 55 (0x7f4b019b2000) [pid = 2212] [serial = 508] [outer = (nil)] 13:49:53 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 13:49:54 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 13:49:54 INFO - ++DOMWINDOW == 56 (0x7f4aff417c00) [pid = 2212] [serial = 509] [outer = 0x7f4b019b2000] 13:49:54 INFO - console.warn: Asynchronous operation was aborted as selection changed. 13:49:55 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 13:49:55 INFO - ++DOCSHELL 0x7f4b10a75800 == 24 [pid = 2212] [id = 220] 13:49:55 INFO - ++DOMWINDOW == 57 (0x7f4afe544c00) [pid = 2212] [serial = 510] [outer = (nil)] 13:49:55 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 13:49:55 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 13:49:55 INFO - ++DOCSHELL 0x7f4b10a83800 == 25 [pid = 2212] [id = 221] 13:49:55 INFO - ++DOMWINDOW == 58 (0x7f4afe548800) [pid = 2212] [serial = 511] [outer = (nil)] 13:49:55 INFO - ++DOCSHELL 0x7f4b10a84000 == 26 [pid = 2212] [id = 222] 13:49:55 INFO - ++DOMWINDOW == 59 (0x7f4afe549400) [pid = 2212] [serial = 512] [outer = (nil)] 13:49:55 INFO - ++DOCSHELL 0x7f4b10a84800 == 27 [pid = 2212] [id = 223] 13:49:55 INFO - ++DOMWINDOW == 60 (0x7f4afe549c00) [pid = 2212] [serial = 513] [outer = (nil)] 13:49:55 INFO - ++DOCSHELL 0x7f4b10a85000 == 28 [pid = 2212] [id = 224] 13:49:55 INFO - ++DOMWINDOW == 61 (0x7f4afe54a400) [pid = 2212] [serial = 514] [outer = (nil)] 13:49:55 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 13:49:55 INFO - ++DOCSHELL 0x7f4b10a85800 == 29 [pid = 2212] [id = 225] 13:49:55 INFO - ++DOMWINDOW == 62 (0x7f4afe54b800) [pid = 2212] [serial = 515] [outer = (nil)] 13:49:55 INFO - ++DOMWINDOW == 63 (0x7f4afe54c400) [pid = 2212] [serial = 516] [outer = 0x7f4afe54b800] 13:49:55 INFO - ++DOMWINDOW == 64 (0x7f4afe4c3800) [pid = 2212] [serial = 517] [outer = 0x7f4afe544c00] 13:49:55 INFO - ++DOMWINDOW == 65 (0x7f4afe4c4800) [pid = 2212] [serial = 518] [outer = 0x7f4afe548800] 13:49:55 INFO - ++DOMWINDOW == 66 (0x7f4afe4c5800) [pid = 2212] [serial = 519] [outer = 0x7f4afe549400] 13:49:55 INFO - ++DOMWINDOW == 67 (0x7f4afe4c6800) [pid = 2212] [serial = 520] [outer = 0x7f4afe549c00] 13:49:55 INFO - ++DOMWINDOW == 68 (0x7f4afe4c7800) [pid = 2212] [serial = 521] [outer = 0x7f4afe54a400] 13:49:55 INFO - ++DOMWINDOW == 69 (0x7f4afe4c8800) [pid = 2212] [serial = 522] [outer = 0x7f4afe54b800] 13:50:00 INFO - --DOCSHELL 0x7f4b10a84000 == 28 [pid = 2212] [id = 222] 13:50:00 INFO - --DOCSHELL 0x7f4b10a84800 == 27 [pid = 2212] [id = 223] 13:50:00 INFO - --DOCSHELL 0x7f4b10a83800 == 26 [pid = 2212] [id = 221] 13:50:00 INFO - --DOCSHELL 0x7f4b10a85000 == 25 [pid = 2212] [id = 224] 13:50:00 INFO - --DOCSHELL 0x7f4b10a75800 == 24 [pid = 2212] [id = 220] 13:50:00 INFO - --DOCSHELL 0x7f4aff27e800 == 23 [pid = 2212] [id = 219] 13:50:02 INFO - --DOCSHELL 0x7f4b10a85800 == 22 [pid = 2212] [id = 225] 13:50:02 INFO - --DOCSHELL 0x7f4aff216000 == 21 [pid = 2212] [id = 202] 13:50:02 INFO - --DOCSHELL 0x7f4b12a04800 == 20 [pid = 2212] [id = 210] 13:50:02 INFO - --DOCSHELL 0x7f4b1ea35000 == 19 [pid = 2212] [id = 211] 13:50:02 INFO - --DOCSHELL 0x7f4b2b073800 == 18 [pid = 2212] [id = 212] 13:50:02 INFO - --DOCSHELL 0x7f4b07c5f000 == 17 [pid = 2212] [id = 203] 13:50:02 INFO - --DOCSHELL 0x7f4b2b67d800 == 16 [pid = 2212] [id = 213] 13:50:02 INFO - --DOCSHELL 0x7f4b2c11a000 == 15 [pid = 2212] [id = 214] 13:50:02 INFO - --DOCSHELL 0x7f4b2c11a800 == 14 [pid = 2212] [id = 215] 13:50:02 INFO - --DOCSHELL 0x7f4b2c11b000 == 13 [pid = 2212] [id = 216] 13:50:02 INFO - --DOCSHELL 0x7f4b2c11b800 == 12 [pid = 2212] [id = 217] 13:50:02 INFO - --DOCSHELL 0x7f4b2c11c000 == 11 [pid = 2212] [id = 218] 13:50:02 INFO - --DOMWINDOW == 68 (0x7f4b07a05000) [pid = 2212] [serial = 466] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:50:02 INFO - --DOMWINDOW == 67 (0x7f4b11ef0800) [pid = 2212] [serial = 468] [outer = (nil)] [url = about:blank] 13:50:02 INFO - --DOMWINDOW == 66 (0x7f4b20db5000) [pid = 2212] [serial = 481] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:50:02 INFO - --DOMWINDOW == 65 (0x7f4b09586000) [pid = 2212] [serial = 470] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:50:02 INFO - --DOMWINDOW == 64 (0x7f4afe54b800) [pid = 2212] [serial = 515] [outer = (nil)] [url = data:text/html,] 13:50:02 INFO - --DOMWINDOW == 63 (0x7f4afe549400) [pid = 2212] [serial = 512] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 13:50:02 INFO - --DOMWINDOW == 62 (0x7f4afe549c00) [pid = 2212] [serial = 513] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 13:50:02 INFO - --DOMWINDOW == 61 (0x7f4afe548800) [pid = 2212] [serial = 511] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 13:50:02 INFO - --DOMWINDOW == 60 (0x7f4afe54a400) [pid = 2212] [serial = 514] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 13:50:02 INFO - --DOMWINDOW == 59 (0x7f4b2e9ed800) [pid = 2212] [serial = 500] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 13:50:02 INFO - --DOMWINDOW == 58 (0x7f4b2e9ee400) [pid = 2212] [serial = 501] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 13:50:02 INFO - --DOMWINDOW == 57 (0x7f4b15710000) [pid = 2212] [serial = 492] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:50:02 INFO - --DOMWINDOW == 56 (0x7f4b2e9ec400) [pid = 2212] [serial = 498] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 13:50:02 INFO - --DOMWINDOW == 55 (0x7f4b0f7dbc00) [pid = 2212] [serial = 478] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:50:02 INFO - --DOMWINDOW == 54 (0x7f4b0984b800) [pid = 2212] [serial = 475] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:50:02 INFO - --DOMWINDOW == 53 (0x7f4b07a04400) [pid = 2212] [serial = 471] [outer = (nil)] [url = about:blank] 13:50:02 INFO - --DOMWINDOW == 52 (0x7f4b09620c00) [pid = 2212] [serial = 473] [outer = (nil)] [url = data:text/html;charset=utf-8,webconsole-filter] 13:50:02 INFO - --DOMWINDOW == 51 (0x7f4b09bb4800) [pid = 2212] [serial = 488] [outer = (nil)] [url = about:blank] 13:50:02 INFO - --DOMWINDOW == 50 (0x7f4b07a11c00) [pid = 2212] [serial = 472] [outer = (nil)] [url = about:blank] 13:50:02 INFO - --DOMWINDOW == 49 (0x7f4b09849800) [pid = 2212] [serial = 474] [outer = (nil)] [url = about:blank] 13:50:02 INFO - --DOMWINDOW == 48 (0x7f4b089f0000) [pid = 2212] [serial = 485] [outer = (nil)] [url = about:blank] 13:50:02 INFO - --DOMWINDOW == 47 (0x7f4afe54c400) [pid = 2212] [serial = 516] [outer = (nil)] [url = about:blank] 13:50:02 INFO - --DOMWINDOW == 46 (0x7f4afe4c8800) [pid = 2212] [serial = 522] [outer = (nil)] [url = data:text/html,] 13:50:02 INFO - --DOMWINDOW == 45 (0x7f4b019b2000) [pid = 2212] [serial = 508] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:50:03 INFO - MEMORY STAT | vsize 1126MB | residentFast 303MB | heapAllocated 114MB 13:50:03 INFO - 136 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_highlighter.js | took 14305ms 13:50:03 INFO - ++DOCSHELL 0x7f4afe2d2000 == 12 [pid = 2212] [id = 226] 13:50:03 INFO - ++DOMWINDOW == 46 (0x7f4afe015000) [pid = 2212] [serial = 523] [outer = (nil)] 13:50:03 INFO - ++DOMWINDOW == 47 (0x7f4afe1e8400) [pid = 2212] [serial = 524] [outer = 0x7f4afe015000] 13:50:03 INFO - 137 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_while_debugging.js 13:50:03 INFO - ++DOCSHELL 0x7f4afe39f000 == 13 [pid = 2212] [id = 227] 13:50:03 INFO - ++DOMWINDOW == 48 (0x7f4afe3dcc00) [pid = 2212] [serial = 525] [outer = (nil)] 13:50:03 INFO - ++DOMWINDOW == 49 (0x7f4afe3df800) [pid = 2212] [serial = 526] [outer = 0x7f4afe3dcc00] 13:50:03 INFO - ++DOMWINDOW == 50 (0x7f4afe4c0c00) [pid = 2212] [serial = 527] [outer = 0x7f4afe3dcc00] 13:50:03 INFO - ++DOCSHELL 0x7f4afe4ec800 == 14 [pid = 2212] [id = 228] 13:50:03 INFO - ++DOMWINDOW == 51 (0x7f4afe571c00) [pid = 2212] [serial = 528] [outer = (nil)] 13:50:03 INFO - ++DOMWINDOW == 52 (0x7f4afe572800) [pid = 2212] [serial = 529] [outer = 0x7f4afe571c00] 13:50:03 INFO - ++DOMWINDOW == 53 (0x7f4afe817400) [pid = 2212] [serial = 530] [outer = 0x7f4afe571c00] 13:50:04 INFO - ++DOCSHELL 0x7f4aff212800 == 15 [pid = 2212] [id = 229] 13:50:04 INFO - ++DOMWINDOW == 54 (0x7f4b00f2d800) [pid = 2212] [serial = 531] [outer = (nil)] 13:50:04 INFO - ++DOMWINDOW == 55 (0x7f4b00f2e400) [pid = 2212] [serial = 532] [outer = 0x7f4b00f2d800] 13:50:05 INFO - ++DOCSHELL 0x7f4b0fa34800 == 16 [pid = 2212] [id = 230] 13:50:05 INFO - ++DOMWINDOW == 56 (0x7f4aff22c000) [pid = 2212] [serial = 533] [outer = (nil)] 13:50:05 INFO - ++DOMWINDOW == 57 (0x7f4b0c1a4c00) [pid = 2212] [serial = 534] [outer = 0x7f4aff22c000] 13:50:06 INFO - ++DOCSHELL 0x7f4aff202800 == 17 [pid = 2212] [id = 231] 13:50:06 INFO - ++DOMWINDOW == 58 (0x7f4aff419400) [pid = 2212] [serial = 535] [outer = (nil)] 13:50:06 INFO - [2212] WARNING: No inner window available!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 9211 13:50:06 INFO - ++DOMWINDOW == 59 (0x7f4afe00d400) [pid = 2212] [serial = 536] [outer = 0x7f4aff419400] 13:50:08 INFO - --DOCSHELL 0x7f4b1274d800 == 16 [pid = 2212] [id = 209] 13:50:08 INFO - --DOCSHELL 0x7f4aff213800 == 15 [pid = 2212] [id = 207] 13:50:09 INFO - --DOCSHELL 0x7f4b07c32800 == 14 [pid = 2212] [id = 208] 13:50:09 INFO - --DOMWINDOW == 58 (0x7f4afe4c7800) [pid = 2212] [serial = 521] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 13:50:09 INFO - --DOMWINDOW == 57 (0x7f4afe4c6800) [pid = 2212] [serial = 520] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 13:50:09 INFO - --DOMWINDOW == 56 (0x7f4afe4c5800) [pid = 2212] [serial = 519] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 13:50:09 INFO - --DOMWINDOW == 55 (0x7f4afe4c4800) [pid = 2212] [serial = 518] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 13:50:09 INFO - --DOMWINDOW == 54 (0x7f4aff417c00) [pid = 2212] [serial = 509] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:50:09 INFO - --DOMWINDOW == 53 (0x7f4b2e9f5000) [pid = 2212] [serial = 506] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 13:50:09 INFO - --DOMWINDOW == 52 (0x7f4b2e9f3400) [pid = 2212] [serial = 505] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 13:50:09 INFO - --DOMWINDOW == 51 (0x7f4b2e9f0400) [pid = 2212] [serial = 503] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 13:50:09 INFO - --DOMWINDOW == 50 (0x7f4b0f981c00) [pid = 2212] [serial = 479] [outer = (nil)] [url = about:blank] 13:50:09 INFO - --DOMWINDOW == 49 (0x7f4b20196800) [pid = 2212] [serial = 493] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:50:09 INFO - --DOMWINDOW == 48 (0x7f4b0a867400) [pid = 2212] [serial = 477] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:50:11 INFO - ++DOCSHELL 0x7f4b07c5a800 == 15 [pid = 2212] [id = 232] 13:50:11 INFO - ++DOMWINDOW == 49 (0x7f4b09853000) [pid = 2212] [serial = 537] [outer = (nil)] 13:50:11 INFO - ++DOMWINDOW == 50 (0x7f4b0984f400) [pid = 2212] [serial = 538] [outer = 0x7f4b09853000] 13:50:12 INFO - --DOCSHELL 0x7f4aff202800 == 14 [pid = 2212] [id = 231] 13:50:12 INFO - --DOCSHELL 0x7f4b0fa34800 == 13 [pid = 2212] [id = 230] 13:50:12 INFO - --DOCSHELL 0x7f4aff212800 == 12 [pid = 2212] [id = 229] 13:50:13 INFO - --DOCSHELL 0x7f4b07c5a800 == 11 [pid = 2212] [id = 232] 13:50:14 INFO - --DOMWINDOW == 49 (0x7f4b2a564800) [pid = 2212] [serial = 495] [outer = (nil)] [url = about:blank] 13:50:14 INFO - --DOMWINDOW == 48 (0x7f4afe544c00) [pid = 2212] [serial = 510] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 13:50:14 INFO - --DOMWINDOW == 47 (0x7f4b2e9ed000) [pid = 2212] [serial = 499] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 13:50:14 INFO - --DOMWINDOW == 46 (0x7f4b2b6a6400) [pid = 2212] [serial = 496] [outer = (nil)] [url = chrome://devtools/content/markupview/markup-view.xhtml] 13:50:14 INFO - --DOMWINDOW == 45 (0x7f4b019b2400) [pid = 2212] [serial = 483] [outer = (nil)] [url = about:blank] 13:50:14 INFO - --DOMWINDOW == 44 (0x7f4afe3df800) [pid = 2212] [serial = 526] [outer = (nil)] [url = about:blank] 13:50:14 INFO - --DOMWINDOW == 43 (0x7f4b2a426000) [pid = 2212] [serial = 494] [outer = (nil)] [url = chrome://devtools/content/inspector/inspector.xul] 13:50:14 INFO - --DOMWINDOW == 42 (0x7f4b2e9eec00) [pid = 2212] [serial = 502] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 13:50:14 INFO - --DOMWINDOW == 41 (0x7f4b07a12c00) [pid = 2212] [serial = 484] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-952277-highlight-nodes-in-vview.html] 13:50:14 INFO - --DOMWINDOW == 40 (0x7f4b00f5e800) [pid = 2212] [serial = 482] [outer = (nil)] [url = about:blank] 13:50:14 INFO - --DOMWINDOW == 39 (0x7f4b2e9f1800) [pid = 2212] [serial = 504] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 13:50:14 INFO - --DOMWINDOW == 38 (0x7f4b2ea50400) [pid = 2212] [serial = 507] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 13:50:14 INFO - --DOMWINDOW == 37 (0x7f4b13011800) [pid = 2212] [serial = 486] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-952277-highlight-nodes-in-vview.html] 13:50:14 INFO - --DOMWINDOW == 36 (0x7f4afe4c3800) [pid = 2212] [serial = 517] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 13:50:14 INFO - --DOMWINDOW == 35 (0x7f4b2b6a9800) [pid = 2212] [serial = 497] [outer = (nil)] [url = about:blank] 13:50:14 INFO - --DOMWINDOW == 34 (0x7f4aff419400) [pid = 2212] [serial = 535] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:50:14 INFO - --DOMWINDOW == 33 (0x7f4afe572800) [pid = 2212] [serial = 529] [outer = (nil)] [url = about:blank] 13:50:14 INFO - --DOMWINDOW == 32 (0x7f4b099b4800) [pid = 2212] [serial = 487] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:50:14 INFO - --DOMWINDOW == 31 (0x7f4b0d751400) [pid = 2212] [serial = 490] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:50:14 INFO - MEMORY STAT | vsize 1124MB | residentFast 292MB | heapAllocated 113MB 13:50:14 INFO - 138 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_while_debugging.js | took 11202ms 13:50:14 INFO - ++DOCSHELL 0x7f4afe398000 == 12 [pid = 2212] [id = 233] 13:50:14 INFO - ++DOMWINDOW == 32 (0x7f4afe1e7800) [pid = 2212] [serial = 539] [outer = (nil)] 13:50:14 INFO - ++DOMWINDOW == 33 (0x7f4afe3dc800) [pid = 2212] [serial = 540] [outer = 0x7f4afe1e7800] 13:50:14 INFO - 139 INFO TEST-START | devtools/client/webconsole/test/browser_console_variables_view_while_debugging_and_inspecting.js 13:50:14 INFO - ++DOCSHELL 0x7f4afe4f3800 == 13 [pid = 2212] [id = 234] 13:50:14 INFO - ++DOMWINDOW == 34 (0x7f4afe4c4000) [pid = 2212] [serial = 541] [outer = (nil)] 13:50:14 INFO - ++DOMWINDOW == 35 (0x7f4afe54c400) [pid = 2212] [serial = 542] [outer = 0x7f4afe4c4000] 13:50:14 INFO - ++DOMWINDOW == 36 (0x7f4afe578800) [pid = 2212] [serial = 543] [outer = 0x7f4afe4c4000] 13:50:15 INFO - ++DOCSHELL 0x7f4afe2be000 == 14 [pid = 2212] [id = 235] 13:50:15 INFO - ++DOMWINDOW == 37 (0x7f4afe817c00) [pid = 2212] [serial = 544] [outer = (nil)] 13:50:15 INFO - ++DOMWINDOW == 38 (0x7f4afe81b000) [pid = 2212] [serial = 545] [outer = 0x7f4afe817c00] 13:50:15 INFO - ++DOMWINDOW == 39 (0x7f4aff41fc00) [pid = 2212] [serial = 546] [outer = 0x7f4afe817c00] 13:50:15 INFO - ++DOCSHELL 0x7f4b0175a000 == 15 [pid = 2212] [id = 236] 13:50:15 INFO - ++DOMWINDOW == 40 (0x7f4b012d7000) [pid = 2212] [serial = 547] [outer = (nil)] 13:50:15 INFO - ++DOMWINDOW == 41 (0x7f4b012d8800) [pid = 2212] [serial = 548] [outer = 0x7f4b012d7000] 13:50:17 INFO - ++DOCSHELL 0x7f4afe4e2800 == 16 [pid = 2212] [id = 237] 13:50:17 INFO - ++DOMWINDOW == 42 (0x7f4afe1e6c00) [pid = 2212] [serial = 549] [outer = (nil)] 13:50:17 INFO - ++DOMWINDOW == 43 (0x7f4afe3d6800) [pid = 2212] [serial = 550] [outer = 0x7f4afe1e6c00] 13:50:17 INFO - ++DOCSHELL 0x7f4b07c31800 == 17 [pid = 2212] [id = 238] 13:50:17 INFO - ++DOMWINDOW == 44 (0x7f4aff22ac00) [pid = 2212] [serial = 551] [outer = (nil)] 13:50:17 INFO - ++DOMWINDOW == 45 (0x7f4aff41c000) [pid = 2212] [serial = 552] [outer = 0x7f4aff22ac00] 13:50:19 INFO - --DOCSHELL 0x7f4afe4ec800 == 16 [pid = 2212] [id = 228] 13:50:20 INFO - --DOCSHELL 0x7f4afe39f000 == 15 [pid = 2212] [id = 227] 13:50:20 INFO - --DOCSHELL 0x7f4afe2d2000 == 14 [pid = 2212] [id = 226] 13:50:20 INFO - --DOMWINDOW == 44 (0x7f4b0a85e000) [pid = 2212] [serial = 489] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:50:20 INFO - --DOMWINDOW == 43 (0x7f4b0f702c00) [pid = 2212] [serial = 491] [outer = (nil)] [url = about:blank] 13:50:20 INFO - --DOMWINDOW == 42 (0x7f4afe00d400) [pid = 2212] [serial = 536] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:50:21 INFO - ++DOCSHELL 0x7f4aff222000 == 15 [pid = 2212] [id = 239] 13:50:21 INFO - ++DOMWINDOW == 43 (0x7f4b09527400) [pid = 2212] [serial = 553] [outer = (nil)] 13:50:21 INFO - ++DOMWINDOW == 44 (0x7f4b09581000) [pid = 2212] [serial = 554] [outer = 0x7f4b09527400] 13:50:21 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 13:50:21 INFO - ++DOCSHELL 0x7f4b01917800 == 16 [pid = 2212] [id = 240] 13:50:21 INFO - ++DOMWINDOW == 45 (0x7f4b09853c00) [pid = 2212] [serial = 555] [outer = (nil)] 13:50:21 INFO - ++DOMWINDOW == 46 (0x7f4b09855400) [pid = 2212] [serial = 556] [outer = 0x7f4b09853c00] 13:50:21 INFO - ++DOCSHELL 0x7f4b094aa000 == 17 [pid = 2212] [id = 241] 13:50:21 INFO - ++DOMWINDOW == 47 (0x7f4b0c4e5c00) [pid = 2212] [serial = 557] [outer = (nil)] 13:50:21 INFO - ++DOCSHELL 0x7f4afe2c6800 == 18 [pid = 2212] [id = 242] 13:50:21 INFO - ++DOMWINDOW == 48 (0x7f4b0c4e6400) [pid = 2212] [serial = 558] [outer = (nil)] 13:50:21 INFO - ++DOCSHELL 0x7f4b094aa800 == 19 [pid = 2212] [id = 243] 13:50:21 INFO - ++DOMWINDOW == 49 (0x7f4b0c8ec400) [pid = 2212] [serial = 559] [outer = (nil)] 13:50:21 INFO - ++DOCSHELL 0x7f4b0a7c3000 == 20 [pid = 2212] [id = 244] 13:50:21 INFO - ++DOMWINDOW == 50 (0x7f4b0c8ed400) [pid = 2212] [serial = 560] [outer = (nil)] 13:50:21 INFO - ++DOCSHELL 0x7f4b0c38c800 == 21 [pid = 2212] [id = 245] 13:50:21 INFO - ++DOMWINDOW == 51 (0x7f4b0ca81400) [pid = 2212] [serial = 561] [outer = (nil)] 13:50:21 INFO - ++DOMWINDOW == 52 (0x7f4b0d754000) [pid = 2212] [serial = 562] [outer = 0x7f4b0c4e5c00] 13:50:21 INFO - ++DOMWINDOW == 53 (0x7f4b10b04000) [pid = 2212] [serial = 563] [outer = 0x7f4b0c4e6400] 13:50:21 INFO - ++DOMWINDOW == 54 (0x7f4b10b06000) [pid = 2212] [serial = 564] [outer = 0x7f4b0c8ec400] 13:50:21 INFO - ++DOMWINDOW == 55 (0x7f4b10b0c400) [pid = 2212] [serial = 565] [outer = 0x7f4b0c8ed400] 13:50:21 INFO - ++DOMWINDOW == 56 (0x7f4b11ee5800) [pid = 2212] [serial = 566] [outer = 0x7f4b0ca81400] 13:50:21 INFO - ++DOCSHELL 0x7f4b12759000 == 22 [pid = 2212] [id = 246] 13:50:21 INFO - ++DOMWINDOW == 57 (0x7f4b14a97c00) [pid = 2212] [serial = 567] [outer = (nil)] 13:50:21 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 13:50:21 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 13:50:22 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 13:50:22 INFO - ++DOCSHELL 0x7f4b129aa800 == 23 [pid = 2212] [id = 247] 13:50:22 INFO - ++DOMWINDOW == 58 (0x7f4b15ca8400) [pid = 2212] [serial = 568] [outer = (nil)] 13:50:22 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 13:50:22 INFO - ++DOMWINDOW == 59 (0x7f4b191a1c00) [pid = 2212] [serial = 569] [outer = 0x7f4b14a97c00] 13:50:22 INFO - [2212] WARNING: We should have hit the document element...: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/xul/BoxObject.cpp, line 175 13:50:22 INFO - ++DOMWINDOW == 60 (0x7f4b196e0400) [pid = 2212] [serial = 570] [outer = 0x7f4b15ca8400] 13:50:22 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 13:50:22 INFO - ++DOCSHELL 0x7f4b12a05000 == 24 [pid = 2212] [id = 248] 13:50:22 INFO - ++DOMWINDOW == 61 (0x7f4aff41d000) [pid = 2212] [serial = 571] [outer = (nil)] 13:50:22 INFO - ++DOCSHELL 0x7f4b12a09800 == 25 [pid = 2212] [id = 249] 13:50:22 INFO - ++DOMWINDOW == 62 (0x7f4b09852000) [pid = 2212] [serial = 572] [outer = (nil)] 13:50:22 INFO - ++DOCSHELL 0x7f4b14519800 == 26 [pid = 2212] [id = 250] 13:50:22 INFO - ++DOMWINDOW == 63 (0x7f4b0a045400) [pid = 2212] [serial = 573] [outer = (nil)] 13:50:22 INFO - ++DOCSHELL 0x7f4b1465a800 == 27 [pid = 2212] [id = 251] 13:50:22 INFO - ++DOMWINDOW == 64 (0x7f4b0ca85800) [pid = 2212] [serial = 574] [outer = (nil)] 13:50:22 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 13:50:22 INFO - ++DOCSHELL 0x7f4b1465b000 == 28 [pid = 2212] [id = 252] 13:50:22 INFO - ++DOMWINDOW == 65 (0x7f4b12148800) [pid = 2212] [serial = 575] [outer = (nil)] 13:50:22 INFO - ++DOMWINDOW == 66 (0x7f4b21052c00) [pid = 2212] [serial = 576] [outer = 0x7f4b12148800] 13:50:22 INFO - ++DOMWINDOW == 67 (0x7f4afe571400) [pid = 2212] [serial = 577] [outer = 0x7f4aff41d000] 13:50:22 INFO - ++DOMWINDOW == 68 (0x7f4b12bb5c00) [pid = 2212] [serial = 578] [outer = 0x7f4b09852000] 13:50:22 INFO - ++DOMWINDOW == 69 (0x7f4b29b53800) [pid = 2212] [serial = 579] [outer = 0x7f4b0a045400] 13:50:22 INFO - ++DOMWINDOW == 70 (0x7f4b29b55400) [pid = 2212] [serial = 580] [outer = 0x7f4b0ca85800] 13:50:22 INFO - ++DOMWINDOW == 71 (0x7f4b10b08000) [pid = 2212] [serial = 581] [outer = 0x7f4b12148800] 13:50:24 INFO - ++DOCSHELL 0x7f4afe391000 == 29 [pid = 2212] [id = 253] 13:50:24 INFO - ++DOMWINDOW == 72 (0x7f4b2ea4d400) [pid = 2212] [serial = 582] [outer = (nil)] 13:50:24 INFO - ++DOMWINDOW == 73 (0x7f4afe0a9000) [pid = 2212] [serial = 583] [outer = 0x7f4b2ea4d400] 13:50:25 INFO - --DOMWINDOW == 72 (0x7f4afe1e8400) [pid = 2212] [serial = 524] [outer = (nil)] [url = about:blank] 13:50:25 INFO - --DOMWINDOW == 71 (0x7f4afe54c400) [pid = 2212] [serial = 542] [outer = (nil)] [url = about:blank] 13:50:25 INFO - --DOMWINDOW == 70 (0x7f4afe3dcc00) [pid = 2212] [serial = 525] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 13:50:25 INFO - --DOMWINDOW == 69 (0x7f4afe015000) [pid = 2212] [serial = 523] [outer = (nil)] [url = about:blank] 13:50:25 INFO - --DOMWINDOW == 68 (0x7f4afe81b000) [pid = 2212] [serial = 545] [outer = (nil)] [url = about:blank] 13:50:25 INFO - --DOMWINDOW == 67 (0x7f4afe4c0c00) [pid = 2212] [serial = 527] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 13:50:26 INFO - --DOCSHELL 0x7f4b07c31800 == 28 [pid = 2212] [id = 238] 13:50:26 INFO - --DOCSHELL 0x7f4b12a09800 == 27 [pid = 2212] [id = 249] 13:50:26 INFO - --DOCSHELL 0x7f4b14519800 == 26 [pid = 2212] [id = 250] 13:50:26 INFO - --DOCSHELL 0x7f4b12a05000 == 25 [pid = 2212] [id = 248] 13:50:26 INFO - --DOCSHELL 0x7f4b1465a800 == 24 [pid = 2212] [id = 251] 13:50:26 INFO - --DOCSHELL 0x7f4b129aa800 == 23 [pid = 2212] [id = 247] 13:50:26 INFO - --DOCSHELL 0x7f4b12759000 == 22 [pid = 2212] [id = 246] 13:50:26 INFO - --DOCSHELL 0x7f4afe4e2800 == 21 [pid = 2212] [id = 237] 13:50:26 INFO - --DOCSHELL 0x7f4b0175a000 == 20 [pid = 2212] [id = 236] 13:50:27 INFO - --DOCSHELL 0x7f4b1465b000 == 19 [pid = 2212] [id = 252] 13:50:27 INFO - --DOCSHELL 0x7f4aff222000 == 18 [pid = 2212] [id = 239] 13:50:27 INFO - --DOCSHELL 0x7f4b01917800 == 17 [pid = 2212] [id = 240] 13:50:27 INFO - --DOCSHELL 0x7f4afe391000 == 16 [pid = 2212] [id = 253] 13:50:27 INFO - --DOCSHELL 0x7f4b094aa000 == 15 [pid = 2212] [id = 241] 13:50:27 INFO - --DOCSHELL 0x7f4afe2c6800 == 14 [pid = 2212] [id = 242] 13:50:27 INFO - --DOCSHELL 0x7f4b094aa800 == 13 [pid = 2212] [id = 243] 13:50:28 INFO - --DOMWINDOW == 66 (0x7f4b0c8ed400) [pid = 2212] [serial = 560] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 13:50:28 INFO - --DOMWINDOW == 65 (0x7f4b0ca85800) [pid = 2212] [serial = 574] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 13:50:28 INFO - --DOMWINDOW == 64 (0x7f4aff22ac00) [pid = 2212] [serial = 551] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:50:28 INFO - --DOMWINDOW == 63 (0x7f4b09852000) [pid = 2212] [serial = 572] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 13:50:28 INFO - --DOMWINDOW == 62 (0x7f4aff41d000) [pid = 2212] [serial = 571] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 13:50:28 INFO - --DOMWINDOW == 61 (0x7f4b0c4e6400) [pid = 2212] [serial = 558] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 13:50:28 INFO - --DOMWINDOW == 60 (0x7f4b0c8ec400) [pid = 2212] [serial = 559] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 13:50:28 INFO - --DOMWINDOW == 59 (0x7f4b0c4e5c00) [pid = 2212] [serial = 557] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 13:50:28 INFO - --DOMWINDOW == 58 (0x7f4b15ca8400) [pid = 2212] [serial = 568] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 13:50:28 INFO - --DOMWINDOW == 57 (0x7f4b14a97c00) [pid = 2212] [serial = 567] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:50:28 INFO - --DOMWINDOW == 56 (0x7f4b00f2d800) [pid = 2212] [serial = 531] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:50:28 INFO - --DOMWINDOW == 55 (0x7f4afe571c00) [pid = 2212] [serial = 528] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:50:28 INFO - --DOMWINDOW == 54 (0x7f4b09853000) [pid = 2212] [serial = 537] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:50:28 INFO - --DOMWINDOW == 53 (0x7f4aff22c000) [pid = 2212] [serial = 533] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul] 13:50:28 INFO - --DOMWINDOW == 52 (0x7f4b12148800) [pid = 2212] [serial = 575] [outer = (nil)] [url = data:text/html,] 13:50:28 INFO - --DOMWINDOW == 51 (0x7f4b21052c00) [pid = 2212] [serial = 576] [outer = (nil)] [url = about:blank] 13:50:28 INFO - --DOMWINDOW == 50 (0x7f4b10b08000) [pid = 2212] [serial = 581] [outer = (nil)] [url = data:text/html,] 13:50:28 INFO - MEMORY STAT | vsize 1129MB | residentFast 302MB | heapAllocated 120MB 13:50:28 INFO - 140 INFO TEST-OK | devtools/client/webconsole/test/browser_console_variables_view_while_debugging_and_inspecting.js | took 13941ms 13:50:28 INFO - ++DOCSHELL 0x7f4afe38f800 == 14 [pid = 2212] [id = 254] 13:50:28 INFO - ++DOMWINDOW == 51 (0x7f4afe0adc00) [pid = 2212] [serial = 584] [outer = (nil)] 13:50:28 INFO - ++DOMWINDOW == 52 (0x7f4afe0b1800) [pid = 2212] [serial = 585] [outer = 0x7f4afe0adc00] 13:50:28 INFO - 141 INFO TEST-START | devtools/client/webconsole/test/browser_eval_in_debugger_stackframe.js 13:50:28 INFO - ++DOCSHELL 0x7f4afe4f3000 == 15 [pid = 2212] [id = 255] 13:50:28 INFO - ++DOMWINDOW == 53 (0x7f4afe3e1000) [pid = 2212] [serial = 586] [outer = (nil)] 13:50:28 INFO - ++DOMWINDOW == 54 (0x7f4afe3e4c00) [pid = 2212] [serial = 587] [outer = 0x7f4afe3e1000] 13:50:29 INFO - ++DOMWINDOW == 55 (0x7f4afe572c00) [pid = 2212] [serial = 588] [outer = 0x7f4afe3e1000] 13:50:29 INFO - ++DOCSHELL 0x7f4afe4fd800 == 16 [pid = 2212] [id = 256] 13:50:29 INFO - ++DOMWINDOW == 56 (0x7f4afe81b000) [pid = 2212] [serial = 589] [outer = (nil)] 13:50:29 INFO - ++DOMWINDOW == 57 (0x7f4aff225c00) [pid = 2212] [serial = 590] [outer = 0x7f4afe81b000] 13:50:29 INFO - ++DOMWINDOW == 58 (0x7f4aff37cc00) [pid = 2212] [serial = 591] [outer = 0x7f4afe81b000] 13:50:29 INFO - ++DOCSHELL 0x7f4aff2bf800 == 17 [pid = 2212] [id = 257] 13:50:29 INFO - ++DOMWINDOW == 59 (0x7f4b00f31000) [pid = 2212] [serial = 592] [outer = (nil)] 13:50:29 INFO - ++DOMWINDOW == 60 (0x7f4b00f57400) [pid = 2212] [serial = 593] [outer = 0x7f4b00f31000] 13:50:31 INFO - ++DOCSHELL 0x7f4b01775000 == 18 [pid = 2212] [id = 258] 13:50:31 INFO - ++DOMWINDOW == 61 (0x7f4aff37d800) [pid = 2212] [serial = 594] [outer = (nil)] 13:50:31 INFO - ++DOMWINDOW == 62 (0x7f4b09582800) [pid = 2212] [serial = 595] [outer = 0x7f4aff37d800] 13:50:32 INFO - ++DOCSHELL 0x7f4afe2d6000 == 19 [pid = 2212] [id = 259] 13:50:32 INFO - ++DOMWINDOW == 63 (0x7f4afe0ae400) [pid = 2212] [serial = 596] [outer = (nil)] 13:50:32 INFO - ++DOMWINDOW == 64 (0x7f4afe0aa800) [pid = 2212] [serial = 597] [outer = 0x7f4afe0ae400] 13:50:33 INFO - --DOCSHELL 0x7f4afe398000 == 18 [pid = 2212] [id = 233] 13:50:33 INFO - --DOCSHELL 0x7f4afe2be000 == 17 [pid = 2212] [id = 235] 13:50:33 INFO - --DOCSHELL 0x7f4b0a7c3000 == 16 [pid = 2212] [id = 244] 13:50:33 INFO - --DOCSHELL 0x7f4b0c38c800 == 15 [pid = 2212] [id = 245] 13:50:34 INFO - --DOCSHELL 0x7f4afe4f3800 == 14 [pid = 2212] [id = 234] 13:50:35 INFO - --DOMWINDOW == 63 (0x7f4b0984f400) [pid = 2212] [serial = 538] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:50:35 INFO - --DOMWINDOW == 62 (0x7f4b0c1a4c00) [pid = 2212] [serial = 534] [outer = (nil)] [url = about:blank] 13:50:35 INFO - --DOMWINDOW == 61 (0x7f4b00f2e400) [pid = 2212] [serial = 532] [outer = (nil)] [url = about:blank] 13:50:35 INFO - --DOMWINDOW == 60 (0x7f4afe817400) [pid = 2212] [serial = 530] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:50:35 INFO - --DOMWINDOW == 59 (0x7f4b191a1c00) [pid = 2212] [serial = 569] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:50:35 INFO - --DOMWINDOW == 58 (0x7f4b10b0c400) [pid = 2212] [serial = 565] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 13:50:35 INFO - --DOMWINDOW == 57 (0x7f4b10b06000) [pid = 2212] [serial = 564] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 13:50:35 INFO - --DOMWINDOW == 56 (0x7f4b196e0400) [pid = 2212] [serial = 570] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 13:50:35 INFO - --DOMWINDOW == 55 (0x7f4b10b04000) [pid = 2212] [serial = 563] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 13:50:35 INFO - --DOMWINDOW == 54 (0x7f4aff41c000) [pid = 2212] [serial = 552] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:50:35 INFO - --DOMWINDOW == 53 (0x7f4b0d754000) [pid = 2212] [serial = 562] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 13:50:35 INFO - --DOMWINDOW == 52 (0x7f4b12bb5c00) [pid = 2212] [serial = 578] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 13:50:35 INFO - --DOMWINDOW == 51 (0x7f4afe571400) [pid = 2212] [serial = 577] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 13:50:35 INFO - --DOMWINDOW == 50 (0x7f4b29b55400) [pid = 2212] [serial = 580] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 13:50:38 INFO - --DOCSHELL 0x7f4afe2d6000 == 13 [pid = 2212] [id = 259] 13:50:38 INFO - --DOCSHELL 0x7f4b01775000 == 12 [pid = 2212] [id = 258] 13:50:38 INFO - --DOCSHELL 0x7f4aff2bf800 == 11 [pid = 2212] [id = 257] 13:50:39 INFO - --DOMWINDOW == 49 (0x7f4b0a045400) [pid = 2212] [serial = 573] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 13:50:39 INFO - --DOMWINDOW == 48 (0x7f4b09853c00) [pid = 2212] [serial = 555] [outer = (nil)] [url = chrome://devtools/content/markupview/markup-view.xhtml] 13:50:39 INFO - --DOMWINDOW == 47 (0x7f4afe3e4c00) [pid = 2212] [serial = 587] [outer = (nil)] [url = about:blank] 13:50:39 INFO - --DOMWINDOW == 46 (0x7f4afe3dc800) [pid = 2212] [serial = 540] [outer = (nil)] [url = about:blank] 13:50:39 INFO - --DOMWINDOW == 45 (0x7f4b09527400) [pid = 2212] [serial = 553] [outer = (nil)] [url = chrome://devtools/content/inspector/inspector.xul] 13:50:39 INFO - --DOMWINDOW == 44 (0x7f4afe4c4000) [pid = 2212] [serial = 541] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 13:50:39 INFO - --DOMWINDOW == 43 (0x7f4b0ca81400) [pid = 2212] [serial = 561] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 13:50:39 INFO - --DOMWINDOW == 42 (0x7f4afe1e7800) [pid = 2212] [serial = 539] [outer = (nil)] [url = about:blank] 13:50:39 INFO - --DOMWINDOW == 41 (0x7f4b09581000) [pid = 2212] [serial = 554] [outer = (nil)] [url = about:blank] 13:50:39 INFO - --DOMWINDOW == 40 (0x7f4b29b53800) [pid = 2212] [serial = 579] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 13:50:39 INFO - --DOMWINDOW == 39 (0x7f4b09855400) [pid = 2212] [serial = 556] [outer = (nil)] [url = about:blank] 13:50:39 INFO - --DOMWINDOW == 38 (0x7f4afe578800) [pid = 2212] [serial = 543] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 13:50:39 INFO - --DOMWINDOW == 37 (0x7f4b11ee5800) [pid = 2212] [serial = 566] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 13:50:40 INFO - --DOMWINDOW == 36 (0x7f4afe0ae400) [pid = 2212] [serial = 596] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:50:40 INFO - --DOMWINDOW == 35 (0x7f4aff225c00) [pid = 2212] [serial = 590] [outer = (nil)] [url = about:blank] 13:50:40 INFO - --DOMWINDOW == 34 (0x7f4afe1e6c00) [pid = 2212] [serial = 549] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul] 13:50:40 INFO - --DOMWINDOW == 33 (0x7f4b012d7000) [pid = 2212] [serial = 547] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:50:40 INFO - --DOMWINDOW == 32 (0x7f4b2ea4d400) [pid = 2212] [serial = 582] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:50:40 INFO - --DOMWINDOW == 31 (0x7f4afe817c00) [pid = 2212] [serial = 544] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:50:40 INFO - MEMORY STAT | vsize 1128MB | residentFast 295MB | heapAllocated 115MB 13:50:40 INFO - 142 INFO TEST-OK | devtools/client/webconsole/test/browser_eval_in_debugger_stackframe.js | took 11597ms 13:50:40 INFO - ++DOCSHELL 0x7f4afe2be800 == 12 [pid = 2212] [id = 260] 13:50:40 INFO - ++DOMWINDOW == 32 (0x7f4afe0b3000) [pid = 2212] [serial = 598] [outer = (nil)] 13:50:40 INFO - ++DOMWINDOW == 33 (0x7f4afe3d7800) [pid = 2212] [serial = 599] [outer = 0x7f4afe0b3000] 13:50:40 INFO - 143 INFO TEST-START | devtools/client/webconsole/test/browser_eval_in_debugger_stackframe2.js 13:50:40 INFO - ++DOCSHELL 0x7f4afe4f6800 == 13 [pid = 2212] [id = 261] 13:50:40 INFO - ++DOMWINDOW == 34 (0x7f4afe3e4400) [pid = 2212] [serial = 600] [outer = (nil)] 13:50:40 INFO - ++DOMWINDOW == 35 (0x7f4afe4bf000) [pid = 2212] [serial = 601] [outer = 0x7f4afe3e4400] 13:50:40 INFO - ++DOMWINDOW == 36 (0x7f4afe573000) [pid = 2212] [serial = 602] [outer = 0x7f4afe3e4400] 13:50:41 INFO - ++DOCSHELL 0x7f4afe2c1800 == 14 [pid = 2212] [id = 262] 13:50:41 INFO - ++DOMWINDOW == 37 (0x7f4afe81a000) [pid = 2212] [serial = 603] [outer = (nil)] 13:50:41 INFO - ++DOMWINDOW == 38 (0x7f4afe81f000) [pid = 2212] [serial = 604] [outer = 0x7f4afe81a000] 13:50:41 INFO - ++DOMWINDOW == 39 (0x7f4aff381c00) [pid = 2212] [serial = 605] [outer = 0x7f4afe81a000] 13:50:41 INFO - ++DOCSHELL 0x7f4aff2c2000 == 15 [pid = 2212] [id = 263] 13:50:41 INFO - ++DOMWINDOW == 40 (0x7f4b012d2400) [pid = 2212] [serial = 606] [outer = (nil)] 13:50:41 INFO - ++DOMWINDOW == 41 (0x7f4b012d7800) [pid = 2212] [serial = 607] [outer = 0x7f4b012d2400] 13:50:43 INFO - ++DOCSHELL 0x7f4aff27e800 == 16 [pid = 2212] [id = 264] 13:50:43 INFO - ++DOMWINDOW == 42 (0x7f4afe016000) [pid = 2212] [serial = 608] [outer = (nil)] 13:50:43 INFO - ++DOMWINDOW == 43 (0x7f4aff37e800) [pid = 2212] [serial = 609] [outer = 0x7f4afe016000] 13:50:43 INFO - ++DOCSHELL 0x7f4b07c6d000 == 17 [pid = 2212] [id = 265] 13:50:43 INFO - ++DOMWINDOW == 44 (0x7f4b08988400) [pid = 2212] [serial = 610] [outer = (nil)] 13:50:43 INFO - ++DOMWINDOW == 45 (0x7f4afe0a8800) [pid = 2212] [serial = 611] [outer = 0x7f4b08988400] 13:50:45 INFO - --DOCSHELL 0x7f4afe4fd800 == 16 [pid = 2212] [id = 256] 13:50:46 INFO - --DOCSHELL 0x7f4afe4f3000 == 15 [pid = 2212] [id = 255] 13:50:46 INFO - --DOCSHELL 0x7f4afe38f800 == 14 [pid = 2212] [id = 254] 13:50:46 INFO - --DOMWINDOW == 44 (0x7f4afe3d6800) [pid = 2212] [serial = 550] [outer = (nil)] [url = about:blank] 13:50:46 INFO - --DOMWINDOW == 43 (0x7f4b012d8800) [pid = 2212] [serial = 548] [outer = (nil)] [url = about:blank] 13:50:46 INFO - --DOMWINDOW == 42 (0x7f4afe0a9000) [pid = 2212] [serial = 583] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:50:46 INFO - --DOMWINDOW == 41 (0x7f4aff41fc00) [pid = 2212] [serial = 546] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:50:46 INFO - --DOMWINDOW == 40 (0x7f4afe0aa800) [pid = 2212] [serial = 597] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:50:49 INFO - --DOCSHELL 0x7f4b07c6d000 == 13 [pid = 2212] [id = 265] 13:50:49 INFO - --DOCSHELL 0x7f4aff27e800 == 12 [pid = 2212] [id = 264] 13:50:49 INFO - --DOCSHELL 0x7f4aff2c2000 == 11 [pid = 2212] [id = 263] 13:50:50 INFO - --DOCSHELL 0x7f4afe2c1800 == 10 [pid = 2212] [id = 262] 13:50:51 INFO - --DOMWINDOW == 39 (0x7f4afe0b1800) [pid = 2212] [serial = 585] [outer = (nil)] [url = about:blank] 13:50:51 INFO - --DOMWINDOW == 38 (0x7f4afe4bf000) [pid = 2212] [serial = 601] [outer = (nil)] [url = about:blank] 13:50:51 INFO - --DOMWINDOW == 37 (0x7f4afe3e1000) [pid = 2212] [serial = 586] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 13:50:51 INFO - --DOMWINDOW == 36 (0x7f4afe0adc00) [pid = 2212] [serial = 584] [outer = (nil)] [url = about:blank] 13:50:51 INFO - --DOMWINDOW == 35 (0x7f4afe572c00) [pid = 2212] [serial = 588] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 13:50:51 INFO - --DOMWINDOW == 34 (0x7f4afe81f000) [pid = 2212] [serial = 604] [outer = (nil)] [url = about:blank] 13:50:51 INFO - --DOMWINDOW == 33 (0x7f4b08988400) [pid = 2212] [serial = 610] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:50:51 INFO - --DOMWINDOW == 32 (0x7f4b00f31000) [pid = 2212] [serial = 592] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:50:51 INFO - --DOMWINDOW == 31 (0x7f4aff37d800) [pid = 2212] [serial = 594] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul] 13:50:51 INFO - --DOMWINDOW == 30 (0x7f4afe81b000) [pid = 2212] [serial = 589] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:50:51 INFO - MEMORY STAT | vsize 1128MB | residentFast 292MB | heapAllocated 114MB 13:50:51 INFO - 144 INFO TEST-OK | devtools/client/webconsole/test/browser_eval_in_debugger_stackframe2.js | took 11134ms 13:50:51 INFO - ++DOCSHELL 0x7f4afe2c2800 == 11 [pid = 2212] [id = 266] 13:50:51 INFO - ++DOMWINDOW == 31 (0x7f4afe1f2000) [pid = 2212] [serial = 612] [outer = (nil)] 13:50:51 INFO - ++DOMWINDOW == 32 (0x7f4afe3d6400) [pid = 2212] [serial = 613] [outer = 0x7f4afe1f2000] 13:50:52 INFO - 145 INFO TEST-START | devtools/client/webconsole/test/browser_jsterm_inspect.js 13:50:52 INFO - ++DOCSHELL 0x7f4afe2c3000 == 12 [pid = 2212] [id = 267] 13:50:52 INFO - ++DOMWINDOW == 33 (0x7f4afe4c1c00) [pid = 2212] [serial = 614] [outer = (nil)] 13:50:52 INFO - ++DOMWINDOW == 34 (0x7f4afe54c800) [pid = 2212] [serial = 615] [outer = 0x7f4afe4c1c00] 13:50:52 INFO - ++DOCSHELL 0x7f4afe2d1800 == 13 [pid = 2212] [id = 268] 13:50:52 INFO - ++DOMWINDOW == 35 (0x7f4afe81d400) [pid = 2212] [serial = 616] [outer = (nil)] 13:50:52 INFO - ++DOMWINDOW == 36 (0x7f4afe81f000) [pid = 2212] [serial = 617] [outer = 0x7f4afe81d400] 13:50:52 INFO - ++DOMWINDOW == 37 (0x7f4aff37d400) [pid = 2212] [serial = 618] [outer = 0x7f4afe81d400] 13:50:53 INFO - ++DOCSHELL 0x7f4aff275800 == 14 [pid = 2212] [id = 269] 13:50:53 INFO - ++DOMWINDOW == 38 (0x7f4b00f59800) [pid = 2212] [serial = 619] [outer = (nil)] 13:50:53 INFO - ++DOMWINDOW == 39 (0x7f4b00f5a400) [pid = 2212] [serial = 620] [outer = 0x7f4b00f59800] 13:50:55 INFO - ++DOCSHELL 0x7f4b07c1e800 == 15 [pid = 2212] [id = 270] 13:50:55 INFO - ++DOMWINDOW == 40 (0x7f4b09bb4800) [pid = 2212] [serial = 621] [outer = (nil)] 13:50:55 INFO - ++DOMWINDOW == 41 (0x7f4b09bb7000) [pid = 2212] [serial = 622] [outer = 0x7f4b09bb4800] 13:50:55 INFO - [2212] WARNING: NS_ENSURE_SUCCESS(rv, nullptr) failed with result 0x80570027: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/js/xpconnect/wrappers/WrapperFactory.cpp, line 274 13:50:56 INFO - [2212] WARNING: CacheStorage not supported on untrusted origins.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/cache/CacheStorage.cpp, line 173 13:50:56 INFO - [2212] WARNING: IndexedDB is not permitted in a third-party window.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/indexedDB/IDBFactory.cpp, line 142 13:51:11 INFO - --DOCSHELL 0x7f4afe4f6800 == 14 [pid = 2212] [id = 261] 13:51:11 INFO - --DOCSHELL 0x7f4aff275800 == 13 [pid = 2212] [id = 269] 13:51:11 INFO - --DOCSHELL 0x7f4b07c1e800 == 12 [pid = 2212] [id = 270] 13:51:11 INFO - --DOCSHELL 0x7f4afe2be800 == 11 [pid = 2212] [id = 260] 13:51:11 INFO - --DOMWINDOW == 40 (0x7f4b00f57400) [pid = 2212] [serial = 593] [outer = (nil)] [url = about:blank] 13:51:11 INFO - --DOMWINDOW == 39 (0x7f4b09582800) [pid = 2212] [serial = 595] [outer = (nil)] [url = about:blank] 13:51:11 INFO - --DOMWINDOW == 38 (0x7f4aff37cc00) [pid = 2212] [serial = 591] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:51:11 INFO - --DOMWINDOW == 37 (0x7f4afe0a8800) [pid = 2212] [serial = 611] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:51:11 INFO - --DOMWINDOW == 36 (0x7f4afe81a000) [pid = 2212] [serial = 603] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:51:11 INFO - --DOMWINDOW == 35 (0x7f4afe3d7800) [pid = 2212] [serial = 599] [outer = (nil)] [url = about:blank] 13:51:11 INFO - --DOMWINDOW == 34 (0x7f4afe0b3000) [pid = 2212] [serial = 598] [outer = (nil)] [url = about:blank] 13:51:11 INFO - --DOMWINDOW == 33 (0x7f4afe3e4400) [pid = 2212] [serial = 600] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 13:51:11 INFO - --DOMWINDOW == 32 (0x7f4b012d2400) [pid = 2212] [serial = 606] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:51:11 INFO - --DOMWINDOW == 31 (0x7f4afe016000) [pid = 2212] [serial = 608] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul] 13:51:11 INFO - --DOMWINDOW == 30 (0x7f4afe81f000) [pid = 2212] [serial = 617] [outer = (nil)] [url = about:blank] 13:51:12 INFO - --DOMWINDOW == 29 (0x7f4afe573000) [pid = 2212] [serial = 602] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-eval-in-stackframe.html] 13:51:12 INFO - MEMORY STAT | vsize 1144MB | residentFast 318MB | heapAllocated 125MB 13:51:12 INFO - 146 INFO TEST-OK | devtools/client/webconsole/test/browser_jsterm_inspect.js | took 20174ms 13:51:12 INFO - ++DOCSHELL 0x7f4afe2c5000 == 12 [pid = 2212] [id = 271] 13:51:12 INFO - ++DOMWINDOW == 30 (0x7f4afe0b0400) [pid = 2212] [serial = 623] [outer = (nil)] 13:51:12 INFO - ++DOMWINDOW == 31 (0x7f4afe1f1400) [pid = 2212] [serial = 624] [outer = 0x7f4afe0b0400] 13:51:12 INFO - 147 INFO TEST-START | devtools/client/webconsole/test/browser_longstring_hang.js 13:51:12 INFO - ++DOCSHELL 0x7f4aff20c800 == 13 [pid = 2212] [id = 272] 13:51:12 INFO - ++DOMWINDOW == 32 (0x7f4afe4be800) [pid = 2212] [serial = 625] [outer = (nil)] 13:51:12 INFO - ++DOMWINDOW == 33 (0x7f4afe4c8400) [pid = 2212] [serial = 626] [outer = 0x7f4afe4be800] 13:51:13 INFO - ++DOMWINDOW == 34 (0x7f4aff41c400) [pid = 2212] [serial = 627] [outer = 0x7f4afe4be800] 13:51:13 INFO - ++DOCSHELL 0x7f4afe2c7800 == 14 [pid = 2212] [id = 273] 13:51:13 INFO - ++DOMWINDOW == 35 (0x7f4aff22b000) [pid = 2212] [serial = 628] [outer = (nil)] 13:51:13 INFO - ++DOMWINDOW == 36 (0x7f4aff375800) [pid = 2212] [serial = 629] [outer = 0x7f4aff22b000] 13:51:13 INFO - ++DOMWINDOW == 37 (0x7f4aff379800) [pid = 2212] [serial = 630] [outer = 0x7f4aff22b000] 13:51:13 INFO - ++DOCSHELL 0x7f4b09499000 == 15 [pid = 2212] [id = 274] 13:51:13 INFO - ++DOMWINDOW == 38 (0x7f4b00f2c800) [pid = 2212] [serial = 631] [outer = (nil)] 13:51:13 INFO - ++DOMWINDOW == 39 (0x7f4b00f31800) [pid = 2212] [serial = 632] [outer = 0x7f4b00f2c800] 13:51:15 INFO - Block(span)(3)@7f4b0f996e68: Init: bad caller: width WAS 84007040(0x501d880) 13:51:15 INFO - Block(span)(0)@7f4b0f9fe258: Init: bad caller: width WAS 84000000(0x501bd00) 13:51:15 INFO - nsLineLayout: Text(0)"foobaraaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaaa"@7f4b0f9fe6d8 metrics=84000000,840! 13:51:15 INFO - nsLineLayout: Inline(span)(0)@7f4b0f9fe660 metrics=84000000,840! 13:51:15 INFO - nsBlockReflowContext: FlexContainer(span)(0)@7f4b0f9971f8 metrics=84007040,840! 13:51:15 INFO - nsBlockReflowContext: Block(span)(0)@7f4b0fa5c708 metrics=84007040,840! 13:51:15 INFO - Block(span)(3)@7f4b0f996e68: Init: bad caller: width WAS 84007040(0x501d880) 13:51:15 INFO - nsBlockReflowContext: Block(span)(0)@7f4b0fa5c708 metrics=84007040,840! 13:51:15 INFO - nsBlockReflowContext: Block(span)(0)@7f4b0fa5c708 metrics=84007040,840! 13:51:15 INFO - Block(span)(3)@7f4b0fa5f1f8: Init: bad caller: width WAS 84007040(0x501d880) 13:51:15 INFO - nsBlockReflowContext: Block(span)(0)@7f4b0fa5c708 metrics=84007040,840! 13:51:16 INFO - --DOCSHELL 0x7f4afe2c7800 == 14 [pid = 2212] [id = 273] 13:51:16 INFO - --DOCSHELL 0x7f4b09499000 == 13 [pid = 2212] [id = 274] 13:51:16 INFO - --DOCSHELL 0x7f4afe2c2800 == 12 [pid = 2212] [id = 266] 13:51:16 INFO - --DOCSHELL 0x7f4afe2d1800 == 11 [pid = 2212] [id = 268] 13:51:16 INFO - --DOCSHELL 0x7f4afe2c3000 == 10 [pid = 2212] [id = 267] 13:51:17 INFO - --DOMWINDOW == 38 (0x7f4aff381c00) [pid = 2212] [serial = 605] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:51:17 INFO - --DOMWINDOW == 37 (0x7f4b012d7800) [pid = 2212] [serial = 607] [outer = (nil)] [url = about:blank] 13:51:17 INFO - --DOMWINDOW == 36 (0x7f4aff37e800) [pid = 2212] [serial = 609] [outer = (nil)] [url = about:blank] 13:51:17 INFO - --DOMWINDOW == 35 (0x7f4b09bb4800) [pid = 2212] [serial = 621] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:51:17 INFO - --DOMWINDOW == 34 (0x7f4afe1f2000) [pid = 2212] [serial = 612] [outer = (nil)] [url = about:blank] 13:51:17 INFO - --DOMWINDOW == 33 (0x7f4afe4c1c00) [pid = 2212] [serial = 614] [outer = (nil)] [url = data:text/html;charset=utf8,

hello%20bug%20869981] 13:51:17 INFO - --DOMWINDOW == 32 (0x7f4afe3d6400) [pid = 2212] [serial = 613] [outer = (nil)] [url = about:blank] 13:51:17 INFO - --DOMWINDOW == 31 (0x7f4afe4c8400) [pid = 2212] [serial = 626] [outer = (nil)] [url = about:blank] 13:51:17 INFO - --DOMWINDOW == 30 (0x7f4aff375800) [pid = 2212] [serial = 629] [outer = (nil)] [url = about:blank] 13:51:17 INFO - --DOMWINDOW == 29 (0x7f4afe81d400) [pid = 2212] [serial = 616] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:51:17 INFO - --DOMWINDOW == 28 (0x7f4b00f59800) [pid = 2212] [serial = 619] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:51:17 INFO - MEMORY STAT | vsize 1142MB | residentFast 305MB | heapAllocated 118MB 13:51:17 INFO - 148 INFO TEST-OK | devtools/client/webconsole/test/browser_longstring_hang.js | took 5123ms 13:51:17 INFO - ++DOCSHELL 0x7f4afe38f000 == 11 [pid = 2212] [id = 275] 13:51:17 INFO - ++DOMWINDOW == 29 (0x7f4afe0af800) [pid = 2212] [serial = 633] [outer = (nil)] 13:51:17 INFO - ++DOMWINDOW == 30 (0x7f4afe0b3c00) [pid = 2212] [serial = 634] [outer = 0x7f4afe0af800] 13:51:18 INFO - 149 INFO TEST-START | devtools/client/webconsole/test/browser_netmonitor_shows_reqs_in_webconsole.js 13:51:18 INFO - ++DOCSHELL 0x7f4afe4ed000 == 12 [pid = 2212] [id = 276] 13:51:18 INFO - ++DOMWINDOW == 31 (0x7f4afe3de800) [pid = 2212] [serial = 635] [outer = (nil)] 13:51:18 INFO - ++DOMWINDOW == 32 (0x7f4afe3e1c00) [pid = 2212] [serial = 636] [outer = 0x7f4afe3de800] 13:51:18 INFO - ++DOCSHELL 0x7f4afe2bb800 == 13 [pid = 2212] [id = 277] 13:51:18 INFO - ++DOMWINDOW == 33 (0x7f4afe3e3c00) [pid = 2212] [serial = 637] [outer = (nil)] 13:51:18 INFO - ++DOMWINDOW == 34 (0x7f4afe573c00) [pid = 2212] [serial = 638] [outer = 0x7f4afe3e3c00] 13:51:18 INFO - ++DOMWINDOW == 35 (0x7f4afe819800) [pid = 2212] [serial = 639] [outer = 0x7f4afe3e3c00] 13:51:18 INFO - ++DOCSHELL 0x7f4aff287800 == 14 [pid = 2212] [id = 278] 13:51:18 INFO - ++DOMWINDOW == 36 (0x7f4aff37b400) [pid = 2212] [serial = 640] [outer = (nil)] 13:51:18 INFO - ++DOMWINDOW == 37 (0x7f4aff37c400) [pid = 2212] [serial = 641] [outer = 0x7f4aff37b400] 13:51:20 INFO - ++DOMWINDOW == 38 (0x7f4b07a0d400) [pid = 2212] [serial = 642] [outer = 0x7f4afe3de800] 13:51:20 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:51:20 INFO - ++DOCSHELL 0x7f4b07c36000 == 15 [pid = 2212] [id = 279] 13:51:20 INFO - ++DOMWINDOW == 39 (0x7f4afe57f000) [pid = 2212] [serial = 643] [outer = (nil)] 13:51:20 INFO - ++DOMWINDOW == 40 (0x7f4b019b5800) [pid = 2212] [serial = 644] [outer = 0x7f4afe57f000] 13:51:25 INFO - --DOCSHELL 0x7f4afe2c5000 == 14 [pid = 2212] [id = 271] 13:51:25 INFO - --DOCSHELL 0x7f4aff20c800 == 13 [pid = 2212] [id = 272] 13:51:25 INFO - --DOMWINDOW == 39 (0x7f4afe54c800) [pid = 2212] [serial = 615] [outer = (nil)] [url = about:blank] 13:51:25 INFO - ++DOCSHELL 0x7f4afe2be000 == 14 [pid = 2212] [id = 280] 13:51:25 INFO - ++DOMWINDOW == 40 (0x7f4afe1f2c00) [pid = 2212] [serial = 645] [outer = (nil)] 13:51:25 INFO - ++DOMWINDOW == 41 (0x7f4afe4c5400) [pid = 2212] [serial = 646] [outer = 0x7f4afe1f2c00] 13:51:26 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 13:51:26 INFO - --DOCSHELL 0x7f4afe2be000 == 13 [pid = 2212] [id = 280] 13:51:26 INFO - --DOCSHELL 0x7f4aff287800 == 12 [pid = 2212] [id = 278] 13:51:26 INFO - MEMORY STAT | vsize 1146MB | residentFast 299MB | heapAllocated 120MB 13:51:26 INFO - 150 INFO TEST-OK | devtools/client/webconsole/test/browser_netmonitor_shows_reqs_in_webconsole.js | took 8837ms 13:51:26 INFO - ++DOCSHELL 0x7f4aff21d000 == 13 [pid = 2212] [id = 281] 13:51:26 INFO - ++DOMWINDOW == 42 (0x7f4afe813000) [pid = 2212] [serial = 647] [outer = (nil)] 13:51:26 INFO - ++DOMWINDOW == 43 (0x7f4aff22b800) [pid = 2212] [serial = 648] [outer = 0x7f4afe813000] 13:51:27 INFO - 151 INFO TEST-START | devtools/client/webconsole/test/browser_output_breaks_after_console_dir_uninspectable.js 13:51:27 INFO - ++DOCSHELL 0x7f4afe2bc000 == 14 [pid = 2212] [id = 282] 13:51:27 INFO - ++DOMWINDOW == 44 (0x7f4aff421c00) [pid = 2212] [serial = 649] [outer = (nil)] 13:51:27 INFO - ++DOMWINDOW == 45 (0x7f4b00f2b800) [pid = 2212] [serial = 650] [outer = 0x7f4aff421c00] 13:51:27 INFO - ++DOCSHELL 0x7f4b01903000 == 15 [pid = 2212] [id = 283] 13:51:27 INFO - ++DOMWINDOW == 46 (0x7f4afe815c00) [pid = 2212] [serial = 651] [outer = (nil)] 13:51:27 INFO - ++DOMWINDOW == 47 (0x7f4b00f5fc00) [pid = 2212] [serial = 652] [outer = 0x7f4afe815c00] 13:51:27 INFO - ++DOMWINDOW == 48 (0x7f4b00f65800) [pid = 2212] [serial = 653] [outer = 0x7f4afe815c00] 13:51:27 INFO - ++DOCSHELL 0x7f4b07c35000 == 16 [pid = 2212] [id = 284] 13:51:27 INFO - ++DOMWINDOW == 49 (0x7f4b089ec000) [pid = 2212] [serial = 654] [outer = (nil)] 13:51:27 INFO - ++DOMWINDOW == 50 (0x7f4b0952c000) [pid = 2212] [serial = 655] [outer = 0x7f4b089ec000] 13:51:29 INFO - --DOMWINDOW == 49 (0x7f4afe573c00) [pid = 2212] [serial = 638] [outer = (nil)] [url = about:blank] 13:51:29 INFO - --DOMWINDOW == 48 (0x7f4afe0b0400) [pid = 2212] [serial = 623] [outer = (nil)] [url = about:blank] 13:51:29 INFO - --DOMWINDOW == 47 (0x7f4afe4be800) [pid = 2212] [serial = 625] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-859170-longstring-hang.html] 13:51:29 INFO - --DOMWINDOW == 46 (0x7f4afe1f1400) [pid = 2212] [serial = 624] [outer = (nil)] [url = about:blank] 13:51:29 INFO - --DOMWINDOW == 45 (0x7f4aff41c400) [pid = 2212] [serial = 627] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-859170-longstring-hang.html] 13:51:29 INFO - ++DOCSHELL 0x7f4aff2cf000 == 17 [pid = 2212] [id = 285] 13:51:29 INFO - ++DOMWINDOW == 46 (0x7f4aff226000) [pid = 2212] [serial = 656] [outer = (nil)] 13:51:29 INFO - ++DOMWINDOW == 47 (0x7f4b012dc400) [pid = 2212] [serial = 657] [outer = 0x7f4aff226000] 13:51:29 INFO - --DOCSHELL 0x7f4aff2cf000 == 16 [pid = 2212] [id = 285] 13:51:30 INFO - --DOCSHELL 0x7f4afe4ed000 == 15 [pid = 2212] [id = 276] 13:51:31 INFO - --DOCSHELL 0x7f4b07c36000 == 14 [pid = 2212] [id = 279] 13:51:31 INFO - --DOCSHELL 0x7f4afe2bb800 == 13 [pid = 2212] [id = 277] 13:51:31 INFO - --DOCSHELL 0x7f4b07c35000 == 12 [pid = 2212] [id = 284] 13:51:31 INFO - --DOMWINDOW == 46 (0x7f4aff37d400) [pid = 2212] [serial = 618] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:51:31 INFO - --DOMWINDOW == 45 (0x7f4b00f5a400) [pid = 2212] [serial = 620] [outer = (nil)] [url = about:blank] 13:51:31 INFO - --DOMWINDOW == 44 (0x7f4b09bb7000) [pid = 2212] [serial = 622] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:51:31 INFO - --DOMWINDOW == 43 (0x7f4afe4c5400) [pid = 2212] [serial = 646] [outer = (nil)] [url = about:blank] 13:51:31 INFO - --DOMWINDOW == 42 (0x7f4afe0b3c00) [pid = 2212] [serial = 634] [outer = (nil)] [url = about:blank] 13:51:31 INFO - --DOMWINDOW == 41 (0x7f4afe3e1c00) [pid = 2212] [serial = 636] [outer = (nil)] [url = about:blank] 13:51:31 INFO - --DOMWINDOW == 40 (0x7f4b00f5fc00) [pid = 2212] [serial = 652] [outer = (nil)] [url = about:blank] 13:51:31 INFO - --DOMWINDOW == 39 (0x7f4b00f2c800) [pid = 2212] [serial = 631] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:51:31 INFO - --DOMWINDOW == 38 (0x7f4aff22b000) [pid = 2212] [serial = 628] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:51:31 INFO - --DOMWINDOW == 37 (0x7f4afe1f2c00) [pid = 2212] [serial = 645] [outer = (nil)] [url = about:blank] 13:51:31 INFO - --DOMWINDOW == 36 (0x7f4afe0af800) [pid = 2212] [serial = 633] [outer = (nil)] [url = about:blank] 13:51:31 INFO - --DOMWINDOW == 35 (0x7f4afe3de800) [pid = 2212] [serial = 635] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 13:51:31 INFO - --DOMWINDOW == 34 (0x7f4b07a0d400) [pid = 2212] [serial = 642] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 13:51:31 INFO - MEMORY STAT | vsize 1147MB | residentFast 297MB | heapAllocated 112MB 13:51:31 INFO - 152 INFO TEST-OK | devtools/client/webconsole/test/browser_output_breaks_after_console_dir_uninspectable.js | took 4403ms 13:51:31 INFO - ++DOCSHELL 0x7f4afe2ca800 == 13 [pid = 2212] [id = 286] 13:51:31 INFO - ++DOMWINDOW == 35 (0x7f4afe3d6000) [pid = 2212] [serial = 658] [outer = (nil)] 13:51:31 INFO - ++DOMWINDOW == 36 (0x7f4afe3de000) [pid = 2212] [serial = 659] [outer = 0x7f4afe3d6000] 13:51:31 INFO - 153 INFO TEST-START | devtools/client/webconsole/test/browser_output_longstring_expand.js 13:51:31 INFO - ++DOCSHELL 0x7f4afe2d0000 == 14 [pid = 2212] [id = 287] 13:51:31 INFO - ++DOMWINDOW == 37 (0x7f4afe4c7800) [pid = 2212] [serial = 660] [outer = (nil)] 13:51:31 INFO - ++DOMWINDOW == 38 (0x7f4afe54d800) [pid = 2212] [serial = 661] [outer = 0x7f4afe4c7800] 13:51:32 INFO - ++DOCSHELL 0x7f4afe3a0000 == 15 [pid = 2212] [id = 288] 13:51:32 INFO - ++DOMWINDOW == 39 (0x7f4afe57f800) [pid = 2212] [serial = 662] [outer = (nil)] 13:51:32 INFO - ++DOMWINDOW == 40 (0x7f4aff375800) [pid = 2212] [serial = 663] [outer = 0x7f4afe57f800] 13:51:32 INFO - ++DOMWINDOW == 41 (0x7f4aff41fc00) [pid = 2212] [serial = 664] [outer = 0x7f4afe57f800] 13:51:32 INFO - ++DOCSHELL 0x7f4aff2c7800 == 16 [pid = 2212] [id = 289] 13:51:32 INFO - ++DOMWINDOW == 42 (0x7f4b012d8000) [pid = 2212] [serial = 665] [outer = (nil)] 13:51:32 INFO - ++DOMWINDOW == 43 (0x7f4b012ddc00) [pid = 2212] [serial = 666] [outer = 0x7f4b012d8000] 13:51:36 INFO - --DOCSHELL 0x7f4afe3a0000 == 15 [pid = 2212] [id = 288] 13:51:36 INFO - --DOCSHELL 0x7f4afe38f000 == 14 [pid = 2212] [id = 275] 13:51:36 INFO - --DOCSHELL 0x7f4aff2c7800 == 13 [pid = 2212] [id = 289] 13:51:36 INFO - --DOCSHELL 0x7f4afe2bc000 == 12 [pid = 2212] [id = 282] 13:51:36 INFO - --DOCSHELL 0x7f4b01903000 == 11 [pid = 2212] [id = 283] 13:51:36 INFO - --DOCSHELL 0x7f4aff21d000 == 10 [pid = 2212] [id = 281] 13:51:36 INFO - --DOMWINDOW == 42 (0x7f4b00f31800) [pid = 2212] [serial = 632] [outer = (nil)] [url = about:blank] 13:51:36 INFO - --DOMWINDOW == 41 (0x7f4aff379800) [pid = 2212] [serial = 630] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:51:36 INFO - --DOMWINDOW == 40 (0x7f4afe815c00) [pid = 2212] [serial = 651] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:51:36 INFO - --DOMWINDOW == 39 (0x7f4b00f2b800) [pid = 2212] [serial = 650] [outer = (nil)] [url = about:blank] 13:51:36 INFO - --DOMWINDOW == 38 (0x7f4aff375800) [pid = 2212] [serial = 663] [outer = (nil)] [url = about:blank] 13:51:36 INFO - --DOMWINDOW == 37 (0x7f4afe3e3c00) [pid = 2212] [serial = 637] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:51:36 INFO - --DOMWINDOW == 36 (0x7f4aff22b800) [pid = 2212] [serial = 648] [outer = (nil)] [url = about:blank] 13:51:36 INFO - --DOMWINDOW == 35 (0x7f4afe813000) [pid = 2212] [serial = 647] [outer = (nil)] [url = about:blank] 13:51:36 INFO - --DOMWINDOW == 34 (0x7f4b089ec000) [pid = 2212] [serial = 654] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:51:36 INFO - --DOMWINDOW == 33 (0x7f4aff37b400) [pid = 2212] [serial = 640] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:51:36 INFO - --DOMWINDOW == 32 (0x7f4aff421c00) [pid = 2212] [serial = 649] [outer = (nil)] [url = data:text/html;charset=utf8,test%20for%20bug%20773466] 13:51:36 INFO - --DOMWINDOW == 31 (0x7f4aff226000) [pid = 2212] [serial = 656] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:51:36 INFO - --DOMWINDOW == 30 (0x7f4afe57f000) [pid = 2212] [serial = 643] [outer = (nil)] [url = chrome://devtools/content/netmonitor/netmonitor.xul] 13:51:36 INFO - MEMORY STAT | vsize 1145MB | residentFast 294MB | heapAllocated 111MB 13:51:36 INFO - 154 INFO TEST-OK | devtools/client/webconsole/test/browser_output_longstring_expand.js | took 5137ms 13:51:36 INFO - ++DOCSHELL 0x7f4afe394800 == 11 [pid = 2212] [id = 290] 13:51:36 INFO - ++DOMWINDOW == 31 (0x7f4afe1f4400) [pid = 2212] [serial = 667] [outer = (nil)] 13:51:37 INFO - ++DOMWINDOW == 32 (0x7f4afe3d8400) [pid = 2212] [serial = 668] [outer = 0x7f4afe1f4400] 13:51:37 INFO - 155 INFO TEST-START | devtools/client/webconsole/test/browser_repeated_messages_accuracy.js 13:51:37 INFO - ++DOCSHELL 0x7f4afe4f3000 == 12 [pid = 2212] [id = 291] 13:51:37 INFO - ++DOMWINDOW == 33 (0x7f4afe4c4000) [pid = 2212] [serial = 669] [outer = (nil)] 13:51:37 INFO - ++DOMWINDOW == 34 (0x7f4afe4c8000) [pid = 2212] [serial = 670] [outer = 0x7f4afe4c4000] 13:51:37 INFO - ++DOMWINDOW == 35 (0x7f4afe816800) [pid = 2212] [serial = 671] [outer = 0x7f4afe4c4000] 13:51:37 INFO - ++DOCSHELL 0x7f4afe395800 == 13 [pid = 2212] [id = 292] 13:51:37 INFO - ++DOMWINDOW == 36 (0x7f4aff22ac00) [pid = 2212] [serial = 672] [outer = (nil)] 13:51:37 INFO - ++DOMWINDOW == 37 (0x7f4aff22cc00) [pid = 2212] [serial = 673] [outer = 0x7f4aff22ac00] 13:51:37 INFO - ++DOMWINDOW == 38 (0x7f4aff37f000) [pid = 2212] [serial = 674] [outer = 0x7f4aff22ac00] 13:51:38 INFO - ++DOCSHELL 0x7f4aff2c9000 == 14 [pid = 2212] [id = 293] 13:51:38 INFO - ++DOMWINDOW == 39 (0x7f4b00f2f000) [pid = 2212] [serial = 675] [outer = (nil)] 13:51:38 INFO - ++DOMWINDOW == 40 (0x7f4b00f56400) [pid = 2212] [serial = 676] [outer = 0x7f4b00f2f000] 13:51:39 INFO - ++DOMWINDOW == 41 (0x7f4b09bbd800) [pid = 2212] [serial = 677] [outer = 0x7f4afe4c4000] 13:51:39 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:51:41 INFO - --DOCSHELL 0x7f4afe2ca800 == 13 [pid = 2212] [id = 286] 13:51:41 INFO - --DOCSHELL 0x7f4afe395800 == 12 [pid = 2212] [id = 292] 13:51:41 INFO - --DOCSHELL 0x7f4aff2c9000 == 11 [pid = 2212] [id = 293] 13:51:41 INFO - --DOCSHELL 0x7f4afe2d0000 == 10 [pid = 2212] [id = 287] 13:51:41 INFO - --DOMWINDOW == 40 (0x7f4b012dc400) [pid = 2212] [serial = 657] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:51:41 INFO - --DOMWINDOW == 39 (0x7f4b019b5800) [pid = 2212] [serial = 644] [outer = (nil)] [url = about:blank] 13:51:41 INFO - --DOMWINDOW == 38 (0x7f4afe819800) [pid = 2212] [serial = 639] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:51:41 INFO - --DOMWINDOW == 37 (0x7f4aff37c400) [pid = 2212] [serial = 641] [outer = (nil)] [url = about:blank] 13:51:41 INFO - --DOMWINDOW == 36 (0x7f4b00f65800) [pid = 2212] [serial = 653] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:51:41 INFO - --DOMWINDOW == 35 (0x7f4b0952c000) [pid = 2212] [serial = 655] [outer = (nil)] [url = about:blank] 13:51:41 INFO - --DOMWINDOW == 34 (0x7f4afe3de000) [pid = 2212] [serial = 659] [outer = (nil)] [url = about:blank] 13:51:41 INFO - --DOMWINDOW == 33 (0x7f4afe54d800) [pid = 2212] [serial = 661] [outer = (nil)] [url = about:blank] 13:51:41 INFO - --DOMWINDOW == 32 (0x7f4afe4c8000) [pid = 2212] [serial = 670] [outer = (nil)] [url = about:blank] 13:51:41 INFO - --DOMWINDOW == 31 (0x7f4aff22cc00) [pid = 2212] [serial = 673] [outer = (nil)] [url = about:blank] 13:51:41 INFO - --DOMWINDOW == 30 (0x7f4b012d8000) [pid = 2212] [serial = 665] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:51:41 INFO - --DOMWINDOW == 29 (0x7f4afe57f800) [pid = 2212] [serial = 662] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:51:41 INFO - --DOMWINDOW == 28 (0x7f4afe3d6000) [pid = 2212] [serial = 658] [outer = (nil)] [url = about:blank] 13:51:41 INFO - --DOMWINDOW == 27 (0x7f4afe4c7800) [pid = 2212] [serial = 660] [outer = (nil)] [url = data:text/html;charset=utf8,test%20for%20bug%20787981%20-%20check%20that%20long%20strings%20can%20be%20expanded%20in%20the%20output.] 13:51:42 INFO - --DOMWINDOW == 26 (0x7f4afe816800) [pid = 2212] [serial = 671] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-repeated-messages.html] 13:51:42 INFO - MEMORY STAT | vsize 1145MB | residentFast 292MB | heapAllocated 110MB 13:51:42 INFO - 156 INFO TEST-OK | devtools/client/webconsole/test/browser_repeated_messages_accuracy.js | took 5009ms 13:51:42 INFO - ++DOCSHELL 0x7f4afe392800 == 11 [pid = 2212] [id = 294] 13:51:42 INFO - ++DOMWINDOW == 27 (0x7f4afe3e0000) [pid = 2212] [serial = 678] [outer = (nil)] 13:51:42 INFO - ++DOMWINDOW == 28 (0x7f4afe3e4400) [pid = 2212] [serial = 679] [outer = 0x7f4afe3e0000] 13:51:42 INFO - 157 INFO TEST-START | devtools/client/webconsole/test/browser_result_format_as_string.js 13:51:42 INFO - ++DOCSHELL 0x7f4aff210800 == 12 [pid = 2212] [id = 295] 13:51:42 INFO - ++DOMWINDOW == 29 (0x7f4afe1f2800) [pid = 2212] [serial = 680] [outer = (nil)] 13:51:42 INFO - ++DOMWINDOW == 30 (0x7f4afe575000) [pid = 2212] [serial = 681] [outer = 0x7f4afe1f2800] 13:51:42 INFO - ++DOMWINDOW == 31 (0x7f4afe81a400) [pid = 2212] [serial = 682] [outer = 0x7f4afe1f2800] 13:51:43 INFO - ++DOCSHELL 0x7f4afe4e2000 == 13 [pid = 2212] [id = 296] 13:51:43 INFO - ++DOMWINDOW == 32 (0x7f4afe57f400) [pid = 2212] [serial = 683] [outer = (nil)] 13:51:43 INFO - ++DOMWINDOW == 33 (0x7f4aff374000) [pid = 2212] [serial = 684] [outer = 0x7f4afe57f400] 13:51:43 INFO - ++DOMWINDOW == 34 (0x7f4aff37c000) [pid = 2212] [serial = 685] [outer = 0x7f4afe57f400] 13:51:43 INFO - ++DOCSHELL 0x7f4aff2bf000 == 14 [pid = 2212] [id = 297] 13:51:43 INFO - ++DOMWINDOW == 35 (0x7f4aff41b800) [pid = 2212] [serial = 686] [outer = (nil)] 13:51:43 INFO - ++DOMWINDOW == 36 (0x7f4aff421800) [pid = 2212] [serial = 687] [outer = 0x7f4aff41b800] 13:51:46 INFO - --DOCSHELL 0x7f4afe4f3000 == 13 [pid = 2212] [id = 291] 13:51:46 INFO - --DOCSHELL 0x7f4aff2bf000 == 12 [pid = 2212] [id = 297] 13:51:46 INFO - --DOMWINDOW == 35 (0x7f4aff41fc00) [pid = 2212] [serial = 664] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:51:46 INFO - --DOMWINDOW == 34 (0x7f4b012ddc00) [pid = 2212] [serial = 666] [outer = (nil)] [url = about:blank] 13:51:46 INFO - --DOMWINDOW == 33 (0x7f4aff374000) [pid = 2212] [serial = 684] [outer = (nil)] [url = about:blank] 13:51:46 INFO - --DOMWINDOW == 32 (0x7f4afe575000) [pid = 2212] [serial = 681] [outer = (nil)] [url = about:blank] 13:51:46 INFO - --DOMWINDOW == 31 (0x7f4afe3d8400) [pid = 2212] [serial = 668] [outer = (nil)] [url = about:blank] 13:51:46 INFO - --DOMWINDOW == 30 (0x7f4b00f2f000) [pid = 2212] [serial = 675] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:51:46 INFO - --DOMWINDOW == 29 (0x7f4aff22ac00) [pid = 2212] [serial = 672] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:51:46 INFO - --DOMWINDOW == 28 (0x7f4afe1f4400) [pid = 2212] [serial = 667] [outer = (nil)] [url = about:blank] 13:51:46 INFO - --DOMWINDOW == 27 (0x7f4afe4c4000) [pid = 2212] [serial = 669] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-repeated-messages.html] 13:51:46 INFO - --DOMWINDOW == 26 (0x7f4b09bbd800) [pid = 2212] [serial = 677] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-repeated-messages.html] 13:51:46 INFO - MEMORY STAT | vsize 1147MB | residentFast 292MB | heapAllocated 111MB 13:51:46 INFO - 158 INFO TEST-OK | devtools/client/webconsole/test/browser_result_format_as_string.js | took 4428ms 13:51:46 INFO - ++DOCSHELL 0x7f4afe2d7000 == 13 [pid = 2212] [id = 298] 13:51:46 INFO - ++DOMWINDOW == 27 (0x7f4afe1f1400) [pid = 2212] [serial = 688] [outer = (nil)] 13:51:46 INFO - ++DOMWINDOW == 28 (0x7f4afe3dd000) [pid = 2212] [serial = 689] [outer = 0x7f4afe1f1400] 13:51:47 INFO - 159 INFO TEST-START | devtools/client/webconsole/test/browser_warn_user_about_replaced_api.js 13:51:47 INFO - ++DOCSHELL 0x7f4afe4fb000 == 14 [pid = 2212] [id = 299] 13:51:47 INFO - ++DOMWINDOW == 29 (0x7f4afe4c8400) [pid = 2212] [serial = 690] [outer = (nil)] 13:51:47 INFO - ++DOMWINDOW == 30 (0x7f4afe572800) [pid = 2212] [serial = 691] [outer = 0x7f4afe4c8400] 13:51:47 INFO - ++DOMWINDOW == 31 (0x7f4b0c1a7800) [pid = 2212] [serial = 692] [outer = 0x7f4afe4c8400] 13:51:47 INFO - ++DOCSHELL 0x7f4afe2c4000 == 15 [pid = 2212] [id = 300] 13:51:47 INFO - ++DOMWINDOW == 32 (0x7f4aff37a000) [pid = 2212] [serial = 693] [outer = (nil)] 13:51:47 INFO - ++DOMWINDOW == 33 (0x7f4aff37d400) [pid = 2212] [serial = 694] [outer = 0x7f4aff37a000] 13:51:47 INFO - ++DOMWINDOW == 34 (0x7f4aff420400) [pid = 2212] [serial = 695] [outer = 0x7f4aff37a000] 13:51:48 INFO - ++DOCSHELL 0x7f4aff2cb800 == 16 [pid = 2212] [id = 301] 13:51:48 INFO - ++DOMWINDOW == 35 (0x7f4b00f27800) [pid = 2212] [serial = 696] [outer = (nil)] 13:51:48 INFO - ++DOMWINDOW == 36 (0x7f4b019b3400) [pid = 2212] [serial = 697] [outer = 0x7f4b00f27800] 13:51:50 INFO - ++DOMWINDOW == 37 (0x7f4aff227400) [pid = 2212] [serial = 698] [outer = 0x7f4afe4c8400] 13:51:50 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:51:51 INFO - --DOCSHELL 0x7f4aff210800 == 15 [pid = 2212] [id = 295] 13:51:51 INFO - --DOCSHELL 0x7f4afe392800 == 14 [pid = 2212] [id = 294] 13:51:51 INFO - --DOCSHELL 0x7f4afe394800 == 13 [pid = 2212] [id = 290] 13:51:51 INFO - --DOCSHELL 0x7f4afe2c4000 == 12 [pid = 2212] [id = 300] 13:51:51 INFO - --DOCSHELL 0x7f4afe4e2000 == 11 [pid = 2212] [id = 296] 13:51:51 INFO - --DOCSHELL 0x7f4aff2cb800 == 10 [pid = 2212] [id = 301] 13:51:51 INFO - --DOMWINDOW == 36 (0x7f4b00f56400) [pid = 2212] [serial = 676] [outer = (nil)] [url = about:blank] 13:51:51 INFO - --DOMWINDOW == 35 (0x7f4aff37f000) [pid = 2212] [serial = 674] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:51:51 INFO - --DOMWINDOW == 34 (0x7f4aff37d400) [pid = 2212] [serial = 694] [outer = (nil)] [url = about:blank] 13:51:51 INFO - --DOMWINDOW == 33 (0x7f4afe572800) [pid = 2212] [serial = 691] [outer = (nil)] [url = about:blank] 13:51:51 INFO - --DOMWINDOW == 32 (0x7f4afe3e4400) [pid = 2212] [serial = 679] [outer = (nil)] [url = about:blank] 13:51:51 INFO - --DOMWINDOW == 31 (0x7f4b0c1a7800) [pid = 2212] [serial = 692] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/testscript.js] 13:51:51 INFO - --DOMWINDOW == 30 (0x7f4afe57f400) [pid = 2212] [serial = 683] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:51:51 INFO - --DOMWINDOW == 29 (0x7f4aff41b800) [pid = 2212] [serial = 686] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:51:51 INFO - --DOMWINDOW == 28 (0x7f4afe1f2800) [pid = 2212] [serial = 680] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-result-format-as-string.html] 13:51:51 INFO - --DOMWINDOW == 27 (0x7f4afe3e0000) [pid = 2212] [serial = 678] [outer = (nil)] [url = about:blank] 13:51:52 INFO - --DOMWINDOW == 26 (0x7f4afe81a400) [pid = 2212] [serial = 682] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-result-format-as-string.html] 13:51:52 INFO - ++DOMWINDOW == 27 (0x7f4afe1e9800) [pid = 2212] [serial = 699] [outer = 0x7f4afe4c8400] 13:51:52 INFO - ++DOCSHELL 0x7f4afe4eb000 == 11 [pid = 2212] [id = 302] 13:51:52 INFO - ++DOMWINDOW == 28 (0x7f4afe4c5800) [pid = 2212] [serial = 700] [outer = (nil)] 13:51:52 INFO - ++DOMWINDOW == 29 (0x7f4afe4c7c00) [pid = 2212] [serial = 701] [outer = 0x7f4afe4c5800] 13:51:52 INFO - ++DOMWINDOW == 30 (0x7f4afe575c00) [pid = 2212] [serial = 702] [outer = 0x7f4afe4c5800] 13:51:52 INFO - ++DOCSHELL 0x7f4aff285000 == 12 [pid = 2212] [id = 303] 13:51:52 INFO - ++DOMWINDOW == 31 (0x7f4aff37e400) [pid = 2212] [serial = 703] [outer = (nil)] 13:51:52 INFO - ++DOMWINDOW == 32 (0x7f4aff419400) [pid = 2212] [serial = 704] [outer = 0x7f4aff37e400] 13:51:54 INFO - ++DOMWINDOW == 33 (0x7f4b089f5400) [pid = 2212] [serial = 705] [outer = 0x7f4afe4c8400] 13:51:54 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:51:55 INFO - --DOCSHELL 0x7f4aff285000 == 11 [pid = 2212] [id = 303] 13:51:55 INFO - --DOMWINDOW == 32 (0x7f4aff421800) [pid = 2212] [serial = 687] [outer = (nil)] [url = about:blank] 13:51:55 INFO - --DOMWINDOW == 31 (0x7f4aff37c000) [pid = 2212] [serial = 685] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:51:55 INFO - --DOMWINDOW == 30 (0x7f4afe4c7c00) [pid = 2212] [serial = 701] [outer = (nil)] [url = about:blank] 13:51:56 INFO - --DOMWINDOW == 29 (0x7f4afe1e9800) [pid = 2212] [serial = 699] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-replaced-api.html] 13:51:56 INFO - MEMORY STAT | vsize 1147MB | residentFast 291MB | heapAllocated 111MB 13:51:56 INFO - 160 INFO TEST-OK | devtools/client/webconsole/test/browser_warn_user_about_replaced_api.js | took 9141ms 13:51:56 INFO - ++DOCSHELL 0x7f4afe2be000 == 12 [pid = 2212] [id = 304] 13:51:56 INFO - ++DOMWINDOW == 30 (0x7f4afe1f2400) [pid = 2212] [serial = 706] [outer = (nil)] 13:51:56 INFO - ++DOMWINDOW == 31 (0x7f4afe3dd800) [pid = 2212] [serial = 707] [outer = 0x7f4afe1f2400] 13:51:56 INFO - 161 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_abbreviate_source_url.js 13:51:56 INFO - MEMORY STAT | vsize 1148MB | residentFast 292MB | heapAllocated 112MB 13:51:56 INFO - 162 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_abbreviate_source_url.js | took 159ms 13:51:56 INFO - ++DOCSHELL 0x7f4aff213000 == 13 [pid = 2212] [id = 305] 13:51:56 INFO - ++DOMWINDOW == 32 (0x7f4afe575800) [pid = 2212] [serial = 708] [outer = (nil)] 13:51:56 INFO - ++DOMWINDOW == 33 (0x7f4afe810800) [pid = 2212] [serial = 709] [outer = 0x7f4afe575800] 13:51:56 INFO - 163 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_allow_mixedcontent_securityerrors.js 13:51:57 INFO - ++DOCSHELL 0x7f4aff2c3000 == 14 [pid = 2212] [id = 306] 13:51:57 INFO - ++DOMWINDOW == 34 (0x7f4aff376800) [pid = 2212] [serial = 710] [outer = (nil)] 13:51:57 INFO - ++DOMWINDOW == 35 (0x7f4aff380c00) [pid = 2212] [serial = 711] [outer = 0x7f4aff376800] 13:51:57 INFO - ++DOMWINDOW == 36 (0x7f4b012d6c00) [pid = 2212] [serial = 712] [outer = 0x7f4aff376800] 13:51:58 INFO - ++DOCSHELL 0x7f4b07c19800 == 15 [pid = 2212] [id = 307] 13:51:58 INFO - ++DOMWINDOW == 37 (0x7f4afe1f3000) [pid = 2212] [serial = 713] [outer = (nil)] 13:51:58 INFO - [2212] WARNING: non-IME selection type: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 13:51:58 INFO - [2212] WARNING: Requested underline style is not valid: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5295 13:51:58 INFO - [2212] WARNING: Requested underline style is not valid: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5295 13:51:58 INFO - [2212] WARNING: non-IME selection type: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 13:51:58 INFO - ++DOMWINDOW == 38 (0x7f4b07a0b000) [pid = 2212] [serial = 714] [outer = 0x7f4afe1f3000] 13:51:58 INFO - ++DOCSHELL 0x7f4b07d92000 == 16 [pid = 2212] [id = 308] 13:51:58 INFO - ++DOMWINDOW == 39 (0x7f4b07a0dc00) [pid = 2212] [serial = 715] [outer = (nil)] 13:51:58 INFO - ++DOMWINDOW == 40 (0x7f4b07a11400) [pid = 2212] [serial = 716] [outer = 0x7f4b07a0dc00] 13:51:59 INFO - [2212] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 13:51:59 INFO - ++DOMWINDOW == 41 (0x7f4b09847800) [pid = 2212] [serial = 717] [outer = 0x7f4b07a0dc00] 13:51:59 INFO - ++DOCSHELL 0x7f4b0c399000 == 17 [pid = 2212] [id = 309] 13:51:59 INFO - ++DOMWINDOW == 42 (0x7f4b0984b800) [pid = 2212] [serial = 718] [outer = (nil)] 13:51:59 INFO - ++DOMWINDOW == 43 (0x7f4b0984e000) [pid = 2212] [serial = 719] [outer = 0x7f4b0984b800] 13:52:02 INFO - --DOCSHELL 0x7f4afe2be000 == 16 [pid = 2212] [id = 304] 13:52:02 INFO - --DOCSHELL 0x7f4afe4eb000 == 15 [pid = 2212] [id = 302] 13:52:02 INFO - --DOCSHELL 0x7f4afe4fb000 == 14 [pid = 2212] [id = 299] 13:52:02 INFO - --DOCSHELL 0x7f4b0c399000 == 13 [pid = 2212] [id = 309] 13:52:02 INFO - --DOCSHELL 0x7f4afe2d7000 == 12 [pid = 2212] [id = 298] 13:52:02 INFO - --DOMWINDOW == 42 (0x7f4b07a11400) [pid = 2212] [serial = 716] [outer = (nil)] [url = about:blank] 13:52:02 INFO - --DOMWINDOW == 41 (0x7f4afe3dd000) [pid = 2212] [serial = 689] [outer = (nil)] [url = about:blank] 13:52:02 INFO - --DOMWINDOW == 40 (0x7f4aff227400) [pid = 2212] [serial = 698] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/testscript.js] 13:52:02 INFO - --DOMWINDOW == 39 (0x7f4afe3dd800) [pid = 2212] [serial = 707] [outer = (nil)] [url = about:blank] 13:52:02 INFO - --DOMWINDOW == 38 (0x7f4aff380c00) [pid = 2212] [serial = 711] [outer = (nil)] [url = about:blank] 13:52:02 INFO - --DOMWINDOW == 37 (0x7f4aff37e400) [pid = 2212] [serial = 703] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:52:02 INFO - --DOMWINDOW == 36 (0x7f4aff37a000) [pid = 2212] [serial = 693] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:52:02 INFO - --DOMWINDOW == 35 (0x7f4b00f27800) [pid = 2212] [serial = 696] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:52:02 INFO - --DOMWINDOW == 34 (0x7f4afe4c5800) [pid = 2212] [serial = 700] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:52:02 INFO - --DOMWINDOW == 33 (0x7f4afe1f1400) [pid = 2212] [serial = 688] [outer = (nil)] [url = about:blank] 13:52:02 INFO - --DOMWINDOW == 32 (0x7f4afe4c8400) [pid = 2212] [serial = 690] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-replaced-api.html] 13:52:02 INFO - --DOMWINDOW == 31 (0x7f4afe1f2400) [pid = 2212] [serial = 706] [outer = (nil)] [url = about:blank] 13:52:03 INFO - --DOCSHELL 0x7f4b07c19800 == 11 [pid = 2212] [id = 307] 13:52:03 INFO - --DOMWINDOW == 30 (0x7f4b089f5400) [pid = 2212] [serial = 705] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-replaced-api.html] 13:52:03 INFO - MEMORY STAT | vsize 1147MB | residentFast 294MB | heapAllocated 113MB 13:52:03 INFO - 164 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_allow_mixedcontent_securityerrors.js | took 6319ms 13:52:03 INFO - ++DOCSHELL 0x7f4afe2d5000 == 12 [pid = 2212] [id = 310] 13:52:03 INFO - ++DOMWINDOW == 31 (0x7f4afe4c0c00) [pid = 2212] [serial = 720] [outer = (nil)] 13:52:03 INFO - ++DOMWINDOW == 32 (0x7f4afe547c00) [pid = 2212] [serial = 721] [outer = 0x7f4afe4c0c00] 13:52:03 INFO - 165 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_assert.js 13:52:03 INFO - ++DOCSHELL 0x7f4aff211000 == 13 [pid = 2212] [id = 311] 13:52:03 INFO - ++DOMWINDOW == 33 (0x7f4afe577400) [pid = 2212] [serial = 722] [outer = (nil)] 13:52:03 INFO - ++DOMWINDOW == 34 (0x7f4afe815000) [pid = 2212] [serial = 723] [outer = 0x7f4afe577400] 13:52:03 INFO - ++DOMWINDOW == 35 (0x7f4aff419c00) [pid = 2212] [serial = 724] [outer = 0x7f4afe577400] 13:52:04 INFO - ++DOCSHELL 0x7f4afe2bf800 == 14 [pid = 2212] [id = 312] 13:52:04 INFO - ++DOMWINDOW == 36 (0x7f4b00f58800) [pid = 2212] [serial = 725] [outer = (nil)] 13:52:04 INFO - ++DOMWINDOW == 37 (0x7f4b00f59c00) [pid = 2212] [serial = 726] [outer = 0x7f4b00f58800] 13:52:04 INFO - ++DOMWINDOW == 38 (0x7f4b012d7400) [pid = 2212] [serial = 727] [outer = 0x7f4b00f58800] 13:52:04 INFO - ++DOCSHELL 0x7f4b01904000 == 15 [pid = 2212] [id = 313] 13:52:04 INFO - ++DOMWINDOW == 39 (0x7f4b019b2400) [pid = 2212] [serial = 728] [outer = (nil)] 13:52:04 INFO - ++DOMWINDOW == 40 (0x7f4b07a04400) [pid = 2212] [serial = 729] [outer = 0x7f4b019b2400] 13:52:07 INFO - --DOCSHELL 0x7f4aff2c3000 == 14 [pid = 2212] [id = 306] 13:52:07 INFO - --DOCSHELL 0x7f4b01904000 == 13 [pid = 2212] [id = 313] 13:52:07 INFO - --DOCSHELL 0x7f4b07d92000 == 12 [pid = 2212] [id = 308] 13:52:07 INFO - --DOCSHELL 0x7f4aff213000 == 11 [pid = 2212] [id = 305] 13:52:07 INFO - --DOMWINDOW == 39 (0x7f4aff420400) [pid = 2212] [serial = 695] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:52:07 INFO - --DOMWINDOW == 38 (0x7f4b019b3400) [pid = 2212] [serial = 697] [outer = (nil)] [url = about:blank] 13:52:07 INFO - --DOMWINDOW == 37 (0x7f4afe575c00) [pid = 2212] [serial = 702] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:52:07 INFO - --DOMWINDOW == 36 (0x7f4aff419400) [pid = 2212] [serial = 704] [outer = (nil)] [url = about:blank] 13:52:07 INFO - --DOMWINDOW == 35 (0x7f4afe810800) [pid = 2212] [serial = 709] [outer = (nil)] [url = about:blank] 13:52:07 INFO - --DOMWINDOW == 34 (0x7f4b07a0b000) [pid = 2212] [serial = 714] [outer = (nil)] [url = http://example.com/] 13:52:07 INFO - --DOMWINDOW == 33 (0x7f4afe815000) [pid = 2212] [serial = 723] [outer = (nil)] [url = about:blank] 13:52:07 INFO - --DOMWINDOW == 32 (0x7f4b00f59c00) [pid = 2212] [serial = 726] [outer = (nil)] [url = about:blank] 13:52:07 INFO - --DOMWINDOW == 31 (0x7f4b07a0dc00) [pid = 2212] [serial = 715] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:52:07 INFO - --DOMWINDOW == 30 (0x7f4b0984b800) [pid = 2212] [serial = 718] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:52:07 INFO - --DOMWINDOW == 29 (0x7f4afe575800) [pid = 2212] [serial = 708] [outer = (nil)] [url = about:blank] 13:52:07 INFO - --DOMWINDOW == 28 (0x7f4aff376800) [pid = 2212] [serial = 710] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-mixedcontent-securityerrors.html] 13:52:07 INFO - --DOMWINDOW == 27 (0x7f4afe1f3000) [pid = 2212] [serial = 713] [outer = (nil)] [url = http://example.com/] 13:52:07 INFO - --DOMWINDOW == 26 (0x7f4b012d6c00) [pid = 2212] [serial = 712] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-mixedcontent-securityerrors.html] 13:52:07 INFO - MEMORY STAT | vsize 1148MB | residentFast 293MB | heapAllocated 112MB 13:52:07 INFO - 166 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_assert.js | took 4398ms 13:52:07 INFO - ++DOCSHELL 0x7f4afe2d7000 == 12 [pid = 2212] [id = 314] 13:52:07 INFO - ++DOMWINDOW == 27 (0x7f4afe1f2000) [pid = 2212] [serial = 730] [outer = (nil)] 13:52:07 INFO - ++DOMWINDOW == 28 (0x7f4afe3d8400) [pid = 2212] [serial = 731] [outer = 0x7f4afe1f2000] 13:52:08 INFO - 167 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_autocomplete-properties-with-non-alphanumeric-names.js 13:52:08 INFO - ++DOCSHELL 0x7f4afe4f1000 == 13 [pid = 2212] [id = 315] 13:52:08 INFO - ++DOMWINDOW == 29 (0x7f4afe4c4000) [pid = 2212] [serial = 732] [outer = (nil)] 13:52:08 INFO - ++DOMWINDOW == 30 (0x7f4afe54c400) [pid = 2212] [serial = 733] [outer = 0x7f4afe4c4000] 13:52:08 INFO - ++DOCSHELL 0x7f4aff205000 == 14 [pid = 2212] [id = 316] 13:52:08 INFO - ++DOMWINDOW == 31 (0x7f4afe571c00) [pid = 2212] [serial = 734] [outer = (nil)] 13:52:08 INFO - ++DOMWINDOW == 32 (0x7f4afe818800) [pid = 2212] [serial = 735] [outer = 0x7f4afe571c00] 13:52:08 INFO - ++DOMWINDOW == 33 (0x7f4aff420400) [pid = 2212] [serial = 736] [outer = 0x7f4afe571c00] 13:52:08 INFO - ++DOCSHELL 0x7f4aff2ce800 == 15 [pid = 2212] [id = 317] 13:52:08 INFO - ++DOMWINDOW == 34 (0x7f4b019b1c00) [pid = 2212] [serial = 737] [outer = (nil)] 13:52:08 INFO - ++DOMWINDOW == 35 (0x7f4b019bc400) [pid = 2212] [serial = 738] [outer = 0x7f4b019b1c00] 13:52:12 INFO - --DOCSHELL 0x7f4aff211000 == 14 [pid = 2212] [id = 311] 13:52:12 INFO - --DOCSHELL 0x7f4aff205000 == 13 [pid = 2212] [id = 316] 13:52:12 INFO - --DOCSHELL 0x7f4aff2ce800 == 12 [pid = 2212] [id = 317] 13:52:12 INFO - --DOCSHELL 0x7f4afe2d5000 == 11 [pid = 2212] [id = 310] 13:52:12 INFO - --DOCSHELL 0x7f4afe2bf800 == 10 [pid = 2212] [id = 312] 13:52:12 INFO - --DOMWINDOW == 34 (0x7f4b09847800) [pid = 2212] [serial = 717] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:52:12 INFO - --DOMWINDOW == 33 (0x7f4b0984e000) [pid = 2212] [serial = 719] [outer = (nil)] [url = about:blank] 13:52:12 INFO - --DOMWINDOW == 32 (0x7f4afe818800) [pid = 2212] [serial = 735] [outer = (nil)] [url = about:blank] 13:52:12 INFO - --DOMWINDOW == 31 (0x7f4afe547c00) [pid = 2212] [serial = 721] [outer = (nil)] [url = about:blank] 13:52:12 INFO - --DOMWINDOW == 30 (0x7f4b019b2400) [pid = 2212] [serial = 728] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:52:12 INFO - --DOMWINDOW == 29 (0x7f4b00f58800) [pid = 2212] [serial = 725] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:52:12 INFO - --DOMWINDOW == 28 (0x7f4afe577400) [pid = 2212] [serial = 722] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-assert.html] 13:52:12 INFO - --DOMWINDOW == 27 (0x7f4afe4c0c00) [pid = 2212] [serial = 720] [outer = (nil)] [url = about:blank] 13:52:12 INFO - --DOMWINDOW == 26 (0x7f4aff419c00) [pid = 2212] [serial = 724] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-assert.html] 13:52:12 INFO - MEMORY STAT | vsize 1147MB | residentFast 292MB | heapAllocated 111MB 13:52:12 INFO - 168 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_autocomplete-properties-with-non-alphanumeric-names.js | took 4600ms 13:52:12 INFO - ++DOCSHELL 0x7f4afe2d6800 == 11 [pid = 2212] [id = 318] 13:52:12 INFO - ++DOMWINDOW == 27 (0x7f4afe1e9800) [pid = 2212] [serial = 739] [outer = (nil)] 13:52:12 INFO - ++DOMWINDOW == 28 (0x7f4afe3d8800) [pid = 2212] [serial = 740] [outer = 0x7f4afe1e9800] 13:52:12 INFO - 169 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_autocomplete_and_selfxss.js 13:52:12 INFO - ++DOCSHELL 0x7f4aff213800 == 12 [pid = 2212] [id = 319] 13:52:12 INFO - ++DOMWINDOW == 29 (0x7f4afe571800) [pid = 2212] [serial = 741] [outer = (nil)] 13:52:13 INFO - ++DOMWINDOW == 30 (0x7f4afe576c00) [pid = 2212] [serial = 742] [outer = 0x7f4afe571800] 13:52:13 INFO - ++DOCSHELL 0x7f4afe2d9800 == 13 [pid = 2212] [id = 320] 13:52:13 INFO - ++DOMWINDOW == 31 (0x7f4afe578400) [pid = 2212] [serial = 743] [outer = (nil)] 13:52:13 INFO - ++DOMWINDOW == 32 (0x7f4afe81f000) [pid = 2212] [serial = 744] [outer = 0x7f4afe578400] 13:52:13 INFO - ++DOMWINDOW == 33 (0x7f4aff37a000) [pid = 2212] [serial = 745] [outer = 0x7f4afe578400] 13:52:13 INFO - ++DOCSHELL 0x7f4b01758800 == 14 [pid = 2212] [id = 321] 13:52:13 INFO - ++DOMWINDOW == 34 (0x7f4b00f2d800) [pid = 2212] [serial = 746] [outer = (nil)] 13:52:13 INFO - ++DOMWINDOW == 35 (0x7f4b00f31400) [pid = 2212] [serial = 747] [outer = 0x7f4b00f2d800] 13:52:15 INFO - [2212] WARNING: We should have hit the document element...: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/xul/BoxObject.cpp, line 175 13:52:16 INFO - --DOCSHELL 0x7f4afe4f1000 == 13 [pid = 2212] [id = 315] 13:52:16 INFO - --DOCSHELL 0x7f4b01758800 == 12 [pid = 2212] [id = 321] 13:52:16 INFO - --DOCSHELL 0x7f4afe2d7000 == 11 [pid = 2212] [id = 314] 13:52:16 INFO - --DOMWINDOW == 34 (0x7f4b012d7400) [pid = 2212] [serial = 727] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:52:16 INFO - --DOMWINDOW == 33 (0x7f4b07a04400) [pid = 2212] [serial = 729] [outer = (nil)] [url = about:blank] 13:52:17 INFO - --DOMWINDOW == 32 (0x7f4afe3d8400) [pid = 2212] [serial = 731] [outer = (nil)] [url = about:blank] 13:52:17 INFO - --DOMWINDOW == 31 (0x7f4afe54c400) [pid = 2212] [serial = 733] [outer = (nil)] [url = about:blank] 13:52:17 INFO - --DOMWINDOW == 30 (0x7f4afe81f000) [pid = 2212] [serial = 744] [outer = (nil)] [url = about:blank] 13:52:17 INFO - --DOMWINDOW == 29 (0x7f4afe571c00) [pid = 2212] [serial = 734] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:52:17 INFO - --DOMWINDOW == 28 (0x7f4b019b1c00) [pid = 2212] [serial = 737] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:52:17 INFO - --DOMWINDOW == 27 (0x7f4afe1f2000) [pid = 2212] [serial = 730] [outer = (nil)] [url = about:blank] 13:52:17 INFO - --DOMWINDOW == 26 (0x7f4afe4c4000) [pid = 2212] [serial = 732] [outer = (nil)] [url = data:text/html;charset=utf8,test%20autocompletion%20with%20$%20or%20_] 13:52:17 INFO - MEMORY STAT | vsize 1148MB | residentFast 295MB | heapAllocated 111MB 13:52:17 INFO - 170 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_autocomplete_and_selfxss.js | took 4384ms 13:52:17 INFO - ++DOCSHELL 0x7f4afe2d7000 == 12 [pid = 2212] [id = 322] 13:52:17 INFO - ++DOMWINDOW == 27 (0x7f4afe1f1400) [pid = 2212] [serial = 748] [outer = (nil)] 13:52:17 INFO - ++DOMWINDOW == 28 (0x7f4afe3d9000) [pid = 2212] [serial = 749] [outer = 0x7f4afe1f1400] 13:52:17 INFO - 171 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_autocomplete_crossdomain_iframe.js 13:52:17 INFO - ++DOCSHELL 0x7f4aff211800 == 13 [pid = 2212] [id = 323] 13:52:17 INFO - ++DOMWINDOW == 29 (0x7f4afe573800) [pid = 2212] [serial = 750] [outer = (nil)] 13:52:17 INFO - ++DOMWINDOW == 30 (0x7f4afe811400) [pid = 2212] [serial = 751] [outer = 0x7f4afe573800] 13:52:17 INFO - ++DOMWINDOW == 31 (0x7f4afe81dc00) [pid = 2212] [serial = 752] [outer = 0x7f4afe573800] 13:52:18 INFO - ++DOCSHELL 0x7f4aff2c7800 == 14 [pid = 2212] [id = 324] 13:52:18 INFO - ++DOMWINDOW == 32 (0x7f4afe00e800) [pid = 2212] [serial = 753] [outer = (nil)] 13:52:18 INFO - ++DOMWINDOW == 33 (0x7f4aff376400) [pid = 2212] [serial = 754] [outer = 0x7f4afe00e800] 13:52:18 INFO - ++DOCSHELL 0x7f4afe394000 == 15 [pid = 2212] [id = 325] 13:52:18 INFO - ++DOMWINDOW == 34 (0x7f4aff37bc00) [pid = 2212] [serial = 755] [outer = (nil)] 13:52:18 INFO - ++DOMWINDOW == 35 (0x7f4aff420000) [pid = 2212] [serial = 756] [outer = 0x7f4aff37bc00] 13:52:18 INFO - ++DOMWINDOW == 36 (0x7f4aff424000) [pid = 2212] [serial = 757] [outer = 0x7f4aff37bc00] 13:52:18 INFO - ++DOCSHELL 0x7f4b01775800 == 16 [pid = 2212] [id = 326] 13:52:18 INFO - ++DOMWINDOW == 37 (0x7f4b07d5c000) [pid = 2212] [serial = 758] [outer = (nil)] 13:52:18 INFO - ++DOMWINDOW == 38 (0x7f4b07d76000) [pid = 2212] [serial = 759] [outer = 0x7f4b07d5c000] 13:52:20 INFO - getProperty threw an exception: Error: Permission denied to access property "document" 13:52:20 INFO - Stack: getProperty@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:300:20 13:52:20 INFO - JSPropertyProvider@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/js-property-provider.js:253:13 13:52:20 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 13:52:20 INFO - WCA_onAutocomplete@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:908:18 13:52:20 INFO - DSC_onPacket@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/main.js:1606:15 13:52:20 INFO - LocalDebuggerTransport.prototype.send/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/transport/transport.js:569:11 13:52:20 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 13:52:20 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 13:52:20 INFO - Line: 0, column: 0 13:52:21 INFO - --DOCSHELL 0x7f4aff213800 == 15 [pid = 2212] [id = 319] 13:52:21 INFO - --DOCSHELL 0x7f4afe2d9800 == 14 [pid = 2212] [id = 320] 13:52:21 INFO - --DOCSHELL 0x7f4afe394000 == 13 [pid = 2212] [id = 325] 13:52:21 INFO - --DOCSHELL 0x7f4afe2d6800 == 12 [pid = 2212] [id = 318] 13:52:21 INFO - --DOCSHELL 0x7f4b01775800 == 11 [pid = 2212] [id = 326] 13:52:22 INFO - --DOMWINDOW == 37 (0x7f4aff420400) [pid = 2212] [serial = 736] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:52:22 INFO - --DOMWINDOW == 36 (0x7f4b019bc400) [pid = 2212] [serial = 738] [outer = (nil)] [url = about:blank] 13:52:22 INFO - --DOMWINDOW == 35 (0x7f4aff420000) [pid = 2212] [serial = 756] [outer = (nil)] [url = about:blank] 13:52:22 INFO - --DOMWINDOW == 34 (0x7f4afe811400) [pid = 2212] [serial = 751] [outer = (nil)] [url = about:blank] 13:52:22 INFO - --DOMWINDOW == 33 (0x7f4afe576c00) [pid = 2212] [serial = 742] [outer = (nil)] [url = about:blank] 13:52:22 INFO - --DOMWINDOW == 32 (0x7f4afe3d8800) [pid = 2212] [serial = 740] [outer = (nil)] [url = about:blank] 13:52:22 INFO - --DOMWINDOW == 31 (0x7f4b00f2d800) [pid = 2212] [serial = 746] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:52:22 INFO - --DOMWINDOW == 30 (0x7f4afe578400) [pid = 2212] [serial = 743] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:52:22 INFO - --DOMWINDOW == 29 (0x7f4afe571800) [pid = 2212] [serial = 741] [outer = (nil)] [url = data:text/html;charset=utf-8,

test%20for%20bug%20642615] 13:52:22 INFO - --DOMWINDOW == 28 (0x7f4afe1e9800) [pid = 2212] [serial = 739] [outer = (nil)] [url = about:blank] 13:52:22 INFO - --DOCSHELL 0x7f4aff2c7800 == 10 [pid = 2212] [id = 324] 13:52:22 INFO - MEMORY STAT | vsize 1147MB | residentFast 292MB | heapAllocated 111MB 13:52:22 INFO - 172 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_autocomplete_crossdomain_iframe.js | took 4877ms 13:52:22 INFO - ++DOCSHELL 0x7f4afe2ce800 == 11 [pid = 2212] [id = 327] 13:52:22 INFO - ++DOMWINDOW == 29 (0x7f4afe1e9800) [pid = 2212] [serial = 760] [outer = (nil)] 13:52:22 INFO - ++DOMWINDOW == 30 (0x7f4afe3de000) [pid = 2212] [serial = 761] [outer = 0x7f4afe1e9800] 13:52:22 INFO - 173 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_autocomplete_in_debugger_stackframe.js 13:52:22 INFO - ++DOCSHELL 0x7f4aff212000 == 12 [pid = 2212] [id = 328] 13:52:22 INFO - ++DOMWINDOW == 31 (0x7f4afe574c00) [pid = 2212] [serial = 762] [outer = (nil)] 13:52:22 INFO - ++DOMWINDOW == 32 (0x7f4afe810800) [pid = 2212] [serial = 763] [outer = 0x7f4afe574c00] 13:52:22 INFO - ++DOMWINDOW == 33 (0x7f4aff22a000) [pid = 2212] [serial = 764] [outer = 0x7f4afe574c00] 13:52:23 INFO - ++DOCSHELL 0x7f4afe4e3000 == 13 [pid = 2212] [id = 329] 13:52:23 INFO - ++DOMWINDOW == 34 (0x7f4aff37fc00) [pid = 2212] [serial = 765] [outer = (nil)] 13:52:23 INFO - ++DOMWINDOW == 35 (0x7f4aff416800) [pid = 2212] [serial = 766] [outer = 0x7f4aff37fc00] 13:52:23 INFO - ++DOMWINDOW == 36 (0x7f4b00f23800) [pid = 2212] [serial = 767] [outer = 0x7f4aff37fc00] 13:52:23 INFO - ++DOCSHELL 0x7f4b0190c800 == 14 [pid = 2212] [id = 330] 13:52:23 INFO - ++DOMWINDOW == 37 (0x7f4b012dc000) [pid = 2212] [serial = 768] [outer = (nil)] 13:52:23 INFO - ++DOMWINDOW == 38 (0x7f4b012df800) [pid = 2212] [serial = 769] [outer = 0x7f4b012dc000] 13:52:26 INFO - ++DOCSHELL 0x7f4afe2d1000 == 15 [pid = 2212] [id = 331] 13:52:26 INFO - ++DOMWINDOW == 39 (0x7f4afe0b0c00) [pid = 2212] [serial = 770] [outer = (nil)] 13:52:26 INFO - ++DOMWINDOW == 40 (0x7f4afe0b2c00) [pid = 2212] [serial = 771] [outer = 0x7f4afe0b0c00] 13:52:26 INFO - ++DOCSHELL 0x7f4b07c31000 == 16 [pid = 2212] [id = 332] 13:52:26 INFO - ++DOMWINDOW == 41 (0x7f4afe81b400) [pid = 2212] [serial = 772] [outer = (nil)] 13:52:26 INFO - ++DOMWINDOW == 42 (0x7f4aff373c00) [pid = 2212] [serial = 773] [outer = 0x7f4afe81b400] 13:52:28 INFO - --DOCSHELL 0x7f4afe2d7000 == 15 [pid = 2212] [id = 322] 13:52:29 INFO - --DOCSHELL 0x7f4aff211800 == 14 [pid = 2212] [id = 323] 13:52:29 INFO - --DOMWINDOW == 41 (0x7f4aff37a000) [pid = 2212] [serial = 745] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:52:29 INFO - --DOMWINDOW == 40 (0x7f4b00f31400) [pid = 2212] [serial = 747] [outer = (nil)] [url = about:blank] 13:52:33 INFO - Handler function JSPropertyProvider threw an exception: TypeError: aName is not an identifier 13:52:33 INFO - Stack: DebuggerEnvironmentSupport.getProperty@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/js-property-provider.js:512:18 13:52:33 INFO - getExactMatch_impl@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/js-property-provider.js:444:16 13:52:33 INFO - getVariableInEnvironment@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/js-property-provider.js:340:10 13:52:33 INFO - JSPropertyProvider@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/webconsole/js-property-provider.js:232:11 13:52:33 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 13:52:33 INFO - WCA_onAutocomplete@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/webconsole.js:908:18 13:52:33 INFO - DSC_onPacket@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/main.js:1606:15 13:52:33 INFO - LocalDebuggerTransport.prototype.send/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/transport/transport.js:569:11 13:52:33 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 13:52:33 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 13:52:33 INFO - EventLoop.prototype.enter@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/script.js:347:5 13:52:33 INFO - ThreadActor.prototype._pushThreadPause@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/script.js:544:5 13:52:33 INFO - ThreadActor.prototype._pauseAndRespond@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/script.js:747:7 13:52:33 INFO - ThreadActor.prototype.onDebuggerStatement@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/script.js:1819:9 13:52:33 INFO - secondCall@http://example.com/browser/devtools/client/webconsole/test/test-autocomplete-in-stackframe.html:43:9 13:52:33 INFO - firstCall@http://example.com/browser/devtools/client/webconsole/test/test-autocomplete-in-stackframe.html:30:9 13:52:33 INFO - debuggerOpened/<@chrome://mochitests/content/browser/devtools/client/webconsole/test/browser_webconsole_autocomplete_in_debugger_stackframe.js:231:5 13:52:33 INFO - testScope/test_executeSoon/<.run@chrome://mochikit/content/browser-test.js:969:9 13:52:33 INFO - Line: 512, column: 18 13:52:33 INFO - --DOCSHELL 0x7f4b07c31000 == 13 [pid = 2212] [id = 332] 13:52:33 INFO - --DOCSHELL 0x7f4afe2d1000 == 12 [pid = 2212] [id = 331] 13:52:33 INFO - --DOCSHELL 0x7f4b0190c800 == 11 [pid = 2212] [id = 330] 13:52:34 INFO - --DOMWINDOW == 39 (0x7f4afe3d9000) [pid = 2212] [serial = 749] [outer = (nil)] [url = about:blank] 13:52:34 INFO - --DOMWINDOW == 38 (0x7f4afe810800) [pid = 2212] [serial = 763] [outer = (nil)] [url = about:blank] 13:52:34 INFO - --DOMWINDOW == 37 (0x7f4afe1f1400) [pid = 2212] [serial = 748] [outer = (nil)] [url = about:blank] 13:52:34 INFO - --DOMWINDOW == 36 (0x7f4afe00e800) [pid = 2212] [serial = 753] [outer = (nil)] [url = http://mochi.test:8888/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-child.html] 13:52:34 INFO - --DOMWINDOW == 35 (0x7f4afe573800) [pid = 2212] [serial = 750] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-989025-iframe-parent.html] 13:52:34 INFO - --DOMWINDOW == 34 (0x7f4aff376400) [pid = 2212] [serial = 754] [outer = (nil)] [url = http://mochi.test:8888/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-child.html] 13:52:34 INFO - --DOMWINDOW == 33 (0x7f4afe81dc00) [pid = 2212] [serial = 752] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-989025-iframe-parent.html] 13:52:34 INFO - --DOMWINDOW == 32 (0x7f4afe81b400) [pid = 2212] [serial = 772] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:52:34 INFO - --DOMWINDOW == 31 (0x7f4aff416800) [pid = 2212] [serial = 766] [outer = (nil)] [url = about:blank] 13:52:34 INFO - --DOMWINDOW == 30 (0x7f4b07d5c000) [pid = 2212] [serial = 758] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:52:34 INFO - --DOMWINDOW == 29 (0x7f4aff37bc00) [pid = 2212] [serial = 755] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:52:35 INFO - MEMORY STAT | vsize 1145MB | residentFast 294MB | heapAllocated 114MB 13:52:35 INFO - 174 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_autocomplete_in_debugger_stackframe.js | took 12573ms 13:52:35 INFO - ++DOCSHELL 0x7f4afe2bc000 == 12 [pid = 2212] [id = 333] 13:52:35 INFO - ++DOMWINDOW == 30 (0x7f4afe1f4400) [pid = 2212] [serial = 774] [outer = (nil)] 13:52:35 INFO - ++DOMWINDOW == 31 (0x7f4afe571800) [pid = 2212] [serial = 775] [outer = 0x7f4afe1f4400] 13:52:35 INFO - 175 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_autocomplete_popup_close_on_tab_switch.js 13:52:35 INFO - ++DOCSHELL 0x7f4aff21e800 == 13 [pid = 2212] [id = 334] 13:52:35 INFO - ++DOMWINDOW == 32 (0x7f4aff416800) [pid = 2212] [serial = 776] [outer = (nil)] 13:52:35 INFO - ++DOMWINDOW == 33 (0x7f4aff41ec00) [pid = 2212] [serial = 777] [outer = 0x7f4aff416800] 13:52:36 INFO - ++DOCSHELL 0x7f4afe2d5000 == 14 [pid = 2212] [id = 335] 13:52:36 INFO - ++DOMWINDOW == 34 (0x7f4aff420000) [pid = 2212] [serial = 778] [outer = (nil)] 13:52:36 INFO - ++DOMWINDOW == 35 (0x7f4b00f30400) [pid = 2212] [serial = 779] [outer = 0x7f4aff420000] 13:52:36 INFO - ++DOMWINDOW == 36 (0x7f4b012d8400) [pid = 2212] [serial = 780] [outer = 0x7f4aff420000] 13:52:36 INFO - ++DOCSHELL 0x7f4b01775800 == 15 [pid = 2212] [id = 336] 13:52:36 INFO - ++DOMWINDOW == 37 (0x7f4b08988400) [pid = 2212] [serial = 781] [outer = (nil)] 13:52:36 INFO - ++DOMWINDOW == 38 (0x7f4b09581400) [pid = 2212] [serial = 782] [outer = 0x7f4b08988400] 13:52:39 INFO - ++DOCSHELL 0x7f4b0c3a7000 == 16 [pid = 2212] [id = 337] 13:52:39 INFO - ++DOMWINDOW == 39 (0x7f4b012df400) [pid = 2212] [serial = 783] [outer = (nil)] 13:52:39 INFO - ++DOMWINDOW == 40 (0x7f4b0c1ab000) [pid = 2212] [serial = 784] [outer = 0x7f4b012df400] 13:52:40 INFO - MEMORY STAT | vsize 1148MB | residentFast 301MB | heapAllocated 121MB 13:52:40 INFO - 176 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_autocomplete_popup_close_on_tab_switch.js | took 5070ms 13:52:40 INFO - ++DOCSHELL 0x7f4afe2d2000 == 17 [pid = 2212] [id = 338] 13:52:40 INFO - ++DOMWINDOW == 41 (0x7f4b07a0dc00) [pid = 2212] [serial = 785] [outer = (nil)] 13:52:40 INFO - ++DOMWINDOW == 42 (0x7f4b07a10000) [pid = 2212] [serial = 786] [outer = 0x7f4b07a0dc00] 13:52:41 INFO - 177 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_basic_net_logging.js 13:52:41 INFO - ++DOCSHELL 0x7f4afe2c8800 == 18 [pid = 2212] [id = 339] 13:52:41 INFO - ++DOMWINDOW == 43 (0x7f4b0ac02800) [pid = 2212] [serial = 787] [outer = (nil)] 13:52:41 INFO - ++DOMWINDOW == 44 (0x7f4b0ca7fc00) [pid = 2212] [serial = 788] [outer = 0x7f4b0ac02800] 13:52:41 INFO - ++DOCSHELL 0x7f4b10a7a000 == 19 [pid = 2212] [id = 340] 13:52:41 INFO - ++DOMWINDOW == 45 (0x7f4b0d754000) [pid = 2212] [serial = 789] [outer = (nil)] 13:52:41 INFO - ++DOMWINDOW == 46 (0x7f4b0fbb8000) [pid = 2212] [serial = 790] [outer = 0x7f4b0d754000] 13:52:41 INFO - ++DOMWINDOW == 47 (0x7f4b120a1c00) [pid = 2212] [serial = 791] [outer = 0x7f4b0d754000] 13:52:42 INFO - ++DOCSHELL 0x7f4b11d1f800 == 20 [pid = 2212] [id = 341] 13:52:42 INFO - ++DOMWINDOW == 48 (0x7f4b12608800) [pid = 2212] [serial = 792] [outer = (nil)] 13:52:42 INFO - ++DOMWINDOW == 49 (0x7f4b12954000) [pid = 2212] [serial = 793] [outer = 0x7f4b12608800] 13:52:44 INFO - ++DOMWINDOW == 50 (0x7f4b15bf6000) [pid = 2212] [serial = 794] [outer = 0x7f4b0ac02800] 13:52:44 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:52:46 INFO - --DOCSHELL 0x7f4aff212000 == 19 [pid = 2212] [id = 328] 13:52:46 INFO - --DOCSHELL 0x7f4afe4e3000 == 18 [pid = 2212] [id = 329] 13:52:46 INFO - --DOCSHELL 0x7f4b01775800 == 17 [pid = 2212] [id = 336] 13:52:46 INFO - --DOCSHELL 0x7f4afe2ce800 == 16 [pid = 2212] [id = 327] 13:52:46 INFO - --DOCSHELL 0x7f4b11d1f800 == 15 [pid = 2212] [id = 341] 13:52:46 INFO - --DOMWINDOW == 49 (0x7f4b07d76000) [pid = 2212] [serial = 759] [outer = (nil)] [url = about:blank] 13:52:46 INFO - --DOMWINDOW == 48 (0x7f4aff424000) [pid = 2212] [serial = 757] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:52:46 INFO - --DOMWINDOW == 47 (0x7f4aff373c00) [pid = 2212] [serial = 773] [outer = (nil)] [url = data:text/html;charset=utf8,%20%20%20%20%20%20%20%20%20%20] 13:52:47 INFO - --DOMWINDOW == 46 (0x7f4b0fbb8000) [pid = 2212] [serial = 790] [outer = (nil)] [url = about:blank] 13:52:47 INFO - --DOMWINDOW == 45 (0x7f4b0c1ab000) [pid = 2212] [serial = 784] [outer = (nil)] [url = about:blank] 13:52:47 INFO - --DOMWINDOW == 44 (0x7f4afe1e9800) [pid = 2212] [serial = 760] [outer = (nil)] [url = about:blank] 13:52:47 INFO - --DOMWINDOW == 43 (0x7f4afe3de000) [pid = 2212] [serial = 761] [outer = (nil)] [url = about:blank] 13:52:47 INFO - --DOMWINDOW == 42 (0x7f4aff416800) [pid = 2212] [serial = 776] [outer = (nil)] [url = data:text/html;charset=utf-8,

bug%20900448%20-%20autocomplete%20popup%20closes%20on%20tab%20switch] 13:52:47 INFO - --DOMWINDOW == 41 (0x7f4b00f30400) [pid = 2212] [serial = 779] [outer = (nil)] [url = about:blank] 13:52:47 INFO - --DOMWINDOW == 40 (0x7f4aff41ec00) [pid = 2212] [serial = 777] [outer = (nil)] [url = about:blank] 13:52:47 INFO - --DOMWINDOW == 39 (0x7f4afe571800) [pid = 2212] [serial = 775] [outer = (nil)] [url = about:blank] 13:52:47 INFO - --DOMWINDOW == 38 (0x7f4afe1f4400) [pid = 2212] [serial = 774] [outer = (nil)] [url = about:blank] 13:52:47 INFO - --DOMWINDOW == 37 (0x7f4aff37fc00) [pid = 2212] [serial = 765] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:52:47 INFO - --DOMWINDOW == 36 (0x7f4afe0b0c00) [pid = 2212] [serial = 770] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul] 13:52:47 INFO - --DOMWINDOW == 35 (0x7f4b012dc000) [pid = 2212] [serial = 768] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:52:47 INFO - --DOMWINDOW == 34 (0x7f4afe574c00) [pid = 2212] [serial = 762] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-autocomplete-in-stackframe.html] 13:52:47 INFO - --DOMWINDOW == 33 (0x7f4b012df400) [pid = 2212] [serial = 783] [outer = (nil)] [url = data:text/html;charset=utf-8,

testing%20autocomplete%20closes] 13:52:47 INFO - --DOMWINDOW == 32 (0x7f4aff22a000) [pid = 2212] [serial = 764] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-autocomplete-in-stackframe.html] 13:52:47 INFO - MEMORY STAT | vsize 1149MB | residentFast 303MB | heapAllocated 115MB 13:52:47 INFO - 178 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_basic_net_logging.js | took 6429ms 13:52:47 INFO - ++DOCSHELL 0x7f4afe2d1000 == 16 [pid = 2212] [id = 342] 13:52:47 INFO - ++DOMWINDOW == 33 (0x7f4afe3d6c00) [pid = 2212] [serial = 795] [outer = (nil)] 13:52:47 INFO - ++DOMWINDOW == 34 (0x7f4afe3e2000) [pid = 2212] [serial = 796] [outer = 0x7f4afe3d6c00] 13:52:47 INFO - 179 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_block_mixedcontent_securityerrors.js 13:52:47 INFO - ++DOCSHELL 0x7f4aff2c3000 == 17 [pid = 2212] [id = 343] 13:52:47 INFO - ++DOMWINDOW == 35 (0x7f4afe81bc00) [pid = 2212] [serial = 797] [outer = (nil)] 13:52:47 INFO - ++DOMWINDOW == 36 (0x7f4aff376c00) [pid = 2212] [serial = 798] [outer = 0x7f4afe81bc00] 13:52:48 INFO - ++DOMWINDOW == 37 (0x7f4aff421800) [pid = 2212] [serial = 799] [outer = 0x7f4afe81bc00] 13:52:48 INFO - ++DOCSHELL 0x7f4aff2d0800 == 18 [pid = 2212] [id = 344] 13:52:48 INFO - ++DOMWINDOW == 38 (0x7f4b00f23c00) [pid = 2212] [serial = 800] [outer = (nil)] 13:52:48 INFO - [2212] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x805E0006: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 445 13:52:48 INFO - ++DOMWINDOW == 39 (0x7f4b00f25000) [pid = 2212] [serial = 801] [outer = 0x7f4b00f23c00] 13:52:48 INFO - ++DOCSHELL 0x7f4aff28e800 == 19 [pid = 2212] [id = 345] 13:52:48 INFO - ++DOMWINDOW == 40 (0x7f4b00f28800) [pid = 2212] [serial = 802] [outer = (nil)] 13:52:48 INFO - ++DOMWINDOW == 41 (0x7f4b00f56400) [pid = 2212] [serial = 803] [outer = 0x7f4b00f28800] 13:52:48 INFO - ++DOMWINDOW == 42 (0x7f4b012dc000) [pid = 2212] [serial = 804] [outer = 0x7f4b00f28800] 13:52:48 INFO - ++DOCSHELL 0x7f4b0a7d0800 == 20 [pid = 2212] [id = 346] 13:52:48 INFO - ++DOMWINDOW == 43 (0x7f4b0952c000) [pid = 2212] [serial = 805] [outer = (nil)] 13:52:48 INFO - ++DOMWINDOW == 44 (0x7f4b09622000) [pid = 2212] [serial = 806] [outer = 0x7f4b0952c000] 13:52:51 INFO - ++DOMWINDOW == 45 (0x7f4b00f29400) [pid = 2212] [serial = 807] [outer = 0x7f4afe81bc00] 13:52:51 INFO - [2212] WARNING: Page was shift reloaded, skipping ServiceWorker control: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsDocument.cpp, line 4702 13:52:51 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:52:52 INFO - ++DOCSHELL 0x7f4b01911800 == 21 [pid = 2212] [id = 347] 13:52:52 INFO - ++DOMWINDOW == 46 (0x7f4b019be000) [pid = 2212] [serial = 808] [outer = (nil)] 13:52:52 INFO - [2212] WARNING: non-IME selection type: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 13:52:52 INFO - [2212] WARNING: Requested underline style is not valid: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5295 13:52:52 INFO - ++DOMWINDOW == 47 (0x7f4b099b4c00) [pid = 2212] [serial = 809] [outer = 0x7f4b019be000] 13:52:52 INFO - [2212] WARNING: Requested underline style is not valid: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5295 13:52:52 INFO - [2212] WARNING: non-IME selection type: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 13:52:52 INFO - ++DOMWINDOW == 48 (0x7f4b00f27400) [pid = 2212] [serial = 810] [outer = 0x7f4b019be000] 13:52:52 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:52:54 INFO - --DOCSHELL 0x7f4aff2d0800 == 20 [pid = 2212] [id = 344] 13:52:54 INFO - --DOCSHELL 0x7f4afe2bc000 == 19 [pid = 2212] [id = 333] 13:52:54 INFO - --DOCSHELL 0x7f4aff21e800 == 18 [pid = 2212] [id = 334] 13:52:54 INFO - --DOCSHELL 0x7f4afe2d5000 == 17 [pid = 2212] [id = 335] 13:52:54 INFO - --DOCSHELL 0x7f4aff28e800 == 16 [pid = 2212] [id = 345] 13:52:54 INFO - --DOCSHELL 0x7f4b0a7d0800 == 15 [pid = 2212] [id = 346] 13:52:54 INFO - --DOCSHELL 0x7f4b10a7a000 == 14 [pid = 2212] [id = 340] 13:52:54 INFO - --DOCSHELL 0x7f4afe2d2000 == 13 [pid = 2212] [id = 338] 13:52:54 INFO - --DOCSHELL 0x7f4afe2c8800 == 12 [pid = 2212] [id = 339] 13:52:54 INFO - --DOCSHELL 0x7f4b0c3a7000 == 11 [pid = 2212] [id = 337] 13:52:54 INFO - --DOMWINDOW == 47 (0x7f4b00f23800) [pid = 2212] [serial = 767] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:52:54 INFO - --DOMWINDOW == 46 (0x7f4b012df800) [pid = 2212] [serial = 769] [outer = (nil)] [url = about:blank] 13:52:54 INFO - --DOMWINDOW == 45 (0x7f4afe0b2c00) [pid = 2212] [serial = 771] [outer = (nil)] [url = about:blank] 13:52:54 INFO - --DOMWINDOW == 44 (0x7f4b00f23c00) [pid = 2212] [serial = 800] [outer = (nil)] [url = about:blank] 13:52:54 INFO - --DOMWINDOW == 43 (0x7f4b00f25000) [pid = 2212] [serial = 801] [outer = (nil)] [url = about:blank] 13:52:54 INFO - --DOMWINDOW == 42 (0x7f4aff376c00) [pid = 2212] [serial = 798] [outer = (nil)] [url = about:blank] 13:52:54 INFO - --DOMWINDOW == 41 (0x7f4b07a10000) [pid = 2212] [serial = 786] [outer = (nil)] [url = about:blank] 13:52:54 INFO - --DOMWINDOW == 40 (0x7f4b0ca7fc00) [pid = 2212] [serial = 788] [outer = (nil)] [url = about:blank] 13:52:54 INFO - --DOMWINDOW == 39 (0x7f4b00f56400) [pid = 2212] [serial = 803] [outer = (nil)] [url = about:blank] 13:52:54 INFO - --DOMWINDOW == 38 (0x7f4b099b4c00) [pid = 2212] [serial = 809] [outer = (nil)] [url = about:blank] 13:52:54 INFO - --DOMWINDOW == 37 (0x7f4b08988400) [pid = 2212] [serial = 781] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:52:54 INFO - --DOMWINDOW == 36 (0x7f4b0d754000) [pid = 2212] [serial = 789] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:52:54 INFO - --DOMWINDOW == 35 (0x7f4b12608800) [pid = 2212] [serial = 792] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:52:54 INFO - --DOMWINDOW == 34 (0x7f4aff420000) [pid = 2212] [serial = 778] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:52:54 INFO - --DOMWINDOW == 33 (0x7f4b07a0dc00) [pid = 2212] [serial = 785] [outer = (nil)] [url = about:blank] 13:52:54 INFO - --DOMWINDOW == 32 (0x7f4b0ac02800) [pid = 2212] [serial = 787] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html?_date=1446846761062] 13:52:54 INFO - --DOMWINDOW == 31 (0x7f4aff421800) [pid = 2212] [serial = 799] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-mixedcontent-securityerrors.html] 13:52:54 INFO - --DOMWINDOW == 30 (0x7f4b15bf6000) [pid = 2212] [serial = 794] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html?_date=1446846761062] 13:52:54 INFO - MEMORY STAT | vsize 1147MB | residentFast 298MB | heapAllocated 113MB 13:52:54 INFO - 180 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_block_mixedcontent_securityerrors.js | took 7087ms 13:52:54 INFO - ++DOCSHELL 0x7f4afe39c000 == 12 [pid = 2212] [id = 348] 13:52:54 INFO - ++DOMWINDOW == 31 (0x7f4afe3dfc00) [pid = 2212] [serial = 811] [outer = (nil)] 13:52:54 INFO - ++DOMWINDOW == 32 (0x7f4afe4c4000) [pid = 2212] [serial = 812] [outer = 0x7f4afe3dfc00] 13:52:55 INFO - 181 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_1006027_message_timestamps_incorrect.js 13:52:55 INFO - ++DOCSHELL 0x7f4aff222000 == 13 [pid = 2212] [id = 349] 13:52:55 INFO - ++DOMWINDOW == 33 (0x7f4afe81a000) [pid = 2212] [serial = 813] [outer = (nil)] 13:52:55 INFO - ++DOMWINDOW == 34 (0x7f4aff232800) [pid = 2212] [serial = 814] [outer = 0x7f4afe81a000] 13:52:55 INFO - ++DOCSHELL 0x7f4aff21e800 == 14 [pid = 2212] [id = 350] 13:52:55 INFO - ++DOMWINDOW == 35 (0x7f4aff420800) [pid = 2212] [serial = 815] [outer = (nil)] 13:52:55 INFO - ++DOMWINDOW == 36 (0x7f4b00f26400) [pid = 2212] [serial = 816] [outer = 0x7f4aff420800] 13:52:55 INFO - ++DOMWINDOW == 37 (0x7f4b00f5c000) [pid = 2212] [serial = 817] [outer = 0x7f4aff420800] 13:52:55 INFO - ++DOCSHELL 0x7f4b07c19800 == 15 [pid = 2212] [id = 351] 13:52:55 INFO - ++DOMWINDOW == 38 (0x7f4b07a10000) [pid = 2212] [serial = 818] [outer = (nil)] 13:52:55 INFO - ++DOMWINDOW == 39 (0x7f4b07d5d400) [pid = 2212] [serial = 819] [outer = 0x7f4b07a10000] 13:52:58 INFO - --DOCSHELL 0x7f4b01911800 == 14 [pid = 2212] [id = 347] 13:52:58 INFO - --DOCSHELL 0x7f4aff2c3000 == 13 [pid = 2212] [id = 343] 13:52:58 INFO - --DOCSHELL 0x7f4b07c19800 == 12 [pid = 2212] [id = 351] 13:52:58 INFO - --DOMWINDOW == 38 (0x7f4b12954000) [pid = 2212] [serial = 793] [outer = (nil)] [url = about:blank] 13:52:58 INFO - --DOMWINDOW == 37 (0x7f4b120a1c00) [pid = 2212] [serial = 791] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:52:58 INFO - --DOMWINDOW == 36 (0x7f4b09581400) [pid = 2212] [serial = 782] [outer = (nil)] [url = about:blank] 13:52:58 INFO - --DOMWINDOW == 35 (0x7f4b012d8400) [pid = 2212] [serial = 780] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:52:58 INFO - --DOMWINDOW == 34 (0x7f4b00f27400) [pid = 2212] [serial = 810] [outer = (nil)] [url = http://example.com/] 13:52:58 INFO - --DOMWINDOW == 33 (0x7f4afe3e2000) [pid = 2212] [serial = 796] [outer = (nil)] [url = about:blank] 13:52:58 INFO - --DOMWINDOW == 32 (0x7f4b00f26400) [pid = 2212] [serial = 816] [outer = (nil)] [url = about:blank] 13:52:58 INFO - --DOMWINDOW == 31 (0x7f4b0952c000) [pid = 2212] [serial = 805] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:52:58 INFO - --DOMWINDOW == 30 (0x7f4b00f28800) [pid = 2212] [serial = 802] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:52:58 INFO - --DOMWINDOW == 29 (0x7f4b019be000) [pid = 2212] [serial = 808] [outer = (nil)] [url = http://example.com/] 13:52:58 INFO - --DOMWINDOW == 28 (0x7f4afe81bc00) [pid = 2212] [serial = 797] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-mixedcontent-securityerrors.html] 13:52:58 INFO - --DOMWINDOW == 27 (0x7f4afe3d6c00) [pid = 2212] [serial = 795] [outer = (nil)] [url = about:blank] 13:52:58 INFO - --DOMWINDOW == 26 (0x7f4b00f29400) [pid = 2212] [serial = 807] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-mixedcontent-securityerrors.html] 13:52:59 INFO - MEMORY STAT | vsize 1148MB | residentFast 296MB | heapAllocated 112MB 13:52:59 INFO - 182 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_1006027_message_timestamps_incorrect.js | took 4071ms 13:52:59 INFO - ++DOCSHELL 0x7f4afe2d8800 == 13 [pid = 2212] [id = 352] 13:52:59 INFO - ++DOMWINDOW == 27 (0x7f4afe1e7400) [pid = 2212] [serial = 820] [outer = (nil)] 13:52:59 INFO - ++DOMWINDOW == 28 (0x7f4afe1f5c00) [pid = 2212] [serial = 821] [outer = 0x7f4afe1e7400] 13:52:59 INFO - 183 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_1010953_cspro.js 13:52:59 INFO - ++DOCSHELL 0x7f4aff218000 == 14 [pid = 2212] [id = 353] 13:52:59 INFO - ++DOMWINDOW == 29 (0x7f4afe4cbc00) [pid = 2212] [serial = 822] [outer = (nil)] 13:52:59 INFO - ++DOMWINDOW == 30 (0x7f4afe57e400) [pid = 2212] [serial = 823] [outer = 0x7f4afe4cbc00] 13:52:59 INFO - ++DOCSHELL 0x7f4afe3a4000 == 15 [pid = 2212] [id = 354] 13:52:59 INFO - ++DOMWINDOW == 31 (0x7f4afe811000) [pid = 2212] [serial = 824] [outer = (nil)] 13:52:59 INFO - ++DOMWINDOW == 32 (0x7f4aff41ec00) [pid = 2212] [serial = 825] [outer = 0x7f4afe811000] 13:52:59 INFO - ++DOMWINDOW == 33 (0x7f4b00f2c000) [pid = 2212] [serial = 826] [outer = 0x7f4afe811000] 13:53:00 INFO - ++DOCSHELL 0x7f4b01902800 == 16 [pid = 2212] [id = 355] 13:53:00 INFO - ++DOMWINDOW == 34 (0x7f4b019bc000) [pid = 2212] [serial = 827] [outer = (nil)] 13:53:00 INFO - ++DOMWINDOW == 35 (0x7f4b07a0d400) [pid = 2212] [serial = 828] [outer = 0x7f4b019bc000] 13:53:01 INFO - ++DOMWINDOW == 36 (0x7f4b0ac10c00) [pid = 2212] [serial = 829] [outer = 0x7f4afe4cbc00] 13:53:02 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:53:02 INFO - console.log: 13:53:01.841 GET http://example.com/browser/devtools/client/webconsole/test/test_bug_1010953_cspro.html [HTTP/1.1 200 OK 58ms] 13:53:02 INFO - 13:53:02.201 GET http://some.example.com/test_bug_1010953_cspro.js [63ms] 13:53:02 INFO - 13:53:02.202 Content Security Policy: The page's settings blocked the loading of a resource at http://some.example.com/test.png ("img-src http://example.com").1 13:53:02 INFO - 13:53:02.208 Content Security Policy: The page's settings observed the loading of a resource at http://some.example.com/test_bug_1010953_cspro.js ("script-src http://example.com"). A CSP report is being sent.1 13:53:02 INFO - 13:53:02.268 POST https://example.com/ignored/ [HTTP/1.1 200 Connected 219ms] 13:53:04 INFO - --DOCSHELL 0x7f4afe39c000 == 15 [pid = 2212] [id = 348] 13:53:04 INFO - --DOCSHELL 0x7f4aff222000 == 14 [pid = 2212] [id = 349] 13:53:04 INFO - --DOCSHELL 0x7f4aff21e800 == 13 [pid = 2212] [id = 350] 13:53:04 INFO - --DOCSHELL 0x7f4afe3a4000 == 12 [pid = 2212] [id = 354] 13:53:04 INFO - --DOCSHELL 0x7f4b01902800 == 11 [pid = 2212] [id = 355] 13:53:04 INFO - --DOCSHELL 0x7f4afe2d1000 == 10 [pid = 2212] [id = 342] 13:53:04 INFO - --DOMWINDOW == 35 (0x7f4b012dc000) [pid = 2212] [serial = 804] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:53:04 INFO - --DOMWINDOW == 34 (0x7f4b09622000) [pid = 2212] [serial = 806] [outer = (nil)] [url = about:blank] 13:53:04 INFO - --DOMWINDOW == 33 (0x7f4afe4c4000) [pid = 2212] [serial = 812] [outer = (nil)] [url = about:blank] 13:53:04 INFO - --DOMWINDOW == 32 (0x7f4aff232800) [pid = 2212] [serial = 814] [outer = (nil)] [url = about:blank] 13:53:04 INFO - --DOMWINDOW == 31 (0x7f4aff41ec00) [pid = 2212] [serial = 825] [outer = (nil)] [url = about:blank] 13:53:04 INFO - --DOMWINDOW == 30 (0x7f4aff420800) [pid = 2212] [serial = 815] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:53:04 INFO - --DOMWINDOW == 29 (0x7f4afe81a000) [pid = 2212] [serial = 813] [outer = (nil)] [url = data:text/html;charset=utf8,Test%20for%20Bug%201006027] 13:53:04 INFO - --DOMWINDOW == 28 (0x7f4afe3dfc00) [pid = 2212] [serial = 811] [outer = (nil)] [url = about:blank] 13:53:04 INFO - --DOMWINDOW == 27 (0x7f4b07a10000) [pid = 2212] [serial = 818] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:53:04 INFO - MEMORY STAT | vsize 1145MB | residentFast 290MB | heapAllocated 111MB 13:53:04 INFO - 184 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_1010953_cspro.js | took 5362ms 13:53:04 INFO - ++DOCSHELL 0x7f4afe2cd000 == 11 [pid = 2212] [id = 356] 13:53:04 INFO - ++DOMWINDOW == 28 (0x7f4afe0b2c00) [pid = 2212] [serial = 830] [outer = (nil)] 13:53:04 INFO - ++DOMWINDOW == 29 (0x7f4afe3d7000) [pid = 2212] [serial = 831] [outer = 0x7f4afe0b2c00] 13:53:05 INFO - 185 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_1050691_click_function_to_source.js 13:53:05 INFO - ++DOCSHELL 0x7f4afe2c1800 == 12 [pid = 2212] [id = 357] 13:53:05 INFO - ++DOMWINDOW == 30 (0x7f4afe571400) [pid = 2212] [serial = 832] [outer = (nil)] 13:53:05 INFO - ++DOMWINDOW == 31 (0x7f4afe812400) [pid = 2212] [serial = 833] [outer = 0x7f4afe571400] 13:53:05 INFO - ++DOMWINDOW == 32 (0x7f4b00f64000) [pid = 2212] [serial = 834] [outer = 0x7f4afe571400] 13:53:05 INFO - ++DOCSHELL 0x7f4aff2ca800 == 13 [pid = 2212] [id = 358] 13:53:05 INFO - ++DOMWINDOW == 33 (0x7f4b00f24c00) [pid = 2212] [serial = 835] [outer = (nil)] 13:53:05 INFO - ++DOMWINDOW == 34 (0x7f4b00f26c00) [pid = 2212] [serial = 836] [outer = 0x7f4b00f24c00] 13:53:06 INFO - ++DOMWINDOW == 35 (0x7f4aff424c00) [pid = 2212] [serial = 837] [outer = 0x7f4b00f24c00] 13:53:06 INFO - ++DOCSHELL 0x7f4b07c20000 == 14 [pid = 2212] [id = 359] 13:53:06 INFO - ++DOMWINDOW == 36 (0x7f4b012db400) [pid = 2212] [serial = 838] [outer = (nil)] 13:53:06 INFO - ++DOMWINDOW == 37 (0x7f4b07a12400) [pid = 2212] [serial = 839] [outer = 0x7f4b012db400] 13:53:08 INFO - ++DOCSHELL 0x7f4b0c82d000 == 15 [pid = 2212] [id = 360] 13:53:08 INFO - ++DOMWINDOW == 38 (0x7f4b0c1a8800) [pid = 2212] [serial = 840] [outer = (nil)] 13:53:08 INFO - ++DOMWINDOW == 39 (0x7f4b0c1a5800) [pid = 2212] [serial = 841] [outer = 0x7f4b0c1a8800] 13:53:08 INFO - console.warn: notDebuggee: cannot access the environment of this function. 13:53:08 INFO - ++DOCSHELL 0x7f4b0fa3a000 == 16 [pid = 2212] [id = 361] 13:53:08 INFO - ++DOMWINDOW == 40 (0x7f4b00f59800) [pid = 2212] [serial = 842] [outer = (nil)] 13:53:08 INFO - ++DOMWINDOW == 41 (0x7f4b0c8f2800) [pid = 2212] [serial = 843] [outer = 0x7f4b00f59800] 13:53:08 INFO - ++DOCSHELL 0x7f4b10a83000 == 17 [pid = 2212] [id = 362] 13:53:08 INFO - ++DOMWINDOW == 42 (0x7f4b0f989800) [pid = 2212] [serial = 844] [outer = (nil)] 13:53:08 INFO - ++DOMWINDOW == 43 (0x7f4b0c1a7800) [pid = 2212] [serial = 845] [outer = 0x7f4b0f989800] 13:53:11 INFO - --DOCSHELL 0x7f4afe2d8800 == 16 [pid = 2212] [id = 352] 13:53:11 INFO - --DOCSHELL 0x7f4aff218000 == 15 [pid = 2212] [id = 353] 13:53:11 INFO - --DOCSHELL 0x7f4b07c20000 == 14 [pid = 2212] [id = 359] 13:53:11 INFO - --DOCSHELL 0x7f4b0c82d000 == 13 [pid = 2212] [id = 360] 13:53:11 INFO - --DOCSHELL 0x7f4b0fa3a000 == 12 [pid = 2212] [id = 361] 13:53:11 INFO - --DOCSHELL 0x7f4b10a83000 == 11 [pid = 2212] [id = 362] 13:53:11 INFO - --DOMWINDOW == 42 (0x7f4b07d5d400) [pid = 2212] [serial = 819] [outer = (nil)] [url = about:blank] 13:53:11 INFO - --DOMWINDOW == 41 (0x7f4b00f5c000) [pid = 2212] [serial = 817] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:53:11 INFO - --DOMWINDOW == 40 (0x7f4afe4cbc00) [pid = 2212] [serial = 822] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test_bug_1010953_cspro.html] 13:53:11 INFO - --DOMWINDOW == 39 (0x7f4afe1e7400) [pid = 2212] [serial = 820] [outer = (nil)] [url = about:blank] 13:53:11 INFO - --DOMWINDOW == 38 (0x7f4afe812400) [pid = 2212] [serial = 833] [outer = (nil)] [url = about:blank] 13:53:11 INFO - --DOMWINDOW == 37 (0x7f4afe57e400) [pid = 2212] [serial = 823] [outer = (nil)] [url = about:blank] 13:53:11 INFO - --DOMWINDOW == 36 (0x7f4afe1f5c00) [pid = 2212] [serial = 821] [outer = (nil)] [url = about:blank] 13:53:11 INFO - --DOMWINDOW == 35 (0x7f4b00f26c00) [pid = 2212] [serial = 836] [outer = (nil)] [url = about:blank] 13:53:11 INFO - --DOMWINDOW == 34 (0x7f4b019bc000) [pid = 2212] [serial = 827] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:53:11 INFO - --DOMWINDOW == 33 (0x7f4afe811000) [pid = 2212] [serial = 824] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:53:11 INFO - --DOMWINDOW == 32 (0x7f4b0ac10c00) [pid = 2212] [serial = 829] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test_bug_1010953_cspro.html] 13:53:12 INFO - MEMORY STAT | vsize 1149MB | residentFast 300MB | heapAllocated 116MB 13:53:12 INFO - 186 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_1050691_click_function_to_source.js | took 6995ms 13:53:12 INFO - ++DOCSHELL 0x7f4afe39a000 == 12 [pid = 2212] [id = 363] 13:53:12 INFO - ++DOMWINDOW == 33 (0x7f4afe1e8c00) [pid = 2212] [serial = 846] [outer = (nil)] 13:53:12 INFO - ++DOMWINDOW == 34 (0x7f4afe4bd800) [pid = 2212] [serial = 847] [outer = 0x7f4afe1e8c00] 13:53:12 INFO - 187 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_579412_input_focus.js 13:53:12 INFO - ++DOCSHELL 0x7f4aff2b7000 == 13 [pid = 2212] [id = 364] 13:53:12 INFO - ++DOMWINDOW == 35 (0x7f4afe57e800) [pid = 2212] [serial = 848] [outer = (nil)] 13:53:12 INFO - ++DOMWINDOW == 36 (0x7f4afe819000) [pid = 2212] [serial = 849] [outer = 0x7f4afe57e800] 13:53:12 INFO - ++DOMWINDOW == 37 (0x7f4aff419400) [pid = 2212] [serial = 850] [outer = 0x7f4afe57e800] 13:53:12 INFO - ++DOCSHELL 0x7f4afe2c9000 == 14 [pid = 2212] [id = 365] 13:53:12 INFO - ++DOMWINDOW == 38 (0x7f4aff422400) [pid = 2212] [serial = 851] [outer = (nil)] 13:53:12 INFO - ++DOMWINDOW == 39 (0x7f4aff425c00) [pid = 2212] [serial = 852] [outer = 0x7f4aff422400] 13:53:12 INFO - ++DOMWINDOW == 40 (0x7f4b00f61000) [pid = 2212] [serial = 853] [outer = 0x7f4aff422400] 13:53:13 INFO - ++DOCSHELL 0x7f4b07d87000 == 15 [pid = 2212] [id = 366] 13:53:13 INFO - ++DOMWINDOW == 41 (0x7f4b07d75800) [pid = 2212] [serial = 854] [outer = (nil)] 13:53:13 INFO - ++DOMWINDOW == 42 (0x7f4b0984d400) [pid = 2212] [serial = 855] [outer = 0x7f4b07d75800] 13:53:15 INFO - --DOCSHELL 0x7f4afe2cd000 == 14 [pid = 2212] [id = 356] 13:53:15 INFO - --DOCSHELL 0x7f4aff2ca800 == 13 [pid = 2212] [id = 358] 13:53:15 INFO - --DOCSHELL 0x7f4b07d87000 == 12 [pid = 2212] [id = 366] 13:53:15 INFO - --DOCSHELL 0x7f4afe2c1800 == 11 [pid = 2212] [id = 357] 13:53:15 INFO - --DOMWINDOW == 41 (0x7f4b07a0d400) [pid = 2212] [serial = 828] [outer = (nil)] [url = about:blank] 13:53:15 INFO - --DOMWINDOW == 40 (0x7f4b00f2c000) [pid = 2212] [serial = 826] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:53:16 INFO - --DOMWINDOW == 39 (0x7f4afe819000) [pid = 2212] [serial = 849] [outer = (nil)] [url = about:blank] 13:53:16 INFO - --DOMWINDOW == 38 (0x7f4afe3d7000) [pid = 2212] [serial = 831] [outer = (nil)] [url = about:blank] 13:53:16 INFO - --DOMWINDOW == 37 (0x7f4b0c1a8800) [pid = 2212] [serial = 840] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:53:16 INFO - --DOMWINDOW == 36 (0x7f4aff425c00) [pid = 2212] [serial = 852] [outer = (nil)] [url = about:blank] 13:53:16 INFO - --DOMWINDOW == 35 (0x7f4b00f24c00) [pid = 2212] [serial = 835] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:53:16 INFO - --DOMWINDOW == 34 (0x7f4b012db400) [pid = 2212] [serial = 838] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:53:16 INFO - --DOMWINDOW == 33 (0x7f4afe571400) [pid = 2212] [serial = 832] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_1050691_click_function_to_source.html] 13:53:16 INFO - --DOMWINDOW == 32 (0x7f4afe0b2c00) [pid = 2212] [serial = 830] [outer = (nil)] [url = about:blank] 13:53:16 INFO - --DOMWINDOW == 31 (0x7f4b00f59800) [pid = 2212] [serial = 842] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul] 13:53:16 INFO - --DOMWINDOW == 30 (0x7f4b0f989800) [pid = 2212] [serial = 844] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 13:53:16 INFO - --DOMWINDOW == 29 (0x7f4b00f64000) [pid = 2212] [serial = 834] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_1050691_click_function_to_source.html] 13:53:16 INFO - MEMORY STAT | vsize 1150MB | residentFast 300MB | heapAllocated 116MB 13:53:16 INFO - 188 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_579412_input_focus.js | took 4174ms 13:53:16 INFO - ++DOCSHELL 0x7f4afe396800 == 12 [pid = 2212] [id = 367] 13:53:16 INFO - ++DOMWINDOW == 30 (0x7f4afe1f3c00) [pid = 2212] [serial = 856] [outer = (nil)] 13:53:16 INFO - ++DOMWINDOW == 31 (0x7f4afe3e4800) [pid = 2212] [serial = 857] [outer = 0x7f4afe1f3c00] 13:53:16 INFO - 189 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_580001_closing_after_completion.js 13:53:16 INFO - ++DOCSHELL 0x7f4aff28a000 == 13 [pid = 2212] [id = 368] 13:53:16 INFO - ++DOMWINDOW == 32 (0x7f4afe814c00) [pid = 2212] [serial = 858] [outer = (nil)] 13:53:16 INFO - ++DOMWINDOW == 33 (0x7f4afe81b000) [pid = 2212] [serial = 859] [outer = 0x7f4afe814c00] 13:53:16 INFO - ++DOMWINDOW == 34 (0x7f4aff41b000) [pid = 2212] [serial = 860] [outer = 0x7f4afe814c00] 13:53:17 INFO - ++DOCSHELL 0x7f4afe2db000 == 14 [pid = 2212] [id = 369] 13:53:17 INFO - ++DOMWINDOW == 35 (0x7f4b00f23800) [pid = 2212] [serial = 861] [outer = (nil)] 13:53:17 INFO - ++DOMWINDOW == 36 (0x7f4b00f25800) [pid = 2212] [serial = 862] [outer = 0x7f4b00f23800] 13:53:17 INFO - ++DOMWINDOW == 37 (0x7f4b00f59c00) [pid = 2212] [serial = 863] [outer = 0x7f4b00f23800] 13:53:17 INFO - ++DOCSHELL 0x7f4b07c5a800 == 15 [pid = 2212] [id = 370] 13:53:17 INFO - ++DOMWINDOW == 38 (0x7f4b07a0f400) [pid = 2212] [serial = 864] [outer = (nil)] 13:53:17 INFO - ++DOMWINDOW == 39 (0x7f4b07d59400) [pid = 2212] [serial = 865] [outer = 0x7f4b07a0f400] 13:53:20 INFO - --DOCSHELL 0x7f4afe39a000 == 14 [pid = 2212] [id = 363] 13:53:20 INFO - --DOCSHELL 0x7f4afe2c9000 == 13 [pid = 2212] [id = 365] 13:53:20 INFO - --DOCSHELL 0x7f4b07c5a800 == 12 [pid = 2212] [id = 370] 13:53:20 INFO - --DOCSHELL 0x7f4aff2b7000 == 11 [pid = 2212] [id = 364] 13:53:20 INFO - --DOMWINDOW == 38 (0x7f4b0c1a7800) [pid = 2212] [serial = 845] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 13:53:20 INFO - --DOMWINDOW == 37 (0x7f4b0c8f2800) [pid = 2212] [serial = 843] [outer = (nil)] [url = about:blank] 13:53:20 INFO - --DOMWINDOW == 36 (0x7f4b0c1a5800) [pid = 2212] [serial = 841] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:53:20 INFO - --DOMWINDOW == 35 (0x7f4b07a12400) [pid = 2212] [serial = 839] [outer = (nil)] [url = about:blank] 13:53:20 INFO - --DOMWINDOW == 34 (0x7f4aff424c00) [pid = 2212] [serial = 837] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:53:20 INFO - --DOMWINDOW == 33 (0x7f4afe81b000) [pid = 2212] [serial = 859] [outer = (nil)] [url = about:blank] 13:53:20 INFO - --DOMWINDOW == 32 (0x7f4afe4bd800) [pid = 2212] [serial = 847] [outer = (nil)] [url = about:blank] 13:53:20 INFO - --DOMWINDOW == 31 (0x7f4b00f25800) [pid = 2212] [serial = 862] [outer = (nil)] [url = about:blank] 13:53:20 INFO - --DOMWINDOW == 30 (0x7f4b07d75800) [pid = 2212] [serial = 854] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:53:20 INFO - --DOMWINDOW == 29 (0x7f4aff422400) [pid = 2212] [serial = 851] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:53:20 INFO - --DOMWINDOW == 28 (0x7f4afe57e800) [pid = 2212] [serial = 848] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:53:20 INFO - --DOMWINDOW == 27 (0x7f4afe1e8c00) [pid = 2212] [serial = 846] [outer = (nil)] [url = about:blank] 13:53:20 INFO - --DOMWINDOW == 26 (0x7f4aff419400) [pid = 2212] [serial = 850] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:53:20 INFO - MEMORY STAT | vsize 1150MB | residentFast 298MB | heapAllocated 112MB 13:53:20 INFO - 190 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_580001_closing_after_completion.js | took 4108ms 13:53:20 INFO - ++DOCSHELL 0x7f4afe2c3000 == 12 [pid = 2212] [id = 371] 13:53:20 INFO - ++DOMWINDOW == 27 (0x7f4afe1e8800) [pid = 2212] [serial = 866] [outer = (nil)] 13:53:20 INFO - ++DOMWINDOW == 28 (0x7f4afe3de000) [pid = 2212] [serial = 867] [outer = 0x7f4afe1e8800] 13:53:21 INFO - 191 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_580030_errors_after_page_reload.js 13:53:21 INFO - ++DOCSHELL 0x7f4aff221000 == 13 [pid = 2212] [id = 372] 13:53:21 INFO - ++DOMWINDOW == 29 (0x7f4afe00d800) [pid = 2212] [serial = 868] [outer = (nil)] 13:53:21 INFO - ++DOMWINDOW == 30 (0x7f4afe815c00) [pid = 2212] [serial = 869] [outer = 0x7f4afe00d800] 13:53:21 INFO - ++DOMWINDOW == 31 (0x7f4b00f2fc00) [pid = 2212] [serial = 870] [outer = 0x7f4afe00d800] 13:53:21 INFO - ++DOCSHELL 0x7f4afe2c7800 == 14 [pid = 2212] [id = 373] 13:53:21 INFO - ++DOMWINDOW == 32 (0x7f4b00f24400) [pid = 2212] [serial = 871] [outer = (nil)] 13:53:21 INFO - ++DOMWINDOW == 33 (0x7f4b00f26c00) [pid = 2212] [serial = 872] [outer = 0x7f4b00f24400] 13:53:21 INFO - ++DOMWINDOW == 34 (0x7f4b00f56400) [pid = 2212] [serial = 873] [outer = 0x7f4b00f24400] 13:53:21 INFO - ++DOCSHELL 0x7f4b07c6f000 == 15 [pid = 2212] [id = 374] 13:53:21 INFO - ++DOMWINDOW == 35 (0x7f4b07a13000) [pid = 2212] [serial = 874] [outer = (nil)] 13:53:21 INFO - ++DOMWINDOW == 36 (0x7f4b07d64800) [pid = 2212] [serial = 875] [outer = 0x7f4b07a13000] 13:53:23 INFO - ++DOMWINDOW == 37 (0x7f4b0c1a9800) [pid = 2212] [serial = 876] [outer = 0x7f4afe00d800] 13:53:23 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:53:23 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-error.html, line 16: ReferenceError: fooBazBaz is not defined 13:53:25 INFO - --DOCSHELL 0x7f4afe2db000 == 14 [pid = 2212] [id = 369] 13:53:25 INFO - --DOCSHELL 0x7f4b07c6f000 == 13 [pid = 2212] [id = 374] 13:53:25 INFO - --DOCSHELL 0x7f4afe396800 == 12 [pid = 2212] [id = 367] 13:53:25 INFO - --DOCSHELL 0x7f4aff28a000 == 11 [pid = 2212] [id = 368] 13:53:25 INFO - --DOMWINDOW == 36 (0x7f4b00f61000) [pid = 2212] [serial = 853] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:53:25 INFO - --DOMWINDOW == 35 (0x7f4b0984d400) [pid = 2212] [serial = 855] [outer = (nil)] [url = about:blank] 13:53:25 INFO - --DOMWINDOW == 34 (0x7f4afe3e4800) [pid = 2212] [serial = 857] [outer = (nil)] [url = about:blank] 13:53:25 INFO - --DOMWINDOW == 33 (0x7f4afe815c00) [pid = 2212] [serial = 869] [outer = (nil)] [url = about:blank] 13:53:25 INFO - --DOMWINDOW == 32 (0x7f4b00f26c00) [pid = 2212] [serial = 872] [outer = (nil)] [url = about:blank] 13:53:25 INFO - --DOMWINDOW == 31 (0x7f4b07a0f400) [pid = 2212] [serial = 864] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:53:25 INFO - --DOMWINDOW == 30 (0x7f4b00f23800) [pid = 2212] [serial = 861] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:53:25 INFO - --DOMWINDOW == 29 (0x7f4afe1f3c00) [pid = 2212] [serial = 856] [outer = (nil)] [url = about:blank] 13:53:25 INFO - --DOMWINDOW == 28 (0x7f4afe814c00) [pid = 2212] [serial = 858] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:53:25 INFO - --DOMWINDOW == 27 (0x7f4aff41b000) [pid = 2212] [serial = 860] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:53:25 INFO - MEMORY STAT | vsize 1149MB | residentFast 296MB | heapAllocated 112MB 13:53:25 INFO - 192 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_580030_errors_after_page_reload.js | took 4633ms 13:53:25 INFO - ++DOCSHELL 0x7f4afe2cc800 == 12 [pid = 2212] [id = 375] 13:53:25 INFO - ++DOMWINDOW == 28 (0x7f4afe4c4400) [pid = 2212] [serial = 877] [outer = (nil)] 13:53:25 INFO - ++DOMWINDOW == 29 (0x7f4afe54dc00) [pid = 2212] [serial = 878] [outer = 0x7f4afe4c4400] 13:53:25 INFO - 193 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_580454_timestamp_l10n.js 13:53:25 INFO - ++DOCSHELL 0x7f4aff2ce000 == 13 [pid = 2212] [id = 376] 13:53:25 INFO - ++DOMWINDOW == 30 (0x7f4afe81c400) [pid = 2212] [serial = 879] [outer = (nil)] 13:53:25 INFO - ++DOMWINDOW == 31 (0x7f4aff379800) [pid = 2212] [serial = 880] [outer = 0x7f4afe81c400] 13:53:26 INFO - ++DOMWINDOW == 32 (0x7f4aff425800) [pid = 2212] [serial = 881] [outer = 0x7f4afe81c400] 13:53:26 INFO - MEMORY STAT | vsize 1150MB | residentFast 296MB | heapAllocated 114MB 13:53:26 INFO - 194 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_580454_timestamp_l10n.js | took 771ms 13:53:26 INFO - ++DOCSHELL 0x7f4b07c1e800 == 14 [pid = 2212] [id = 377] 13:53:26 INFO - ++DOMWINDOW == 33 (0x7f4b00f2f000) [pid = 2212] [serial = 882] [outer = (nil)] 13:53:26 INFO - ++DOMWINDOW == 34 (0x7f4b00f5a400) [pid = 2212] [serial = 883] [outer = 0x7f4b00f2f000] 13:53:26 INFO - 195 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_582201_duplicate_errors.js 13:53:26 INFO - ++DOCSHELL 0x7f4afe391000 == 15 [pid = 2212] [id = 378] 13:53:26 INFO - ++DOMWINDOW == 35 (0x7f4b019ba800) [pid = 2212] [serial = 884] [outer = (nil)] 13:53:26 INFO - ++DOMWINDOW == 36 (0x7f4b07a0d000) [pid = 2212] [serial = 885] [outer = 0x7f4b019ba800] 13:53:27 INFO - ++DOCSHELL 0x7f4aff2cc800 == 16 [pid = 2212] [id = 379] 13:53:27 INFO - ++DOMWINDOW == 37 (0x7f4b07a0ec00) [pid = 2212] [serial = 886] [outer = (nil)] 13:53:27 INFO - ++DOMWINDOW == 38 (0x7f4b09849000) [pid = 2212] [serial = 887] [outer = 0x7f4b07a0ec00] 13:53:27 INFO - ++DOMWINDOW == 39 (0x7f4b09bbb000) [pid = 2212] [serial = 888] [outer = 0x7f4b07a0ec00] 13:53:27 INFO - ++DOCSHELL 0x7f4afe3a0000 == 17 [pid = 2212] [id = 380] 13:53:27 INFO - ++DOMWINDOW == 40 (0x7f4afe1e9400) [pid = 2212] [serial = 889] [outer = (nil)] 13:53:27 INFO - ++DOMWINDOW == 41 (0x7f4afe3e0000) [pid = 2212] [serial = 890] [outer = 0x7f4afe1e9400] 13:53:29 INFO - ++DOMWINDOW == 42 (0x7f4b0c8f1400) [pid = 2212] [serial = 891] [outer = 0x7f4b019ba800] 13:53:29 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:53:29 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-duplicate-error.html, line 17: ReferenceError: fooDuplicateError1 is not defined 13:53:31 INFO - --DOCSHELL 0x7f4aff221000 == 16 [pid = 2212] [id = 372] 13:53:31 INFO - --DOCSHELL 0x7f4afe2c7800 == 15 [pid = 2212] [id = 373] 13:53:31 INFO - --DOCSHELL 0x7f4afe3a0000 == 14 [pid = 2212] [id = 380] 13:53:31 INFO - --DOMWINDOW == 41 (0x7f4b07d59400) [pid = 2212] [serial = 865] [outer = (nil)] [url = about:blank] 13:53:31 INFO - --DOMWINDOW == 40 (0x7f4b00f59c00) [pid = 2212] [serial = 863] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:53:31 INFO - --DOMWINDOW == 39 (0x7f4b00f2fc00) [pid = 2212] [serial = 870] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-error.html] 13:53:31 INFO - --DOMWINDOW == 38 (0x7f4aff379800) [pid = 2212] [serial = 880] [outer = (nil)] [url = about:blank] 13:53:31 INFO - --DOMWINDOW == 37 (0x7f4afe54dc00) [pid = 2212] [serial = 878] [outer = (nil)] [url = about:blank] 13:53:31 INFO - --DOMWINDOW == 36 (0x7f4afe3de000) [pid = 2212] [serial = 867] [outer = (nil)] [url = about:blank] 13:53:31 INFO - --DOMWINDOW == 35 (0x7f4b09849000) [pid = 2212] [serial = 887] [outer = (nil)] [url = about:blank] 13:53:31 INFO - --DOMWINDOW == 34 (0x7f4b00f24400) [pid = 2212] [serial = 871] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:53:31 INFO - --DOMWINDOW == 33 (0x7f4b07a13000) [pid = 2212] [serial = 874] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:53:31 INFO - --DOMWINDOW == 32 (0x7f4afe81c400) [pid = 2212] [serial = 879] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:53:31 INFO - --DOMWINDOW == 31 (0x7f4afe4c4400) [pid = 2212] [serial = 877] [outer = (nil)] [url = about:blank] 13:53:31 INFO - --DOMWINDOW == 30 (0x7f4afe1e8800) [pid = 2212] [serial = 866] [outer = (nil)] [url = about:blank] 13:53:31 INFO - --DOMWINDOW == 29 (0x7f4afe00d800) [pid = 2212] [serial = 868] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-error.html] 13:53:31 INFO - MEMORY STAT | vsize 1150MB | residentFast 298MB | heapAllocated 113MB 13:53:31 INFO - 196 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_582201_duplicate_errors.js | took 5044ms 13:53:31 INFO - ++DOCSHELL 0x7f4afe396800 == 15 [pid = 2212] [id = 381] 13:53:31 INFO - ++DOMWINDOW == 30 (0x7f4afe3df400) [pid = 2212] [serial = 892] [outer = (nil)] 13:53:31 INFO - ++DOMWINDOW == 31 (0x7f4afe54b000) [pid = 2212] [serial = 893] [outer = 0x7f4afe3df400] 13:53:32 INFO - 197 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_583816_No_input_and_Tab_key_pressed.js 13:53:32 INFO - ++DOCSHELL 0x7f4aff2d0000 == 16 [pid = 2212] [id = 382] 13:53:32 INFO - ++DOMWINDOW == 32 (0x7f4aff22ac00) [pid = 2212] [serial = 894] [outer = (nil)] 13:53:32 INFO - ++DOMWINDOW == 33 (0x7f4aff380c00) [pid = 2212] [serial = 895] [outer = 0x7f4aff22ac00] 13:53:32 INFO - ++DOMWINDOW == 34 (0x7f4b00f27800) [pid = 2212] [serial = 896] [outer = 0x7f4aff22ac00] 13:53:32 INFO - ++DOCSHELL 0x7f4afe2cd800 == 17 [pid = 2212] [id = 383] 13:53:32 INFO - ++DOMWINDOW == 35 (0x7f4aff425c00) [pid = 2212] [serial = 897] [outer = (nil)] 13:53:32 INFO - ++DOMWINDOW == 36 (0x7f4b00f30c00) [pid = 2212] [serial = 898] [outer = 0x7f4aff425c00] 13:53:32 INFO - ++DOMWINDOW == 37 (0x7f4b07a04400) [pid = 2212] [serial = 899] [outer = 0x7f4aff425c00] 13:53:33 INFO - ++DOCSHELL 0x7f4b0f7b8000 == 18 [pid = 2212] [id = 384] 13:53:33 INFO - ++DOMWINDOW == 38 (0x7f4b09853800) [pid = 2212] [serial = 900] [outer = (nil)] 13:53:33 INFO - ++DOMWINDOW == 39 (0x7f4b099b4c00) [pid = 2212] [serial = 901] [outer = 0x7f4b09853800] 13:53:36 INFO - --DOCSHELL 0x7f4afe2c3000 == 17 [pid = 2212] [id = 371] 13:53:36 INFO - --DOCSHELL 0x7f4aff2ce000 == 16 [pid = 2212] [id = 376] 13:53:36 INFO - --DOCSHELL 0x7f4b07c1e800 == 15 [pid = 2212] [id = 377] 13:53:36 INFO - --DOCSHELL 0x7f4afe2cc800 == 14 [pid = 2212] [id = 375] 13:53:36 INFO - --DOCSHELL 0x7f4afe2cd800 == 13 [pid = 2212] [id = 383] 13:53:36 INFO - --DOCSHELL 0x7f4b0f7b8000 == 12 [pid = 2212] [id = 384] 13:53:36 INFO - --DOCSHELL 0x7f4afe391000 == 11 [pid = 2212] [id = 378] 13:53:36 INFO - --DOCSHELL 0x7f4aff2cc800 == 10 [pid = 2212] [id = 379] 13:53:36 INFO - --DOMWINDOW == 38 (0x7f4b00f56400) [pid = 2212] [serial = 873] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:53:36 INFO - --DOMWINDOW == 37 (0x7f4b07d64800) [pid = 2212] [serial = 875] [outer = (nil)] [url = about:blank] 13:53:36 INFO - --DOMWINDOW == 36 (0x7f4b0c1a9800) [pid = 2212] [serial = 876] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-error.html] 13:53:36 INFO - --DOMWINDOW == 35 (0x7f4aff425800) [pid = 2212] [serial = 881] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:53:36 INFO - --DOMWINDOW == 34 (0x7f4b00f5a400) [pid = 2212] [serial = 883] [outer = (nil)] [url = about:blank] 13:53:36 INFO - --DOMWINDOW == 33 (0x7f4b07a0d000) [pid = 2212] [serial = 885] [outer = (nil)] [url = about:blank] 13:53:36 INFO - --DOMWINDOW == 32 (0x7f4aff380c00) [pid = 2212] [serial = 895] [outer = (nil)] [url = about:blank] 13:53:36 INFO - --DOMWINDOW == 31 (0x7f4b00f30c00) [pid = 2212] [serial = 898] [outer = (nil)] [url = about:blank] 13:53:36 INFO - --DOMWINDOW == 30 (0x7f4afe1e9400) [pid = 2212] [serial = 889] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:53:36 INFO - --DOMWINDOW == 29 (0x7f4b07a0ec00) [pid = 2212] [serial = 886] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:53:36 INFO - --DOMWINDOW == 28 (0x7f4b00f2f000) [pid = 2212] [serial = 882] [outer = (nil)] [url = about:blank] 13:53:36 INFO - --DOMWINDOW == 27 (0x7f4b019ba800) [pid = 2212] [serial = 884] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-duplicate-error.html] 13:53:37 INFO - --DOMWINDOW == 26 (0x7f4b0c8f1400) [pid = 2212] [serial = 891] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-duplicate-error.html] 13:53:37 INFO - MEMORY STAT | vsize 1144MB | residentFast 293MB | heapAllocated 112MB 13:53:37 INFO - 198 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_583816_No_input_and_Tab_key_pressed.js | took 5075ms 13:53:37 INFO - ++DOCSHELL 0x7f4afe2d6000 == 11 [pid = 2212] [id = 385] 13:53:37 INFO - ++DOMWINDOW == 27 (0x7f4afe1f2400) [pid = 2212] [serial = 902] [outer = (nil)] 13:53:37 INFO - ++DOMWINDOW == 28 (0x7f4afe3dc400) [pid = 2212] [serial = 903] [outer = 0x7f4afe1f2400] 13:53:37 INFO - 199 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_585237_line_limit.js 13:53:37 INFO - ++DOCSHELL 0x7f4aff221800 == 12 [pid = 2212] [id = 386] 13:53:37 INFO - ++DOMWINDOW == 29 (0x7f4afe576400) [pid = 2212] [serial = 904] [outer = (nil)] 13:53:37 INFO - ++DOMWINDOW == 30 (0x7f4afe812400) [pid = 2212] [serial = 905] [outer = 0x7f4afe576400] 13:53:37 INFO - ++DOCSHELL 0x7f4afe4f7800 == 13 [pid = 2212] [id = 387] 13:53:37 INFO - ++DOMWINDOW == 31 (0x7f4afe816000) [pid = 2212] [serial = 906] [outer = (nil)] 13:53:37 INFO - ++DOMWINDOW == 32 (0x7f4aff420000) [pid = 2212] [serial = 907] [outer = 0x7f4afe816000] 13:53:37 INFO - ++DOMWINDOW == 33 (0x7f4b00f56400) [pid = 2212] [serial = 908] [outer = 0x7f4afe816000] 13:53:38 INFO - ++DOCSHELL 0x7f4b07d8f800 == 14 [pid = 2212] [id = 388] 13:53:38 INFO - ++DOMWINDOW == 34 (0x7f4b019bc000) [pid = 2212] [serial = 909] [outer = (nil)] 13:53:38 INFO - ++DOMWINDOW == 35 (0x7f4b07a0c400) [pid = 2212] [serial = 910] [outer = 0x7f4b019bc000] 13:53:41 INFO - --DOCSHELL 0x7f4aff2d0000 == 13 [pid = 2212] [id = 382] 13:53:41 INFO - --DOCSHELL 0x7f4afe4f7800 == 12 [pid = 2212] [id = 387] 13:53:41 INFO - --DOCSHELL 0x7f4b07d8f800 == 11 [pid = 2212] [id = 388] 13:53:41 INFO - --DOCSHELL 0x7f4afe396800 == 10 [pid = 2212] [id = 381] 13:53:41 INFO - --DOMWINDOW == 34 (0x7f4afe3e0000) [pid = 2212] [serial = 890] [outer = (nil)] [url = about:blank] 13:53:41 INFO - --DOMWINDOW == 33 (0x7f4b09bbb000) [pid = 2212] [serial = 888] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:53:41 INFO - --DOMWINDOW == 32 (0x7f4aff22ac00) [pid = 2212] [serial = 894] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/browser/test-console.html] 13:53:41 INFO - --DOMWINDOW == 31 (0x7f4afe3df400) [pid = 2212] [serial = 892] [outer = (nil)] [url = about:blank] 13:53:41 INFO - --DOMWINDOW == 30 (0x7f4b00f27800) [pid = 2212] [serial = 896] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/browser/test-console.html] 13:53:41 INFO - --DOMWINDOW == 29 (0x7f4afe54b000) [pid = 2212] [serial = 893] [outer = (nil)] [url = about:blank] 13:53:41 INFO - --DOMWINDOW == 28 (0x7f4aff420000) [pid = 2212] [serial = 907] [outer = (nil)] [url = about:blank] 13:53:41 INFO - --DOMWINDOW == 27 (0x7f4b09853800) [pid = 2212] [serial = 900] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:53:41 INFO - --DOMWINDOW == 26 (0x7f4aff425c00) [pid = 2212] [serial = 897] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:53:42 INFO - MEMORY STAT | vsize 1144MB | residentFast 290MB | heapAllocated 112MB 13:53:42 INFO - 200 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_585237_line_limit.js | took 4783ms 13:53:42 INFO - ++DOCSHELL 0x7f4afe3a0000 == 11 [pid = 2212] [id = 389] 13:53:42 INFO - ++DOMWINDOW == 27 (0x7f4afe3d7400) [pid = 2212] [serial = 911] [outer = (nil)] 13:53:42 INFO - ++DOMWINDOW == 28 (0x7f4afe4bfc00) [pid = 2212] [serial = 912] [outer = 0x7f4afe3d7400] 13:53:42 INFO - 201 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_585956_console_trace.js 13:53:42 INFO - ++DOCSHELL 0x7f4afe398000 == 12 [pid = 2212] [id = 390] 13:53:42 INFO - ++DOMWINDOW == 29 (0x7f4afe819000) [pid = 2212] [serial = 913] [outer = (nil)] 13:53:42 INFO - ++DOMWINDOW == 30 (0x7f4aff225c00) [pid = 2212] [serial = 914] [outer = 0x7f4afe819000] 13:53:42 INFO - ++DOCSHELL 0x7f4afe2c3000 == 13 [pid = 2212] [id = 391] 13:53:42 INFO - ++DOMWINDOW == 31 (0x7f4aff425800) [pid = 2212] [serial = 915] [outer = (nil)] 13:53:42 INFO - ++DOMWINDOW == 32 (0x7f4b00f23800) [pid = 2212] [serial = 916] [outer = 0x7f4aff425800] 13:53:42 INFO - ++DOMWINDOW == 33 (0x7f4b00f59c00) [pid = 2212] [serial = 917] [outer = 0x7f4aff425800] 13:53:43 INFO - ++DOCSHELL 0x7f4b09499000 == 14 [pid = 2212] [id = 392] 13:53:43 INFO - ++DOMWINDOW == 34 (0x7f4b07a0a800) [pid = 2212] [serial = 918] [outer = (nil)] 13:53:43 INFO - ++DOMWINDOW == 35 (0x7f4b07a0ec00) [pid = 2212] [serial = 919] [outer = 0x7f4b07a0a800] 13:53:44 INFO - ++DOMWINDOW == 36 (0x7f4b09e60800) [pid = 2212] [serial = 920] [outer = 0x7f4afe819000] 13:53:44 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:53:46 INFO - --DOCSHELL 0x7f4afe2d6000 == 13 [pid = 2212] [id = 385] 13:53:46 INFO - --DOCSHELL 0x7f4aff221800 == 12 [pid = 2212] [id = 386] 13:53:46 INFO - --DOCSHELL 0x7f4b09499000 == 11 [pid = 2212] [id = 392] 13:53:46 INFO - --DOMWINDOW == 35 (0x7f4b099b4c00) [pid = 2212] [serial = 901] [outer = (nil)] [url = about:blank] 13:53:46 INFO - --DOMWINDOW == 34 (0x7f4b07a04400) [pid = 2212] [serial = 899] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:53:46 INFO - --DOMWINDOW == 33 (0x7f4afe812400) [pid = 2212] [serial = 905] [outer = (nil)] [url = about:blank] 13:53:46 INFO - --DOMWINDOW == 32 (0x7f4afe3dc400) [pid = 2212] [serial = 903] [outer = (nil)] [url = about:blank] 13:53:46 INFO - --DOMWINDOW == 31 (0x7f4b00f23800) [pid = 2212] [serial = 916] [outer = (nil)] [url = about:blank] 13:53:46 INFO - --DOMWINDOW == 30 (0x7f4afe816000) [pid = 2212] [serial = 906] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:53:46 INFO - --DOMWINDOW == 29 (0x7f4b019bc000) [pid = 2212] [serial = 909] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:53:46 INFO - --DOMWINDOW == 28 (0x7f4afe576400) [pid = 2212] [serial = 904] [outer = (nil)] [url = data:text/html;charset=utf8,test%20for%20bug%20585237] 13:53:46 INFO - --DOMWINDOW == 27 (0x7f4afe1f2400) [pid = 2212] [serial = 902] [outer = (nil)] [url = about:blank] 13:53:46 INFO - MEMORY STAT | vsize 1146MB | residentFast 292MB | heapAllocated 113MB 13:53:46 INFO - 202 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_585956_console_trace.js | took 4337ms 13:53:46 INFO - ++DOCSHELL 0x7f4afe38f800 == 12 [pid = 2212] [id = 393] 13:53:46 INFO - ++DOMWINDOW == 28 (0x7f4afe3dc400) [pid = 2212] [serial = 921] [outer = (nil)] 13:53:46 INFO - ++DOMWINDOW == 29 (0x7f4afe551000) [pid = 2212] [serial = 922] [outer = 0x7f4afe3dc400] 13:53:46 INFO - 203 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_585991_autocomplete_keys.js 13:53:47 INFO - ++DOCSHELL 0x7f4b01769800 == 13 [pid = 2212] [id = 394] 13:53:47 INFO - ++DOMWINDOW == 30 (0x7f4aff37b800) [pid = 2212] [serial = 923] [outer = (nil)] 13:53:47 INFO - ++DOMWINDOW == 31 (0x7f4aff41f000) [pid = 2212] [serial = 924] [outer = 0x7f4aff37b800] 13:53:47 INFO - ++DOCSHELL 0x7f4b01913800 == 14 [pid = 2212] [id = 395] 13:53:47 INFO - ++DOMWINDOW == 32 (0x7f4aff421400) [pid = 2212] [serial = 925] [outer = (nil)] 13:53:47 INFO - ++DOMWINDOW == 33 (0x7f4b00f2e400) [pid = 2212] [serial = 926] [outer = 0x7f4aff421400] 13:53:47 INFO - ++DOMWINDOW == 34 (0x7f4b012dc400) [pid = 2212] [serial = 927] [outer = 0x7f4aff421400] 13:53:47 INFO - ++DOCSHELL 0x7f4b0c3ab800 == 15 [pid = 2212] [id = 396] 13:53:47 INFO - ++DOMWINDOW == 35 (0x7f4b0962cc00) [pid = 2212] [serial = 928] [outer = (nil)] 13:53:47 INFO - ++DOMWINDOW == 36 (0x7f4b0984c000) [pid = 2212] [serial = 929] [outer = 0x7f4b0962cc00] 13:53:52 INFO - --DOCSHELL 0x7f4b01913800 == 14 [pid = 2212] [id = 395] 13:53:52 INFO - --DOCSHELL 0x7f4afe3a0000 == 13 [pid = 2212] [id = 389] 13:53:52 INFO - --DOCSHELL 0x7f4afe398000 == 12 [pid = 2212] [id = 390] 13:53:52 INFO - --DOCSHELL 0x7f4b0c3ab800 == 11 [pid = 2212] [id = 396] 13:53:52 INFO - --DOCSHELL 0x7f4afe2c3000 == 10 [pid = 2212] [id = 391] 13:53:52 INFO - --DOMWINDOW == 35 (0x7f4b07a0c400) [pid = 2212] [serial = 910] [outer = (nil)] [url = about:blank] 13:53:52 INFO - --DOMWINDOW == 34 (0x7f4b00f56400) [pid = 2212] [serial = 908] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:53:52 INFO - --DOMWINDOW == 33 (0x7f4b00f2e400) [pid = 2212] [serial = 926] [outer = (nil)] [url = about:blank] 13:53:52 INFO - --DOMWINDOW == 32 (0x7f4aff225c00) [pid = 2212] [serial = 914] [outer = (nil)] [url = about:blank] 13:53:52 INFO - --DOMWINDOW == 31 (0x7f4afe4bfc00) [pid = 2212] [serial = 912] [outer = (nil)] [url = about:blank] 13:53:52 INFO - --DOMWINDOW == 30 (0x7f4aff425800) [pid = 2212] [serial = 915] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:53:52 INFO - --DOMWINDOW == 29 (0x7f4b07a0a800) [pid = 2212] [serial = 918] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:53:52 INFO - --DOMWINDOW == 28 (0x7f4afe819000) [pid = 2212] [serial = 913] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-585956-console-trace.html] 13:53:52 INFO - --DOMWINDOW == 27 (0x7f4afe3d7400) [pid = 2212] [serial = 911] [outer = (nil)] [url = about:blank] 13:53:52 INFO - --DOMWINDOW == 26 (0x7f4b09e60800) [pid = 2212] [serial = 920] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-585956-console-trace.html] 13:53:52 INFO - MEMORY STAT | vsize 1147MB | residentFast 295MB | heapAllocated 113MB 13:53:52 INFO - 204 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_585991_autocomplete_keys.js | took 5960ms 13:53:52 INFO - ++DOCSHELL 0x7f4afe2db000 == 11 [pid = 2212] [id = 397] 13:53:52 INFO - ++DOMWINDOW == 27 (0x7f4afe1f1400) [pid = 2212] [serial = 930] [outer = (nil)] 13:53:52 INFO - ++DOMWINDOW == 28 (0x7f4afe3d8400) [pid = 2212] [serial = 931] [outer = 0x7f4afe1f1400] 13:53:53 INFO - 205 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_585991_autocomplete_popup.js 13:53:53 INFO - ++DOCSHELL 0x7f4aff28f000 == 12 [pid = 2212] [id = 398] 13:53:53 INFO - ++DOMWINDOW == 29 (0x7f4afe578400) [pid = 2212] [serial = 932] [outer = (nil)] 13:53:53 INFO - ++DOMWINDOW == 30 (0x7f4afe816800) [pid = 2212] [serial = 933] [outer = 0x7f4afe578400] 13:53:53 INFO - ++DOCSHELL 0x7f4afe2c1800 == 13 [pid = 2212] [id = 399] 13:53:53 INFO - ++DOMWINDOW == 31 (0x7f4afe819000) [pid = 2212] [serial = 934] [outer = (nil)] 13:53:53 INFO - ++DOMWINDOW == 32 (0x7f4aff425c00) [pid = 2212] [serial = 935] [outer = 0x7f4afe819000] 13:53:53 INFO - ++DOMWINDOW == 33 (0x7f4b00f5a000) [pid = 2212] [serial = 936] [outer = 0x7f4afe819000] 13:53:53 INFO - ++DOCSHELL 0x7f4b094a5800 == 14 [pid = 2212] [id = 400] 13:53:53 INFO - ++DOMWINDOW == 34 (0x7f4b07a10c00) [pid = 2212] [serial = 937] [outer = (nil)] 13:53:53 INFO - ++DOMWINDOW == 35 (0x7f4b07a13c00) [pid = 2212] [serial = 938] [outer = 0x7f4b07a10c00] 13:53:56 INFO - --DOCSHELL 0x7f4afe38f800 == 13 [pid = 2212] [id = 393] 13:53:56 INFO - --DOCSHELL 0x7f4b01769800 == 12 [pid = 2212] [id = 394] 13:53:56 INFO - --DOCSHELL 0x7f4b094a5800 == 11 [pid = 2212] [id = 400] 13:53:56 INFO - --DOMWINDOW == 34 (0x7f4b07a0ec00) [pid = 2212] [serial = 919] [outer = (nil)] [url = about:blank] 13:53:56 INFO - --DOMWINDOW == 33 (0x7f4b00f59c00) [pid = 2212] [serial = 917] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:53:56 INFO - --DOMWINDOW == 32 (0x7f4aff41f000) [pid = 2212] [serial = 924] [outer = (nil)] [url = about:blank] 13:53:56 INFO - --DOMWINDOW == 31 (0x7f4afe551000) [pid = 2212] [serial = 922] [outer = (nil)] [url = about:blank] 13:53:56 INFO - --DOMWINDOW == 30 (0x7f4aff425c00) [pid = 2212] [serial = 935] [outer = (nil)] [url = about:blank] 13:53:56 INFO - --DOMWINDOW == 29 (0x7f4b0962cc00) [pid = 2212] [serial = 928] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:53:56 INFO - --DOMWINDOW == 28 (0x7f4aff421400) [pid = 2212] [serial = 925] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:53:56 INFO - --DOMWINDOW == 27 (0x7f4aff37b800) [pid = 2212] [serial = 923] [outer = (nil)] [url = data:text/html;charset=utf-8,<p>bug%20585991%20-%20autocomplete%20popup%20keyboard%20usage%20test] 13:53:56 INFO - --DOMWINDOW == 26 (0x7f4afe3dc400) [pid = 2212] [serial = 921] [outer = (nil)] [url = about:blank] 13:53:57 INFO - MEMORY STAT | vsize 1148MB | residentFast 295MB | heapAllocated 112MB 13:53:57 INFO - 206 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_585991_autocomplete_popup.js | took 3857ms 13:53:57 INFO - ++DOCSHELL 0x7f4afe2ca800 == 12 [pid = 2212] [id = 401] 13:53:57 INFO - ++DOMWINDOW == 27 (0x7f4afe1f4c00) [pid = 2212] [serial = 939] [outer = (nil)] 13:53:57 INFO - ++DOMWINDOW == 28 (0x7f4afe4bf800) [pid = 2212] [serial = 940] [outer = 0x7f4afe1f4c00] 13:53:57 INFO - 207 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_586388_select_all.js 13:53:57 INFO - ++DOCSHELL 0x7f4b01769000 == 13 [pid = 2212] [id = 402] 13:53:57 INFO - ++DOMWINDOW == 29 (0x7f4afe81b000) [pid = 2212] [serial = 941] [outer = (nil)] 13:53:57 INFO - ++DOMWINDOW == 30 (0x7f4aff373400) [pid = 2212] [serial = 942] [outer = 0x7f4afe81b000] 13:53:57 INFO - ++DOMWINDOW == 31 (0x7f4b00f25000) [pid = 2212] [serial = 943] [outer = 0x7f4afe81b000] 13:53:58 INFO - ++DOCSHELL 0x7f4afe2c3000 == 14 [pid = 2212] [id = 403] 13:53:58 INFO - ++DOMWINDOW == 32 (0x7f4aff379800) [pid = 2212] [serial = 944] [outer = (nil)] 13:53:58 INFO - ++DOMWINDOW == 33 (0x7f4b00f58800) [pid = 2212] [serial = 945] [outer = 0x7f4aff379800] 13:53:58 INFO - ++DOMWINDOW == 34 (0x7f4b019b7400) [pid = 2212] [serial = 946] [outer = 0x7f4aff379800] 13:53:58 INFO - ++DOCSHELL 0x7f4b0c667800 == 15 [pid = 2212] [id = 404] 13:53:58 INFO - ++DOMWINDOW == 35 (0x7f4b0984d800) [pid = 2212] [serial = 947] [outer = (nil)] 13:53:58 INFO - ++DOMWINDOW == 36 (0x7f4b09855400) [pid = 2212] [serial = 948] [outer = 0x7f4b0984d800] 13:54:01 INFO - --DOCSHELL 0x7f4afe2db000 == 14 [pid = 2212] [id = 397] 13:54:01 INFO - --DOCSHELL 0x7f4aff28f000 == 13 [pid = 2212] [id = 398] 13:54:01 INFO - --DOCSHELL 0x7f4afe2c3000 == 12 [pid = 2212] [id = 403] 13:54:01 INFO - --DOCSHELL 0x7f4afe2c1800 == 11 [pid = 2212] [id = 399] 13:54:01 INFO - --DOCSHELL 0x7f4b0c667800 == 10 [pid = 2212] [id = 404] 13:54:01 INFO - --DOMWINDOW == 35 (0x7f4b012dc400) [pid = 2212] [serial = 927] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:54:01 INFO - --DOMWINDOW == 34 (0x7f4b0984c000) [pid = 2212] [serial = 929] [outer = (nil)] [url = about:blank] 13:54:01 INFO - --DOMWINDOW == 33 (0x7f4b0984d800) [pid = 2212] [serial = 947] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:54:01 INFO - --DOMWINDOW == 32 (0x7f4afe3d8400) [pid = 2212] [serial = 931] [outer = (nil)] [url = about:blank] 13:54:01 INFO - --DOMWINDOW == 31 (0x7f4afe816800) [pid = 2212] [serial = 933] [outer = (nil)] [url = about:blank] 13:54:01 INFO - --DOMWINDOW == 30 (0x7f4aff373400) [pid = 2212] [serial = 942] [outer = (nil)] [url = about:blank] 13:54:01 INFO - --DOMWINDOW == 29 (0x7f4b00f58800) [pid = 2212] [serial = 945] [outer = (nil)] [url = about:blank] 13:54:01 INFO - --DOMWINDOW == 28 (0x7f4b07a10c00) [pid = 2212] [serial = 937] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:54:01 INFO - --DOMWINDOW == 27 (0x7f4afe819000) [pid = 2212] [serial = 934] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:54:01 INFO - --DOMWINDOW == 26 (0x7f4afe1f1400) [pid = 2212] [serial = 930] [outer = (nil)] [url = about:blank] 13:54:01 INFO - --DOMWINDOW == 25 (0x7f4afe578400) [pid = 2212] [serial = 932] [outer = (nil)] [url = data:text/html;charset=utf-8,<p>bug%20585991%20-%20autocomplete%20popup%20test] 13:54:02 INFO - MEMORY STAT | vsize 1144MB | residentFast 289MB | heapAllocated 112MB 13:54:02 INFO - 208 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_586388_select_all.js | took 4851ms 13:54:02 INFO - ++DOCSHELL 0x7f4afe39a800 == 11 [pid = 2212] [id = 405] 13:54:02 INFO - ++DOMWINDOW == 26 (0x7f4afe1f2c00) [pid = 2212] [serial = 949] [outer = (nil)] 13:54:02 INFO - ++DOMWINDOW == 27 (0x7f4afe3e1400) [pid = 2212] [serial = 950] [outer = 0x7f4afe1f2c00] 13:54:02 INFO - 209 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_587617_output_copy.js 13:54:02 INFO - ++DOCSHELL 0x7f4aff2c8800 == 12 [pid = 2212] [id = 406] 13:54:02 INFO - ++DOMWINDOW == 28 (0x7f4afe812400) [pid = 2212] [serial = 951] [outer = (nil)] 13:54:02 INFO - ++DOMWINDOW == 29 (0x7f4aff226400) [pid = 2212] [serial = 952] [outer = 0x7f4afe812400] 13:54:02 INFO - ++DOMWINDOW == 30 (0x7f4aff421400) [pid = 2212] [serial = 953] [outer = 0x7f4afe812400] 13:54:02 INFO - ++DOCSHELL 0x7f4afe2d6800 == 13 [pid = 2212] [id = 407] 13:54:02 INFO - ++DOMWINDOW == 31 (0x7f4b00f27400) [pid = 2212] [serial = 954] [outer = (nil)] 13:54:02 INFO - ++DOMWINDOW == 32 (0x7f4b00f28400) [pid = 2212] [serial = 955] [outer = 0x7f4b00f27400] 13:54:03 INFO - ++DOMWINDOW == 33 (0x7f4b00f5f400) [pid = 2212] [serial = 956] [outer = 0x7f4b00f27400] 13:54:03 INFO - ++DOCSHELL 0x7f4b0c026000 == 14 [pid = 2212] [id = 408] 13:54:03 INFO - ++DOMWINDOW == 34 (0x7f4b07a12400) [pid = 2212] [serial = 957] [outer = (nil)] 13:54:03 INFO - ++DOMWINDOW == 35 (0x7f4b07d63800) [pid = 2212] [serial = 958] [outer = 0x7f4b07a12400] 13:54:06 INFO - --DOCSHELL 0x7f4afe2ca800 == 13 [pid = 2212] [id = 401] 13:54:06 INFO - --DOCSHELL 0x7f4b01769000 == 12 [pid = 2212] [id = 402] 13:54:06 INFO - --DOCSHELL 0x7f4b0c026000 == 11 [pid = 2212] [id = 408] 13:54:06 INFO - --DOMWINDOW == 34 (0x7f4b00f5a000) [pid = 2212] [serial = 936] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:54:06 INFO - --DOMWINDOW == 33 (0x7f4b07a13c00) [pid = 2212] [serial = 938] [outer = (nil)] [url = about:blank] 13:54:06 INFO - --DOMWINDOW == 32 (0x7f4b09855400) [pid = 2212] [serial = 948] [outer = (nil)] [url = about:blank] 13:54:06 INFO - --DOMWINDOW == 31 (0x7f4b00f28400) [pid = 2212] [serial = 955] [outer = (nil)] [url = about:blank] 13:54:06 INFO - --DOMWINDOW == 30 (0x7f4afe4bf800) [pid = 2212] [serial = 940] [outer = (nil)] [url = about:blank] 13:54:06 INFO - --DOMWINDOW == 29 (0x7f4b00f25000) [pid = 2212] [serial = 943] [outer = (nil)] [url = http://example.com/] 13:54:06 INFO - --DOMWINDOW == 28 (0x7f4aff226400) [pid = 2212] [serial = 952] [outer = (nil)] [url = about:blank] 13:54:06 INFO - --DOMWINDOW == 27 (0x7f4aff379800) [pid = 2212] [serial = 944] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:54:06 INFO - --DOMWINDOW == 26 (0x7f4afe1f4c00) [pid = 2212] [serial = 939] [outer = (nil)] [url = about:blank] 13:54:06 INFO - --DOMWINDOW == 25 (0x7f4afe81b000) [pid = 2212] [serial = 941] [outer = (nil)] [url = http://example.com/] 13:54:06 INFO - MEMORY STAT | vsize 1146MB | residentFast 292MB | heapAllocated 112MB 13:54:06 INFO - 210 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_587617_output_copy.js | took 4320ms 13:54:06 INFO - ++DOCSHELL 0x7f4afe2da800 == 12 [pid = 2212] [id = 409] 13:54:06 INFO - ++DOMWINDOW == 26 (0x7f4afe1e7800) [pid = 2212] [serial = 959] [outer = (nil)] 13:54:06 INFO - ++DOMWINDOW == 27 (0x7f4afe3df400) [pid = 2212] [serial = 960] [outer = 0x7f4afe1e7800] 13:54:06 INFO - 211 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_588342_document_focus.js 13:54:06 INFO - ++DOCSHELL 0x7f4aff2c6800 == 13 [pid = 2212] [id = 410] 13:54:06 INFO - ++DOMWINDOW == 28 (0x7f4afe57e800) [pid = 2212] [serial = 961] [outer = (nil)] 13:54:06 INFO - ++DOMWINDOW == 29 (0x7f4afe818c00) [pid = 2212] [serial = 962] [outer = 0x7f4afe57e800] 13:54:07 INFO - ++DOCSHELL 0x7f4afe2c4000 == 14 [pid = 2212] [id = 411] 13:54:07 INFO - ++DOMWINDOW == 30 (0x7f4afe81bc00) [pid = 2212] [serial = 963] [outer = (nil)] 13:54:07 INFO - ++DOMWINDOW == 31 (0x7f4aff425c00) [pid = 2212] [serial = 964] [outer = 0x7f4afe81bc00] 13:54:07 INFO - ++DOMWINDOW == 32 (0x7f4b00f5ac00) [pid = 2212] [serial = 965] [outer = 0x7f4afe81bc00] 13:54:07 INFO - ++DOCSHELL 0x7f4b0a7d0800 == 15 [pid = 2212] [id = 412] 13:54:07 INFO - ++DOMWINDOW == 33 (0x7f4b07a10800) [pid = 2212] [serial = 966] [outer = (nil)] 13:54:07 INFO - ++DOMWINDOW == 34 (0x7f4b07d59400) [pid = 2212] [serial = 967] [outer = 0x7f4b07a10800] 13:54:10 INFO - --DOCSHELL 0x7f4afe39a800 == 14 [pid = 2212] [id = 405] 13:54:10 INFO - --DOCSHELL 0x7f4afe2d6800 == 13 [pid = 2212] [id = 407] 13:54:10 INFO - --DOCSHELL 0x7f4aff2c8800 == 12 [pid = 2212] [id = 406] 13:54:10 INFO - --DOCSHELL 0x7f4b0a7d0800 == 11 [pid = 2212] [id = 412] 13:54:10 INFO - --DOMWINDOW == 33 (0x7f4b019b7400) [pid = 2212] [serial = 946] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:54:10 INFO - --DOMWINDOW == 32 (0x7f4afe3e1400) [pid = 2212] [serial = 950] [outer = (nil)] [url = about:blank] 13:54:10 INFO - --DOMWINDOW == 31 (0x7f4aff425c00) [pid = 2212] [serial = 964] [outer = (nil)] [url = about:blank] 13:54:10 INFO - --DOMWINDOW == 30 (0x7f4b00f27400) [pid = 2212] [serial = 954] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:54:10 INFO - --DOMWINDOW == 29 (0x7f4b07a12400) [pid = 2212] [serial = 957] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:54:10 INFO - --DOMWINDOW == 28 (0x7f4afe812400) [pid = 2212] [serial = 951] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:54:10 INFO - --DOMWINDOW == 27 (0x7f4afe1f2c00) [pid = 2212] [serial = 949] [outer = (nil)] [url = about:blank] 13:54:10 INFO - --DOMWINDOW == 26 (0x7f4aff421400) [pid = 2212] [serial = 953] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:54:10 INFO - MEMORY STAT | vsize 1148MB | residentFast 294MB | heapAllocated 112MB 13:54:10 INFO - 212 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_588342_document_focus.js | took 3884ms 13:54:10 INFO - ++DOCSHELL 0x7f4afe2c7800 == 12 [pid = 2212] [id = 413] 13:54:10 INFO - ++DOMWINDOW == 27 (0x7f4afe3d6400) [pid = 2212] [serial = 968] [outer = (nil)] 13:54:10 INFO - ++DOMWINDOW == 28 (0x7f4afe4c2c00) [pid = 2212] [serial = 969] [outer = 0x7f4afe3d6400] 13:54:10 INFO - 213 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_588730_text_node_insertion.js 13:54:11 INFO - ++DOCSHELL 0x7f4aff2c8800 == 13 [pid = 2212] [id = 414] 13:54:11 INFO - ++DOMWINDOW == 29 (0x7f4afe819c00) [pid = 2212] [serial = 970] [outer = (nil)] 13:54:11 INFO - ++DOMWINDOW == 30 (0x7f4aff373c00) [pid = 2212] [serial = 971] [outer = 0x7f4afe819c00] 13:54:11 INFO - ++DOMWINDOW == 31 (0x7f4aff424c00) [pid = 2212] [serial = 972] [outer = 0x7f4afe819c00] 13:54:11 INFO - ++DOCSHELL 0x7f4afe397000 == 14 [pid = 2212] [id = 415] 13:54:11 INFO - ++DOMWINDOW == 32 (0x7f4b00f2b800) [pid = 2212] [serial = 973] [outer = (nil)] 13:54:11 INFO - ++DOMWINDOW == 33 (0x7f4b00f2dc00) [pid = 2212] [serial = 974] [outer = 0x7f4b00f2b800] 13:54:11 INFO - ++DOMWINDOW == 34 (0x7f4b012d8c00) [pid = 2212] [serial = 975] [outer = 0x7f4b00f2b800] 13:54:11 INFO - ++DOCSHELL 0x7f4b0c3ab800 == 15 [pid = 2212] [id = 416] 13:54:11 INFO - ++DOMWINDOW == 35 (0x7f4b07d76c00) [pid = 2212] [serial = 976] [outer = (nil)] 13:54:11 INFO - ++DOMWINDOW == 36 (0x7f4b09849400) [pid = 2212] [serial = 977] [outer = 0x7f4b07d76c00] 13:54:14 INFO - --DOCSHELL 0x7f4aff2c6800 == 14 [pid = 2212] [id = 410] 13:54:14 INFO - --DOCSHELL 0x7f4afe2da800 == 13 [pid = 2212] [id = 409] 13:54:14 INFO - --DOCSHELL 0x7f4b0c3ab800 == 12 [pid = 2212] [id = 416] 13:54:14 INFO - --DOCSHELL 0x7f4afe2c4000 == 11 [pid = 2212] [id = 411] 13:54:14 INFO - --DOMWINDOW == 35 (0x7f4b07d63800) [pid = 2212] [serial = 958] [outer = (nil)] [url = about:blank] 13:54:14 INFO - --DOMWINDOW == 34 (0x7f4b00f5f400) [pid = 2212] [serial = 956] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:54:14 INFO - --DOMWINDOW == 33 (0x7f4aff373c00) [pid = 2212] [serial = 971] [outer = (nil)] [url = about:blank] 13:54:14 INFO - --DOMWINDOW == 32 (0x7f4afe818c00) [pid = 2212] [serial = 962] [outer = (nil)] [url = about:blank] 13:54:14 INFO - --DOMWINDOW == 31 (0x7f4afe3df400) [pid = 2212] [serial = 960] [outer = (nil)] [url = about:blank] 13:54:14 INFO - --DOMWINDOW == 30 (0x7f4b00f2dc00) [pid = 2212] [serial = 974] [outer = (nil)] [url = about:blank] 13:54:14 INFO - --DOMWINDOW == 29 (0x7f4b07a10800) [pid = 2212] [serial = 966] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:54:14 INFO - --DOMWINDOW == 28 (0x7f4afe81bc00) [pid = 2212] [serial = 963] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:54:14 INFO - --DOMWINDOW == 27 (0x7f4afe57e800) [pid = 2212] [serial = 961] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20588342] 13:54:14 INFO - --DOMWINDOW == 26 (0x7f4afe1e7800) [pid = 2212] [serial = 959] [outer = (nil)] [url = about:blank] 13:54:15 INFO - MEMORY STAT | vsize 1148MB | residentFast 293MB | heapAllocated 112MB 13:54:15 INFO - 214 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_588730_text_node_insertion.js | took 4095ms 13:54:15 INFO - ++DOCSHELL 0x7f4afe2c9000 == 12 [pid = 2212] [id = 417] 13:54:15 INFO - ++DOMWINDOW == 27 (0x7f4afe0af800) [pid = 2212] [serial = 978] [outer = (nil)] 13:54:15 INFO - ++DOMWINDOW == 28 (0x7f4afe0b4c00) [pid = 2212] [serial = 979] [outer = 0x7f4afe0af800] 13:54:15 INFO - 215 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_588967_input_expansion.js 13:54:15 INFO - ++DOCSHELL 0x7f4aff28c000 == 13 [pid = 2212] [id = 418] 13:54:15 INFO - ++DOMWINDOW == 29 (0x7f4afe573800) [pid = 2212] [serial = 980] [outer = (nil)] 13:54:15 INFO - ++DOMWINDOW == 30 (0x7f4afe57f400) [pid = 2212] [serial = 981] [outer = 0x7f4afe573800] 13:54:15 INFO - ++DOMWINDOW == 31 (0x7f4aff380c00) [pid = 2212] [serial = 982] [outer = 0x7f4afe573800] 13:54:16 INFO - ++DOCSHELL 0x7f4b0190c800 == 14 [pid = 2212] [id = 419] 13:54:16 INFO - ++DOMWINDOW == 32 (0x7f4b00f23800) [pid = 2212] [serial = 983] [outer = (nil)] 13:54:16 INFO - ++DOMWINDOW == 33 (0x7f4b00f28800) [pid = 2212] [serial = 984] [outer = 0x7f4b00f23800] 13:54:16 INFO - ++DOMWINDOW == 34 (0x7f4b00f64400) [pid = 2212] [serial = 985] [outer = 0x7f4b00f23800] 13:54:16 INFO - ++DOCSHELL 0x7f4b0c39d800 == 15 [pid = 2212] [id = 420] 13:54:16 INFO - ++DOMWINDOW == 35 (0x7f4b012dc400) [pid = 2212] [serial = 986] [outer = (nil)] 13:54:16 INFO - ++DOMWINDOW == 36 (0x7f4b07a13c00) [pid = 2212] [serial = 987] [outer = 0x7f4b012dc400] 13:54:19 INFO - --DOCSHELL 0x7f4aff2c8800 == 14 [pid = 2212] [id = 414] 13:54:19 INFO - --DOCSHELL 0x7f4afe2c7800 == 13 [pid = 2212] [id = 413] 13:54:19 INFO - --DOCSHELL 0x7f4afe397000 == 12 [pid = 2212] [id = 415] 13:54:19 INFO - --DOCSHELL 0x7f4b0c39d800 == 11 [pid = 2212] [id = 420] 13:54:19 INFO - --DOMWINDOW == 35 (0x7f4b07d59400) [pid = 2212] [serial = 967] [outer = (nil)] [url = about:blank] 13:54:19 INFO - --DOMWINDOW == 34 (0x7f4b00f5ac00) [pid = 2212] [serial = 965] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:54:19 INFO - --DOMWINDOW == 33 (0x7f4b00f28800) [pid = 2212] [serial = 984] [outer = (nil)] [url = about:blank] 13:54:19 INFO - --DOMWINDOW == 32 (0x7f4afe57f400) [pid = 2212] [serial = 981] [outer = (nil)] [url = about:blank] 13:54:19 INFO - --DOMWINDOW == 31 (0x7f4afe4c2c00) [pid = 2212] [serial = 969] [outer = (nil)] [url = about:blank] 13:54:19 INFO - --DOMWINDOW == 30 (0x7f4b00f2b800) [pid = 2212] [serial = 973] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:54:19 INFO - --DOMWINDOW == 29 (0x7f4b07d76c00) [pid = 2212] [serial = 976] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:54:19 INFO - --DOMWINDOW == 28 (0x7f4afe819c00) [pid = 2212] [serial = 970] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:54:19 INFO - --DOMWINDOW == 27 (0x7f4afe3d6400) [pid = 2212] [serial = 968] [outer = (nil)] [url = about:blank] 13:54:19 INFO - --DOMWINDOW == 26 (0x7f4aff424c00) [pid = 2212] [serial = 972] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:54:20 INFO - MEMORY STAT | vsize 1149MB | residentFast 297MB | heapAllocated 113MB 13:54:20 INFO - 216 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_588967_input_expansion.js | took 4703ms 13:54:20 INFO - ++DOCSHELL 0x7f4afe39a000 == 12 [pid = 2212] [id = 421] 13:54:20 INFO - ++DOMWINDOW == 27 (0x7f4afe3d6000) [pid = 2212] [serial = 988] [outer = (nil)] 13:54:20 INFO - ++DOMWINDOW == 28 (0x7f4afe3e3400) [pid = 2212] [serial = 989] [outer = 0x7f4afe3d6000] 13:54:20 INFO - 217 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_589162_css_filter.js 13:54:20 INFO - ++DOCSHELL 0x7f4b0176c800 == 13 [pid = 2212] [id = 422] 13:54:20 INFO - ++DOMWINDOW == 29 (0x7f4afe815c00) [pid = 2212] [serial = 990] [outer = (nil)] 13:54:20 INFO - ++DOMWINDOW == 30 (0x7f4afe81c000) [pid = 2212] [serial = 991] [outer = 0x7f4afe815c00] 13:54:20 INFO - ++DOCSHELL 0x7f4afe2d6800 == 14 [pid = 2212] [id = 423] 13:54:20 INFO - ++DOMWINDOW == 31 (0x7f4aff22a000) [pid = 2212] [serial = 992] [outer = (nil)] 13:54:20 INFO - ++DOMWINDOW == 32 (0x7f4b00f2a000) [pid = 2212] [serial = 993] [outer = 0x7f4aff22a000] 13:54:20 INFO - ++DOMWINDOW == 33 (0x7f4b00f63400) [pid = 2212] [serial = 994] [outer = 0x7f4aff22a000] 13:54:20 INFO - ++DOCSHELL 0x7f4b0c66b000 == 15 [pid = 2212] [id = 424] 13:54:20 INFO - ++DOMWINDOW == 34 (0x7f4b07d5dc00) [pid = 2212] [serial = 995] [outer = (nil)] 13:54:20 INFO - ++DOMWINDOW == 35 (0x7f4b089f0000) [pid = 2212] [serial = 996] [outer = 0x7f4b07d5dc00] 13:54:22 INFO - ++DOMWINDOW == 36 (0x7f4b0c41d400) [pid = 2212] [serial = 997] [outer = 0x7f4afe815c00] 13:54:23 INFO - --DOCSHELL 0x7f4afe2c9000 == 14 [pid = 2212] [id = 417] 13:54:23 INFO - --DOCSHELL 0x7f4aff28c000 == 13 [pid = 2212] [id = 418] 13:54:23 INFO - --DOCSHELL 0x7f4b0c66b000 == 12 [pid = 2212] [id = 424] 13:54:23 INFO - --DOCSHELL 0x7f4b0190c800 == 11 [pid = 2212] [id = 419] 13:54:23 INFO - --DOMWINDOW == 35 (0x7f4b012d8c00) [pid = 2212] [serial = 975] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:54:23 INFO - --DOMWINDOW == 34 (0x7f4b09849400) [pid = 2212] [serial = 977] [outer = (nil)] [url = about:blank] 13:54:24 INFO - --DOMWINDOW == 33 (0x7f4b00f2a000) [pid = 2212] [serial = 993] [outer = (nil)] [url = about:blank] 13:54:24 INFO - --DOMWINDOW == 32 (0x7f4afe0b4c00) [pid = 2212] [serial = 979] [outer = (nil)] [url = about:blank] 13:54:24 INFO - --DOMWINDOW == 31 (0x7f4afe81c000) [pid = 2212] [serial = 991] [outer = (nil)] [url = about:blank] 13:54:24 INFO - --DOMWINDOW == 30 (0x7f4b012dc400) [pid = 2212] [serial = 986] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:54:24 INFO - --DOMWINDOW == 29 (0x7f4b00f23800) [pid = 2212] [serial = 983] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:54:24 INFO - --DOMWINDOW == 28 (0x7f4afe0af800) [pid = 2212] [serial = 978] [outer = (nil)] [url = about:blank] 13:54:24 INFO - --DOMWINDOW == 27 (0x7f4afe573800) [pid = 2212] [serial = 980] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:54:24 INFO - --DOMWINDOW == 26 (0x7f4aff380c00) [pid = 2212] [serial = 982] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:54:24 INFO - MEMORY STAT | vsize 1148MB | residentFast 295MB | heapAllocated 113MB 13:54:24 INFO - 218 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_589162_css_filter.js | took 4051ms 13:54:24 INFO - ++DOCSHELL 0x7f4afe4e4000 == 12 [pid = 2212] [id = 425] 13:54:24 INFO - ++DOMWINDOW == 27 (0x7f4afe3d5c00) [pid = 2212] [serial = 998] [outer = (nil)] 13:54:24 INFO - ++DOMWINDOW == 28 (0x7f4afe4c5400) [pid = 2212] [serial = 999] [outer = 0x7f4afe3d5c00] 13:54:24 INFO - 219 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_592442_closing_brackets.js 13:54:24 INFO - ++DOCSHELL 0x7f4b07c19800 == 13 [pid = 2212] [id = 426] 13:54:24 INFO - ++DOMWINDOW == 29 (0x7f4aff229800) [pid = 2212] [serial = 1000] [outer = (nil)] 13:54:24 INFO - ++DOMWINDOW == 30 (0x7f4aff419c00) [pid = 2212] [serial = 1001] [outer = 0x7f4aff229800] 13:54:24 INFO - ++DOCSHELL 0x7f4afe2c4000 == 14 [pid = 2212] [id = 427] 13:54:24 INFO - ++DOMWINDOW == 31 (0x7f4b00f27400) [pid = 2212] [serial = 1002] [outer = (nil)] 13:54:24 INFO - ++DOMWINDOW == 32 (0x7f4b00f28400) [pid = 2212] [serial = 1003] [outer = 0x7f4b00f27400] 13:54:25 INFO - ++DOMWINDOW == 33 (0x7f4b00f5fc00) [pid = 2212] [serial = 1004] [outer = 0x7f4b00f27400] 13:54:25 INFO - ++DOCSHELL 0x7f4b0c66b000 == 15 [pid = 2212] [id = 428] 13:54:25 INFO - ++DOMWINDOW == 34 (0x7f4b07a12400) [pid = 2212] [serial = 1005] [outer = (nil)] 13:54:25 INFO - ++DOMWINDOW == 35 (0x7f4b07d71400) [pid = 2212] [serial = 1006] [outer = 0x7f4b07a12400] 13:54:27 INFO - --DOCSHELL 0x7f4b0176c800 == 14 [pid = 2212] [id = 422] 13:54:27 INFO - --DOCSHELL 0x7f4b0c66b000 == 13 [pid = 2212] [id = 428] 13:54:27 INFO - --DOCSHELL 0x7f4afe2d6800 == 12 [pid = 2212] [id = 423] 13:54:27 INFO - --DOMWINDOW == 34 (0x7f4b07a13c00) [pid = 2212] [serial = 987] [outer = (nil)] [url = about:blank] 13:54:27 INFO - --DOMWINDOW == 33 (0x7f4b00f64400) [pid = 2212] [serial = 985] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:54:27 INFO - --DOMWINDOW == 32 (0x7f4b0c41d400) [pid = 2212] [serial = 997] [outer = (nil)] [url = data:text/html;charset=utf-8,<div%20style='font-size:3em;foobarCssParser:baz'>test%20CSS%20parser%20filter</div>] 13:54:27 INFO - --DOMWINDOW == 31 (0x7f4afe3e3400) [pid = 2212] [serial = 989] [outer = (nil)] [url = about:blank] 13:54:27 INFO - --DOMWINDOW == 30 (0x7f4b00f28400) [pid = 2212] [serial = 1003] [outer = (nil)] [url = about:blank] 13:54:27 INFO - --DOMWINDOW == 29 (0x7f4aff22a000) [pid = 2212] [serial = 992] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:54:27 INFO - --DOMWINDOW == 28 (0x7f4b07d5dc00) [pid = 2212] [serial = 995] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:54:27 INFO - --DOMWINDOW == 27 (0x7f4afe815c00) [pid = 2212] [serial = 990] [outer = (nil)] [url = data:text/html;charset=utf-8,<div%20style='font-size:3em;foobarCssParser:baz'>test%20CSS%20parser%20filter</div>] 13:54:27 INFO - --DOMWINDOW == 26 (0x7f4afe3d6000) [pid = 2212] [serial = 988] [outer = (nil)] [url = about:blank] 13:54:28 INFO - MEMORY STAT | vsize 1149MB | residentFast 295MB | heapAllocated 113MB 13:54:28 INFO - 220 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_592442_closing_brackets.js | took 3749ms 13:54:28 INFO - ++DOCSHELL 0x7f4afe4e3800 == 13 [pid = 2212] [id = 429] 13:54:28 INFO - ++DOMWINDOW == 27 (0x7f4afe3db400) [pid = 2212] [serial = 1007] [outer = (nil)] 13:54:28 INFO - ++DOMWINDOW == 28 (0x7f4afe547c00) [pid = 2212] [serial = 1008] [outer = 0x7f4afe3db400] 13:54:28 INFO - 221 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_593003_iframe_wrong_hud.js 13:54:28 INFO - ++DOCSHELL 0x7f4b01904800 == 14 [pid = 2212] [id = 430] 13:54:28 INFO - ++DOMWINDOW == 29 (0x7f4afe81c400) [pid = 2212] [serial = 1009] [outer = (nil)] 13:54:28 INFO - ++DOMWINDOW == 30 (0x7f4aff380400) [pid = 2212] [serial = 1010] [outer = 0x7f4afe81c400] 13:54:28 INFO - ++DOMWINDOW == 31 (0x7f4b00f24400) [pid = 2212] [serial = 1011] [outer = 0x7f4afe81c400] 13:54:28 INFO - ++DOCSHELL 0x7f4b0c396800 == 15 [pid = 2212] [id = 431] 13:54:29 INFO - ++DOMWINDOW == 32 (0x7f4afe00d800) [pid = 2212] [serial = 1012] [outer = (nil)] 13:54:29 INFO - ++DOMWINDOW == 33 (0x7f4b00f59800) [pid = 2212] [serial = 1013] [outer = 0x7f4afe00d800] 13:54:29 INFO - ++DOCSHELL 0x7f4b07c37000 == 16 [pid = 2212] [id = 432] 13:54:29 INFO - ++DOMWINDOW == 34 (0x7f4b00f29000) [pid = 2212] [serial = 1014] [outer = (nil)] 13:54:29 INFO - ++DOMWINDOW == 35 (0x7f4b012dac00) [pid = 2212] [serial = 1015] [outer = 0x7f4b00f29000] 13:54:29 INFO - ++DOMWINDOW == 36 (0x7f4b019be000) [pid = 2212] [serial = 1016] [outer = 0x7f4b00f29000] 13:54:29 INFO - ++DOCSHELL 0x7f4b0fa29000 == 17 [pid = 2212] [id = 433] 13:54:29 INFO - ++DOMWINDOW == 37 (0x7f4b09853800) [pid = 2212] [serial = 1017] [outer = (nil)] 13:54:29 INFO - ++DOMWINDOW == 38 (0x7f4b099b6800) [pid = 2212] [serial = 1018] [outer = 0x7f4b09853800] 13:54:31 INFO - ++DOCSHELL 0x7f4b12751000 == 18 [pid = 2212] [id = 434] 13:54:31 INFO - ++DOMWINDOW == 39 (0x7f4b0c8f2800) [pid = 2212] [serial = 1019] [outer = (nil)] 13:54:31 INFO - ++DOMWINDOW == 40 (0x7f4b0ca7fc00) [pid = 2212] [serial = 1020] [outer = 0x7f4b0c8f2800] 13:54:31 INFO - ++DOMWINDOW == 41 (0x7f4b00f31400) [pid = 2212] [serial = 1021] [outer = 0x7f4b0c8f2800] 13:54:31 INFO - ++DOCSHELL 0x7f4afe2d6000 == 19 [pid = 2212] [id = 435] 13:54:31 INFO - ++DOMWINDOW == 42 (0x7f4b0c4eac00) [pid = 2212] [serial = 1022] [outer = (nil)] 13:54:31 INFO - ++DOMWINDOW == 43 (0x7f4b0ca8a800) [pid = 2212] [serial = 1023] [outer = 0x7f4b0c4eac00] 13:54:31 INFO - ++DOMWINDOW == 44 (0x7f4afe3e3c00) [pid = 2212] [serial = 1024] [outer = 0x7f4b0c4eac00] 13:54:32 INFO - ++DOCSHELL 0x7f4b0c829000 == 20 [pid = 2212] [id = 436] 13:54:32 INFO - ++DOMWINDOW == 45 (0x7f4b09852000) [pid = 2212] [serial = 1025] [outer = (nil)] 13:54:32 INFO - ++DOMWINDOW == 46 (0x7f4b09bb4400) [pid = 2212] [serial = 1026] [outer = 0x7f4b09852000] 13:54:34 INFO - ++DOMWINDOW == 47 (0x7f4b12e3ec00) [pid = 2212] [serial = 1027] [outer = 0x7f4afe81c400] 13:54:34 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:54:34 INFO - ++DOCSHELL 0x7f4b14c42000 == 21 [pid = 2212] [id = 437] 13:54:34 INFO - ++DOMWINDOW == 48 (0x7f4b12ab9000) [pid = 2212] [serial = 1028] [outer = (nil)] 13:54:34 INFO - ++DOMWINDOW == 49 (0x7f4afe012000) [pid = 2212] [serial = 1029] [outer = 0x7f4b12ab9000] 13:54:34 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:54:35 INFO - --DOCSHELL 0x7f4afe4e4000 == 20 [pid = 2212] [id = 425] 13:54:35 INFO - --DOCSHELL 0x7f4b07c19800 == 19 [pid = 2212] [id = 426] 13:54:35 INFO - --DOCSHELL 0x7f4b0c396800 == 18 [pid = 2212] [id = 431] 13:54:35 INFO - --DOCSHELL 0x7f4afe39a000 == 17 [pid = 2212] [id = 421] 13:54:35 INFO - --DOCSHELL 0x7f4afe2c4000 == 16 [pid = 2212] [id = 427] 13:54:35 INFO - --DOCSHELL 0x7f4b0c829000 == 15 [pid = 2212] [id = 436] 13:54:35 INFO - --DOMWINDOW == 48 (0x7f4b00f63400) [pid = 2212] [serial = 994] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:54:35 INFO - --DOMWINDOW == 47 (0x7f4b089f0000) [pid = 2212] [serial = 996] [outer = (nil)] [url = about:blank] 13:54:36 INFO - --DOMWINDOW == 46 (0x7f4b0ca7fc00) [pid = 2212] [serial = 1020] [outer = (nil)] [url = about:blank] 13:54:36 INFO - --DOMWINDOW == 45 (0x7f4b0ca8a800) [pid = 2212] [serial = 1023] [outer = (nil)] [url = about:blank] 13:54:36 INFO - --DOMWINDOW == 44 (0x7f4aff229800) [pid = 2212] [serial = 1000] [outer = (nil)] [url = data:text/html;charset=utf-8,test%20for%20bug%20592442] 13:54:36 INFO - --DOMWINDOW == 43 (0x7f4aff380400) [pid = 2212] [serial = 1010] [outer = (nil)] [url = about:blank] 13:54:36 INFO - --DOMWINDOW == 42 (0x7f4b07a12400) [pid = 2212] [serial = 1005] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:54:36 INFO - --DOMWINDOW == 41 (0x7f4afe3d5c00) [pid = 2212] [serial = 998] [outer = (nil)] [url = about:blank] 13:54:36 INFO - --DOMWINDOW == 40 (0x7f4b00f27400) [pid = 2212] [serial = 1002] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:54:36 INFO - --DOMWINDOW == 39 (0x7f4b012dac00) [pid = 2212] [serial = 1015] [outer = (nil)] [url = about:blank] 13:54:36 INFO - --DOMWINDOW == 38 (0x7f4afe4c5400) [pid = 2212] [serial = 999] [outer = (nil)] [url = about:blank] 13:54:36 INFO - --DOMWINDOW == 37 (0x7f4aff419c00) [pid = 2212] [serial = 1001] [outer = (nil)] [url = about:blank] 13:54:36 INFO - --DOMWINDOW == 36 (0x7f4afe00d800) [pid = 2212] [serial = 1012] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud-iframe.html] 13:54:36 INFO - --DOCSHELL 0x7f4b0fa29000 == 14 [pid = 2212] [id = 433] 13:54:36 INFO - --DOMWINDOW == 35 (0x7f4b00f24400) [pid = 2212] [serial = 1011] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud.html] 13:54:36 INFO - --DOMWINDOW == 34 (0x7f4b00f59800) [pid = 2212] [serial = 1013] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud-iframe.html] 13:54:37 INFO - --DOCSHELL 0x7f4b07c37000 == 13 [pid = 2212] [id = 432] 13:54:37 INFO - --DOCSHELL 0x7f4b12751000 == 12 [pid = 2212] [id = 434] 13:54:37 INFO - --DOCSHELL 0x7f4afe2d6000 == 11 [pid = 2212] [id = 435] 13:54:37 INFO - --DOMWINDOW == 33 (0x7f4b00f5fc00) [pid = 2212] [serial = 1004] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:54:37 INFO - --DOMWINDOW == 32 (0x7f4b07d71400) [pid = 2212] [serial = 1006] [outer = (nil)] [url = about:blank] 13:54:37 INFO - --DOMWINDOW == 31 (0x7f4b0c8f2800) [pid = 2212] [serial = 1019] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:54:37 INFO - --DOMWINDOW == 30 (0x7f4b0c4eac00) [pid = 2212] [serial = 1022] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:54:37 INFO - --DOMWINDOW == 29 (0x7f4b09852000) [pid = 2212] [serial = 1025] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:54:37 INFO - --DOCSHELL 0x7f4b14c42000 == 10 [pid = 2212] [id = 437] 13:54:37 INFO - --DOMWINDOW == 28 (0x7f4b00f31400) [pid = 2212] [serial = 1021] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:54:37 INFO - MEMORY STAT | vsize 1146MB | residentFast 292MB | heapAllocated 112MB 13:54:37 INFO - 222 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_593003_iframe_wrong_hud.js | took 9194ms 13:54:37 INFO - ++DOCSHELL 0x7f4afe397000 == 11 [pid = 2212] [id = 438] 13:54:37 INFO - ++DOMWINDOW == 29 (0x7f4afe1f3c00) [pid = 2212] [serial = 1030] [outer = (nil)] 13:54:37 INFO - ++DOMWINDOW == 30 (0x7f4afe3e1400) [pid = 2212] [serial = 1031] [outer = 0x7f4afe1f3c00] 13:54:37 INFO - 223 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_594497_history_arrow_keys.js 13:54:37 INFO - ++DOCSHELL 0x7f4b01763800 == 12 [pid = 2212] [id = 439] 13:54:37 INFO - ++DOMWINDOW == 31 (0x7f4afe819c00) [pid = 2212] [serial = 1032] [outer = (nil)] 13:54:38 INFO - ++DOMWINDOW == 32 (0x7f4aff232800) [pid = 2212] [serial = 1033] [outer = 0x7f4afe819c00] 13:54:38 INFO - ++DOCSHELL 0x7f4b0176d000 == 13 [pid = 2212] [id = 440] 13:54:38 INFO - ++DOMWINDOW == 33 (0x7f4aff37c000) [pid = 2212] [serial = 1034] [outer = (nil)] 13:54:38 INFO - ++DOMWINDOW == 34 (0x7f4b00f2d800) [pid = 2212] [serial = 1035] [outer = 0x7f4aff37c000] 13:54:38 INFO - ++DOMWINDOW == 35 (0x7f4b00f64000) [pid = 2212] [serial = 1036] [outer = 0x7f4aff37c000] 13:54:38 INFO - ++DOCSHELL 0x7f4b0c39e800 == 14 [pid = 2212] [id = 441] 13:54:38 INFO - ++DOMWINDOW == 36 (0x7f4b07a0ec00) [pid = 2212] [serial = 1037] [outer = (nil)] 13:54:38 INFO - ++DOMWINDOW == 37 (0x7f4b07a13400) [pid = 2212] [serial = 1038] [outer = 0x7f4b07a0ec00] 13:54:41 INFO - --DOCSHELL 0x7f4b0c39e800 == 13 [pid = 2212] [id = 441] 13:54:41 INFO - --DOCSHELL 0x7f4b01904800 == 12 [pid = 2212] [id = 430] 13:54:41 INFO - --DOMWINDOW == 36 (0x7f4b09bb4400) [pid = 2212] [serial = 1026] [outer = (nil)] [url = about:blank] 13:54:41 INFO - --DOMWINDOW == 35 (0x7f4afe3e3c00) [pid = 2212] [serial = 1024] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:54:41 INFO - --DOMWINDOW == 34 (0x7f4afe547c00) [pid = 2212] [serial = 1008] [outer = (nil)] [url = about:blank] 13:54:41 INFO - --DOMWINDOW == 33 (0x7f4b00f2d800) [pid = 2212] [serial = 1035] [outer = (nil)] [url = about:blank] 13:54:41 INFO - --DOMWINDOW == 32 (0x7f4b09853800) [pid = 2212] [serial = 1017] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:54:41 INFO - --DOMWINDOW == 31 (0x7f4b00f29000) [pid = 2212] [serial = 1014] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:54:41 INFO - --DOMWINDOW == 30 (0x7f4b12ab9000) [pid = 2212] [serial = 1028] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud-iframe.html] 13:54:41 INFO - --DOMWINDOW == 29 (0x7f4afe81c400) [pid = 2212] [serial = 1009] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud.html] 13:54:41 INFO - --DOMWINDOW == 28 (0x7f4afe3db400) [pid = 2212] [serial = 1007] [outer = (nil)] [url = about:blank] 13:54:41 INFO - --DOMWINDOW == 27 (0x7f4afe012000) [pid = 2212] [serial = 1029] [outer = (nil)] [url = about:blank] 13:54:41 INFO - --DOMWINDOW == 26 (0x7f4b12e3ec00) [pid = 2212] [serial = 1027] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-593003-iframe-wrong-hud.html] 13:54:42 INFO - MEMORY STAT | vsize 1147MB | residentFast 296MB | heapAllocated 113MB 13:54:42 INFO - 224 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_594497_history_arrow_keys.js | took 4080ms 13:54:42 INFO - ++DOCSHELL 0x7f4afe38f000 == 13 [pid = 2212] [id = 442] 13:54:42 INFO - ++DOMWINDOW == 27 (0x7f4afe1e6400) [pid = 2212] [serial = 1039] [outer = (nil)] 13:54:42 INFO - ++DOMWINDOW == 28 (0x7f4afe3db400) [pid = 2212] [serial = 1040] [outer = 0x7f4afe1e6400] 13:54:42 INFO - 225 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_595223_file_uri.js 13:54:42 INFO - ++DOCSHELL 0x7f4b07c19800 == 14 [pid = 2212] [id = 443] 13:54:42 INFO - ++DOMWINDOW == 29 (0x7f4afe816800) [pid = 2212] [serial = 1041] [outer = (nil)] 13:54:42 INFO - ++DOMWINDOW == 30 (0x7f4aff22a000) [pid = 2212] [serial = 1042] [outer = 0x7f4afe816800] 13:54:42 INFO - ++DOCSHELL 0x7f4afe39a000 == 15 [pid = 2212] [id = 444] 13:54:42 INFO - ++DOMWINDOW == 31 (0x7f4aff41a800) [pid = 2212] [serial = 1043] [outer = (nil)] 13:54:42 INFO - ++DOMWINDOW == 32 (0x7f4b00f2e400) [pid = 2212] [serial = 1044] [outer = 0x7f4aff41a800] 13:54:42 INFO - ++DOMWINDOW == 33 (0x7f4b012dcc00) [pid = 2212] [serial = 1045] [outer = 0x7f4aff41a800] 13:54:42 INFO - ++DOCSHELL 0x7f4b0f7a6000 == 16 [pid = 2212] [id = 445] 13:54:42 INFO - ++DOMWINDOW == 34 (0x7f4b09846800) [pid = 2212] [serial = 1046] [outer = (nil)] 13:54:42 INFO - ++DOMWINDOW == 35 (0x7f4b0984dc00) [pid = 2212] [serial = 1047] [outer = 0x7f4b09846800] 13:54:44 INFO - ++DOMWINDOW == 36 (0x7f4b0c4ea800) [pid = 2212] [serial = 1048] [outer = 0x7f4afe816800] 13:54:46 INFO - --DOCSHELL 0x7f4afe4e3800 == 15 [pid = 2212] [id = 429] 13:54:46 INFO - --DOCSHELL 0x7f4afe397000 == 14 [pid = 2212] [id = 438] 13:54:46 INFO - --DOCSHELL 0x7f4b0176d000 == 13 [pid = 2212] [id = 440] 13:54:46 INFO - --DOCSHELL 0x7f4b01763800 == 12 [pid = 2212] [id = 439] 13:54:46 INFO - --DOCSHELL 0x7f4b0f7a6000 == 11 [pid = 2212] [id = 445] 13:54:46 INFO - --DOMWINDOW == 35 (0x7f4b019be000) [pid = 2212] [serial = 1016] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:54:46 INFO - --DOMWINDOW == 34 (0x7f4b099b6800) [pid = 2212] [serial = 1018] [outer = (nil)] [url = about:blank] 13:54:46 INFO - --DOMWINDOW == 33 (0x7f4b00f2e400) [pid = 2212] [serial = 1044] [outer = (nil)] [url = about:blank] 13:54:46 INFO - --DOMWINDOW == 32 (0x7f4afe3e1400) [pid = 2212] [serial = 1031] [outer = (nil)] [url = about:blank] 13:54:46 INFO - --DOMWINDOW == 31 (0x7f4aff232800) [pid = 2212] [serial = 1033] [outer = (nil)] [url = about:blank] 13:54:46 INFO - --DOMWINDOW == 30 (0x7f4aff37c000) [pid = 2212] [serial = 1034] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:54:46 INFO - --DOMWINDOW == 29 (0x7f4b07a0ec00) [pid = 2212] [serial = 1037] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:54:46 INFO - --DOMWINDOW == 28 (0x7f4afe1f3c00) [pid = 2212] [serial = 1030] [outer = (nil)] [url = about:blank] 13:54:46 INFO - --DOMWINDOW == 27 (0x7f4afe819c00) [pid = 2212] [serial = 1032] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20594497%20and%20bug%20619598] 13:54:46 INFO - MEMORY STAT | vsize 1150MB | residentFast 298MB | heapAllocated 113MB 13:54:46 INFO - 226 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_595223_file_uri.js | took 4397ms 13:54:46 INFO - ++DOCSHELL 0x7f4afe2d5000 == 12 [pid = 2212] [id = 446] 13:54:46 INFO - ++DOMWINDOW == 28 (0x7f4afe3e0000) [pid = 2212] [serial = 1049] [outer = (nil)] 13:54:46 INFO - ++DOMWINDOW == 29 (0x7f4afe814800) [pid = 2212] [serial = 1050] [outer = 0x7f4afe3e0000] 13:54:46 INFO - 227 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_595350_multiple_windows_and_tabs.js 13:54:46 INFO - ++DOCSHELL 0x7f4b094a5000 == 13 [pid = 2212] [id = 447] 13:54:46 INFO - ++DOMWINDOW == 30 (0x7f4aff421c00) [pid = 2212] [serial = 1051] [outer = (nil)] 13:54:46 INFO - ++DOMWINDOW == 31 (0x7f4b00f23c00) [pid = 2212] [serial = 1052] [outer = 0x7f4aff421c00] 13:54:47 INFO - ++DOCSHELL 0x7f4b01763000 == 14 [pid = 2212] [id = 448] 13:54:47 INFO - ++DOMWINDOW == 32 (0x7f4b00f2e400) [pid = 2212] [serial = 1053] [outer = (nil)] 13:54:47 INFO - ++DOMWINDOW == 33 (0x7f4b00f31800) [pid = 2212] [serial = 1054] [outer = 0x7f4b00f2e400] 13:54:47 INFO - ++DOCSHELL 0x7f4b0f7a6000 == 15 [pid = 2212] [id = 449] 13:54:47 INFO - ++DOMWINDOW == 34 (0x7f4b00f5f000) [pid = 2212] [serial = 1055] [outer = (nil)] 13:54:47 INFO - ++DOMWINDOW == 35 (0x7f4b00f60c00) [pid = 2212] [serial = 1056] [outer = 0x7f4b00f5f000] 13:54:47 INFO - ++DOCSHELL 0x7f4b0fa24000 == 16 [pid = 2212] [id = 450] 13:54:47 INFO - ++DOMWINDOW == 36 (0x7f4b09589c00) [pid = 2212] [serial = 1057] [outer = (nil)] 13:54:47 INFO - ++DOCSHELL 0x7f4b0fa25000 == 17 [pid = 2212] [id = 451] 13:54:47 INFO - ++DOMWINDOW == 37 (0x7f4b09621800) [pid = 2212] [serial = 1058] [outer = (nil)] 13:54:47 INFO - ++DOMWINDOW == 38 (0x7f4b09848400) [pid = 2212] [serial = 1059] [outer = 0x7f4b09621800] 13:54:47 INFO - ++DOCSHELL 0x7f4b116df800 == 18 [pid = 2212] [id = 452] 13:54:47 INFO - ++DOMWINDOW == 39 (0x7f4b09586800) [pid = 2212] [serial = 1060] [outer = (nil)] 13:54:47 INFO - ++DOMWINDOW == 40 (0x7f4b0c1af800) [pid = 2212] [serial = 1061] [outer = 0x7f4b09586800] 13:54:47 INFO - ++DOMWINDOW == 41 (0x7f4b0c8f1c00) [pid = 2212] [serial = 1062] [outer = 0x7f4b09589c00] 13:54:47 INFO - ++DOMWINDOW == 42 (0x7f4b0c8f2c00) [pid = 2212] [serial = 1063] [outer = 0x7f4b09621800] 13:54:47 INFO - ++DOMWINDOW == 43 (0x7f4b0c8f9000) [pid = 2212] [serial = 1064] [outer = 0x7f4b09586800] 13:54:48 INFO - ++DOCSHELL 0x7f4b1306f800 == 19 [pid = 2212] [id = 453] 13:54:48 INFO - ++DOMWINDOW == 44 (0x7f4b0fbb0000) [pid = 2212] [serial = 1065] [outer = (nil)] 13:54:48 INFO - ++DOMWINDOW == 45 (0x7f4b0fbb7800) [pid = 2212] [serial = 1066] [outer = 0x7f4b0fbb0000] 13:54:48 INFO - ++DOCSHELL 0x7f4b13067000 == 20 [pid = 2212] [id = 454] 13:54:48 INFO - ++DOMWINDOW == 46 (0x7f4b10b03400) [pid = 2212] [serial = 1067] [outer = (nil)] 13:54:48 INFO - ++DOMWINDOW == 47 (0x7f4b10b06000) [pid = 2212] [serial = 1068] [outer = 0x7f4b10b03400] 13:54:49 INFO - ++DOCSHELL 0x7f4afe2c1800 == 21 [pid = 2212] [id = 455] 13:54:49 INFO - ++DOMWINDOW == 48 (0x7f4afe0ab000) [pid = 2212] [serial = 1069] [outer = (nil)] 13:54:49 INFO - ++DOMWINDOW == 49 (0x7f4afe0b6400) [pid = 2212] [serial = 1070] [outer = 0x7f4afe0ab000] 13:54:49 INFO - ++DOMWINDOW == 50 (0x7f4b00f2c800) [pid = 2212] [serial = 1071] [outer = 0x7f4afe0ab000] 13:54:49 INFO - ++DOCSHELL 0x7f4b0c3a3800 == 22 [pid = 2212] [id = 456] 13:54:49 INFO - ++DOMWINDOW == 51 (0x7f4b00f65400) [pid = 2212] [serial = 1072] [outer = (nil)] 13:54:49 INFO - ++DOMWINDOW == 52 (0x7f4b012d3c00) [pid = 2212] [serial = 1073] [outer = 0x7f4b00f65400] 13:54:49 INFO - ++DOCSHELL 0x7f4afe4f1800 == 23 [pid = 2212] [id = 457] 13:54:49 INFO - ++DOMWINDOW == 53 (0x7f4b019bc400) [pid = 2212] [serial = 1074] [outer = (nil)] 13:54:49 INFO - ++DOMWINDOW == 54 (0x7f4b07a07000) [pid = 2212] [serial = 1075] [outer = 0x7f4b019bc400] 13:54:49 INFO - ++DOCSHELL 0x7f4b19750000 == 24 [pid = 2212] [id = 458] 13:54:49 INFO - ++DOMWINDOW == 55 (0x7f4b0c4e4800) [pid = 2212] [serial = 1076] [outer = (nil)] 13:54:49 INFO - ++DOMWINDOW == 56 (0x7f4b0f7d6800) [pid = 2212] [serial = 1077] [outer = 0x7f4b0c4e4800] 13:54:49 INFO - ++DOCSHELL 0x7f4b1ea49000 == 25 [pid = 2212] [id = 459] 13:54:49 INFO - ++DOMWINDOW == 57 (0x7f4b11db7400) [pid = 2212] [serial = 1078] [outer = (nil)] 13:54:49 INFO - ++DOMWINDOW == 58 (0x7f4b11db9c00) [pid = 2212] [serial = 1079] [outer = 0x7f4b11db7400] 13:54:51 INFO - ++DOMWINDOW == 59 (0x7f4b17223800) [pid = 2212] [serial = 1080] [outer = 0x7f4b00f65400] 13:54:51 INFO - ++DOMWINDOW == 60 (0x7f4b1776e800) [pid = 2212] [serial = 1081] [outer = 0x7f4b019bc400] 13:54:51 INFO - ++DOMWINDOW == 61 (0x7f4b2575a800) [pid = 2212] [serial = 1082] [outer = 0x7f4b0c4e4800] 13:54:51 INFO - ++DOMWINDOW == 62 (0x7f4afe009000) [pid = 2212] [serial = 1083] [outer = 0x7f4b11db7400] 13:54:51 INFO - ++DOCSHELL 0x7f4b2a4ef800 == 26 [pid = 2212] [id = 460] 13:54:51 INFO - ++DOMWINDOW == 63 (0x7f4b29dcf000) [pid = 2212] [serial = 1084] [outer = (nil)] 13:54:51 INFO - ++DOMWINDOW == 64 (0x7f4b29e82000) [pid = 2212] [serial = 1085] [outer = 0x7f4b29dcf000] 13:54:51 INFO - ++DOCSHELL 0x7f4b29d2c800 == 27 [pid = 2212] [id = 461] 13:54:51 INFO - ++DOMWINDOW == 65 (0x7f4b190c5800) [pid = 2212] [serial = 1086] [outer = (nil)] 13:54:51 INFO - ++DOMWINDOW == 66 (0x7f4b191a3000) [pid = 2212] [serial = 1087] [outer = 0x7f4b190c5800] 13:54:52 INFO - ++DOCSHELL 0x7f4b2b075000 == 28 [pid = 2212] [id = 462] 13:54:52 INFO - ++DOMWINDOW == 67 (0x7f4b203d0000) [pid = 2212] [serial = 1088] [outer = (nil)] 13:54:52 INFO - ++DOMWINDOW == 68 (0x7f4b2104d000) [pid = 2212] [serial = 1089] [outer = 0x7f4b203d0000] 13:54:52 INFO - ++DOCSHELL 0x7f4b2b60c800 == 29 [pid = 2212] [id = 463] 13:54:52 INFO - ++DOMWINDOW == 69 (0x7f4afe008800) [pid = 2212] [serial = 1090] [outer = (nil)] 13:54:52 INFO - ++DOMWINDOW == 70 (0x7f4b25913400) [pid = 2212] [serial = 1091] [outer = 0x7f4afe008800] 13:54:58 INFO - MEMORY STAT | vsize 1155MB | residentFast 325MB | heapAllocated 134MB 13:54:58 INFO - 228 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_595350_multiple_windows_and_tabs.js | took 11891ms 13:54:58 INFO - ++DOCSHELL 0x7f4b10aeb000 == 30 [pid = 2212] [id = 464] 13:54:58 INFO - ++DOMWINDOW == 71 (0x7f4b09e51800) [pid = 2212] [serial = 1092] [outer = (nil)] 13:54:58 INFO - ++DOMWINDOW == 72 (0x7f4b09e5c400) [pid = 2212] [serial = 1093] [outer = 0x7f4b09e51800] 13:54:59 INFO - 229 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_595934_message_categories.js 13:54:59 INFO - ++DOCSHELL 0x7f4b10aea000 == 31 [pid = 2212] [id = 465] 13:54:59 INFO - ++DOMWINDOW == 73 (0x7f4b1204e400) [pid = 2212] [serial = 1094] [outer = (nil)] 13:54:59 INFO - ++DOMWINDOW == 74 (0x7f4b120a3400) [pid = 2212] [serial = 1095] [outer = 0x7f4b1204e400] 13:54:59 INFO - ++DOCSHELL 0x7f4b2a4e4000 == 32 [pid = 2212] [id = 466] 13:54:59 INFO - ++DOMWINDOW == 75 (0x7f4b12608800) [pid = 2212] [serial = 1096] [outer = (nil)] 13:54:59 INFO - ++DOMWINDOW == 76 (0x7f4b1277cc00) [pid = 2212] [serial = 1097] [outer = 0x7f4b12608800] 13:54:59 INFO - ++DOMWINDOW == 77 (0x7f4b12954000) [pid = 2212] [serial = 1098] [outer = 0x7f4b12608800] 13:54:59 INFO - ++DOCSHELL 0x7f4b2c111000 == 33 [pid = 2212] [id = 467] 13:54:59 INFO - ++DOMWINDOW == 78 (0x7f4b21053c00) [pid = 2212] [serial = 1099] [outer = (nil)] 13:54:59 INFO - ++DOMWINDOW == 79 (0x7f4b21055c00) [pid = 2212] [serial = 1100] [outer = 0x7f4b21053c00] 13:55:01 INFO - ++DOMWINDOW == 80 (0x7f4b25fd3000) [pid = 2212] [serial = 1101] [outer = 0x7f4b1204e400] 13:55:01 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:55:02 INFO - ++DOMWINDOW == 81 (0x7f4b12372400) [pid = 2212] [serial = 1102] [outer = 0x7f4b1204e400] 13:55:02 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:55:03 INFO - ++DOMWINDOW == 82 (0x7f4b1237e400) [pid = 2212] [serial = 1103] [outer = 0x7f4b1204e400] 13:55:03 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:55:04 INFO - JavaScript error: resource://gre/modules/LoginManagerParent.jsm, line 185: TypeError: this._recipeManager is null 13:55:04 INFO - ++DOMWINDOW == 83 (0x7f4b12381400) [pid = 2212] [serial = 1104] [outer = 0x7f4b1204e400] 13:55:04 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:55:05 INFO - ++DOMWINDOW == 84 (0x7f4afe8bf800) [pid = 2212] [serial = 1105] [outer = 0x7f4b1204e400] 13:55:05 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:55:06 INFO - ++DOMWINDOW == 85 (0x7f4afe8bfc00) [pid = 2212] [serial = 1106] [outer = 0x7f4b1204e400] 13:55:07 INFO - ++DOMWINDOW == 86 (0x7f4afd94e800) [pid = 2212] [serial = 1107] [outer = 0x7f4b1204e400] 13:55:08 INFO - ++DOMWINDOW == 87 (0x7f4afd03e000) [pid = 2212] [serial = 1108] [outer = 0x7f4b1204e400] 13:55:08 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:55:09 INFO - ++DOMWINDOW == 88 (0x7f4afc721000) [pid = 2212] [serial = 1109] [outer = 0x7f4b1204e400] 13:55:09 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:55:09 INFO - ++DOMWINDOW == 89 (0x7f4afc859400) [pid = 2212] [serial = 1110] [outer = 0x7f4b1204e400] 13:55:09 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:55:10 INFO - ++DOMWINDOW == 90 (0x7f4afc866c00) [pid = 2212] [serial = 1111] [outer = 0x7f4b1204e400] 13:55:10 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:55:11 INFO - ++DOMWINDOW == 91 (0x7f4afd94d000) [pid = 2212] [serial = 1112] [outer = 0x7f4b1204e400] 13:55:11 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:55:14 INFO - --DOCSHELL 0x7f4afe39a000 == 32 [pid = 2212] [id = 444] 13:55:15 INFO - --DOCSHELL 0x7f4b0c3a3800 == 31 [pid = 2212] [id = 456] 13:55:15 INFO - --DOCSHELL 0x7f4afe4f1800 == 30 [pid = 2212] [id = 457] 13:55:15 INFO - --DOCSHELL 0x7f4afe38f000 == 29 [pid = 2212] [id = 442] 13:55:15 INFO - --DOCSHELL 0x7f4b2a4ef800 == 28 [pid = 2212] [id = 460] 13:55:15 INFO - --DOCSHELL 0x7f4b29d2c800 == 27 [pid = 2212] [id = 461] 13:55:15 INFO - --DOCSHELL 0x7f4b2a4e4000 == 26 [pid = 2212] [id = 466] 13:55:15 INFO - --DOCSHELL 0x7f4b2c111000 == 25 [pid = 2212] [id = 467] 13:55:15 INFO - --DOCSHELL 0x7f4b07c19800 == 24 [pid = 2212] [id = 443] 13:55:15 INFO - --DOCSHELL 0x7f4afe2d5000 == 23 [pid = 2212] [id = 446] 13:55:15 INFO - --DOCSHELL 0x7f4b01763000 == 22 [pid = 2212] [id = 448] 13:55:15 INFO - --DOCSHELL 0x7f4b094a5000 == 21 [pid = 2212] [id = 447] 13:55:15 INFO - --DOCSHELL 0x7f4b2b075000 == 20 [pid = 2212] [id = 462] 13:55:15 INFO - --DOCSHELL 0x7f4b2b60c800 == 19 [pid = 2212] [id = 463] 13:55:15 INFO - --DOCSHELL 0x7f4b0f7a6000 == 18 [pid = 2212] [id = 449] 13:55:15 INFO - --DOMWINDOW == 90 (0x7f4b00f64000) [pid = 2212] [serial = 1036] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:15 INFO - --DOMWINDOW == 89 (0x7f4b07a13400) [pid = 2212] [serial = 1038] [outer = (nil)] [url = about:blank] 13:55:15 INFO - --DOMWINDOW == 88 (0x7f4b09848400) [pid = 2212] [serial = 1059] [outer = 0x7f4b09621800] [url = about:blank] 13:55:15 INFO - --DOMWINDOW == 87 (0x7f4b0c8f1c00) [pid = 2212] [serial = 1062] [outer = 0x7f4b09589c00] [url = about:blank] 13:55:15 INFO - --DOMWINDOW == 86 (0x7f4b0c8f2c00) [pid = 2212] [serial = 1063] [outer = 0x7f4b09621800] [url = about:blank] 13:55:15 INFO - --DOMWINDOW == 85 (0x7f4b09589c00) [pid = 2212] [serial = 1057] [outer = (nil)] [url = about:blank] 13:55:15 INFO - --DOMWINDOW == 84 (0x7f4b09621800) [pid = 2212] [serial = 1058] [outer = (nil)] [url = about:blank] 13:55:16 INFO - --DOMWINDOW == 83 (0x7f4afe1e6400) [pid = 2212] [serial = 1039] [outer = (nil)] [url = about:blank] 13:55:16 INFO - --DOMWINDOW == 82 (0x7f4afe816800) [pid = 2212] [serial = 1041] [outer = (nil)] [url = file:///builds/slave/test/build/tests/mochitest/browser/devtools/client/webconsole/test/test-network.html] 13:55:16 INFO - --DOMWINDOW == 81 (0x7f4b0fbb7800) [pid = 2212] [serial = 1066] [outer = (nil)] [url = about:blank] 13:55:16 INFO - --DOMWINDOW == 80 (0x7f4b0fbb0000) [pid = 2212] [serial = 1065] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20595350] 13:55:16 INFO - --DOMWINDOW == 79 (0x7f4afe814800) [pid = 2212] [serial = 1050] [outer = (nil)] [url = about:blank] 13:55:16 INFO - --DOMWINDOW == 78 (0x7f4aff41a800) [pid = 2212] [serial = 1043] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:16 INFO - --DOMWINDOW == 77 (0x7f4b09846800) [pid = 2212] [serial = 1046] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:55:16 INFO - --DOMWINDOW == 76 (0x7f4b1277cc00) [pid = 2212] [serial = 1097] [outer = (nil)] [url = about:blank] 13:55:16 INFO - --DOMWINDOW == 75 (0x7f4afe3db400) [pid = 2212] [serial = 1040] [outer = (nil)] [url = about:blank] 13:55:16 INFO - --DOMWINDOW == 74 (0x7f4aff22a000) [pid = 2212] [serial = 1042] [outer = (nil)] [url = about:blank] 13:55:16 INFO - --DOMWINDOW == 73 (0x7f4b019bc400) [pid = 2212] [serial = 1074] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:16 INFO - --DOMWINDOW == 72 (0x7f4b07a07000) [pid = 2212] [serial = 1075] [outer = (nil)] [url = about:blank] 13:55:16 INFO - --DOMWINDOW == 71 (0x7f4b0c4e4800) [pid = 2212] [serial = 1076] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:16 INFO - --DOMWINDOW == 70 (0x7f4b0f7d6800) [pid = 2212] [serial = 1077] [outer = (nil)] [url = about:blank] 13:55:16 INFO - --DOMWINDOW == 69 (0x7f4b11db7400) [pid = 2212] [serial = 1078] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:16 INFO - --DOMWINDOW == 68 (0x7f4b11db9c00) [pid = 2212] [serial = 1079] [outer = (nil)] [url = about:blank] 13:55:16 INFO - --DOMWINDOW == 67 (0x7f4afe0b6400) [pid = 2212] [serial = 1070] [outer = (nil)] [url = about:blank] 13:55:16 INFO - --DOMWINDOW == 66 (0x7f4afe0ab000) [pid = 2212] [serial = 1069] [outer = (nil)] [url = about:newtab] 13:55:16 INFO - --DOMWINDOW == 65 (0x7f4b00f23c00) [pid = 2212] [serial = 1052] [outer = (nil)] [url = about:blank] 13:55:16 INFO - --DOMWINDOW == 64 (0x7f4aff421c00) [pid = 2212] [serial = 1051] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20595350] 13:55:16 INFO - --DOMWINDOW == 63 (0x7f4b00f31800) [pid = 2212] [serial = 1054] [outer = (nil)] [url = about:blank] 13:55:16 INFO - --DOMWINDOW == 62 (0x7f4b00f2e400) [pid = 2212] [serial = 1053] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20595350] 13:55:16 INFO - --DOMWINDOW == 61 (0x7f4afe3e0000) [pid = 2212] [serial = 1049] [outer = (nil)] [url = about:blank] 13:55:16 INFO - --DOMWINDOW == 60 (0x7f4b0c8f9000) [pid = 2212] [serial = 1064] [outer = (nil)] [url = about:blank] 13:55:16 INFO - --DOMWINDOW == 59 (0x7f4b09586800) [pid = 2212] [serial = 1060] [outer = (nil)] [url = about:blank] 13:55:16 INFO - --DOMWINDOW == 58 (0x7f4b10b06000) [pid = 2212] [serial = 1068] [outer = (nil)] [url = about:blank] 13:55:16 INFO - --DOMWINDOW == 57 (0x7f4b10b03400) [pid = 2212] [serial = 1067] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20595350] 13:55:16 INFO - --DOMWINDOW == 56 (0x7f4afe008800) [pid = 2212] [serial = 1090] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:55:16 INFO - --DOMWINDOW == 55 (0x7f4b190c5800) [pid = 2212] [serial = 1086] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:55:16 INFO - --DOMWINDOW == 54 (0x7f4b29dcf000) [pid = 2212] [serial = 1084] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:55:16 INFO - --DOMWINDOW == 53 (0x7f4b203d0000) [pid = 2212] [serial = 1088] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:55:16 INFO - --DOMWINDOW == 52 (0x7f4b120a3400) [pid = 2212] [serial = 1095] [outer = (nil)] [url = about:blank] 13:55:16 INFO - --DOMWINDOW == 51 (0x7f4b012d3c00) [pid = 2212] [serial = 1073] [outer = (nil)] [url = about:blank] 13:55:16 INFO - --DOMWINDOW == 50 (0x7f4b00f65400) [pid = 2212] [serial = 1072] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:16 INFO - --DOMWINDOW == 49 (0x7f4afe8bfc00) [pid = 2212] [serial = 1106] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-malformedxml.xhtml] 13:55:16 INFO - --DOMWINDOW == 48 (0x7f4afd94e800) [pid = 2212] [serial = 1107] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-svg.xhtml] 13:55:16 INFO - --DOMWINDOW == 47 (0x7f4b12381400) [pid = 2212] [serial = 1104] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-html.html] 13:55:16 INFO - --DOMWINDOW == 46 (0x7f4b0c1af800) [pid = 2212] [serial = 1061] [outer = (nil)] [url = about:blank] 13:55:16 INFO - --DOMWINDOW == 45 (0x7f4b0c4ea800) [pid = 2212] [serial = 1048] [outer = (nil)] [url = file:///builds/slave/test/build/tests/mochitest/browser/devtools/client/webconsole/test/test-network.html] 13:55:16 INFO - --DOMWINDOW == 44 (0x7f4b25fd3000) [pid = 2212] [serial = 1101] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-css-loader.html] 13:55:16 INFO - --DOMWINDOW == 43 (0x7f4afd03e000) [pid = 2212] [serial = 1108] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-css-parser.html] 13:55:16 INFO - --DOMWINDOW == 42 (0x7f4b1237e400) [pid = 2212] [serial = 1103] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-html.html] 13:55:16 INFO - --DOMWINDOW == 41 (0x7f4b12372400) [pid = 2212] [serial = 1102] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-imagemap.html] 13:55:17 INFO - MEMORY STAT | vsize 1178MB | residentFast 328MB | heapAllocated 122MB 13:55:17 INFO - 230 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_595934_message_categories.js | took 17973ms 13:55:17 INFO - ++DOCSHELL 0x7f4afd9ae800 == 19 [pid = 2212] [id = 468] 13:55:17 INFO - ++DOMWINDOW == 42 (0x7f4afd03f000) [pid = 2212] [serial = 1113] [outer = (nil)] 13:55:17 INFO - ++DOMWINDOW == 43 (0x7f4afd338400) [pid = 2212] [serial = 1114] [outer = 0x7f4afd03f000] 13:55:17 INFO - 231 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_597103_deactivateHUDForContext_unfocused_window.js 13:55:17 INFO - ++DOCSHELL 0x7f4afdae3000 == 20 [pid = 2212] [id = 469] 13:55:17 INFO - ++DOMWINDOW == 44 (0x7f4afd341800) [pid = 2212] [serial = 1115] [outer = (nil)] 13:55:17 INFO - ++DOMWINDOW == 45 (0x7f4afd344400) [pid = 2212] [serial = 1116] [outer = 0x7f4afd341800] 13:55:17 INFO - ++DOMWINDOW == 46 (0x7f4afd3a6800) [pid = 2212] [serial = 1117] [outer = 0x7f4afd341800] 13:55:17 INFO - ++DOCSHELL 0x7f4afd59d800 == 21 [pid = 2212] [id = 470] 13:55:17 INFO - ++DOMWINDOW == 47 (0x7f4afd3ae400) [pid = 2212] [serial = 1118] [outer = (nil)] 13:55:17 INFO - ++DOMWINDOW == 48 (0x7f4afd3b0c00) [pid = 2212] [serial = 1119] [outer = 0x7f4afd3ae400] 13:55:17 INFO - ++DOCSHELL 0x7f4afddb9000 == 22 [pid = 2212] [id = 471] 13:55:17 INFO - ++DOMWINDOW == 49 (0x7f4afd947400) [pid = 2212] [serial = 1120] [outer = (nil)] 13:55:17 INFO - ++DOCSHELL 0x7f4afddb9800 == 23 [pid = 2212] [id = 472] 13:55:17 INFO - ++DOMWINDOW == 50 (0x7f4afd947c00) [pid = 2212] [serial = 1121] [outer = (nil)] 13:55:17 INFO - ++DOMWINDOW == 51 (0x7f4afd949c00) [pid = 2212] [serial = 1122] [outer = 0x7f4afd947c00] 13:55:18 INFO - ++DOCSHELL 0x7f4afe2db800 == 24 [pid = 2212] [id = 473] 13:55:18 INFO - ++DOMWINDOW == 52 (0x7f4afd947000) [pid = 2212] [serial = 1123] [outer = (nil)] 13:55:18 INFO - ++DOMWINDOW == 53 (0x7f4afe1e9400) [pid = 2212] [serial = 1124] [outer = 0x7f4afd947000] 13:55:18 INFO - ++DOMWINDOW == 54 (0x7f4afe3d9c00) [pid = 2212] [serial = 1125] [outer = 0x7f4afd947400] 13:55:18 INFO - ++DOMWINDOW == 55 (0x7f4afe3db400) [pid = 2212] [serial = 1126] [outer = 0x7f4afd947c00] 13:55:18 INFO - ++DOMWINDOW == 56 (0x7f4afe3de400) [pid = 2212] [serial = 1127] [outer = 0x7f4afd947000] 13:55:19 INFO - ++DOCSHELL 0x7f4afe85f800 == 25 [pid = 2212] [id = 474] 13:55:19 INFO - ++DOMWINDOW == 57 (0x7f4afd03bc00) [pid = 2212] [serial = 1128] [outer = (nil)] 13:55:19 INFO - ++DOMWINDOW == 58 (0x7f4afe8ab400) [pid = 2212] [serial = 1129] [outer = 0x7f4afd03bc00] 13:55:19 INFO - ++DOMWINDOW == 59 (0x7f4afe3dc800) [pid = 2212] [serial = 1130] [outer = 0x7f4afd03bc00] 13:55:19 INFO - ++DOCSHELL 0x7f4aff213000 == 26 [pid = 2212] [id = 475] 13:55:19 INFO - ++DOMWINDOW == 60 (0x7f4afe8c0c00) [pid = 2212] [serial = 1131] [outer = (nil)] 13:55:19 INFO - ++DOMWINDOW == 61 (0x7f4aff229800) [pid = 2212] [serial = 1132] [outer = 0x7f4afe8c0c00] 13:55:19 INFO - ++DOMWINDOW == 62 (0x7f4afc720800) [pid = 2212] [serial = 1133] [outer = 0x7f4afe8c0c00] 13:55:20 INFO - ++DOCSHELL 0x7f4afe4e0800 == 27 [pid = 2212] [id = 476] 13:55:20 INFO - ++DOMWINDOW == 63 (0x7f4afd035c00) [pid = 2212] [serial = 1134] [outer = (nil)] 13:55:20 INFO - ++DOMWINDOW == 64 (0x7f4afd03b800) [pid = 2212] [serial = 1135] [outer = 0x7f4afd035c00] 13:55:20 INFO - ++DOCSHELL 0x7f4afe850000 == 28 [pid = 2212] [id = 477] 13:55:20 INFO - ++DOMWINDOW == 65 (0x7f4afd03ec00) [pid = 2212] [serial = 1136] [outer = (nil)] 13:55:20 INFO - ++DOMWINDOW == 66 (0x7f4afd338800) [pid = 2212] [serial = 1137] [outer = 0x7f4afd03ec00] 13:55:21 INFO - ++DOMWINDOW == 67 (0x7f4aff423400) [pid = 2212] [serial = 1138] [outer = 0x7f4afd035c00] 13:55:21 INFO - ++DOMWINDOW == 68 (0x7f4b00f65400) [pid = 2212] [serial = 1139] [outer = 0x7f4afd03ec00] 13:55:21 INFO - ++DOCSHELL 0x7f4aff2c3800 == 29 [pid = 2212] [id = 478] 13:55:21 INFO - ++DOMWINDOW == 69 (0x7f4b012d3800) [pid = 2212] [serial = 1140] [outer = (nil)] 13:55:21 INFO - ++DOMWINDOW == 70 (0x7f4b012d8c00) [pid = 2212] [serial = 1141] [outer = 0x7f4b012d3800] 13:55:21 INFO - ++DOCSHELL 0x7f4aff2d3800 == 30 [pid = 2212] [id = 479] 13:55:21 INFO - ++DOMWINDOW == 71 (0x7f4b07d64400) [pid = 2212] [serial = 1142] [outer = (nil)] 13:55:21 INFO - ++DOMWINDOW == 72 (0x7f4b07d78800) [pid = 2212] [serial = 1143] [outer = 0x7f4b07d64400] 13:55:26 INFO - --DOCSHELL 0x7f4aff2c3800 == 29 [pid = 2212] [id = 478] 13:55:26 INFO - --DOCSHELL 0x7f4b10aea000 == 28 [pid = 2212] [id = 465] 13:55:26 INFO - --DOCSHELL 0x7f4b10aeb000 == 27 [pid = 2212] [id = 464] 13:55:26 INFO - --DOCSHELL 0x7f4b116df800 == 26 [pid = 2212] [id = 452] 13:55:26 INFO - --DOCSHELL 0x7f4b13067000 == 25 [pid = 2212] [id = 454] 13:55:26 INFO - --DOCSHELL 0x7f4b0fa24000 == 24 [pid = 2212] [id = 450] 13:55:26 INFO - --DOCSHELL 0x7f4b1306f800 == 23 [pid = 2212] [id = 453] 13:55:26 INFO - --DOCSHELL 0x7f4b0fa25000 == 22 [pid = 2212] [id = 451] 13:55:26 INFO - --DOCSHELL 0x7f4afe2c1800 == 21 [pid = 2212] [id = 455] 13:55:26 INFO - --DOCSHELL 0x7f4b19750000 == 20 [pid = 2212] [id = 458] 13:55:26 INFO - --DOCSHELL 0x7f4b1ea49000 == 19 [pid = 2212] [id = 459] 13:55:26 INFO - --DOMWINDOW == 71 (0x7f4b2104d000) [pid = 2212] [serial = 1089] [outer = (nil)] [url = about:blank] 13:55:26 INFO - --DOMWINDOW == 70 (0x7f4b0984dc00) [pid = 2212] [serial = 1047] [outer = (nil)] [url = about:blank] 13:55:26 INFO - --DOMWINDOW == 69 (0x7f4b191a3000) [pid = 2212] [serial = 1087] [outer = (nil)] [url = about:blank] 13:55:26 INFO - --DOMWINDOW == 68 (0x7f4b2575a800) [pid = 2212] [serial = 1082] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:26 INFO - --DOMWINDOW == 67 (0x7f4b29e82000) [pid = 2212] [serial = 1085] [outer = (nil)] [url = about:blank] 13:55:26 INFO - --DOMWINDOW == 66 (0x7f4b25913400) [pid = 2212] [serial = 1091] [outer = (nil)] [url = about:blank] 13:55:26 INFO - --DOMWINDOW == 65 (0x7f4b012dcc00) [pid = 2212] [serial = 1045] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:26 INFO - --DOMWINDOW == 64 (0x7f4afe009000) [pid = 2212] [serial = 1083] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:26 INFO - --DOMWINDOW == 63 (0x7f4b00f2c800) [pid = 2212] [serial = 1071] [outer = (nil)] [url = about:newtab] 13:55:26 INFO - --DOMWINDOW == 62 (0x7f4b1776e800) [pid = 2212] [serial = 1081] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:26 INFO - --DOMWINDOW == 61 (0x7f4b17223800) [pid = 2212] [serial = 1080] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:26 INFO - --DOMWINDOW == 60 (0x7f4afd949c00) [pid = 2212] [serial = 1122] [outer = 0x7f4afd947c00] [url = about:blank] 13:55:26 INFO - --DOCSHELL 0x7f4aff2d3800 == 18 [pid = 2212] [id = 479] 13:55:26 INFO - --DOMWINDOW == 59 (0x7f4afd338800) [pid = 2212] [serial = 1137] [outer = (nil)] [url = about:blank] 13:55:26 INFO - --DOMWINDOW == 58 (0x7f4afd03b800) [pid = 2212] [serial = 1135] [outer = (nil)] [url = about:blank] 13:55:26 INFO - --DOMWINDOW == 57 (0x7f4aff229800) [pid = 2212] [serial = 1132] [outer = (nil)] [url = about:blank] 13:55:26 INFO - --DOMWINDOW == 56 (0x7f4b12608800) [pid = 2212] [serial = 1096] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:26 INFO - --DOMWINDOW == 55 (0x7f4b21053c00) [pid = 2212] [serial = 1099] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:55:26 INFO - --DOMWINDOW == 54 (0x7f4b09e51800) [pid = 2212] [serial = 1092] [outer = (nil)] [url = about:blank] 13:55:26 INFO - --DOMWINDOW == 53 (0x7f4afd344400) [pid = 2212] [serial = 1116] [outer = (nil)] [url = about:blank] 13:55:26 INFO - --DOMWINDOW == 52 (0x7f4b09e5c400) [pid = 2212] [serial = 1093] [outer = (nil)] [url = about:blank] 13:55:26 INFO - --DOMWINDOW == 51 (0x7f4b00f5f000) [pid = 2212] [serial = 1055] [outer = (nil)] [url = chrome://browser/content/browser.xul] 13:55:26 INFO - --DOMWINDOW == 50 (0x7f4b1204e400) [pid = 2212] [serial = 1094] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-image.html] 13:55:26 INFO - --DOMWINDOW == 49 (0x7f4afe1e9400) [pid = 2212] [serial = 1124] [outer = (nil)] [url = about:blank] 13:55:26 INFO - --DOMWINDOW == 48 (0x7f4afe8ab400) [pid = 2212] [serial = 1129] [outer = (nil)] [url = about:blank] 13:55:26 INFO - --DOMWINDOW == 47 (0x7f4afe8bf800) [pid = 2212] [serial = 1105] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-workers.html] 13:55:26 INFO - --DOMWINDOW == 46 (0x7f4afd94d000) [pid = 2212] [serial = 1112] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-image.html] 13:55:26 INFO - --DOMWINDOW == 45 (0x7f4afc866c00) [pid = 2212] [serial = 1111] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-canvas-css.html] 13:55:26 INFO - --DOMWINDOW == 44 (0x7f4afc721000) [pid = 2212] [serial = 1109] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-malformedxml-external.html] 13:55:26 INFO - --DOMWINDOW == 43 (0x7f4afc859400) [pid = 2212] [serial = 1110] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-595934-empty-getelementbyid.html] 13:55:27 INFO - --DOCSHELL 0x7f4afe4e0800 == 17 [pid = 2212] [id = 476] 13:55:27 INFO - --DOCSHELL 0x7f4afe850000 == 16 [pid = 2212] [id = 477] 13:55:28 INFO - --DOMWINDOW == 42 (0x7f4b00f60c00) [pid = 2212] [serial = 1056] [outer = (nil)] [url = about:blank] 13:55:28 INFO - --DOMWINDOW == 41 (0x7f4b21055c00) [pid = 2212] [serial = 1100] [outer = (nil)] [url = about:blank] 13:55:28 INFO - --DOMWINDOW == 40 (0x7f4b12954000) [pid = 2212] [serial = 1098] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:28 INFO - --DOMWINDOW == 39 (0x7f4afd035c00) [pid = 2212] [serial = 1134] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:28 INFO - --DOMWINDOW == 38 (0x7f4b012d3800) [pid = 2212] [serial = 1140] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:55:28 INFO - MEMORY STAT | vsize 1177MB | residentFast 314MB | heapAllocated 116MB 13:55:28 INFO - 232 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_597103_deactivateHUDForContext_unfocused_window.js | took 11682ms 13:55:28 INFO - ++DOCSHELL 0x7f4afd9bb000 == 17 [pid = 2212] [id = 480] 13:55:28 INFO - ++DOMWINDOW == 39 (0x7f4afd03d800) [pid = 2212] [serial = 1144] [outer = (nil)] 13:55:29 INFO - ++DOMWINDOW == 40 (0x7f4afd041000) [pid = 2212] [serial = 1145] [outer = 0x7f4afd03d800] 13:55:29 INFO - 233 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_597136_external_script_errors.js 13:55:29 INFO - ++DOCSHELL 0x7f4afdda1800 == 18 [pid = 2212] [id = 481] 13:55:29 INFO - ++DOMWINDOW == 41 (0x7f4afd3a4800) [pid = 2212] [serial = 1146] [outer = (nil)] 13:55:29 INFO - ++DOMWINDOW == 42 (0x7f4afd3a7800) [pid = 2212] [serial = 1147] [outer = 0x7f4afd3a4800] 13:55:29 INFO - ++DOMWINDOW == 43 (0x7f4afe816400) [pid = 2212] [serial = 1148] [outer = 0x7f4afd3a4800] 13:55:30 INFO - ++DOCSHELL 0x7f4afd9ac800 == 19 [pid = 2212] [id = 482] 13:55:30 INFO - ++DOMWINDOW == 44 (0x7f4afd94f800) [pid = 2212] [serial = 1149] [outer = (nil)] 13:55:30 INFO - ++DOMWINDOW == 45 (0x7f4afd950800) [pid = 2212] [serial = 1150] [outer = 0x7f4afd94f800] 13:55:30 INFO - ++DOMWINDOW == 46 (0x7f4afe0a9800) [pid = 2212] [serial = 1151] [outer = 0x7f4afd94f800] 13:55:30 INFO - ++DOCSHELL 0x7f4afe3a6800 == 20 [pid = 2212] [id = 483] 13:55:30 INFO - ++DOMWINDOW == 47 (0x7f4afe0b3400) [pid = 2212] [serial = 1152] [outer = (nil)] 13:55:30 INFO - ++DOMWINDOW == 48 (0x7f4afe3e0c00) [pid = 2212] [serial = 1153] [outer = 0x7f4afe0b3400] 13:55:31 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-597136-external-script-errors.js, line 12: ReferenceError: bogus is not defined 13:55:33 INFO - --DOCSHELL 0x7f4afd9ae800 == 19 [pid = 2212] [id = 468] 13:55:33 INFO - --DOCSHELL 0x7f4afd9ac800 == 18 [pid = 2212] [id = 482] 13:55:33 INFO - --DOCSHELL 0x7f4afe3a6800 == 17 [pid = 2212] [id = 483] 13:55:33 INFO - --DOCSHELL 0x7f4afdae3000 == 16 [pid = 2212] [id = 469] 13:55:33 INFO - --DOCSHELL 0x7f4afd59d800 == 15 [pid = 2212] [id = 470] 13:55:33 INFO - --DOCSHELL 0x7f4afe2db800 == 14 [pid = 2212] [id = 473] 13:55:33 INFO - --DOCSHELL 0x7f4afddb9000 == 13 [pid = 2212] [id = 471] 13:55:33 INFO - --DOCSHELL 0x7f4afddb9800 == 12 [pid = 2212] [id = 472] 13:55:33 INFO - --DOCSHELL 0x7f4afe85f800 == 11 [pid = 2212] [id = 474] 13:55:33 INFO - --DOCSHELL 0x7f4aff213000 == 10 [pid = 2212] [id = 475] 13:55:33 INFO - --DOMWINDOW == 47 (0x7f4afe3d9c00) [pid = 2212] [serial = 1125] [outer = 0x7f4afd947400] [url = about:blank] 13:55:33 INFO - --DOMWINDOW == 46 (0x7f4b012d8c00) [pid = 2212] [serial = 1141] [outer = (nil)] [url = about:blank] 13:55:33 INFO - --DOMWINDOW == 45 (0x7f4aff423400) [pid = 2212] [serial = 1138] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:33 INFO - --DOMWINDOW == 44 (0x7f4afe3db400) [pid = 2212] [serial = 1126] [outer = 0x7f4afd947c00] [url = about:blank] 13:55:33 INFO - --DOMWINDOW == 43 (0x7f4afd947400) [pid = 2212] [serial = 1120] [outer = (nil)] [url = about:blank] 13:55:33 INFO - --DOMWINDOW == 42 (0x7f4afd947c00) [pid = 2212] [serial = 1121] [outer = (nil)] [url = about:blank] 13:55:33 INFO - --DOMWINDOW == 41 (0x7f4afd947000) [pid = 2212] [serial = 1123] [outer = (nil)] [url = about:blank] 13:55:33 INFO - --DOMWINDOW == 40 (0x7f4afd03bc00) [pid = 2212] [serial = 1128] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:55:33 INFO - --DOMWINDOW == 39 (0x7f4afe8c0c00) [pid = 2212] [serial = 1131] [outer = (nil)] [url = about:newtab] 13:55:33 INFO - --DOMWINDOW == 38 (0x7f4afd338400) [pid = 2212] [serial = 1114] [outer = (nil)] [url = about:blank] 13:55:33 INFO - --DOMWINDOW == 37 (0x7f4afe3de400) [pid = 2212] [serial = 1127] [outer = (nil)] [url = about:blank] 13:55:33 INFO - --DOMWINDOW == 36 (0x7f4afd3a7800) [pid = 2212] [serial = 1147] [outer = (nil)] [url = about:blank] 13:55:33 INFO - --DOMWINDOW == 35 (0x7f4afd950800) [pid = 2212] [serial = 1150] [outer = (nil)] [url = about:blank] 13:55:33 INFO - --DOMWINDOW == 34 (0x7f4afd03ec00) [pid = 2212] [serial = 1136] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:33 INFO - --DOMWINDOW == 33 (0x7f4afd3ae400) [pid = 2212] [serial = 1118] [outer = (nil)] [url = chrome://browser/content/browser.xul] 13:55:33 INFO - --DOMWINDOW == 32 (0x7f4b07d64400) [pid = 2212] [serial = 1142] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:55:33 INFO - --DOMWINDOW == 31 (0x7f4afd03f000) [pid = 2212] [serial = 1113] [outer = (nil)] [url = about:blank] 13:55:33 INFO - --DOMWINDOW == 30 (0x7f4afd341800) [pid = 2212] [serial = 1115] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:55:33 INFO - --DOMWINDOW == 29 (0x7f4afd3a6800) [pid = 2212] [serial = 1117] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:55:33 INFO - --DOMWINDOW == 28 (0x7f4afe3dc800) [pid = 2212] [serial = 1130] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:55:33 INFO - MEMORY STAT | vsize 1175MB | residentFast 307MB | heapAllocated 115MB 13:55:33 INFO - 234 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_597136_external_script_errors.js | took 4624ms 13:55:33 INFO - ++DOCSHELL 0x7f4afd5a1000 == 11 [pid = 2212] [id = 484] 13:55:33 INFO - ++DOMWINDOW == 29 (0x7f4afc868000) [pid = 2212] [serial = 1154] [outer = (nil)] 13:55:34 INFO - ++DOMWINDOW == 30 (0x7f4afd03ac00) [pid = 2212] [serial = 1155] [outer = 0x7f4afc868000] 13:55:34 INFO - 235 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_597136_network_requests_from_chrome.js 13:55:34 INFO - MEMORY STAT | vsize 1175MB | residentFast 306MB | heapAllocated 116MB 13:55:34 INFO - 236 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_597136_network_requests_from_chrome.js | took 324ms 13:55:34 INFO - ++DOCSHELL 0x7f4afdd9f800 == 12 [pid = 2212] [id = 485] 13:55:34 INFO - ++DOMWINDOW == 31 (0x7f4afd344400) [pid = 2212] [serial = 1156] [outer = (nil)] 13:55:34 INFO - ++DOMWINDOW == 32 (0x7f4afd3a4000) [pid = 2212] [serial = 1157] [outer = 0x7f4afd344400] 13:55:34 INFO - 237 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_597460_filter_scroll.js 13:55:34 INFO - ++DOCSHELL 0x7f4afd9aa000 == 13 [pid = 2212] [id = 486] 13:55:34 INFO - ++DOMWINDOW == 33 (0x7f4afd944c00) [pid = 2212] [serial = 1158] [outer = (nil)] 13:55:34 INFO - ++DOMWINDOW == 34 (0x7f4afd948400) [pid = 2212] [serial = 1159] [outer = 0x7f4afd944c00] 13:55:35 INFO - ++DOMWINDOW == 35 (0x7f4afd951c00) [pid = 2212] [serial = 1160] [outer = 0x7f4afd944c00] 13:55:35 INFO - ++DOCSHELL 0x7f4afe2c8800 == 14 [pid = 2212] [id = 487] 13:55:35 INFO - ++DOMWINDOW == 36 (0x7f4afd94a400) [pid = 2212] [serial = 1161] [outer = (nil)] 13:55:35 INFO - ++DOMWINDOW == 37 (0x7f4afe0ad400) [pid = 2212] [serial = 1162] [outer = 0x7f4afd94a400] 13:55:35 INFO - ++DOMWINDOW == 38 (0x7f4afe3d6400) [pid = 2212] [serial = 1163] [outer = 0x7f4afd94a400] 13:55:35 INFO - ++DOCSHELL 0x7f4afe4f9000 == 15 [pid = 2212] [id = 488] 13:55:35 INFO - ++DOMWINDOW == 39 (0x7f4afe54dc00) [pid = 2212] [serial = 1164] [outer = (nil)] 13:55:35 INFO - ++DOMWINDOW == 40 (0x7f4afe573800) [pid = 2212] [serial = 1165] [outer = 0x7f4afe54dc00] 13:55:40 INFO - ++DOMWINDOW == 41 (0x7f4afe3d8c00) [pid = 2212] [serial = 1166] [outer = 0x7f4afd944c00] 13:55:40 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:55:42 INFO - --DOCSHELL 0x7f4afd5a1000 == 14 [pid = 2212] [id = 484] 13:55:42 INFO - --DOCSHELL 0x7f4afdda1800 == 13 [pid = 2212] [id = 481] 13:55:42 INFO - --DOCSHELL 0x7f4afd9bb000 == 12 [pid = 2212] [id = 480] 13:55:42 INFO - --DOCSHELL 0x7f4afe2c8800 == 11 [pid = 2212] [id = 487] 13:55:42 INFO - --DOCSHELL 0x7f4afe4f9000 == 10 [pid = 2212] [id = 488] 13:55:42 INFO - --DOMWINDOW == 40 (0x7f4b00f65400) [pid = 2212] [serial = 1139] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:42 INFO - --DOMWINDOW == 39 (0x7f4afd3b0c00) [pid = 2212] [serial = 1119] [outer = (nil)] [url = about:blank] 13:55:42 INFO - --DOMWINDOW == 38 (0x7f4b07d78800) [pid = 2212] [serial = 1143] [outer = (nil)] [url = about:blank] 13:55:42 INFO - --DOMWINDOW == 37 (0x7f4afc720800) [pid = 2212] [serial = 1133] [outer = (nil)] [url = about:newtab] 13:55:42 INFO - --DOMWINDOW == 36 (0x7f4afd94f800) [pid = 2212] [serial = 1149] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:42 INFO - --DOMWINDOW == 35 (0x7f4afe0b3400) [pid = 2212] [serial = 1152] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:55:42 INFO - --DOMWINDOW == 34 (0x7f4afc868000) [pid = 2212] [serial = 1154] [outer = (nil)] [url = about:blank] 13:55:42 INFO - --DOMWINDOW == 33 (0x7f4afd03d800) [pid = 2212] [serial = 1144] [outer = (nil)] [url = about:blank] 13:55:42 INFO - --DOMWINDOW == 32 (0x7f4afd3a4800) [pid = 2212] [serial = 1146] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597136-external-script-errors.html] 13:55:42 INFO - --DOMWINDOW == 31 (0x7f4afd948400) [pid = 2212] [serial = 1159] [outer = (nil)] [url = about:blank] 13:55:42 INFO - --DOMWINDOW == 30 (0x7f4afd03ac00) [pid = 2212] [serial = 1155] [outer = (nil)] [url = about:blank] 13:55:42 INFO - --DOMWINDOW == 29 (0x7f4afd041000) [pid = 2212] [serial = 1145] [outer = (nil)] [url = about:blank] 13:55:42 INFO - --DOMWINDOW == 28 (0x7f4afe0ad400) [pid = 2212] [serial = 1162] [outer = (nil)] [url = about:blank] 13:55:43 INFO - MEMORY STAT | vsize 1177MB | residentFast 308MB | heapAllocated 115MB 13:55:43 INFO - 238 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_597460_filter_scroll.js | took 8331ms 13:55:43 INFO - ++DOCSHELL 0x7f4afd5ab800 == 11 [pid = 2212] [id = 489] 13:55:43 INFO - ++DOMWINDOW == 29 (0x7f4afc862c00) [pid = 2212] [serial = 1167] [outer = (nil)] 13:55:43 INFO - ++DOMWINDOW == 30 (0x7f4afc868000) [pid = 2212] [serial = 1168] [outer = 0x7f4afc862c00] 13:55:43 INFO - 239 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_597756_reopen_closed_tab.js 13:55:43 INFO - ++DOCSHELL 0x7f4afdade800 == 12 [pid = 2212] [id = 490] 13:55:43 INFO - ++DOMWINDOW == 31 (0x7f4afd33a000) [pid = 2212] [serial = 1169] [outer = (nil)] 13:55:43 INFO - ++DOMWINDOW == 32 (0x7f4afd33dc00) [pid = 2212] [serial = 1170] [outer = 0x7f4afd33a000] 13:55:43 INFO - ++DOMWINDOW == 33 (0x7f4afe3e2000) [pid = 2212] [serial = 1171] [outer = 0x7f4afd33a000] 13:55:43 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html, line 15: ReferenceError: fooBug597756_error is not defined 13:55:43 INFO - ++DOCSHELL 0x7f4afd58e000 == 13 [pid = 2212] [id = 491] 13:55:43 INFO - ++DOMWINDOW == 34 (0x7f4afd944800) [pid = 2212] [serial = 1172] [outer = (nil)] 13:55:43 INFO - ++DOMWINDOW == 35 (0x7f4afd947000) [pid = 2212] [serial = 1173] [outer = 0x7f4afd944800] 13:55:44 INFO - ++DOMWINDOW == 36 (0x7f4afe009000) [pid = 2212] [serial = 1174] [outer = 0x7f4afd944800] 13:55:44 INFO - ++DOCSHELL 0x7f4afe397000 == 14 [pid = 2212] [id = 492] 13:55:44 INFO - ++DOMWINDOW == 37 (0x7f4afe1f4000) [pid = 2212] [serial = 1175] [outer = (nil)] 13:55:44 INFO - ++DOMWINDOW == 38 (0x7f4afe3d8000) [pid = 2212] [serial = 1176] [outer = 0x7f4afe1f4000] 13:55:46 INFO - ++DOMWINDOW == 39 (0x7f4afc727400) [pid = 2212] [serial = 1177] [outer = 0x7f4afd33a000] 13:55:46 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:55:47 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html, line 15: ReferenceError: fooBug597756_error is not defined 13:55:48 INFO - --DOCSHELL 0x7f4afdd9f800 == 13 [pid = 2212] [id = 485] 13:55:48 INFO - --DOCSHELL 0x7f4afd9aa000 == 12 [pid = 2212] [id = 486] 13:55:48 INFO - --DOCSHELL 0x7f4afd58e000 == 11 [pid = 2212] [id = 491] 13:55:48 INFO - --DOCSHELL 0x7f4afe397000 == 10 [pid = 2212] [id = 492] 13:55:48 INFO - --DOMWINDOW == 38 (0x7f4afe3e0c00) [pid = 2212] [serial = 1153] [outer = (nil)] [url = about:blank] 13:55:48 INFO - --DOMWINDOW == 37 (0x7f4afe0a9800) [pid = 2212] [serial = 1151] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:48 INFO - --DOMWINDOW == 36 (0x7f4afe816400) [pid = 2212] [serial = 1148] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597136-external-script-errors.html] 13:55:48 INFO - ++DOCSHELL 0x7f4afd5a1800 == 11 [pid = 2212] [id = 493] 13:55:48 INFO - ++DOMWINDOW == 37 (0x7f4afc725400) [pid = 2212] [serial = 1178] [outer = (nil)] 13:55:48 INFO - ++DOMWINDOW == 38 (0x7f4afc859c00) [pid = 2212] [serial = 1179] [outer = 0x7f4afc725400] 13:55:49 INFO - --DOMWINDOW == 37 (0x7f4afd3a4000) [pid = 2212] [serial = 1157] [outer = (nil)] [url = about:blank] 13:55:49 INFO - --DOMWINDOW == 36 (0x7f4afd33dc00) [pid = 2212] [serial = 1170] [outer = (nil)] [url = about:blank] 13:55:49 INFO - --DOMWINDOW == 35 (0x7f4afd947000) [pid = 2212] [serial = 1173] [outer = (nil)] [url = about:blank] 13:55:49 INFO - --DOMWINDOW == 34 (0x7f4afe54dc00) [pid = 2212] [serial = 1164] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:55:49 INFO - --DOMWINDOW == 33 (0x7f4afd94a400) [pid = 2212] [serial = 1161] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:49 INFO - --DOMWINDOW == 32 (0x7f4afd344400) [pid = 2212] [serial = 1156] [outer = (nil)] [url = about:blank] 13:55:49 INFO - --DOMWINDOW == 31 (0x7f4afd944c00) [pid = 2212] [serial = 1158] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html] 13:55:49 INFO - --DOMWINDOW == 30 (0x7f4afd951c00) [pid = 2212] [serial = 1160] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html] 13:55:49 INFO - --DOMWINDOW == 29 (0x7f4afe3d8c00) [pid = 2212] [serial = 1166] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html] 13:55:49 INFO - ++DOMWINDOW == 30 (0x7f4afd037400) [pid = 2212] [serial = 1180] [outer = 0x7f4afc725400] 13:55:49 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html, line 15: ReferenceError: fooBug597756_error is not defined 13:55:49 INFO - ++DOCSHELL 0x7f4afd9a9800 == 12 [pid = 2212] [id = 494] 13:55:49 INFO - ++DOMWINDOW == 31 (0x7f4afd33f800) [pid = 2212] [serial = 1181] [outer = (nil)] 13:55:49 INFO - ++DOMWINDOW == 32 (0x7f4afd342000) [pid = 2212] [serial = 1182] [outer = 0x7f4afd33f800] 13:55:49 INFO - ++DOMWINDOW == 33 (0x7f4afd3aa400) [pid = 2212] [serial = 1183] [outer = 0x7f4afd33f800] 13:55:49 INFO - ++DOCSHELL 0x7f4afe2be000 == 13 [pid = 2212] [id = 495] 13:55:49 INFO - ++DOMWINDOW == 34 (0x7f4afd950000) [pid = 2212] [serial = 1184] [outer = (nil)] 13:55:49 INFO - ++DOMWINDOW == 35 (0x7f4afe009400) [pid = 2212] [serial = 1185] [outer = 0x7f4afd950000] 13:55:51 INFO - ++DOMWINDOW == 36 (0x7f4afe8aa000) [pid = 2212] [serial = 1186] [outer = 0x7f4afc725400] 13:55:51 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:55:51 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html, line 15: ReferenceError: fooBug597756_error is not defined 13:55:52 INFO - --DOCSHELL 0x7f4afdade800 == 12 [pid = 2212] [id = 490] 13:55:52 INFO - --DOCSHELL 0x7f4afe2be000 == 11 [pid = 2212] [id = 495] 13:55:52 INFO - --DOMWINDOW == 35 (0x7f4afe3e2000) [pid = 2212] [serial = 1171] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html] 13:55:52 INFO - --DOMWINDOW == 34 (0x7f4afe573800) [pid = 2212] [serial = 1165] [outer = (nil)] [url = about:blank] 13:55:52 INFO - --DOMWINDOW == 33 (0x7f4afe3d6400) [pid = 2212] [serial = 1163] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:53 INFO - --DOMWINDOW == 32 (0x7f4afc859c00) [pid = 2212] [serial = 1179] [outer = (nil)] [url = about:blank] 13:55:53 INFO - --DOMWINDOW == 31 (0x7f4afd342000) [pid = 2212] [serial = 1182] [outer = (nil)] [url = about:blank] 13:55:53 INFO - --DOMWINDOW == 30 (0x7f4afd33a000) [pid = 2212] [serial = 1169] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html] 13:55:53 INFO - --DOMWINDOW == 29 (0x7f4afc727400) [pid = 2212] [serial = 1177] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html] 13:55:53 INFO - MEMORY STAT | vsize 1177MB | residentFast 300MB | heapAllocated 113MB 13:55:53 INFO - 240 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_597756_reopen_closed_tab.js | took 10115ms 13:55:53 INFO - ++DOCSHELL 0x7f4afd9af800 == 12 [pid = 2212] [id = 496] 13:55:53 INFO - ++DOMWINDOW == 30 (0x7f4afc863c00) [pid = 2212] [serial = 1187] [outer = (nil)] 13:55:53 INFO - ++DOMWINDOW == 31 (0x7f4afd039c00) [pid = 2212] [serial = 1188] [outer = 0x7f4afc863c00] 13:55:53 INFO - 241 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_599725_response_headers.js 13:55:53 INFO - ++DOCSHELL 0x7f4afdd9e800 == 13 [pid = 2212] [id = 497] 13:55:53 INFO - ++DOMWINDOW == 32 (0x7f4afd33c800) [pid = 2212] [serial = 1189] [outer = (nil)] 13:55:53 INFO - ++DOMWINDOW == 33 (0x7f4afd342c00) [pid = 2212] [serial = 1190] [outer = 0x7f4afd33c800] 13:55:54 INFO - ++DOCSHELL 0x7f4afd9a5000 == 14 [pid = 2212] [id = 498] 13:55:54 INFO - ++DOMWINDOW == 34 (0x7f4afd344000) [pid = 2212] [serial = 1191] [outer = (nil)] 13:55:54 INFO - ++DOMWINDOW == 35 (0x7f4afd3aa800) [pid = 2212] [serial = 1192] [outer = 0x7f4afd344000] 13:55:54 INFO - ++DOMWINDOW == 36 (0x7f4afd948c00) [pid = 2212] [serial = 1193] [outer = 0x7f4afd344000] 13:55:54 INFO - ++DOCSHELL 0x7f4afe38e800 == 15 [pid = 2212] [id = 499] 13:55:54 INFO - ++DOMWINDOW == 37 (0x7f4afe3e0000) [pid = 2212] [serial = 1194] [outer = (nil)] 13:55:54 INFO - ++DOMWINDOW == 38 (0x7f4afe3e2400) [pid = 2212] [serial = 1195] [outer = 0x7f4afe3e0000] 13:55:56 INFO - ++DOMWINDOW == 39 (0x7f4afe8ba400) [pid = 2212] [serial = 1196] [outer = 0x7f4afd33c800] 13:55:56 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:55:56 INFO - ++DOMWINDOW == 40 (0x7f4aff37fc00) [pid = 2212] [serial = 1197] [outer = 0x7f4afd33c800] 13:55:56 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:55:58 INFO - --DOCSHELL 0x7f4afd5a1800 == 14 [pid = 2212] [id = 493] 13:55:58 INFO - --DOCSHELL 0x7f4afd5ab800 == 13 [pid = 2212] [id = 489] 13:55:58 INFO - --DOCSHELL 0x7f4afd9a5000 == 12 [pid = 2212] [id = 498] 13:55:58 INFO - --DOCSHELL 0x7f4afd9a9800 == 11 [pid = 2212] [id = 494] 13:55:58 INFO - --DOCSHELL 0x7f4afe38e800 == 10 [pid = 2212] [id = 499] 13:55:58 INFO - --DOMWINDOW == 39 (0x7f4afd037400) [pid = 2212] [serial = 1180] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html] 13:55:58 INFO - --DOMWINDOW == 38 (0x7f4afe8ba400) [pid = 2212] [serial = 1196] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-599725-response-headers.sjs] 13:55:58 INFO - --DOMWINDOW == 37 (0x7f4afc868000) [pid = 2212] [serial = 1168] [outer = (nil)] [url = about:blank] 13:55:58 INFO - --DOMWINDOW == 36 (0x7f4afd3aa800) [pid = 2212] [serial = 1192] [outer = (nil)] [url = about:blank] 13:55:58 INFO - --DOMWINDOW == 35 (0x7f4afd33f800) [pid = 2212] [serial = 1181] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:58 INFO - --DOMWINDOW == 34 (0x7f4afe1f4000) [pid = 2212] [serial = 1175] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:55:58 INFO - --DOMWINDOW == 33 (0x7f4afd950000) [pid = 2212] [serial = 1184] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:55:58 INFO - --DOMWINDOW == 32 (0x7f4afd944800) [pid = 2212] [serial = 1172] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:55:58 INFO - --DOMWINDOW == 31 (0x7f4afc862c00) [pid = 2212] [serial = 1167] [outer = (nil)] [url = about:blank] 13:55:58 INFO - --DOMWINDOW == 30 (0x7f4afc725400) [pid = 2212] [serial = 1178] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html] 13:55:58 INFO - --DOMWINDOW == 29 (0x7f4afe8aa000) [pid = 2212] [serial = 1186] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-597756-reopen-closed-tab.html] 13:55:58 INFO - MEMORY STAT | vsize 1176MB | residentFast 300MB | heapAllocated 113MB 13:55:58 INFO - 242 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_599725_response_headers.js | took 5231ms 13:55:58 INFO - ++DOCSHELL 0x7f4afd9a3000 == 11 [pid = 2212] [id = 500] 13:55:58 INFO - ++DOMWINDOW == 30 (0x7f4afc867400) [pid = 2212] [serial = 1198] [outer = (nil)] 13:55:58 INFO - ++DOMWINDOW == 31 (0x7f4afd03e800) [pid = 2212] [serial = 1199] [outer = 0x7f4afc867400] 13:55:59 INFO - 243 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_600183_charset.js 13:55:59 INFO - ++DOCSHELL 0x7f4afdaeb800 == 12 [pid = 2212] [id = 501] 13:55:59 INFO - ++DOMWINDOW == 32 (0x7f4afd344400) [pid = 2212] [serial = 1200] [outer = (nil)] 13:55:59 INFO - ++DOMWINDOW == 33 (0x7f4afd3a4000) [pid = 2212] [serial = 1201] [outer = 0x7f4afd344400] 13:55:59 INFO - ++DOCSHELL 0x7f4afd5ab000 == 13 [pid = 2212] [id = 502] 13:55:59 INFO - ++DOMWINDOW == 34 (0x7f4afd3a5400) [pid = 2212] [serial = 1202] [outer = (nil)] 13:55:59 INFO - ++DOMWINDOW == 35 (0x7f4afd942c00) [pid = 2212] [serial = 1203] [outer = 0x7f4afd3a5400] 13:55:59 INFO - ++DOMWINDOW == 36 (0x7f4afe010c00) [pid = 2212] [serial = 1204] [outer = 0x7f4afd3a5400] 13:55:59 INFO - ++DOCSHELL 0x7f4afe397000 == 14 [pid = 2212] [id = 503] 13:55:59 INFO - ++DOMWINDOW == 37 (0x7f4afe3d9000) [pid = 2212] [serial = 1205] [outer = (nil)] 13:55:59 INFO - ++DOMWINDOW == 38 (0x7f4afe3de000) [pid = 2212] [serial = 1206] [outer = 0x7f4afe3d9000] 13:56:01 INFO - ++DOMWINDOW == 39 (0x7f4afe8c0800) [pid = 2212] [serial = 1207] [outer = 0x7f4afd344400] 13:56:01 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:56:03 INFO - --DOCSHELL 0x7f4afdd9e800 == 13 [pid = 2212] [id = 497] 13:56:03 INFO - --DOCSHELL 0x7f4afe397000 == 12 [pid = 2212] [id = 503] 13:56:03 INFO - --DOMWINDOW == 38 (0x7f4afd3aa400) [pid = 2212] [serial = 1183] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:56:03 INFO - --DOMWINDOW == 37 (0x7f4afe009400) [pid = 2212] [serial = 1185] [outer = (nil)] [url = about:blank] 13:56:03 INFO - --DOMWINDOW == 36 (0x7f4afe009000) [pid = 2212] [serial = 1174] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:56:03 INFO - --DOMWINDOW == 35 (0x7f4afe3d8000) [pid = 2212] [serial = 1176] [outer = (nil)] [url = about:blank] 13:56:03 INFO - --DOMWINDOW == 34 (0x7f4afd039c00) [pid = 2212] [serial = 1188] [outer = (nil)] [url = about:blank] 13:56:03 INFO - --DOMWINDOW == 33 (0x7f4afd342c00) [pid = 2212] [serial = 1190] [outer = (nil)] [url = about:blank] 13:56:03 INFO - --DOMWINDOW == 32 (0x7f4aff37fc00) [pid = 2212] [serial = 1197] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-599725-response-headers.sjs] 13:56:03 INFO - --DOMWINDOW == 31 (0x7f4afd942c00) [pid = 2212] [serial = 1203] [outer = (nil)] [url = about:blank] 13:56:03 INFO - --DOMWINDOW == 30 (0x7f4afd344000) [pid = 2212] [serial = 1191] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:56:03 INFO - --DOMWINDOW == 29 (0x7f4afe3e0000) [pid = 2212] [serial = 1194] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:56:03 INFO - --DOMWINDOW == 28 (0x7f4afc863c00) [pid = 2212] [serial = 1187] [outer = (nil)] [url = about:blank] 13:56:03 INFO - --DOMWINDOW == 27 (0x7f4afd33c800) [pid = 2212] [serial = 1189] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-599725-response-headers.sjs] 13:56:03 INFO - MEMORY STAT | vsize 1195MB | residentFast 304MB | heapAllocated 114MB 13:56:03 INFO - 244 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_600183_charset.js | took 4552ms 13:56:03 INFO - ++DOCSHELL 0x7f4afd9b2000 == 13 [pid = 2212] [id = 504] 13:56:03 INFO - ++DOMWINDOW == 28 (0x7f4afc864000) [pid = 2212] [serial = 1208] [outer = (nil)] 13:56:03 INFO - ++DOMWINDOW == 29 (0x7f4afd03b400) [pid = 2212] [serial = 1209] [outer = 0x7f4afc864000] 13:56:03 INFO - 245 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_601177_log_levels.js 13:56:03 INFO - ++DOCSHELL 0x7f4afddaf000 == 14 [pid = 2212] [id = 505] 13:56:03 INFO - ++DOMWINDOW == 30 (0x7f4afd341000) [pid = 2212] [serial = 1210] [outer = (nil)] 13:56:03 INFO - ++DOMWINDOW == 31 (0x7f4afd346400) [pid = 2212] [serial = 1211] [outer = 0x7f4afd341000] 13:56:04 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/tilt/tilt.js, line 263: ReferenceError: reference to undefined property this.visualizers[this.currentWindowId] 13:56:04 INFO - ++DOCSHELL 0x7f4afddb9800 == 15 [pid = 2212] [id = 506] 13:56:04 INFO - ++DOMWINDOW == 32 (0x7f4afd347400) [pid = 2212] [serial = 1212] [outer = (nil)] 13:56:04 INFO - ++DOMWINDOW == 33 (0x7f4afd3b0400) [pid = 2212] [serial = 1213] [outer = 0x7f4afd347400] 13:56:04 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/client/main.js, line 949: ReferenceError: reference to undefined property aPacket.type 13:56:04 INFO - ++DOMWINDOW == 34 (0x7f4afd94d800) [pid = 2212] [serial = 1214] [outer = 0x7f4afd347400] 13:56:04 INFO - ++DOCSHELL 0x7f4afe39c000 == 16 [pid = 2212] [id = 507] 13:56:04 INFO - ++DOMWINDOW == 35 (0x7f4afe009400) [pid = 2212] [serial = 1215] [outer = (nil)] 13:56:04 INFO - ++DOMWINDOW == 36 (0x7f4afe00dc00) [pid = 2212] [serial = 1216] [outer = 0x7f4afe009400] 13:56:04 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/gcli/source/lib/gcli/settings.js, line 185: ReferenceError: reference to undefined property prefSpec.ignoreTypeDifference 13:56:04 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/gcli/source/lib/gcli/commands/commands.js, line 293: ReferenceError: reference to undefined property this.paramSpec.manual 13:56:05 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/gcli/source/lib/gcli/system.js, line 366: ReferenceError: reference to undefined property command.front 13:56:05 INFO - JavaScript strict warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/toolbox.js, line 329: ReferenceError: reference to undefined property this._splitConsole 13:56:06 INFO - ++DOMWINDOW == 37 (0x7f4afd03d800) [pid = 2212] [serial = 1217] [outer = 0x7f4afd341000] 13:56:06 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:56:06 INFO - JavaScript strict warning: chrome://mochikit/content/tests/SimpleTest/TestRunner.js, line 237: ReferenceError: reference to undefined property message.level 13:56:06 INFO - JavaScript strict warning: http://example.com/browser/devtools/client/webconsole/test/test-bug-601177-log-levels.js, line 6: ReferenceError: assignment to undeclared variable foobarBug601177strictError 13:56:06 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-601177-log-levels.js, line 8: TypeError: window.foobarBug601177exception is not a function 13:56:07 INFO - [2212] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 13:56:07 INFO - JavaScript strict warning: http://example.com/browser/devtools/client/webconsole/test/test-bug-601177-log-levels.html, line 8: ReferenceError: reference to undefined property window.undefinedPropertyBug601177 13:56:07 INFO - [2212] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 13:56:08 INFO - --DOCSHELL 0x7f4afd9a3000 == 15 [pid = 2212] [id = 500] 13:56:08 INFO - --DOCSHELL 0x7f4afd9af800 == 14 [pid = 2212] [id = 496] 13:56:08 INFO - --DOCSHELL 0x7f4afd5ab000 == 13 [pid = 2212] [id = 502] 13:56:08 INFO - --DOCSHELL 0x7f4afddb9800 == 12 [pid = 2212] [id = 506] 13:56:08 INFO - --DOCSHELL 0x7f4afe39c000 == 11 [pid = 2212] [id = 507] 13:56:08 INFO - --DOCSHELL 0x7f4afdaeb800 == 10 [pid = 2212] [id = 501] 13:56:08 INFO - --DOMWINDOW == 36 (0x7f4afd948c00) [pid = 2212] [serial = 1193] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:56:08 INFO - --DOMWINDOW == 35 (0x7f4afe3e2400) [pid = 2212] [serial = 1195] [outer = (nil)] [url = about:blank] 13:56:09 INFO - --DOMWINDOW == 34 (0x7f4afd3a4000) [pid = 2212] [serial = 1201] [outer = (nil)] [url = about:blank] 13:56:09 INFO - --DOMWINDOW == 33 (0x7f4afd03e800) [pid = 2212] [serial = 1199] [outer = (nil)] [url = about:blank] 13:56:09 INFO - --DOMWINDOW == 32 (0x7f4afd3b0400) [pid = 2212] [serial = 1213] [outer = (nil)] [url = about:blank] 13:56:09 INFO - --DOMWINDOW == 31 (0x7f4afd3a5400) [pid = 2212] [serial = 1202] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:56:09 INFO - --DOMWINDOW == 30 (0x7f4afe3d9000) [pid = 2212] [serial = 1205] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:56:09 INFO - --DOMWINDOW == 29 (0x7f4afd344400) [pid = 2212] [serial = 1200] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-600183-charset.html] 13:56:09 INFO - --DOMWINDOW == 28 (0x7f4afc867400) [pid = 2212] [serial = 1198] [outer = (nil)] [url = about:blank] 13:56:09 INFO - --DOMWINDOW == 27 (0x7f4afe8c0800) [pid = 2212] [serial = 1207] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-600183-charset.html] 13:56:09 INFO - MEMORY STAT | vsize 1196MB | residentFast 303MB | heapAllocated 114MB 13:56:09 INFO - 246 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_601177_log_levels.js | took 5435ms 13:56:09 INFO - ++DOCSHELL 0x7f4afd5a1000 == 11 [pid = 2212] [id = 508] 13:56:09 INFO - ++DOMWINDOW == 28 (0x7f4afc861000) [pid = 2212] [serial = 1218] [outer = (nil)] 13:56:09 INFO - ++DOMWINDOW == 29 (0x7f4afd034c00) [pid = 2212] [serial = 1219] [outer = 0x7f4afc861000] 13:56:09 INFO - 247 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_601352_scroll.js 13:56:09 INFO - ++DOCSHELL 0x7f4afdda8000 == 12 [pid = 2212] [id = 509] 13:56:09 INFO - ++DOMWINDOW == 30 (0x7f4afd33b800) [pid = 2212] [serial = 1220] [outer = (nil)] 13:56:09 INFO - ++DOMWINDOW == 31 (0x7f4afd33f800) [pid = 2212] [serial = 1221] [outer = 0x7f4afd33b800] 13:56:09 INFO - ++DOCSHELL 0x7f4afd58d800 == 13 [pid = 2212] [id = 510] 13:56:09 INFO - ++DOMWINDOW == 32 (0x7f4afd340800) [pid = 2212] [serial = 1222] [outer = (nil)] 13:56:09 INFO - ++DOMWINDOW == 33 (0x7f4afd3ac800) [pid = 2212] [serial = 1223] [outer = 0x7f4afd340800] 13:56:10 INFO - ++DOMWINDOW == 34 (0x7f4afd947400) [pid = 2212] [serial = 1224] [outer = 0x7f4afd340800] 13:56:10 INFO - ++DOCSHELL 0x7f4afe39c000 == 14 [pid = 2212] [id = 511] 13:56:10 INFO - ++DOMWINDOW == 35 (0x7f4afe0afc00) [pid = 2212] [serial = 1225] [outer = (nil)] 13:56:10 INFO - ++DOMWINDOW == 36 (0x7f4afe0b4c00) [pid = 2212] [serial = 1226] [outer = 0x7f4afe0afc00] 13:56:13 INFO - console.debug: 13:56:13 INFO - rectNode 13:56:13 INFO - DOMRect 13:56:13 INFO - - prototype DOMRect 13:56:13 INFO - - height = 20 13:56:13 INFO - - width = 7862.33349609375 13:56:13 INFO - - x = 0 13:56:13 INFO - - y = 173 13:56:13 INFO - - prototype DOMRectReadOnly 13:56:13 INFO - - bottom = 193 13:56:13 INFO - - left = 0 13:56:13 INFO - - right = 7862.33349609375 13:56:13 INFO - - top = 173 13:56:13 INFO - - prototype Object 13:56:13 INFO - rectOutput 13:56:13 INFO - DOMRect 13:56:13 INFO - - prototype DOMRect 13:56:13 INFO - - height = 182 13:56:13 INFO - - width = 1151 13:56:13 INFO - - x = 0 13:56:13 INFO - - y = 24 13:56:13 INFO - - prototype DOMRectReadOnly 13:56:13 INFO - - bottom = 206 13:56:13 INFO - - left = 0 13:56:13 INFO - - right = 1151 13:56:13 INFO - - top = 24 13:56:13 INFO - - prototype Object 13:56:13 INFO - console.log: scrollNode scrollHeight 2060 scrollTop 1891 clientHeight 169 13:56:14 INFO - --DOCSHELL 0x7f4afddaf000 == 13 [pid = 2212] [id = 505] 13:56:14 INFO - --DOCSHELL 0x7f4afd9b2000 == 12 [pid = 2212] [id = 504] 13:56:14 INFO - --DOCSHELL 0x7f4afd58d800 == 11 [pid = 2212] [id = 510] 13:56:14 INFO - --DOCSHELL 0x7f4afe39c000 == 10 [pid = 2212] [id = 511] 13:56:14 INFO - --DOMWINDOW == 35 (0x7f4afe010c00) [pid = 2212] [serial = 1204] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:56:14 INFO - --DOMWINDOW == 34 (0x7f4afe3de000) [pid = 2212] [serial = 1206] [outer = (nil)] [url = about:blank] 13:56:14 INFO - --DOMWINDOW == 33 (0x7f4afc864000) [pid = 2212] [serial = 1208] [outer = (nil)] [url = about:blank] 13:56:14 INFO - --DOMWINDOW == 32 (0x7f4afd341000) [pid = 2212] [serial = 1210] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-601177-log-levels.html] 13:56:14 INFO - --DOMWINDOW == 31 (0x7f4afd3ac800) [pid = 2212] [serial = 1223] [outer = (nil)] [url = about:blank] 13:56:14 INFO - --DOMWINDOW == 30 (0x7f4afd347400) [pid = 2212] [serial = 1212] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:56:14 INFO - --DOMWINDOW == 29 (0x7f4afe009400) [pid = 2212] [serial = 1215] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:56:14 INFO - --DOMWINDOW == 28 (0x7f4afd03b400) [pid = 2212] [serial = 1209] [outer = (nil)] [url = about:blank] 13:56:14 INFO - --DOMWINDOW == 27 (0x7f4afd346400) [pid = 2212] [serial = 1211] [outer = (nil)] [url = about:blank] 13:56:15 INFO - --DOMWINDOW == 26 (0x7f4afd03d800) [pid = 2212] [serial = 1217] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-601177-log-levels.html] 13:56:15 INFO - MEMORY STAT | vsize 1193MB | residentFast 299MB | heapAllocated 115MB 13:56:15 INFO - 248 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_601352_scroll.js | took 5646ms 13:56:15 INFO - ++DOCSHELL 0x7f4afd9b2000 == 11 [pid = 2212] [id = 512] 13:56:15 INFO - ++DOMWINDOW == 27 (0x7f4afd032400) [pid = 2212] [serial = 1227] [outer = (nil)] 13:56:15 INFO - ++DOMWINDOW == 28 (0x7f4afd03e800) [pid = 2212] [serial = 1228] [outer = 0x7f4afd032400] 13:56:15 INFO - 249 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_601667_filter_buttons.js 13:56:15 INFO - ++DOCSHELL 0x7f4afdda5800 == 12 [pid = 2212] [id = 513] 13:56:15 INFO - ++DOMWINDOW == 29 (0x7f4afd342000) [pid = 2212] [serial = 1229] [outer = (nil)] 13:56:15 INFO - ++DOMWINDOW == 30 (0x7f4afd346000) [pid = 2212] [serial = 1230] [outer = 0x7f4afd342000] 13:56:15 INFO - ++DOMWINDOW == 31 (0x7f4afd3ac400) [pid = 2212] [serial = 1231] [outer = 0x7f4afd342000] 13:56:16 INFO - ++DOCSHELL 0x7f4afd597800 == 13 [pid = 2212] [id = 514] 13:56:16 INFO - ++DOMWINDOW == 32 (0x7f4afd347400) [pid = 2212] [serial = 1232] [outer = (nil)] 13:56:16 INFO - ++DOMWINDOW == 33 (0x7f4afd949c00) [pid = 2212] [serial = 1233] [outer = 0x7f4afd347400] 13:56:16 INFO - ++DOMWINDOW == 34 (0x7f4afe013800) [pid = 2212] [serial = 1234] [outer = 0x7f4afd347400] 13:56:16 INFO - ++DOCSHELL 0x7f4afe3ad800 == 14 [pid = 2212] [id = 515] 13:56:16 INFO - ++DOMWINDOW == 35 (0x7f4afe3e3400) [pid = 2212] [serial = 1235] [outer = (nil)] 13:56:16 INFO - ++DOMWINDOW == 36 (0x7f4afe4be000) [pid = 2212] [serial = 1236] [outer = 0x7f4afe3e3400] 13:56:21 INFO - --DOCSHELL 0x7f4afd5a1000 == 13 [pid = 2212] [id = 508] 13:56:21 INFO - --DOCSHELL 0x7f4afdda8000 == 12 [pid = 2212] [id = 509] 13:56:21 INFO - --DOCSHELL 0x7f4afd597800 == 11 [pid = 2212] [id = 514] 13:56:21 INFO - --DOCSHELL 0x7f4afe3ad800 == 10 [pid = 2212] [id = 515] 13:56:21 INFO - --DOMWINDOW == 35 (0x7f4afe00dc00) [pid = 2212] [serial = 1216] [outer = (nil)] [url = about:blank] 13:56:21 INFO - --DOMWINDOW == 34 (0x7f4afd94d800) [pid = 2212] [serial = 1214] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:56:21 INFO - --DOMWINDOW == 33 (0x7f4afe3e3400) [pid = 2212] [serial = 1235] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:56:21 INFO - --DOMWINDOW == 32 (0x7f4afd949c00) [pid = 2212] [serial = 1233] [outer = (nil)] [url = about:blank] 13:56:21 INFO - --DOMWINDOW == 31 (0x7f4afd034c00) [pid = 2212] [serial = 1219] [outer = (nil)] [url = about:blank] 13:56:21 INFO - --DOMWINDOW == 30 (0x7f4afd33f800) [pid = 2212] [serial = 1221] [outer = (nil)] [url = about:blank] 13:56:21 INFO - --DOMWINDOW == 29 (0x7f4afd346000) [pid = 2212] [serial = 1230] [outer = (nil)] [url = about:blank] 13:56:21 INFO - --DOMWINDOW == 28 (0x7f4afc861000) [pid = 2212] [serial = 1218] [outer = (nil)] [url = about:blank] 13:56:21 INFO - --DOMWINDOW == 27 (0x7f4afd33b800) [pid = 2212] [serial = 1220] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20601352] 13:56:21 INFO - MEMORY STAT | vsize 1191MB | residentFast 298MB | heapAllocated 114MB 13:56:21 INFO - 250 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_601667_filter_buttons.js | took 6409ms 13:56:21 INFO - ++DOCSHELL 0x7f4afd9a5800 == 11 [pid = 2212] [id = 516] 13:56:21 INFO - ++DOMWINDOW == 28 (0x7f4afc85e400) [pid = 2212] [serial = 1237] [outer = (nil)] 13:56:21 INFO - ++DOMWINDOW == 29 (0x7f4afd032800) [pid = 2212] [serial = 1238] [outer = 0x7f4afc85e400] 13:56:22 INFO - 251 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_603750_websocket.js 13:56:22 INFO - ++DOCSHELL 0x7f4afdd9c800 == 12 [pid = 2212] [id = 517] 13:56:22 INFO - ++DOMWINDOW == 30 (0x7f4afd33b400) [pid = 2212] [serial = 1239] [outer = (nil)] 13:56:22 INFO - ++DOMWINDOW == 31 (0x7f4afd33f800) [pid = 2212] [serial = 1240] [outer = 0x7f4afd33b400] 13:56:22 INFO - ++DOCSHELL 0x7f4afd9ab000 == 13 [pid = 2212] [id = 518] 13:56:22 INFO - ++DOMWINDOW == 32 (0x7f4afd341000) [pid = 2212] [serial = 1241] [outer = (nil)] 13:56:22 INFO - ++DOMWINDOW == 33 (0x7f4afd3ad000) [pid = 2212] [serial = 1242] [outer = 0x7f4afd341000] 13:56:22 INFO - ++DOMWINDOW == 34 (0x7f4afd94c800) [pid = 2212] [serial = 1243] [outer = 0x7f4afd341000] 13:56:22 INFO - ++DOCSHELL 0x7f4afe399800 == 14 [pid = 2212] [id = 519] 13:56:22 INFO - ++DOMWINDOW == 35 (0x7f4afe1f2000) [pid = 2212] [serial = 1244] [outer = (nil)] 13:56:22 INFO - ++DOMWINDOW == 36 (0x7f4afe3d6800) [pid = 2212] [serial = 1245] [outer = 0x7f4afe1f2000] 13:56:24 INFO - ++DOMWINDOW == 37 (0x7f4b012dc400) [pid = 2212] [serial = 1246] [outer = 0x7f4afd33b400] 13:56:24 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:56:24 INFO - ++DOCSHELL 0x7f4aff274800 == 15 [pid = 2212] [id = 520] 13:56:24 INFO - ++DOMWINDOW == 38 (0x7f4afe8c1400) [pid = 2212] [serial = 1247] [outer = (nil)] 13:56:24 INFO - ++DOMWINDOW == 39 (0x7f4afc726400) [pid = 2212] [serial = 1248] [outer = 0x7f4afe8c1400] 13:56:26 INFO - --DOCSHELL 0x7f4afd9b2000 == 14 [pid = 2212] [id = 512] 13:56:26 INFO - --DOCSHELL 0x7f4afd9ab000 == 13 [pid = 2212] [id = 518] 13:56:26 INFO - --DOCSHELL 0x7f4afdda5800 == 12 [pid = 2212] [id = 513] 13:56:26 INFO - --DOCSHELL 0x7f4afe399800 == 11 [pid = 2212] [id = 519] 13:56:26 INFO - --DOMWINDOW == 38 (0x7f4afe4be000) [pid = 2212] [serial = 1236] [outer = (nil)] [url = about:blank] 13:56:26 INFO - --DOMWINDOW == 37 (0x7f4afd3ad000) [pid = 2212] [serial = 1242] [outer = (nil)] [url = about:blank] 13:56:26 INFO - --DOMWINDOW == 36 (0x7f4afd3ac400) [pid = 2212] [serial = 1231] [outer = (nil)] [url = http://example.com/] 13:56:26 INFO - --DOMWINDOW == 35 (0x7f4afd03e800) [pid = 2212] [serial = 1228] [outer = (nil)] [url = about:blank] 13:56:26 INFO - --DOMWINDOW == 34 (0x7f4afd347400) [pid = 2212] [serial = 1232] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:56:26 INFO - --DOMWINDOW == 33 (0x7f4afd342000) [pid = 2212] [serial = 1229] [outer = (nil)] [url = http://example.com/] 13:56:26 INFO - --DOMWINDOW == 32 (0x7f4afd032400) [pid = 2212] [serial = 1227] [outer = (nil)] [url = about:blank] 13:56:26 INFO - --DOCSHELL 0x7f4aff274800 == 10 [pid = 2212] [id = 520] 13:56:27 INFO - MEMORY STAT | vsize 1191MB | residentFast 299MB | heapAllocated 114MB 13:56:27 INFO - 252 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_603750_websocket.js | took 5102ms 13:56:27 INFO - ++DOCSHELL 0x7f4afd9a5000 == 11 [pid = 2212] [id = 521] 13:56:27 INFO - ++DOMWINDOW == 33 (0x7f4afc866000) [pid = 2212] [serial = 1249] [outer = (nil)] 13:56:27 INFO - ++DOMWINDOW == 34 (0x7f4afd03a400) [pid = 2212] [serial = 1250] [outer = 0x7f4afc866000] 13:56:27 INFO - 253 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_611795.js 13:56:27 INFO - ++DOCSHELL 0x7f4afddab000 == 12 [pid = 2212] [id = 522] 13:56:27 INFO - ++DOMWINDOW == 35 (0x7f4afd341400) [pid = 2212] [serial = 1251] [outer = (nil)] 13:56:27 INFO - ++DOMWINDOW == 36 (0x7f4afd344000) [pid = 2212] [serial = 1252] [outer = 0x7f4afd341400] 13:56:27 INFO - ++DOCSHELL 0x7f4afd595800 == 13 [pid = 2212] [id = 523] 13:56:27 INFO - ++DOMWINDOW == 37 (0x7f4afd346000) [pid = 2212] [serial = 1253] [outer = (nil)] 13:56:27 INFO - ++DOMWINDOW == 38 (0x7f4afd942800) [pid = 2212] [serial = 1254] [outer = 0x7f4afd346000] 13:56:27 INFO - ++DOMWINDOW == 39 (0x7f4afe009000) [pid = 2212] [serial = 1255] [outer = 0x7f4afd346000] 13:56:28 INFO - ++DOCSHELL 0x7f4afe3a7800 == 14 [pid = 2212] [id = 524] 13:56:28 INFO - ++DOMWINDOW == 40 (0x7f4afe3d5c00) [pid = 2212] [serial = 1256] [outer = (nil)] 13:56:28 INFO - ++DOMWINDOW == 41 (0x7f4afe3d8400) [pid = 2212] [serial = 1257] [outer = 0x7f4afe3d5c00] 13:56:29 INFO - ++DOMWINDOW == 42 (0x7f4afe8ba400) [pid = 2212] [serial = 1258] [outer = 0x7f4afd341400] 13:56:31 INFO - --DOCSHELL 0x7f4afdd9c800 == 13 [pid = 2212] [id = 517] 13:56:31 INFO - --DOCSHELL 0x7f4afe3a7800 == 12 [pid = 2212] [id = 524] 13:56:31 INFO - --DOMWINDOW == 41 (0x7f4afe013800) [pid = 2212] [serial = 1234] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:56:31 INFO - --DOMWINDOW == 40 (0x7f4afd032800) [pid = 2212] [serial = 1238] [outer = (nil)] [url = about:blank] 13:56:31 INFO - --DOMWINDOW == 39 (0x7f4afd33f800) [pid = 2212] [serial = 1240] [outer = (nil)] [url = about:blank] 13:56:31 INFO - --DOMWINDOW == 38 (0x7f4afc726400) [pid = 2212] [serial = 1248] [outer = (nil)] [url = about:blank] 13:56:31 INFO - --DOMWINDOW == 37 (0x7f4afd344000) [pid = 2212] [serial = 1252] [outer = (nil)] [url = about:blank] 13:56:31 INFO - --DOMWINDOW == 36 (0x7f4afd942800) [pid = 2212] [serial = 1254] [outer = (nil)] [url = about:blank] 13:56:31 INFO - --DOMWINDOW == 35 (0x7f4afe1f2000) [pid = 2212] [serial = 1244] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:56:31 INFO - --DOMWINDOW == 34 (0x7f4afd341000) [pid = 2212] [serial = 1241] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:56:31 INFO - --DOMWINDOW == 33 (0x7f4afc85e400) [pid = 2212] [serial = 1237] [outer = (nil)] [url = about:blank] 13:56:31 INFO - --DOMWINDOW == 32 (0x7f4afd33b400) [pid = 2212] [serial = 1239] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-603750-websocket.html] 13:56:31 INFO - --DOMWINDOW == 31 (0x7f4afe8c1400) [pid = 2212] [serial = 1247] [outer = (nil)] [url = data:text/html;charset=utf-8,hello%20world!] 13:56:31 INFO - --DOMWINDOW == 30 (0x7f4b012dc400) [pid = 2212] [serial = 1246] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-603750-websocket.html] 13:56:31 INFO - MEMORY STAT | vsize 1185MB | residentFast 301MB | heapAllocated 115MB 13:56:31 INFO - 254 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_611795.js | took 4517ms 13:56:31 INFO - ++DOCSHELL 0x7f4afdad2000 == 13 [pid = 2212] [id = 525] 13:56:31 INFO - ++DOMWINDOW == 31 (0x7f4afc864400) [pid = 2212] [serial = 1259] [outer = (nil)] 13:56:31 INFO - ++DOMWINDOW == 32 (0x7f4afd039000) [pid = 2212] [serial = 1260] [outer = 0x7f4afc864400] 13:56:32 INFO - 255 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_613013_console_api_iframe.js 13:56:32 INFO - ++DOCSHELL 0x7f4afddb4000 == 14 [pid = 2212] [id = 526] 13:56:32 INFO - ++DOMWINDOW == 33 (0x7f4afd341800) [pid = 2212] [serial = 1261] [outer = (nil)] 13:56:32 INFO - ++DOMWINDOW == 34 (0x7f4afd345800) [pid = 2212] [serial = 1262] [outer = 0x7f4afd341800] 13:56:32 INFO - ++DOMWINDOW == 35 (0x7f4afd3ac800) [pid = 2212] [serial = 1263] [outer = 0x7f4afd341800] 13:56:32 INFO - ++DOCSHELL 0x7f4afe2d8800 == 15 [pid = 2212] [id = 527] 13:56:32 INFO - ++DOMWINDOW == 36 (0x7f4afd3b2c00) [pid = 2212] [serial = 1264] [outer = (nil)] 13:56:32 INFO - ++DOMWINDOW == 37 (0x7f4afd3b2000) [pid = 2212] [serial = 1265] [outer = 0x7f4afd3b2c00] 13:56:32 INFO - ++DOCSHELL 0x7f4afd9a1800 == 16 [pid = 2212] [id = 528] 13:56:32 INFO - ++DOMWINDOW == 38 (0x7f4afe008800) [pid = 2212] [serial = 1266] [outer = (nil)] 13:56:32 INFO - ++DOMWINDOW == 39 (0x7f4afe00b000) [pid = 2212] [serial = 1267] [outer = 0x7f4afe008800] 13:56:32 INFO - ++DOMWINDOW == 40 (0x7f4afe0ae000) [pid = 2212] [serial = 1268] [outer = 0x7f4afe008800] 13:56:33 INFO - ++DOCSHELL 0x7f4afe84a800 == 17 [pid = 2212] [id = 529] 13:56:33 INFO - ++DOMWINDOW == 41 (0x7f4afe57e400) [pid = 2212] [serial = 1269] [outer = (nil)] 13:56:33 INFO - ++DOMWINDOW == 42 (0x7f4afe815c00) [pid = 2212] [serial = 1270] [outer = 0x7f4afe57e400] 13:56:35 INFO - ++DOMWINDOW == 43 (0x7f4afd339000) [pid = 2212] [serial = 1271] [outer = 0x7f4afd341800] 13:56:35 INFO - ++DOCSHELL 0x7f4afe39d800 == 18 [pid = 2212] [id = 530] 13:56:35 INFO - ++DOMWINDOW == 44 (0x7f4afe008c00) [pid = 2212] [serial = 1272] [outer = (nil)] 13:56:35 INFO - [2212] WARNING: No inner window available!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 9211 13:56:36 INFO - --DOCSHELL 0x7f4afd9a5800 == 17 [pid = 2212] [id = 516] 13:56:36 INFO - --DOCSHELL 0x7f4afd9a5000 == 16 [pid = 2212] [id = 521] 13:56:36 INFO - --DOCSHELL 0x7f4afd595800 == 15 [pid = 2212] [id = 523] 13:56:36 INFO - --DOCSHELL 0x7f4afddab000 == 14 [pid = 2212] [id = 522] 13:56:36 INFO - --DOCSHELL 0x7f4afd9a1800 == 13 [pid = 2212] [id = 528] 13:56:36 INFO - --DOCSHELL 0x7f4afe84a800 == 12 [pid = 2212] [id = 529] 13:56:36 INFO - --DOMWINDOW == 43 (0x7f4afe3d6800) [pid = 2212] [serial = 1245] [outer = (nil)] [url = about:blank] 13:56:36 INFO - --DOMWINDOW == 42 (0x7f4afd94c800) [pid = 2212] [serial = 1243] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:56:36 INFO - ++DOMWINDOW == 43 (0x7f4afc71ec00) [pid = 2212] [serial = 1273] [outer = 0x7f4afe008c00] 13:56:36 INFO - --DOMWINDOW == 42 (0x7f4afe00b000) [pid = 2212] [serial = 1267] [outer = (nil)] [url = about:blank] 13:56:36 INFO - --DOMWINDOW == 41 (0x7f4afd345800) [pid = 2212] [serial = 1262] [outer = (nil)] [url = about:blank] 13:56:36 INFO - --DOMWINDOW == 40 (0x7f4afe8ba400) [pid = 2212] [serial = 1258] [outer = (nil)] [url = data:text/html;charset=utf-8,<div%20style="-moz-opacity:0;">test%20repeated%20css%20warnings</div><p%20style="-moz-opacity:0">hi</p>] 13:56:36 INFO - --DOMWINDOW == 39 (0x7f4afd03a400) [pid = 2212] [serial = 1250] [outer = (nil)] [url = about:blank] 13:56:36 INFO - --DOMWINDOW == 38 (0x7f4afd346000) [pid = 2212] [serial = 1253] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:56:36 INFO - --DOMWINDOW == 37 (0x7f4afe3d5c00) [pid = 2212] [serial = 1256] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:56:36 INFO - --DOMWINDOW == 36 (0x7f4afd341400) [pid = 2212] [serial = 1251] [outer = (nil)] [url = data:text/html;charset=utf-8,<div%20style="-moz-opacity:0;">test%20repeated%20css%20warnings</div><p%20style="-moz-opacity:0">hi</p>] 13:56:36 INFO - --DOMWINDOW == 35 (0x7f4afc866000) [pid = 2212] [serial = 1249] [outer = (nil)] [url = about:blank] 13:56:36 INFO - --DOCSHELL 0x7f4afe2d8800 == 11 [pid = 2212] [id = 527] 13:56:36 INFO - MEMORY STAT | vsize 1185MB | residentFast 301MB | heapAllocated 115MB 13:56:36 INFO - 256 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_613013_console_api_iframe.js | took 4755ms 13:56:36 INFO - ++DOCSHELL 0x7f4afd9b4000 == 12 [pid = 2212] [id = 531] 13:56:36 INFO - ++DOMWINDOW == 36 (0x7f4afc864000) [pid = 2212] [serial = 1274] [outer = (nil)] 13:56:36 INFO - ++DOMWINDOW == 37 (0x7f4afd035800) [pid = 2212] [serial = 1275] [outer = 0x7f4afc864000] 13:56:37 INFO - 257 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_613280_jsterm_copy.js 13:56:37 INFO - ++DOCSHELL 0x7f4afe2bb800 == 13 [pid = 2212] [id = 532] 13:56:37 INFO - ++DOMWINDOW == 38 (0x7f4afd341000) [pid = 2212] [serial = 1276] [outer = (nil)] 13:56:37 INFO - ++DOMWINDOW == 39 (0x7f4afd345800) [pid = 2212] [serial = 1277] [outer = 0x7f4afd341000] 13:56:37 INFO - ++DOCSHELL 0x7f4afe2c9800 == 14 [pid = 2212] [id = 533] 13:56:37 INFO - ++DOMWINDOW == 40 (0x7f4afd946c00) [pid = 2212] [serial = 1278] [outer = (nil)] 13:56:37 INFO - ++DOMWINDOW == 41 (0x7f4afd947c00) [pid = 2212] [serial = 1279] [outer = 0x7f4afd946c00] 13:56:37 INFO - ++DOMWINDOW == 42 (0x7f4afe00ec00) [pid = 2212] [serial = 1280] [outer = 0x7f4afd946c00] 13:56:37 INFO - ++DOCSHELL 0x7f4afe4f2000 == 15 [pid = 2212] [id = 534] 13:56:37 INFO - ++DOMWINDOW == 43 (0x7f4afe3dd800) [pid = 2212] [serial = 1281] [outer = (nil)] 13:56:37 INFO - ++DOMWINDOW == 44 (0x7f4afe3e0800) [pid = 2212] [serial = 1282] [outer = 0x7f4afe3dd800] 13:56:40 INFO - --DOCSHELL 0x7f4afe39d800 == 14 [pid = 2212] [id = 530] 13:56:40 INFO - --DOCSHELL 0x7f4afddb4000 == 13 [pid = 2212] [id = 526] 13:56:40 INFO - --DOCSHELL 0x7f4afe4f2000 == 12 [pid = 2212] [id = 534] 13:56:40 INFO - --DOMWINDOW == 43 (0x7f4afe009000) [pid = 2212] [serial = 1255] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:56:40 INFO - --DOMWINDOW == 42 (0x7f4afe3d8400) [pid = 2212] [serial = 1257] [outer = (nil)] [url = about:blank] 13:56:40 INFO - --DOMWINDOW == 41 (0x7f4afd947c00) [pid = 2212] [serial = 1279] [outer = (nil)] [url = about:blank] 13:56:40 INFO - --DOMWINDOW == 40 (0x7f4afd039000) [pid = 2212] [serial = 1260] [outer = (nil)] [url = about:blank] 13:56:40 INFO - --DOMWINDOW == 39 (0x7f4afc71ec00) [pid = 2212] [serial = 1273] [outer = (nil)] [url = data:text/html;charset=utf-8,little%20iframe] 13:56:40 INFO - --DOMWINDOW == 38 (0x7f4afd3b2000) [pid = 2212] [serial = 1265] [outer = (nil)] [url = data:text/html;charset=utf-8,little%20iframe] 13:56:40 INFO - --DOMWINDOW == 37 (0x7f4afe008800) [pid = 2212] [serial = 1266] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:56:40 INFO - --DOMWINDOW == 36 (0x7f4afe57e400) [pid = 2212] [serial = 1269] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:56:40 INFO - --DOMWINDOW == 35 (0x7f4afc864400) [pid = 2212] [serial = 1259] [outer = (nil)] [url = about:blank] 13:56:40 INFO - --DOMWINDOW == 34 (0x7f4afe008c00) [pid = 2212] [serial = 1272] [outer = (nil)] [url = data:text/html;charset=utf-8,little%20iframe] 13:56:40 INFO - --DOMWINDOW == 33 (0x7f4afd341800) [pid = 2212] [serial = 1261] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-613013-console-api-iframe.html] 13:56:40 INFO - --DOMWINDOW == 32 (0x7f4afd3b2c00) [pid = 2212] [serial = 1264] [outer = (nil)] [url = data:text/html;charset=utf-8,little%20iframe] 13:56:40 INFO - --DOMWINDOW == 31 (0x7f4afd3ac800) [pid = 2212] [serial = 1263] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-613013-console-api-iframe.html] 13:56:40 INFO - --DOMWINDOW == 30 (0x7f4afd339000) [pid = 2212] [serial = 1271] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-613013-console-api-iframe.html] 13:56:41 INFO - MEMORY STAT | vsize 1186MB | residentFast 302MB | heapAllocated 114MB 13:56:41 INFO - 258 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_613280_jsterm_copy.js | took 3961ms 13:56:41 INFO - ++DOCSHELL 0x7f4afd9a7000 == 13 [pid = 2212] [id = 535] 13:56:41 INFO - ++DOMWINDOW == 31 (0x7f4afc860c00) [pid = 2212] [serial = 1283] [outer = (nil)] 13:56:41 INFO - ++DOMWINDOW == 32 (0x7f4afd036800) [pid = 2212] [serial = 1284] [outer = 0x7f4afc860c00] 13:56:41 INFO - 259 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_613642_maintain_scroll.js 13:56:41 INFO - ++DOCSHELL 0x7f4afddb1800 == 14 [pid = 2212] [id = 536] 13:56:41 INFO - ++DOMWINDOW == 33 (0x7f4afd33c000) [pid = 2212] [serial = 1285] [outer = (nil)] 13:56:41 INFO - ++DOMWINDOW == 34 (0x7f4afd33f800) [pid = 2212] [serial = 1286] [outer = 0x7f4afd33c000] 13:56:41 INFO - ++DOCSHELL 0x7f4afd9bd000 == 15 [pid = 2212] [id = 537] 13:56:41 INFO - ++DOMWINDOW == 35 (0x7f4afd341c00) [pid = 2212] [serial = 1287] [outer = (nil)] 13:56:41 INFO - ++DOMWINDOW == 36 (0x7f4afd3b1400) [pid = 2212] [serial = 1288] [outer = 0x7f4afd341c00] 13:56:41 INFO - ++DOMWINDOW == 37 (0x7f4afd950400) [pid = 2212] [serial = 1289] [outer = 0x7f4afd341c00] 13:56:42 INFO - ++DOCSHELL 0x7f4afe4e2800 == 16 [pid = 2212] [id = 538] 13:56:42 INFO - ++DOMWINDOW == 38 (0x7f4afe00a400) [pid = 2212] [serial = 1290] [outer = (nil)] 13:56:42 INFO - ++DOMWINDOW == 39 (0x7f4afe1e7c00) [pid = 2212] [serial = 1291] [outer = 0x7f4afe00a400] 13:56:47 INFO - --DOCSHELL 0x7f4afd9b4000 == 15 [pid = 2212] [id = 531] 13:56:47 INFO - --DOCSHELL 0x7f4afdad2000 == 14 [pid = 2212] [id = 525] 13:56:47 INFO - --DOCSHELL 0x7f4afd9bd000 == 13 [pid = 2212] [id = 537] 13:56:47 INFO - --DOCSHELL 0x7f4afe2bb800 == 12 [pid = 2212] [id = 532] 13:56:47 INFO - --DOCSHELL 0x7f4afe2c9800 == 11 [pid = 2212] [id = 533] 13:56:47 INFO - --DOCSHELL 0x7f4afe4e2800 == 10 [pid = 2212] [id = 538] 13:56:47 INFO - --DOMWINDOW == 38 (0x7f4afe815c00) [pid = 2212] [serial = 1270] [outer = (nil)] [url = about:blank] 13:56:47 INFO - --DOMWINDOW == 37 (0x7f4afe0ae000) [pid = 2212] [serial = 1268] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:56:48 INFO - --DOMWINDOW == 36 (0x7f4afd946c00) [pid = 2212] [serial = 1278] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:56:48 INFO - --DOMWINDOW == 35 (0x7f4afe3dd800) [pid = 2212] [serial = 1281] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:56:48 INFO - --DOMWINDOW == 34 (0x7f4afd341000) [pid = 2212] [serial = 1276] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20613280] 13:56:48 INFO - --DOMWINDOW == 33 (0x7f4afc864000) [pid = 2212] [serial = 1274] [outer = (nil)] [url = about:blank] 13:56:48 INFO - --DOMWINDOW == 32 (0x7f4afd345800) [pid = 2212] [serial = 1277] [outer = (nil)] [url = about:blank] 13:56:48 INFO - --DOMWINDOW == 31 (0x7f4afd035800) [pid = 2212] [serial = 1275] [outer = (nil)] [url = about:blank] 13:56:48 INFO - --DOMWINDOW == 30 (0x7f4afd3b1400) [pid = 2212] [serial = 1288] [outer = (nil)] [url = about:blank] 13:56:48 INFO - MEMORY STAT | vsize 1186MB | residentFast 302MB | heapAllocated 115MB 13:56:48 INFO - 260 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_613642_maintain_scroll.js | took 6994ms 13:56:48 INFO - ++DOCSHELL 0x7f4afd9a1800 == 11 [pid = 2212] [id = 539] 13:56:48 INFO - ++DOMWINDOW == 31 (0x7f4afc863c00) [pid = 2212] [serial = 1292] [outer = (nil)] 13:56:48 INFO - ++DOMWINDOW == 32 (0x7f4afd039c00) [pid = 2212] [serial = 1293] [outer = 0x7f4afc863c00] 13:56:48 INFO - 261 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_613642_prune_scroll.js 13:56:48 INFO - ++DOCSHELL 0x7f4afddad800 == 12 [pid = 2212] [id = 540] 13:56:48 INFO - ++DOMWINDOW == 33 (0x7f4afd342000) [pid = 2212] [serial = 1294] [outer = (nil)] 13:56:48 INFO - ++DOMWINDOW == 34 (0x7f4afd347c00) [pid = 2212] [serial = 1295] [outer = 0x7f4afd342000] 13:56:49 INFO - ++DOCSHELL 0x7f4afd592800 == 13 [pid = 2212] [id = 541] 13:56:49 INFO - ++DOMWINDOW == 35 (0x7f4afd3a6400) [pid = 2212] [serial = 1296] [outer = (nil)] 13:56:49 INFO - ++DOMWINDOW == 36 (0x7f4afd943400) [pid = 2212] [serial = 1297] [outer = 0x7f4afd3a6400] 13:56:49 INFO - ++DOMWINDOW == 37 (0x7f4afe00b000) [pid = 2212] [serial = 1298] [outer = 0x7f4afd3a6400] 13:56:49 INFO - ++DOCSHELL 0x7f4afe4e3000 == 14 [pid = 2212] [id = 542] 13:56:49 INFO - ++DOMWINDOW == 38 (0x7f4afe3e0c00) [pid = 2212] [serial = 1299] [outer = (nil)] 13:56:49 INFO - ++DOMWINDOW == 39 (0x7f4afe3e3800) [pid = 2212] [serial = 1300] [outer = 0x7f4afe3e0c00] 13:56:54 INFO - --DOCSHELL 0x7f4afddb1800 == 13 [pid = 2212] [id = 536] 13:56:54 INFO - --DOCSHELL 0x7f4afd592800 == 12 [pid = 2212] [id = 541] 13:56:54 INFO - --DOCSHELL 0x7f4afe4e3000 == 11 [pid = 2212] [id = 542] 13:56:54 INFO - --DOCSHELL 0x7f4afd9a7000 == 10 [pid = 2212] [id = 535] 13:56:54 INFO - --DOMWINDOW == 38 (0x7f4afe3e0800) [pid = 2212] [serial = 1282] [outer = (nil)] [url = about:blank] 13:56:54 INFO - --DOMWINDOW == 37 (0x7f4afe00ec00) [pid = 2212] [serial = 1280] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:56:55 INFO - --DOMWINDOW == 36 (0x7f4afd33f800) [pid = 2212] [serial = 1286] [outer = (nil)] [url = about:blank] 13:56:55 INFO - --DOMWINDOW == 35 (0x7f4afd33c000) [pid = 2212] [serial = 1285] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20613642:%20remember%20scroll%20location] 13:56:55 INFO - --DOMWINDOW == 34 (0x7f4afd341c00) [pid = 2212] [serial = 1287] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:56:55 INFO - --DOMWINDOW == 33 (0x7f4afe00a400) [pid = 2212] [serial = 1290] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:56:55 INFO - --DOMWINDOW == 32 (0x7f4afc860c00) [pid = 2212] [serial = 1283] [outer = (nil)] [url = about:blank] 13:56:55 INFO - --DOMWINDOW == 31 (0x7f4afd943400) [pid = 2212] [serial = 1297] [outer = (nil)] [url = about:blank] 13:56:55 INFO - --DOMWINDOW == 30 (0x7f4afd036800) [pid = 2212] [serial = 1284] [outer = (nil)] [url = about:blank] 13:56:55 INFO - MEMORY STAT | vsize 1184MB | residentFast 302MB | heapAllocated 115MB 13:56:55 INFO - 262 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_613642_prune_scroll.js | took 6785ms 13:56:55 INFO - ++DOCSHELL 0x7f4afd9b1000 == 11 [pid = 2212] [id = 543] 13:56:55 INFO - ++DOMWINDOW == 31 (0x7f4afc862800) [pid = 2212] [serial = 1301] [outer = (nil)] 13:56:55 INFO - ++DOMWINDOW == 32 (0x7f4afd037c00) [pid = 2212] [serial = 1302] [outer = 0x7f4afc862800] 13:56:55 INFO - 263 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_614793_jsterm_scroll.js 13:56:55 INFO - ++DOCSHELL 0x7f4afddb4000 == 12 [pid = 2212] [id = 544] 13:56:55 INFO - ++DOMWINDOW == 33 (0x7f4afd341c00) [pid = 2212] [serial = 1303] [outer = (nil)] 13:56:55 INFO - ++DOMWINDOW == 34 (0x7f4afd3a3800) [pid = 2212] [serial = 1304] [outer = 0x7f4afd341c00] 13:56:55 INFO - ++DOCSHELL 0x7f4afd5a4000 == 13 [pid = 2212] [id = 545] 13:56:55 INFO - ++DOMWINDOW == 35 (0x7f4afd3a5400) [pid = 2212] [serial = 1305] [outer = (nil)] 13:56:55 INFO - ++DOMWINDOW == 36 (0x7f4afd3b2c00) [pid = 2212] [serial = 1306] [outer = 0x7f4afd3a5400] 13:56:56 INFO - ++DOMWINDOW == 37 (0x7f4afe009400) [pid = 2212] [serial = 1307] [outer = 0x7f4afd3a5400] 13:56:56 INFO - ++DOCSHELL 0x7f4afe4e5000 == 14 [pid = 2212] [id = 546] 13:56:56 INFO - ++DOMWINDOW == 38 (0x7f4afe3d8800) [pid = 2212] [serial = 1308] [outer = (nil)] 13:56:56 INFO - ++DOMWINDOW == 39 (0x7f4afe3df400) [pid = 2212] [serial = 1309] [outer = 0x7f4afe3d8800] 13:57:01 INFO - --DOCSHELL 0x7f4afd9a1800 == 13 [pid = 2212] [id = 539] 13:57:01 INFO - --DOCSHELL 0x7f4afddad800 == 12 [pid = 2212] [id = 540] 13:57:01 INFO - --DOCSHELL 0x7f4afd5a4000 == 11 [pid = 2212] [id = 545] 13:57:01 INFO - --DOCSHELL 0x7f4afe4e5000 == 10 [pid = 2212] [id = 546] 13:57:01 INFO - --DOMWINDOW == 38 (0x7f4afe1e7c00) [pid = 2212] [serial = 1291] [outer = (nil)] [url = about:blank] 13:57:01 INFO - --DOMWINDOW == 37 (0x7f4afd950400) [pid = 2212] [serial = 1289] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:02 INFO - --DOMWINDOW == 36 (0x7f4afe3e0c00) [pid = 2212] [serial = 1299] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:57:02 INFO - --DOMWINDOW == 35 (0x7f4afd3a6400) [pid = 2212] [serial = 1296] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:02 INFO - --DOMWINDOW == 34 (0x7f4afc863c00) [pid = 2212] [serial = 1292] [outer = (nil)] [url = about:blank] 13:57:02 INFO - --DOMWINDOW == 33 (0x7f4afd342000) [pid = 2212] [serial = 1294] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20613642:%20maintain%20scroll%20with%20pruning%20of%20old%20messages] 13:57:02 INFO - --DOMWINDOW == 32 (0x7f4afd3b2c00) [pid = 2212] [serial = 1306] [outer = (nil)] [url = about:blank] 13:57:02 INFO - --DOMWINDOW == 31 (0x7f4afd039c00) [pid = 2212] [serial = 1293] [outer = (nil)] [url = about:blank] 13:57:02 INFO - --DOMWINDOW == 30 (0x7f4afd347c00) [pid = 2212] [serial = 1295] [outer = (nil)] [url = about:blank] 13:57:02 INFO - MEMORY STAT | vsize 1184MB | residentFast 300MB | heapAllocated 115MB 13:57:02 INFO - 264 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_614793_jsterm_scroll.js | took 6815ms 13:57:02 INFO - ++DOCSHELL 0x7f4afdad9000 == 11 [pid = 2212] [id = 547] 13:57:02 INFO - ++DOMWINDOW == 31 (0x7f4afd033800) [pid = 2212] [serial = 1310] [outer = (nil)] 13:57:02 INFO - ++DOMWINDOW == 32 (0x7f4afd33a800) [pid = 2212] [serial = 1311] [outer = 0x7f4afd033800] 13:57:02 INFO - 265 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_618078_network_exceptions.js 13:57:02 INFO - ++DOCSHELL 0x7f4afddb2000 == 12 [pid = 2212] [id = 548] 13:57:02 INFO - ++DOMWINDOW == 33 (0x7f4afd3a4400) [pid = 2212] [serial = 1312] [outer = (nil)] 13:57:02 INFO - ++DOMWINDOW == 34 (0x7f4afd3aa400) [pid = 2212] [serial = 1313] [outer = 0x7f4afd3a4400] 13:57:03 INFO - ++DOCSHELL 0x7f4afd5a0000 == 13 [pid = 2212] [id = 549] 13:57:03 INFO - ++DOMWINDOW == 35 (0x7f4afd3abc00) [pid = 2212] [serial = 1314] [outer = (nil)] 13:57:03 INFO - ++DOMWINDOW == 36 (0x7f4afd947000) [pid = 2212] [serial = 1315] [outer = 0x7f4afd3abc00] 13:57:03 INFO - ++DOMWINDOW == 37 (0x7f4afe012800) [pid = 2212] [serial = 1316] [outer = 0x7f4afd3abc00] 13:57:03 INFO - ++DOCSHELL 0x7f4afe4f4000 == 14 [pid = 2212] [id = 550] 13:57:03 INFO - ++DOMWINDOW == 38 (0x7f4afe3dc800) [pid = 2212] [serial = 1317] [outer = (nil)] 13:57:03 INFO - ++DOMWINDOW == 39 (0x7f4afe3e1400) [pid = 2212] [serial = 1318] [outer = 0x7f4afe3dc800] 13:57:04 INFO - ++DOMWINDOW == 40 (0x7f4afe553400) [pid = 2212] [serial = 1319] [outer = 0x7f4afd3a4400] 13:57:04 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:57:05 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-618078-network-exceptions.html, line 14: ReferenceError: bug618078exception is not defined 13:57:06 INFO - --DOCSHELL 0x7f4afd9b1000 == 13 [pid = 2212] [id = 543] 13:57:06 INFO - --DOCSHELL 0x7f4afddb4000 == 12 [pid = 2212] [id = 544] 13:57:06 INFO - --DOCSHELL 0x7f4afd5a0000 == 11 [pid = 2212] [id = 549] 13:57:06 INFO - --DOCSHELL 0x7f4afe4f4000 == 10 [pid = 2212] [id = 550] 13:57:07 INFO - --DOMWINDOW == 39 (0x7f4afe00b000) [pid = 2212] [serial = 1298] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:07 INFO - --DOMWINDOW == 38 (0x7f4afe3e3800) [pid = 2212] [serial = 1300] [outer = (nil)] [url = about:blank] 13:57:07 INFO - --DOMWINDOW == 37 (0x7f4afd037c00) [pid = 2212] [serial = 1302] [outer = (nil)] [url = about:blank] 13:57:07 INFO - --DOMWINDOW == 36 (0x7f4afd3a3800) [pid = 2212] [serial = 1304] [outer = (nil)] [url = about:blank] 13:57:07 INFO - --DOMWINDOW == 35 (0x7f4afd947000) [pid = 2212] [serial = 1315] [outer = (nil)] [url = about:blank] 13:57:07 INFO - --DOMWINDOW == 34 (0x7f4afd3a5400) [pid = 2212] [serial = 1305] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:07 INFO - --DOMWINDOW == 33 (0x7f4afe3d8800) [pid = 2212] [serial = 1308] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:57:07 INFO - --DOMWINDOW == 32 (0x7f4afc862800) [pid = 2212] [serial = 1301] [outer = (nil)] [url = about:blank] 13:57:07 INFO - --DOMWINDOW == 31 (0x7f4afd341c00) [pid = 2212] [serial = 1303] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20614793:%20jsterm%20result%20scroll] 13:57:07 INFO - MEMORY STAT | vsize 1182MB | residentFast 300MB | heapAllocated 115MB 13:57:07 INFO - 266 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_618078_network_exceptions.js | took 4966ms 13:57:07 INFO - ++DOCSHELL 0x7f4afd591800 == 11 [pid = 2212] [id = 551] 13:57:07 INFO - ++DOMWINDOW == 32 (0x7f4afd036800) [pid = 2212] [serial = 1320] [outer = (nil)] 13:57:07 INFO - ++DOMWINDOW == 33 (0x7f4afd33bc00) [pid = 2212] [serial = 1321] [outer = 0x7f4afd036800] 13:57:07 INFO - 267 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_621644_jsterm_dollar.js 13:57:07 INFO - ++DOCSHELL 0x7f4afddba000 == 12 [pid = 2212] [id = 552] 13:57:07 INFO - ++DOMWINDOW == 34 (0x7f4afd3a7800) [pid = 2212] [serial = 1322] [outer = (nil)] 13:57:07 INFO - ++DOMWINDOW == 35 (0x7f4afd3ac400) [pid = 2212] [serial = 1323] [outer = 0x7f4afd3a7800] 13:57:08 INFO - ++DOMWINDOW == 36 (0x7f4afd947c00) [pid = 2212] [serial = 1324] [outer = 0x7f4afd3a7800] 13:57:08 INFO - ++DOCSHELL 0x7f4afd9bb800 == 13 [pid = 2212] [id = 553] 13:57:08 INFO - ++DOMWINDOW == 37 (0x7f4afe00a800) [pid = 2212] [serial = 1325] [outer = (nil)] 13:57:08 INFO - ++DOMWINDOW == 38 (0x7f4afe00f400) [pid = 2212] [serial = 1326] [outer = 0x7f4afe00a800] 13:57:08 INFO - ++DOMWINDOW == 39 (0x7f4afe0aac00) [pid = 2212] [serial = 1327] [outer = 0x7f4afe00a800] 13:57:08 INFO - ++DOCSHELL 0x7f4afe84e800 == 14 [pid = 2212] [id = 554] 13:57:08 INFO - ++DOMWINDOW == 40 (0x7f4afe3e3800) [pid = 2212] [serial = 1328] [outer = (nil)] 13:57:08 INFO - ++DOMWINDOW == 41 (0x7f4afe4be000) [pid = 2212] [serial = 1329] [outer = 0x7f4afe3e3800] 13:57:12 INFO - --DOCSHELL 0x7f4afddb2000 == 13 [pid = 2212] [id = 548] 13:57:12 INFO - --DOCSHELL 0x7f4afd9bb800 == 12 [pid = 2212] [id = 553] 13:57:12 INFO - --DOCSHELL 0x7f4afe84e800 == 11 [pid = 2212] [id = 554] 13:57:12 INFO - --DOCSHELL 0x7f4afdad9000 == 10 [pid = 2212] [id = 547] 13:57:12 INFO - --DOMWINDOW == 40 (0x7f4afe009400) [pid = 2212] [serial = 1307] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:12 INFO - --DOMWINDOW == 39 (0x7f4afe3df400) [pid = 2212] [serial = 1309] [outer = (nil)] [url = about:blank] 13:57:12 INFO - --DOMWINDOW == 38 (0x7f4afd3ac400) [pid = 2212] [serial = 1323] [outer = (nil)] [url = about:blank] 13:57:12 INFO - --DOMWINDOW == 37 (0x7f4afd3aa400) [pid = 2212] [serial = 1313] [outer = (nil)] [url = about:blank] 13:57:12 INFO - --DOMWINDOW == 36 (0x7f4afd33a800) [pid = 2212] [serial = 1311] [outer = (nil)] [url = about:blank] 13:57:12 INFO - --DOMWINDOW == 35 (0x7f4afe00f400) [pid = 2212] [serial = 1326] [outer = (nil)] [url = about:blank] 13:57:12 INFO - --DOMWINDOW == 34 (0x7f4afe3e3800) [pid = 2212] [serial = 1328] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:57:12 INFO - --DOMWINDOW == 33 (0x7f4afe3dc800) [pid = 2212] [serial = 1317] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:57:12 INFO - --DOMWINDOW == 32 (0x7f4afd3abc00) [pid = 2212] [serial = 1314] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:12 INFO - --DOMWINDOW == 31 (0x7f4afd3a4400) [pid = 2212] [serial = 1312] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-618078-network-exceptions.html] 13:57:12 INFO - --DOMWINDOW == 30 (0x7f4afd033800) [pid = 2212] [serial = 1310] [outer = (nil)] [url = about:blank] 13:57:12 INFO - --DOMWINDOW == 29 (0x7f4afe553400) [pid = 2212] [serial = 1319] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-618078-network-exceptions.html] 13:57:12 INFO - MEMORY STAT | vsize 1182MB | residentFast 299MB | heapAllocated 114MB 13:57:12 INFO - 268 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_621644_jsterm_dollar.js | took 5148ms 13:57:13 INFO - ++DOCSHELL 0x7f4afd9a5800 == 11 [pid = 2212] [id = 555] 13:57:13 INFO - ++DOMWINDOW == 30 (0x7f4afc865800) [pid = 2212] [serial = 1330] [outer = (nil)] 13:57:13 INFO - ++DOMWINDOW == 31 (0x7f4afd035800) [pid = 2212] [serial = 1331] [outer = 0x7f4afc865800] 13:57:13 INFO - 269 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_622303_persistent_filters.js 13:57:13 INFO - ++DOCSHELL 0x7f4afddb3800 == 12 [pid = 2212] [id = 556] 13:57:13 INFO - ++DOMWINDOW == 32 (0x7f4afd343400) [pid = 2212] [serial = 1332] [outer = (nil)] 13:57:13 INFO - ++DOMWINDOW == 33 (0x7f4afd3a3c00) [pid = 2212] [serial = 1333] [outer = 0x7f4afd343400] 13:57:13 INFO - ++DOMWINDOW == 34 (0x7f4afd3ae800) [pid = 2212] [serial = 1334] [outer = 0x7f4afd343400] 13:57:13 INFO - ++DOCSHELL 0x7f4afd9a6800 == 13 [pid = 2212] [id = 557] 13:57:13 INFO - ++DOMWINDOW == 35 (0x7f4afd942c00) [pid = 2212] [serial = 1335] [outer = (nil)] 13:57:13 INFO - ++DOMWINDOW == 36 (0x7f4afd943800) [pid = 2212] [serial = 1336] [outer = 0x7f4afd942c00] 13:57:13 INFO - ++DOMWINDOW == 37 (0x7f4afe00f800) [pid = 2212] [serial = 1337] [outer = 0x7f4afd942c00] 13:57:13 INFO - ++DOCSHELL 0x7f4afe4f9000 == 14 [pid = 2212] [id = 558] 13:57:13 INFO - ++DOMWINDOW == 38 (0x7f4afe3da000) [pid = 2212] [serial = 1338] [outer = (nil)] 13:57:13 INFO - ++DOMWINDOW == 39 (0x7f4afe3df400) [pid = 2212] [serial = 1339] [outer = 0x7f4afe3da000] 13:57:16 INFO - --DOCSHELL 0x7f4afd591800 == 13 [pid = 2212] [id = 551] 13:57:16 INFO - --DOCSHELL 0x7f4afe4f9000 == 12 [pid = 2212] [id = 558] 13:57:16 INFO - --DOCSHELL 0x7f4afddba000 == 11 [pid = 2212] [id = 552] 13:57:16 INFO - --DOMWINDOW == 38 (0x7f4afe4be000) [pid = 2212] [serial = 1329] [outer = (nil)] [url = about:blank] 13:57:16 INFO - --DOMWINDOW == 37 (0x7f4afe3e1400) [pid = 2212] [serial = 1318] [outer = (nil)] [url = about:blank] 13:57:16 INFO - --DOMWINDOW == 36 (0x7f4afe012800) [pid = 2212] [serial = 1316] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:16 INFO - ++DOCSHELL 0x7f4afd591800 == 12 [pid = 2212] [id = 559] 13:57:16 INFO - ++DOMWINDOW == 37 (0x7f4afc721800) [pid = 2212] [serial = 1340] [outer = (nil)] 13:57:16 INFO - ++DOMWINDOW == 38 (0x7f4afc725800) [pid = 2212] [serial = 1341] [outer = 0x7f4afc721800] 13:57:16 INFO - --DOMWINDOW == 37 (0x7f4afd3a3c00) [pid = 2212] [serial = 1333] [outer = (nil)] [url = about:blank] 13:57:16 INFO - --DOMWINDOW == 36 (0x7f4afd33bc00) [pid = 2212] [serial = 1321] [outer = (nil)] [url = about:blank] 13:57:16 INFO - --DOMWINDOW == 35 (0x7f4afd943800) [pid = 2212] [serial = 1336] [outer = (nil)] [url = about:blank] 13:57:16 INFO - --DOMWINDOW == 34 (0x7f4afe00a800) [pid = 2212] [serial = 1325] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:16 INFO - --DOMWINDOW == 33 (0x7f4afd3a7800) [pid = 2212] [serial = 1322] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-621644-jsterm-dollar.html] 13:57:16 INFO - --DOMWINDOW == 32 (0x7f4afd036800) [pid = 2212] [serial = 1320] [outer = (nil)] [url = about:blank] 13:57:16 INFO - --DOMWINDOW == 31 (0x7f4afd947c00) [pid = 2212] [serial = 1324] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-621644-jsterm-dollar.html] 13:57:17 INFO - ++DOMWINDOW == 32 (0x7f4afd037400) [pid = 2212] [serial = 1342] [outer = 0x7f4afc721800] 13:57:17 INFO - ++DOCSHELL 0x7f4afe2c2000 == 13 [pid = 2212] [id = 560] 13:57:17 INFO - ++DOMWINDOW == 33 (0x7f4afd947800) [pid = 2212] [serial = 1343] [outer = (nil)] 13:57:17 INFO - ++DOMWINDOW == 34 (0x7f4afd94c400) [pid = 2212] [serial = 1344] [outer = 0x7f4afd947800] 13:57:19 INFO - --DOCSHELL 0x7f4afd9a6800 == 12 [pid = 2212] [id = 557] 13:57:19 INFO - --DOCSHELL 0x7f4afe2c2000 == 11 [pid = 2212] [id = 560] 13:57:19 INFO - --DOMWINDOW == 33 (0x7f4afe0aac00) [pid = 2212] [serial = 1327] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:19 INFO - ++DOCSHELL 0x7f4afd58f000 == 12 [pid = 2212] [id = 561] 13:57:19 INFO - ++DOMWINDOW == 34 (0x7f4afc721000) [pid = 2212] [serial = 1345] [outer = (nil)] 13:57:19 INFO - ++DOMWINDOW == 35 (0x7f4afc729c00) [pid = 2212] [serial = 1346] [outer = 0x7f4afc721000] 13:57:19 INFO - --DOMWINDOW == 34 (0x7f4afc725800) [pid = 2212] [serial = 1341] [outer = (nil)] [url = about:blank] 13:57:19 INFO - ++DOMWINDOW == 35 (0x7f4afd03d800) [pid = 2212] [serial = 1347] [outer = 0x7f4afc721000] 13:57:20 INFO - ++DOCSHELL 0x7f4afddae000 == 13 [pid = 2212] [id = 562] 13:57:20 INFO - ++DOMWINDOW == 36 (0x7f4afd945400) [pid = 2212] [serial = 1348] [outer = (nil)] 13:57:20 INFO - ++DOMWINDOW == 37 (0x7f4afd94a000) [pid = 2212] [serial = 1349] [outer = 0x7f4afd945400] 13:57:22 INFO - --DOCSHELL 0x7f4afd591800 == 12 [pid = 2212] [id = 559] 13:57:22 INFO - --DOCSHELL 0x7f4afddae000 == 11 [pid = 2212] [id = 562] 13:57:22 INFO - --DOMWINDOW == 36 (0x7f4afc729c00) [pid = 2212] [serial = 1346] [outer = (nil)] [url = about:blank] 13:57:22 INFO - MEMORY STAT | vsize 1185MB | residentFast 301MB | heapAllocated 115MB 13:57:22 INFO - 270 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_622303_persistent_filters.js | took 9589ms 13:57:22 INFO - ++DOCSHELL 0x7f4afd9a6800 == 12 [pid = 2212] [id = 563] 13:57:22 INFO - ++DOMWINDOW == 37 (0x7f4afc865400) [pid = 2212] [serial = 1350] [outer = (nil)] 13:57:22 INFO - ++DOMWINDOW == 38 (0x7f4afd033800) [pid = 2212] [serial = 1351] [outer = 0x7f4afc865400] 13:57:23 INFO - 271 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_630733_response_redirect_headers.js 13:57:23 INFO - ++DOCSHELL 0x7f4afddba000 == 13 [pid = 2212] [id = 564] 13:57:23 INFO - ++DOMWINDOW == 39 (0x7f4afd342000) [pid = 2212] [serial = 1352] [outer = (nil)] 13:57:23 INFO - ++DOMWINDOW == 40 (0x7f4afd3a3c00) [pid = 2212] [serial = 1353] [outer = 0x7f4afd342000] 13:57:23 INFO - ++DOCSHELL 0x7f4afd59b000 == 14 [pid = 2212] [id = 565] 13:57:23 INFO - ++DOMWINDOW == 41 (0x7f4afd3a6400) [pid = 2212] [serial = 1354] [outer = (nil)] 13:57:23 INFO - ++DOMWINDOW == 42 (0x7f4afd947000) [pid = 2212] [serial = 1355] [outer = 0x7f4afd3a6400] 13:57:23 INFO - ++DOMWINDOW == 43 (0x7f4afc866800) [pid = 2212] [serial = 1356] [outer = 0x7f4afd3a6400] 13:57:23 INFO - ++DOCSHELL 0x7f4afe4f9800 == 15 [pid = 2212] [id = 566] 13:57:23 INFO - ++DOMWINDOW == 44 (0x7f4afe3d8400) [pid = 2212] [serial = 1357] [outer = (nil)] 13:57:23 INFO - ++DOMWINDOW == 45 (0x7f4afe570400) [pid = 2212] [serial = 1358] [outer = 0x7f4afe3d8400] 13:57:25 INFO - ++DOMWINDOW == 46 (0x7f4b00f57800) [pid = 2212] [serial = 1359] [outer = 0x7f4afd342000] 13:57:25 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:57:27 INFO - --DOCSHELL 0x7f4afd9a5800 == 14 [pid = 2212] [id = 555] 13:57:27 INFO - --DOCSHELL 0x7f4afd58f000 == 13 [pid = 2212] [id = 561] 13:57:27 INFO - --DOCSHELL 0x7f4afddb3800 == 12 [pid = 2212] [id = 556] 13:57:27 INFO - --DOCSHELL 0x7f4afe4f9800 == 11 [pid = 2212] [id = 566] 13:57:27 INFO - --DOMWINDOW == 45 (0x7f4afd3ae800) [pid = 2212] [serial = 1334] [outer = (nil)] [url = about:blank] 13:57:27 INFO - --DOMWINDOW == 44 (0x7f4afd035800) [pid = 2212] [serial = 1331] [outer = (nil)] [url = about:blank] 13:57:27 INFO - --DOMWINDOW == 43 (0x7f4afd947000) [pid = 2212] [serial = 1355] [outer = (nil)] [url = about:blank] 13:57:27 INFO - --DOMWINDOW == 42 (0x7f4afd947800) [pid = 2212] [serial = 1343] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:57:27 INFO - --DOMWINDOW == 41 (0x7f4afd945400) [pid = 2212] [serial = 1348] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:57:27 INFO - --DOMWINDOW == 40 (0x7f4afc721800) [pid = 2212] [serial = 1340] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:27 INFO - --DOMWINDOW == 39 (0x7f4afc721000) [pid = 2212] [serial = 1345] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:27 INFO - --DOMWINDOW == 38 (0x7f4afe3da000) [pid = 2212] [serial = 1338] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:57:27 INFO - --DOMWINDOW == 37 (0x7f4afd942c00) [pid = 2212] [serial = 1335] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:27 INFO - --DOMWINDOW == 36 (0x7f4afd343400) [pid = 2212] [serial = 1332] [outer = (nil)] [url = about:blank] 13:57:27 INFO - --DOMWINDOW == 35 (0x7f4afc865800) [pid = 2212] [serial = 1330] [outer = (nil)] [url = about:blank] 13:57:27 INFO - MEMORY STAT | vsize 1186MB | residentFast 304MB | heapAllocated 116MB 13:57:27 INFO - 272 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_630733_response_redirect_headers.js | took 4729ms 13:57:27 INFO - ++DOCSHELL 0x7f4afddb7000 == 12 [pid = 2212] [id = 567] 13:57:27 INFO - ++DOMWINDOW == 36 (0x7f4afd040000) [pid = 2212] [serial = 1360] [outer = (nil)] 13:57:27 INFO - ++DOMWINDOW == 37 (0x7f4afd345c00) [pid = 2212] [serial = 1361] [outer = 0x7f4afd040000] 13:57:28 INFO - 273 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_632275_getters_document_width.js 13:57:28 INFO - ++DOCSHELL 0x7f4afe4e0000 == 13 [pid = 2212] [id = 568] 13:57:28 INFO - ++DOMWINDOW == 38 (0x7f4afd3b2000) [pid = 2212] [serial = 1362] [outer = (nil)] 13:57:28 INFO - ++DOMWINDOW == 39 (0x7f4afd945400) [pid = 2212] [serial = 1363] [outer = 0x7f4afd3b2000] 13:57:28 INFO - ++DOMWINDOW == 40 (0x7f4afe00b400) [pid = 2212] [serial = 1364] [outer = 0x7f4afd3b2000] 13:57:28 INFO - ++DOCSHELL 0x7f4afe4e7800 == 14 [pid = 2212] [id = 569] 13:57:28 INFO - ++DOMWINDOW == 41 (0x7f4afe0ab000) [pid = 2212] [serial = 1365] [outer = (nil)] 13:57:28 INFO - ++DOMWINDOW == 42 (0x7f4afe0b2400) [pid = 2212] [serial = 1366] [outer = 0x7f4afe0ab000] 13:57:28 INFO - ++DOMWINDOW == 43 (0x7f4afe3da000) [pid = 2212] [serial = 1367] [outer = 0x7f4afe0ab000] 13:57:28 INFO - ++DOCSHELL 0x7f4aff290000 == 15 [pid = 2212] [id = 570] 13:57:28 INFO - ++DOMWINDOW == 44 (0x7f4afe8aa400) [pid = 2212] [serial = 1368] [outer = (nil)] 13:57:28 INFO - ++DOMWINDOW == 45 (0x7f4afe8ae400) [pid = 2212] [serial = 1369] [outer = 0x7f4afe8aa400] 13:57:30 INFO - ++DOCSHELL 0x7f4b01917800 == 16 [pid = 2212] [id = 571] 13:57:30 INFO - ++DOMWINDOW == 46 (0x7f4b00f59000) [pid = 2212] [serial = 1370] [outer = (nil)] 13:57:30 INFO - ++DOMWINDOW == 47 (0x7f4afe0b4400) [pid = 2212] [serial = 1371] [outer = 0x7f4b00f59000] 13:57:31 INFO - [2212] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3476 13:57:33 INFO - --DOCSHELL 0x7f4b01917800 == 15 [pid = 2212] [id = 571] 13:57:35 INFO - --DOCSHELL 0x7f4afddba000 == 14 [pid = 2212] [id = 564] 13:57:35 INFO - --DOCSHELL 0x7f4afd9a6800 == 13 [pid = 2212] [id = 563] 13:57:35 INFO - --DOCSHELL 0x7f4afe4e7800 == 12 [pid = 2212] [id = 569] 13:57:35 INFO - --DOCSHELL 0x7f4afd59b000 == 11 [pid = 2212] [id = 565] 13:57:35 INFO - --DOCSHELL 0x7f4aff290000 == 10 [pid = 2212] [id = 570] 13:57:35 INFO - --DOMWINDOW == 46 (0x7f4afd94a000) [pid = 2212] [serial = 1349] [outer = (nil)] [url = about:blank] 13:57:35 INFO - --DOMWINDOW == 45 (0x7f4afd94c400) [pid = 2212] [serial = 1344] [outer = (nil)] [url = about:blank] 13:57:35 INFO - --DOMWINDOW == 44 (0x7f4afd037400) [pid = 2212] [serial = 1342] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:35 INFO - --DOMWINDOW == 43 (0x7f4afd03d800) [pid = 2212] [serial = 1347] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:35 INFO - --DOMWINDOW == 42 (0x7f4afe3df400) [pid = 2212] [serial = 1339] [outer = (nil)] [url = about:blank] 13:57:35 INFO - --DOMWINDOW == 41 (0x7f4afe00f800) [pid = 2212] [serial = 1337] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:35 INFO - --DOMWINDOW == 40 (0x7f4afd342000) [pid = 2212] [serial = 1352] [outer = (nil)] [url = http://example.com/redirect-from-bug-630733] 13:57:35 INFO - --DOMWINDOW == 39 (0x7f4afc865400) [pid = 2212] [serial = 1350] [outer = (nil)] [url = about:blank] 13:57:35 INFO - --DOMWINDOW == 38 (0x7f4afe0b2400) [pid = 2212] [serial = 1366] [outer = (nil)] [url = about:blank] 13:57:35 INFO - --DOMWINDOW == 37 (0x7f4afd945400) [pid = 2212] [serial = 1363] [outer = (nil)] [url = about:blank] 13:57:35 INFO - --DOMWINDOW == 36 (0x7f4b00f57800) [pid = 2212] [serial = 1359] [outer = (nil)] [url = http://example.com/redirect-from-bug-630733] 13:57:35 INFO - --DOMWINDOW == 35 (0x7f4afd3a3c00) [pid = 2212] [serial = 1353] [outer = (nil)] [url = about:blank] 13:57:35 INFO - --DOMWINDOW == 34 (0x7f4afd033800) [pid = 2212] [serial = 1351] [outer = (nil)] [url = about:blank] 13:57:35 INFO - --DOMWINDOW == 33 (0x7f4afe3d8400) [pid = 2212] [serial = 1357] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:57:35 INFO - --DOMWINDOW == 32 (0x7f4afd3a6400) [pid = 2212] [serial = 1354] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:35 INFO - MEMORY STAT | vsize 1185MB | residentFast 308MB | heapAllocated 117MB 13:57:35 INFO - 274 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_632275_getters_document_width.js | took 7633ms 13:57:35 INFO - ++DOCSHELL 0x7f4afd9ae000 == 11 [pid = 2212] [id = 572] 13:57:35 INFO - ++DOMWINDOW == 33 (0x7f4afc863400) [pid = 2212] [serial = 1372] [outer = (nil)] 13:57:35 INFO - ++DOMWINDOW == 34 (0x7f4afd035800) [pid = 2212] [serial = 1373] [outer = 0x7f4afc863400] 13:57:35 INFO - 275 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_632347_iterators_generators.js 13:57:35 INFO - ++DOCSHELL 0x7f4afddb2800 == 12 [pid = 2212] [id = 573] 13:57:35 INFO - ++DOMWINDOW == 35 (0x7f4afd341c00) [pid = 2212] [serial = 1374] [outer = (nil)] 13:57:35 INFO - ++DOMWINDOW == 36 (0x7f4afd345800) [pid = 2212] [serial = 1375] [outer = 0x7f4afd341c00] 13:57:36 INFO - ++DOMWINDOW == 37 (0x7f4afd3b0c00) [pid = 2212] [serial = 1376] [outer = 0x7f4afd341c00] 13:57:36 INFO - ++DOCSHELL 0x7f4afddb6000 == 13 [pid = 2212] [id = 574] 13:57:36 INFO - ++DOMWINDOW == 38 (0x7f4afd950400) [pid = 2212] [serial = 1377] [outer = (nil)] 13:57:36 INFO - ++DOMWINDOW == 39 (0x7f4afe008800) [pid = 2212] [serial = 1378] [outer = 0x7f4afd950400] 13:57:36 INFO - ++DOMWINDOW == 40 (0x7f4afe0a9400) [pid = 2212] [serial = 1379] [outer = 0x7f4afd950400] 13:57:36 INFO - ++DOCSHELL 0x7f4afe858800 == 14 [pid = 2212] [id = 575] 13:57:36 INFO - ++DOMWINDOW == 41 (0x7f4afe4c0c00) [pid = 2212] [serial = 1380] [outer = (nil)] 13:57:36 INFO - ++DOMWINDOW == 42 (0x7f4afe4c7000) [pid = 2212] [serial = 1381] [outer = 0x7f4afe4c0c00] 13:57:38 INFO - ++DOCSHELL 0x7f4aff220800 == 15 [pid = 2212] [id = 576] 13:57:38 INFO - ++DOMWINDOW == 43 (0x7f4b012d6c00) [pid = 2212] [serial = 1382] [outer = (nil)] 13:57:38 INFO - ++DOMWINDOW == 44 (0x7f4b00f31400) [pid = 2212] [serial = 1383] [outer = 0x7f4b012d6c00] 13:57:40 INFO - --DOCSHELL 0x7f4afddb6000 == 14 [pid = 2212] [id = 574] 13:57:40 INFO - --DOCSHELL 0x7f4afe858800 == 13 [pid = 2212] [id = 575] 13:57:40 INFO - --DOCSHELL 0x7f4afe4e0000 == 12 [pid = 2212] [id = 568] 13:57:40 INFO - --DOCSHELL 0x7f4aff220800 == 11 [pid = 2212] [id = 576] 13:57:40 INFO - --DOCSHELL 0x7f4afddb7000 == 10 [pid = 2212] [id = 567] 13:57:40 INFO - --DOMWINDOW == 43 (0x7f4afc866800) [pid = 2212] [serial = 1356] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:40 INFO - --DOMWINDOW == 42 (0x7f4afe570400) [pid = 2212] [serial = 1358] [outer = (nil)] [url = about:blank] 13:57:41 INFO - --DOMWINDOW == 41 (0x7f4b00f59000) [pid = 2212] [serial = 1370] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:57:41 INFO - --DOMWINDOW == 40 (0x7f4afd040000) [pid = 2212] [serial = 1360] [outer = (nil)] [url = about:blank] 13:57:41 INFO - --DOMWINDOW == 39 (0x7f4afd3b2000) [pid = 2212] [serial = 1362] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-632275-getters.html] 13:57:41 INFO - --DOMWINDOW == 38 (0x7f4b012d6c00) [pid = 2212] [serial = 1382] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:57:41 INFO - --DOMWINDOW == 37 (0x7f4afd345c00) [pid = 2212] [serial = 1361] [outer = (nil)] [url = about:blank] 13:57:41 INFO - --DOMWINDOW == 36 (0x7f4afd345800) [pid = 2212] [serial = 1375] [outer = (nil)] [url = about:blank] 13:57:41 INFO - --DOMWINDOW == 35 (0x7f4afe008800) [pid = 2212] [serial = 1378] [outer = (nil)] [url = about:blank] 13:57:41 INFO - --DOMWINDOW == 34 (0x7f4afe0ab000) [pid = 2212] [serial = 1365] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:41 INFO - --DOMWINDOW == 33 (0x7f4afe8aa400) [pid = 2212] [serial = 1368] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:57:41 INFO - MEMORY STAT | vsize 1185MB | residentFast 305MB | heapAllocated 117MB 13:57:41 INFO - 276 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_632347_iterators_generators.js | took 5512ms 13:57:41 INFO - ++DOCSHELL 0x7f4afd9b0000 == 11 [pid = 2212] [id = 577] 13:57:41 INFO - ++DOMWINDOW == 34 (0x7f4afc865400) [pid = 2212] [serial = 1384] [outer = (nil)] 13:57:41 INFO - ++DOMWINDOW == 35 (0x7f4afd040000) [pid = 2212] [serial = 1385] [outer = 0x7f4afc865400] 13:57:41 INFO - 277 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_632817.js 13:57:41 INFO - ++DOCSHELL 0x7f4afe39a000 == 12 [pid = 2212] [id = 578] 13:57:41 INFO - ++DOMWINDOW == 36 (0x7f4afd3ae000) [pid = 2212] [serial = 1386] [outer = (nil)] 13:57:41 INFO - ++DOMWINDOW == 37 (0x7f4afd942400) [pid = 2212] [serial = 1387] [outer = 0x7f4afd3ae000] 13:57:42 INFO - ++DOCSHELL 0x7f4afd9bc800 == 13 [pid = 2212] [id = 579] 13:57:42 INFO - ++DOMWINDOW == 38 (0x7f4afe0ae000) [pid = 2212] [serial = 1388] [outer = (nil)] 13:57:42 INFO - ++DOMWINDOW == 39 (0x7f4afe0b0c00) [pid = 2212] [serial = 1389] [outer = 0x7f4afe0ae000] 13:57:42 INFO - ++DOMWINDOW == 40 (0x7f4afe3d5c00) [pid = 2212] [serial = 1390] [outer = 0x7f4afe0ae000] 13:57:42 INFO - ++DOCSHELL 0x7f4afe865800 == 14 [pid = 2212] [id = 580] 13:57:42 INFO - ++DOMWINDOW == 41 (0x7f4afe54e400) [pid = 2212] [serial = 1391] [outer = (nil)] 13:57:42 INFO - ++DOMWINDOW == 42 (0x7f4afe550c00) [pid = 2212] [serial = 1392] [outer = 0x7f4afe54e400] 13:57:44 INFO - ++DOMWINDOW == 43 (0x7f4b099b4c00) [pid = 2212] [serial = 1393] [outer = 0x7f4afd3ae000] 13:57:44 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:57:45 INFO - ++DOMWINDOW == 44 (0x7f4afc85ac00) [pid = 2212] [serial = 1394] [outer = 0x7f4afd3ae000] 13:57:45 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:57:45 INFO - [2212] WARNING: non-IME selection type: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 13:57:45 INFO - [2212] WARNING: Requested underline style is not valid: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5295 13:57:45 INFO - [2212] WARNING: Requested underline style is not valid: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5295 13:57:45 INFO - [2212] WARNING: non-IME selection type: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 13:57:46 INFO - JavaScript error: resource://gre/modules/LoginManagerParent.jsm, line 185: TypeError: this._recipeManager is null 13:57:46 INFO - ++DOMWINDOW == 45 (0x7f4afe553000) [pid = 2212] [serial = 1395] [outer = 0x7f4afd3ae000] 13:57:46 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:57:48 INFO - --DOCSHELL 0x7f4afddb2800 == 13 [pid = 2212] [id = 573] 13:57:48 INFO - --DOCSHELL 0x7f4afd9bc800 == 12 [pid = 2212] [id = 579] 13:57:48 INFO - --DOCSHELL 0x7f4afe865800 == 11 [pid = 2212] [id = 580] 13:57:48 INFO - --DOCSHELL 0x7f4afd9ae000 == 10 [pid = 2212] [id = 572] 13:57:48 INFO - --DOMWINDOW == 44 (0x7f4afe3da000) [pid = 2212] [serial = 1367] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:48 INFO - --DOMWINDOW == 43 (0x7f4afe8ae400) [pid = 2212] [serial = 1369] [outer = (nil)] [url = about:blank] 13:57:48 INFO - --DOMWINDOW == 42 (0x7f4b00f31400) [pid = 2212] [serial = 1383] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:57:48 INFO - --DOMWINDOW == 41 (0x7f4afe0b4400) [pid = 2212] [serial = 1371] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:57:48 INFO - --DOMWINDOW == 40 (0x7f4afe00b400) [pid = 2212] [serial = 1364] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-632275-getters.html] 13:57:48 INFO - --DOMWINDOW == 39 (0x7f4afd035800) [pid = 2212] [serial = 1373] [outer = (nil)] [url = about:blank] 13:57:48 INFO - --DOMWINDOW == 38 (0x7f4afe0b0c00) [pid = 2212] [serial = 1389] [outer = (nil)] [url = about:blank] 13:57:48 INFO - --DOMWINDOW == 37 (0x7f4afd950400) [pid = 2212] [serial = 1377] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:48 INFO - --DOMWINDOW == 36 (0x7f4afe4c0c00) [pid = 2212] [serial = 1380] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:57:48 INFO - --DOMWINDOW == 35 (0x7f4afc863400) [pid = 2212] [serial = 1372] [outer = (nil)] [url = about:blank] 13:57:48 INFO - --DOMWINDOW == 34 (0x7f4afd341c00) [pid = 2212] [serial = 1374] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-632347-iterators-generators.html] 13:57:49 INFO - --DOMWINDOW == 33 (0x7f4b099b4c00) [pid = 2212] [serial = 1393] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 13:57:49 INFO - --DOMWINDOW == 32 (0x7f4afd3b0c00) [pid = 2212] [serial = 1376] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-632347-iterators-generators.html] 13:57:49 INFO - MEMORY STAT | vsize 1187MB | residentFast 305MB | heapAllocated 116MB 13:57:49 INFO - 278 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_632817.js | took 7689ms 13:57:49 INFO - ++DOCSHELL 0x7f4afe2c4800 == 11 [pid = 2212] [id = 581] 13:57:49 INFO - ++DOMWINDOW == 33 (0x7f4afd33e000) [pid = 2212] [serial = 1396] [outer = (nil)] 13:57:49 INFO - ++DOMWINDOW == 34 (0x7f4afd3a7000) [pid = 2212] [serial = 1397] [outer = 0x7f4afd33e000] 13:57:49 INFO - 279 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_642108_pruneTest.js 13:57:49 INFO - ++DOCSHELL 0x7f4afe4ec000 == 12 [pid = 2212] [id = 582] 13:57:49 INFO - ++DOMWINDOW == 35 (0x7f4afd943400) [pid = 2212] [serial = 1398] [outer = (nil)] 13:57:49 INFO - ++DOMWINDOW == 36 (0x7f4afd947000) [pid = 2212] [serial = 1399] [outer = 0x7f4afd943400] 13:57:49 INFO - ++DOCSHELL 0x7f4afd59d800 == 13 [pid = 2212] [id = 583] 13:57:49 INFO - ++DOMWINDOW == 37 (0x7f4afd949c00) [pid = 2212] [serial = 1400] [outer = (nil)] 13:57:49 INFO - ++DOMWINDOW == 38 (0x7f4afe0a8400) [pid = 2212] [serial = 1401] [outer = 0x7f4afd949c00] 13:57:50 INFO - ++DOMWINDOW == 39 (0x7f4afe1f1c00) [pid = 2212] [serial = 1402] [outer = 0x7f4afd949c00] 13:57:50 INFO - ++DOCSHELL 0x7f4aff274800 == 14 [pid = 2212] [id = 584] 13:57:50 INFO - ++DOMWINDOW == 40 (0x7f4afe54f400) [pid = 2212] [serial = 1403] [outer = (nil)] 13:57:50 INFO - ++DOMWINDOW == 41 (0x7f4afe553400) [pid = 2212] [serial = 1404] [outer = 0x7f4afe54f400] 13:57:53 INFO - --DOCSHELL 0x7f4afe39a000 == 13 [pid = 2212] [id = 578] 13:57:53 INFO - --DOCSHELL 0x7f4aff274800 == 12 [pid = 2212] [id = 584] 13:57:53 INFO - --DOMWINDOW == 40 (0x7f4afe0a9400) [pid = 2212] [serial = 1379] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:53 INFO - --DOMWINDOW == 39 (0x7f4afe4c7000) [pid = 2212] [serial = 1381] [outer = (nil)] [url = about:blank] 13:57:53 INFO - --DOMWINDOW == 38 (0x7f4afe0a8400) [pid = 2212] [serial = 1401] [outer = (nil)] [url = about:blank] 13:57:53 INFO - --DOMWINDOW == 37 (0x7f4afd040000) [pid = 2212] [serial = 1385] [outer = (nil)] [url = about:blank] 13:57:53 INFO - --DOMWINDOW == 36 (0x7f4afd942400) [pid = 2212] [serial = 1387] [outer = (nil)] [url = about:blank] 13:57:53 INFO - --DOMWINDOW == 35 (0x7f4afe0ae000) [pid = 2212] [serial = 1388] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:53 INFO - --DOMWINDOW == 34 (0x7f4afe54e400) [pid = 2212] [serial = 1391] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:57:53 INFO - --DOMWINDOW == 33 (0x7f4afc865400) [pid = 2212] [serial = 1384] [outer = (nil)] [url = about:blank] 13:57:53 INFO - --DOMWINDOW == 32 (0x7f4afd3ae000) [pid = 2212] [serial = 1386] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 13:57:53 INFO - MEMORY STAT | vsize 1187MB | residentFast 304MB | heapAllocated 115MB 13:57:53 INFO - 280 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_642108_pruneTest.js | took 4064ms 13:57:53 INFO - ++DOCSHELL 0x7f4afd9ae000 == 13 [pid = 2212] [id = 585] 13:57:53 INFO - ++DOMWINDOW == 33 (0x7f4afc866800) [pid = 2212] [serial = 1405] [outer = (nil)] 13:57:53 INFO - ++DOMWINDOW == 34 (0x7f4afd037400) [pid = 2212] [serial = 1406] [outer = 0x7f4afc866800] 13:57:53 INFO - 281 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_644419_log_limits.js 13:57:53 INFO - ++DOCSHELL 0x7f4afe2be800 == 14 [pid = 2212] [id = 586] 13:57:53 INFO - ++DOMWINDOW == 35 (0x7f4afc71f800) [pid = 2212] [serial = 1407] [outer = (nil)] 13:57:53 INFO - ++DOMWINDOW == 36 (0x7f4afd3aa800) [pid = 2212] [serial = 1408] [outer = 0x7f4afc71f800] 13:57:54 INFO - ++DOCSHELL 0x7f4afe2cd800 == 15 [pid = 2212] [id = 587] 13:57:54 INFO - ++DOMWINDOW == 37 (0x7f4afd3ae000) [pid = 2212] [serial = 1409] [outer = (nil)] 13:57:54 INFO - ++DOMWINDOW == 38 (0x7f4afe00dc00) [pid = 2212] [serial = 1410] [outer = 0x7f4afd3ae000] 13:57:54 INFO - ++DOMWINDOW == 39 (0x7f4afe0b3800) [pid = 2212] [serial = 1411] [outer = 0x7f4afd3ae000] 13:57:54 INFO - ++DOCSHELL 0x7f4afe863800 == 16 [pid = 2212] [id = 588] 13:57:54 INFO - ++DOMWINDOW == 40 (0x7f4afe4c5c00) [pid = 2212] [serial = 1412] [outer = (nil)] 13:57:54 INFO - ++DOMWINDOW == 41 (0x7f4afe54d800) [pid = 2212] [serial = 1413] [outer = 0x7f4afe4c5c00] 13:57:56 INFO - ++DOMWINDOW == 42 (0x7f4b0984d000) [pid = 2212] [serial = 1414] [outer = 0x7f4afc71f800] 13:57:56 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:57:56 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 15: ReferenceError: bar is not defined 13:57:57 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar0 is not defined 13:57:57 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar1 is not defined 13:57:57 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar2 is not defined 13:57:57 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar3 is not defined 13:57:57 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar4 is not defined 13:57:57 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar5 is not defined 13:57:57 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar6 is not defined 13:57:57 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar7 is not defined 13:57:57 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar8 is not defined 13:57:57 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar9 is not defined 13:57:57 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html, line 1: ReferenceError: fubar10 is not defined 13:57:59 INFO - --DOCSHELL 0x7f4afe2c4800 == 15 [pid = 2212] [id = 581] 13:57:59 INFO - --DOCSHELL 0x7f4afe2cd800 == 14 [pid = 2212] [id = 587] 13:57:59 INFO - --DOCSHELL 0x7f4afd59d800 == 13 [pid = 2212] [id = 583] 13:57:59 INFO - --DOCSHELL 0x7f4afe4ec000 == 12 [pid = 2212] [id = 582] 13:57:59 INFO - --DOCSHELL 0x7f4afe863800 == 11 [pid = 2212] [id = 588] 13:57:59 INFO - --DOCSHELL 0x7f4afd9b0000 == 10 [pid = 2212] [id = 577] 13:57:59 INFO - --DOMWINDOW == 41 (0x7f4afe553000) [pid = 2212] [serial = 1395] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 13:57:59 INFO - --DOMWINDOW == 40 (0x7f4afe550c00) [pid = 2212] [serial = 1392] [outer = (nil)] [url = about:blank] 13:57:59 INFO - --DOMWINDOW == 39 (0x7f4afe3d5c00) [pid = 2212] [serial = 1390] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:57:59 INFO - --DOMWINDOW == 38 (0x7f4afc85ac00) [pid = 2212] [serial = 1394] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 13:57:59 INFO - --DOMWINDOW == 37 (0x7f4afd943400) [pid = 2212] [serial = 1398] [outer = (nil)] [url = data:text/html;charset=utf-8,<p>test%20for%20bug%20642108.] 13:57:59 INFO - --DOMWINDOW == 36 (0x7f4afd33e000) [pid = 2212] [serial = 1396] [outer = (nil)] [url = about:blank] 13:57:59 INFO - --DOMWINDOW == 35 (0x7f4afe00dc00) [pid = 2212] [serial = 1410] [outer = (nil)] [url = about:blank] 13:57:59 INFO - --DOMWINDOW == 34 (0x7f4afd947000) [pid = 2212] [serial = 1399] [outer = (nil)] [url = about:blank] 13:57:59 INFO - --DOMWINDOW == 33 (0x7f4afd3a7000) [pid = 2212] [serial = 1397] [outer = (nil)] [url = about:blank] 13:57:59 INFO - --DOMWINDOW == 32 (0x7f4afe54f400) [pid = 2212] [serial = 1403] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:57:59 INFO - --DOMWINDOW == 31 (0x7f4afd949c00) [pid = 2212] [serial = 1400] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:58:00 INFO - MEMORY STAT | vsize 1188MB | residentFast 306MB | heapAllocated 116MB 13:58:00 INFO - 282 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_644419_log_limits.js | took 6327ms 13:58:00 INFO - ++DOCSHELL 0x7f4afd9a9000 == 11 [pid = 2212] [id = 589] 13:58:00 INFO - ++DOMWINDOW == 32 (0x7f4afc868000) [pid = 2212] [serial = 1415] [outer = (nil)] 13:58:00 INFO - ++DOMWINDOW == 33 (0x7f4afd339400) [pid = 2212] [serial = 1416] [outer = 0x7f4afc868000] 13:58:00 INFO - 283 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_646025_console_file_location.js 13:58:00 INFO - ++DOCSHELL 0x7f4afe2be000 == 12 [pid = 2212] [id = 590] 13:58:00 INFO - ++DOMWINDOW == 34 (0x7f4afd3a7000) [pid = 2212] [serial = 1417] [outer = (nil)] 13:58:00 INFO - ++DOMWINDOW == 35 (0x7f4afd3ae800) [pid = 2212] [serial = 1418] [outer = 0x7f4afd3a7000] 13:58:00 INFO - ++DOCSHELL 0x7f4afdad6800 == 13 [pid = 2212] [id = 591] 13:58:00 INFO - ++DOMWINDOW == 36 (0x7f4afc724000) [pid = 2212] [serial = 1419] [outer = (nil)] 13:58:00 INFO - ++DOMWINDOW == 37 (0x7f4afe009800) [pid = 2212] [serial = 1420] [outer = 0x7f4afc724000] 13:58:00 INFO - ++DOMWINDOW == 38 (0x7f4afe0ae000) [pid = 2212] [serial = 1421] [outer = 0x7f4afc724000] 13:58:01 INFO - ++DOCSHELL 0x7f4afe861800 == 14 [pid = 2212] [id = 592] 13:58:01 INFO - ++DOMWINDOW == 39 (0x7f4afe4c4c00) [pid = 2212] [serial = 1422] [outer = (nil)] 13:58:01 INFO - ++DOMWINDOW == 40 (0x7f4afe547c00) [pid = 2212] [serial = 1423] [outer = 0x7f4afe4c4c00] 13:58:02 INFO - ++DOMWINDOW == 41 (0x7f4afe815000) [pid = 2212] [serial = 1424] [outer = 0x7f4afd3a7000] 13:58:02 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:58:04 INFO - --DOCSHELL 0x7f4afdad6800 == 13 [pid = 2212] [id = 591] 13:58:04 INFO - --DOCSHELL 0x7f4afe2be800 == 12 [pid = 2212] [id = 586] 13:58:04 INFO - --DOCSHELL 0x7f4afe861800 == 11 [pid = 2212] [id = 592] 13:58:04 INFO - --DOCSHELL 0x7f4afd9ae000 == 10 [pid = 2212] [id = 585] 13:58:04 INFO - --DOMWINDOW == 40 (0x7f4afe1f1c00) [pid = 2212] [serial = 1402] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:58:04 INFO - --DOMWINDOW == 39 (0x7f4afe553400) [pid = 2212] [serial = 1404] [outer = (nil)] [url = about:blank] 13:58:04 INFO - --DOMWINDOW == 38 (0x7f4afd037400) [pid = 2212] [serial = 1406] [outer = (nil)] [url = about:blank] 13:58:04 INFO - --DOMWINDOW == 37 (0x7f4afd3aa800) [pid = 2212] [serial = 1408] [outer = (nil)] [url = about:blank] 13:58:04 INFO - --DOMWINDOW == 36 (0x7f4afe009800) [pid = 2212] [serial = 1420] [outer = (nil)] [url = about:blank] 13:58:04 INFO - --DOMWINDOW == 35 (0x7f4afe4c5c00) [pid = 2212] [serial = 1412] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:58:04 INFO - --DOMWINDOW == 34 (0x7f4afd3ae000) [pid = 2212] [serial = 1409] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:58:04 INFO - --DOMWINDOW == 33 (0x7f4afc866800) [pid = 2212] [serial = 1405] [outer = (nil)] [url = about:blank] 13:58:04 INFO - --DOMWINDOW == 32 (0x7f4afc71f800) [pid = 2212] [serial = 1407] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html] 13:58:05 INFO - MEMORY STAT | vsize 1182MB | residentFast 300MB | heapAllocated 116MB 13:58:05 INFO - 284 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_646025_console_file_location.js | took 5175ms 13:58:05 INFO - ++DOCSHELL 0x7f4afdad2800 == 11 [pid = 2212] [id = 593] 13:58:05 INFO - ++DOMWINDOW == 33 (0x7f4afd33a800) [pid = 2212] [serial = 1425] [outer = (nil)] 13:58:05 INFO - ++DOMWINDOW == 34 (0x7f4afd342c00) [pid = 2212] [serial = 1426] [outer = 0x7f4afd33a800] 13:58:05 INFO - 285 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_651501_document_body_autocomplete.js 13:58:05 INFO - ++DOCSHELL 0x7f4afe3a0000 == 12 [pid = 2212] [id = 594] 13:58:05 INFO - ++DOMWINDOW == 35 (0x7f4afd3b2800) [pid = 2212] [serial = 1427] [outer = (nil)] 13:58:05 INFO - ++DOMWINDOW == 36 (0x7f4afd946c00) [pid = 2212] [serial = 1428] [outer = 0x7f4afd3b2800] 13:58:06 INFO - ++DOCSHELL 0x7f4afd5a0000 == 13 [pid = 2212] [id = 595] 13:58:06 INFO - ++DOMWINDOW == 37 (0x7f4afe010000) [pid = 2212] [serial = 1429] [outer = (nil)] 13:58:06 INFO - ++DOMWINDOW == 38 (0x7f4afe012000) [pid = 2212] [serial = 1430] [outer = 0x7f4afe010000] 13:58:06 INFO - ++DOMWINDOW == 39 (0x7f4afe1e8c00) [pid = 2212] [serial = 1431] [outer = 0x7f4afe010000] 13:58:06 INFO - ++DOCSHELL 0x7f4afe862000 == 14 [pid = 2212] [id = 596] 13:58:06 INFO - ++DOMWINDOW == 40 (0x7f4afd341000) [pid = 2212] [serial = 1432] [outer = (nil)] 13:58:06 INFO - ++DOMWINDOW == 41 (0x7f4afe54f000) [pid = 2212] [serial = 1433] [outer = 0x7f4afd341000] 13:58:09 INFO - ++DOCSHELL 0x7f4b07c5f800 == 15 [pid = 2212] [id = 597] 13:58:09 INFO - ++DOMWINDOW == 42 (0x7f4b012dc800) [pid = 2212] [serial = 1434] [outer = (nil)] 13:58:09 INFO - ++DOMWINDOW == 43 (0x7f4b00f2f400) [pid = 2212] [serial = 1435] [outer = 0x7f4b012dc800] 13:58:10 INFO - [2212] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3476 13:58:12 INFO - --DOCSHELL 0x7f4afe2be000 == 14 [pid = 2212] [id = 590] 13:58:12 INFO - --DOCSHELL 0x7f4afe862000 == 13 [pid = 2212] [id = 596] 13:58:12 INFO - --DOCSHELL 0x7f4b07c5f800 == 12 [pid = 2212] [id = 597] 13:58:12 INFO - --DOMWINDOW == 42 (0x7f4b0984d000) [pid = 2212] [serial = 1414] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-644419-log-limits.html] 13:58:12 INFO - --DOMWINDOW == 41 (0x7f4afe54d800) [pid = 2212] [serial = 1413] [outer = (nil)] [url = about:blank] 13:58:12 INFO - --DOMWINDOW == 40 (0x7f4afe0b3800) [pid = 2212] [serial = 1411] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:58:13 INFO - --DOMWINDOW == 39 (0x7f4afd3ae800) [pid = 2212] [serial = 1418] [outer = (nil)] [url = about:blank] 13:58:13 INFO - --DOMWINDOW == 38 (0x7f4afd339400) [pid = 2212] [serial = 1416] [outer = (nil)] [url = about:blank] 13:58:13 INFO - --DOMWINDOW == 37 (0x7f4afe012000) [pid = 2212] [serial = 1430] [outer = (nil)] [url = about:blank] 13:58:13 INFO - --DOMWINDOW == 36 (0x7f4afc724000) [pid = 2212] [serial = 1419] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:58:13 INFO - --DOMWINDOW == 35 (0x7f4afe4c4c00) [pid = 2212] [serial = 1422] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:58:13 INFO - --DOMWINDOW == 34 (0x7f4afd3a7000) [pid = 2212] [serial = 1417] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-646025-console-file-location.html] 13:58:13 INFO - --DOMWINDOW == 33 (0x7f4afc868000) [pid = 2212] [serial = 1415] [outer = (nil)] [url = about:blank] 13:58:13 INFO - --DOMWINDOW == 32 (0x7f4afe815000) [pid = 2212] [serial = 1424] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-646025-console-file-location.html] 13:58:13 INFO - MEMORY STAT | vsize 1184MB | residentFast 306MB | heapAllocated 118MB 13:58:13 INFO - 286 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_651501_document_body_autocomplete.js | took 7587ms 13:58:13 INFO - ++DOCSHELL 0x7f4afd9a7000 == 13 [pid = 2212] [id = 598] 13:58:13 INFO - ++DOMWINDOW == 33 (0x7f4afc866c00) [pid = 2212] [serial = 1436] [outer = (nil)] 13:58:13 INFO - ++DOMWINDOW == 34 (0x7f4afd03f800) [pid = 2212] [serial = 1437] [outer = 0x7f4afc866c00] 13:58:13 INFO - 287 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_653531_highlighter_console_helper.js 13:58:13 INFO - ++DOCSHELL 0x7f4afe2ca000 == 14 [pid = 2212] [id = 599] 13:58:13 INFO - ++DOMWINDOW == 35 (0x7f4afd3a6400) [pid = 2212] [serial = 1438] [outer = (nil)] 13:58:13 INFO - ++DOMWINDOW == 36 (0x7f4afd3ac800) [pid = 2212] [serial = 1439] [outer = 0x7f4afd3a6400] 13:58:14 INFO - ++DOCSHELL 0x7f4afe4f3000 == 15 [pid = 2212] [id = 600] 13:58:14 INFO - ++DOMWINDOW == 37 (0x7f4afd3aec00) [pid = 2212] [serial = 1440] [outer = (nil)] 13:58:14 INFO - ++DOMWINDOW == 38 (0x7f4afe00a000) [pid = 2212] [serial = 1441] [outer = 0x7f4afd3aec00] 13:58:14 INFO - ++DOMWINDOW == 39 (0x7f4afe3d6400) [pid = 2212] [serial = 1442] [outer = 0x7f4afd3aec00] 13:58:15 INFO - ++DOCSHELL 0x7f4b07d8d800 == 16 [pid = 2212] [id = 601] 13:58:15 INFO - ++DOMWINDOW == 40 (0x7f4afe0b0400) [pid = 2212] [serial = 1443] [outer = (nil)] 13:58:15 INFO - ++DOMWINDOW == 41 (0x7f4b07a07000) [pid = 2212] [serial = 1444] [outer = 0x7f4afe0b0400] 13:58:15 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 13:58:15 INFO - ++DOCSHELL 0x7f4afe85f000 == 17 [pid = 2212] [id = 602] 13:58:15 INFO - ++DOMWINDOW == 42 (0x7f4afe3de000) [pid = 2212] [serial = 1445] [outer = (nil)] 13:58:15 INFO - ++DOMWINDOW == 43 (0x7f4afe3dec00) [pid = 2212] [serial = 1446] [outer = 0x7f4afe3de000] 13:58:15 INFO - ++DOCSHELL 0x7f4aff290000 == 18 [pid = 2212] [id = 603] 13:58:15 INFO - ++DOMWINDOW == 44 (0x7f4afe3e1000) [pid = 2212] [serial = 1447] [outer = (nil)] 13:58:15 INFO - ++DOCSHELL 0x7f4aff2b6800 == 19 [pid = 2212] [id = 604] 13:58:15 INFO - ++DOMWINDOW == 45 (0x7f4afe3e2000) [pid = 2212] [serial = 1448] [outer = (nil)] 13:58:15 INFO - ++DOCSHELL 0x7f4aff2bf800 == 20 [pid = 2212] [id = 605] 13:58:15 INFO - ++DOMWINDOW == 46 (0x7f4afe816000) [pid = 2212] [serial = 1449] [outer = (nil)] 13:58:15 INFO - ++DOCSHELL 0x7f4aff2c3000 == 21 [pid = 2212] [id = 606] 13:58:15 INFO - ++DOMWINDOW == 47 (0x7f4afe818000) [pid = 2212] [serial = 1450] [outer = (nil)] 13:58:15 INFO - ++DOCSHELL 0x7f4aff2c6800 == 22 [pid = 2212] [id = 607] 13:58:15 INFO - ++DOMWINDOW == 48 (0x7f4afe8a6000) [pid = 2212] [serial = 1451] [outer = (nil)] 13:58:15 INFO - ++DOMWINDOW == 49 (0x7f4afe8aa400) [pid = 2212] [serial = 1452] [outer = 0x7f4afe3e1000] 13:58:15 INFO - ++DOMWINDOW == 50 (0x7f4b07a10000) [pid = 2212] [serial = 1453] [outer = 0x7f4afe3e2000] 13:58:15 INFO - ++DOMWINDOW == 51 (0x7f4b07a11800) [pid = 2212] [serial = 1454] [outer = 0x7f4afe816000] 13:58:15 INFO - ++DOMWINDOW == 52 (0x7f4b07a13800) [pid = 2212] [serial = 1455] [outer = 0x7f4afe818000] 13:58:15 INFO - ++DOMWINDOW == 53 (0x7f4b089f1000) [pid = 2212] [serial = 1456] [outer = 0x7f4afe8a6000] 13:58:16 INFO - ++DOCSHELL 0x7f4b0c830000 == 23 [pid = 2212] [id = 608] 13:58:16 INFO - ++DOMWINDOW == 54 (0x7f4b09e55000) [pid = 2212] [serial = 1457] [outer = (nil)] 13:58:16 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 13:58:16 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 13:58:16 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 13:58:16 INFO - ++DOCSHELL 0x7f4b0f723000 == 24 [pid = 2212] [id = 609] 13:58:16 INFO - ++DOMWINDOW == 55 (0x7f4afe0acc00) [pid = 2212] [serial = 1458] [outer = (nil)] 13:58:16 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 13:58:16 INFO - ++DOMWINDOW == 56 (0x7f4b0a03e400) [pid = 2212] [serial = 1459] [outer = 0x7f4b09e55000] 13:58:16 INFO - ++DOMWINDOW == 57 (0x7f4b0a9d2c00) [pid = 2212] [serial = 1460] [outer = 0x7f4afe0acc00] 13:58:16 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 13:58:16 INFO - ++DOCSHELL 0x7f4b0c38c800 == 25 [pid = 2212] [id = 610] 13:58:16 INFO - ++DOMWINDOW == 58 (0x7f4b07a0f400) [pid = 2212] [serial = 1461] [outer = (nil)] 13:58:16 INFO - ++DOCSHELL 0x7f4b0c38f000 == 26 [pid = 2212] [id = 611] 13:58:16 INFO - ++DOMWINDOW == 59 (0x7f4b0a662000) [pid = 2212] [serial = 1462] [outer = (nil)] 13:58:16 INFO - ++DOCSHELL 0x7f4b0c390800 == 27 [pid = 2212] [id = 612] 13:58:16 INFO - ++DOMWINDOW == 60 (0x7f4b0a865000) [pid = 2212] [serial = 1463] [outer = (nil)] 13:58:17 INFO - ++DOCSHELL 0x7f4b0c391000 == 28 [pid = 2212] [id = 613] 13:58:17 INFO - ++DOMWINDOW == 61 (0x7f4b0ab84800) [pid = 2212] [serial = 1464] [outer = (nil)] 13:58:17 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 13:58:17 INFO - ++DOCSHELL 0x7f4b0c396800 == 29 [pid = 2212] [id = 614] 13:58:17 INFO - ++DOMWINDOW == 62 (0x7f4b0ab88000) [pid = 2212] [serial = 1465] [outer = (nil)] 13:58:17 INFO - ++DOMWINDOW == 63 (0x7f4b0ac02800) [pid = 2212] [serial = 1466] [outer = 0x7f4b0ab88000] 13:58:17 INFO - [2212] WARNING: No inner window available!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 9211 13:58:17 INFO - [2212] WARNING: No inner window available!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 9211 13:58:17 INFO - [2212] WARNING: No inner window available!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 9211 13:58:17 INFO - [2212] WARNING: No inner window available!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 9211 13:58:17 INFO - ++DOMWINDOW == 64 (0x7f4afc723800) [pid = 2212] [serial = 1467] [outer = 0x7f4b07a0f400] 13:58:17 INFO - ++DOMWINDOW == 65 (0x7f4afc859c00) [pid = 2212] [serial = 1468] [outer = 0x7f4b0a662000] 13:58:17 INFO - ++DOMWINDOW == 66 (0x7f4afc85f000) [pid = 2212] [serial = 1469] [outer = 0x7f4b0a865000] 13:58:17 INFO - ++DOMWINDOW == 67 (0x7f4afc862400) [pid = 2212] [serial = 1470] [outer = 0x7f4b0ab84800] 13:58:17 INFO - ++DOMWINDOW == 68 (0x7f4afc867c00) [pid = 2212] [serial = 1471] [outer = 0x7f4b0ab88000] 13:58:19 INFO - ++DOCSHELL 0x7f4aff206800 == 30 [pid = 2212] [id = 615] 13:58:19 INFO - ++DOMWINDOW == 69 (0x7f4b0c4e5800) [pid = 2212] [serial = 1472] [outer = (nil)] 13:58:19 INFO - ++DOMWINDOW == 70 (0x7f4b0fbae400) [pid = 2212] [serial = 1473] [outer = 0x7f4b0c4e5800] 13:58:20 INFO - --DOCSHELL 0x7f4b0c38f000 == 29 [pid = 2212] [id = 611] 13:58:20 INFO - --DOCSHELL 0x7f4b0c390800 == 28 [pid = 2212] [id = 612] 13:58:20 INFO - --DOCSHELL 0x7f4b0c38c800 == 27 [pid = 2212] [id = 610] 13:58:20 INFO - --DOCSHELL 0x7f4b0c391000 == 26 [pid = 2212] [id = 613] 13:58:20 INFO - --DOCSHELL 0x7f4b0f723000 == 25 [pid = 2212] [id = 609] 13:58:20 INFO - --DOCSHELL 0x7f4b0c830000 == 24 [pid = 2212] [id = 608] 13:58:20 INFO - console.error: 13:58:20 INFO - Protocol error (noSuchActor): No such actor for ID: server1.conn136.animationsActor23 13:58:20 INFO - MEMORY STAT | vsize 1184MB | residentFast 323MB | heapAllocated 132MB 13:58:20 INFO - 288 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_653531_highlighter_console_helper.js | took 7263ms 13:58:20 INFO - ++DOCSHELL 0x7f4afd598000 == 25 [pid = 2212] [id = 616] 13:58:20 INFO - ++DOMWINDOW == 71 (0x7f4afe4be400) [pid = 2212] [serial = 1474] [outer = (nil)] 13:58:21 INFO - ++DOMWINDOW == 72 (0x7f4afe4c7000) [pid = 2212] [serial = 1475] [outer = 0x7f4afe4be400] 13:58:21 INFO - 289 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_658368_time_methods.js 13:58:21 INFO - ++DOCSHELL 0x7f4afd9ae800 == 26 [pid = 2212] [id = 617] 13:58:21 INFO - ++DOMWINDOW == 73 (0x7f4afe8bc800) [pid = 2212] [serial = 1476] [outer = (nil)] 13:58:21 INFO - ++DOMWINDOW == 74 (0x7f4afe8c1400) [pid = 2212] [serial = 1477] [outer = 0x7f4afe8bc800] 13:58:21 INFO - ++DOMWINDOW == 75 (0x7f4b09580c00) [pid = 2212] [serial = 1478] [outer = 0x7f4afe8bc800] 13:58:22 INFO - ++DOCSHELL 0x7f4b10bdc800 == 27 [pid = 2212] [id = 618] 13:58:22 INFO - ++DOMWINDOW == 76 (0x7f4b0984cc00) [pid = 2212] [serial = 1479] [outer = (nil)] 13:58:22 INFO - ++DOMWINDOW == 77 (0x7f4b0984dc00) [pid = 2212] [serial = 1480] [outer = 0x7f4b0984cc00] 13:58:22 INFO - ++DOMWINDOW == 78 (0x7f4b099c0400) [pid = 2212] [serial = 1481] [outer = 0x7f4b0984cc00] 13:58:22 INFO - ++DOCSHELL 0x7f4b12e62800 == 28 [pid = 2212] [id = 619] 13:58:22 INFO - ++DOMWINDOW == 79 (0x7f4b1237cc00) [pid = 2212] [serial = 1482] [outer = (nil)] 13:58:22 INFO - ++DOMWINDOW == 80 (0x7f4b1237ec00) [pid = 2212] [serial = 1483] [outer = 0x7f4b1237cc00] 13:58:24 INFO - ++DOCSHELL 0x7f4b14954800 == 29 [pid = 2212] [id = 620] 13:58:24 INFO - ++DOMWINDOW == 81 (0x7f4b13011800) [pid = 2212] [serial = 1484] [outer = (nil)] 13:58:24 INFO - ++DOMWINDOW == 82 (0x7f4b1404d800) [pid = 2212] [serial = 1485] [outer = 0x7f4b13011800] 13:58:24 INFO - ++DOCSHELL 0x7f4b1991e000 == 30 [pid = 2212] [id = 621] 13:58:24 INFO - ++DOMWINDOW == 83 (0x7f4b12ab3c00) [pid = 2212] [serial = 1486] [outer = (nil)] 13:58:24 INFO - ++DOMWINDOW == 84 (0x7f4b12abb800) [pid = 2212] [serial = 1487] [outer = 0x7f4b12ab3c00] 13:58:24 INFO - ++DOMWINDOW == 85 (0x7f4b1450a400) [pid = 2212] [serial = 1488] [outer = 0x7f4b12ab3c00] 13:58:25 INFO - ++DOCSHELL 0x7f4b2578e800 == 31 [pid = 2212] [id = 622] 13:58:25 INFO - ++DOMWINDOW == 86 (0x7f4b12378800) [pid = 2212] [serial = 1489] [outer = (nil)] 13:58:25 INFO - ++DOMWINDOW == 87 (0x7f4b1960d800) [pid = 2212] [serial = 1490] [outer = 0x7f4b12378800] 13:58:26 INFO - ++DOMWINDOW == 88 (0x7f4b257e9800) [pid = 2212] [serial = 1491] [outer = 0x7f4b13011800] 13:58:27 INFO - ++DOMWINDOW == 89 (0x7f4b15946400) [pid = 2212] [serial = 1492] [outer = 0x7f4b13011800] 13:58:28 INFO - --DOCSHELL 0x7f4b0c396800 == 30 [pid = 2212] [id = 614] 13:58:28 INFO - --DOCSHELL 0x7f4afd5a0000 == 29 [pid = 2212] [id = 595] 13:58:28 INFO - --DOCSHELL 0x7f4b07d8d800 == 28 [pid = 2212] [id = 601] 13:58:28 INFO - --DOCSHELL 0x7f4afd9a9000 == 27 [pid = 2212] [id = 589] 13:58:28 INFO - --DOCSHELL 0x7f4afdad2800 == 26 [pid = 2212] [id = 593] 13:58:28 INFO - --DOCSHELL 0x7f4afe85f000 == 25 [pid = 2212] [id = 602] 13:58:28 INFO - --DOCSHELL 0x7f4afe3a0000 == 24 [pid = 2212] [id = 594] 13:58:28 INFO - --DOCSHELL 0x7f4aff206800 == 23 [pid = 2212] [id = 615] 13:58:28 INFO - --DOCSHELL 0x7f4aff290000 == 22 [pid = 2212] [id = 603] 13:58:28 INFO - --DOCSHELL 0x7f4aff2b6800 == 21 [pid = 2212] [id = 604] 13:58:28 INFO - --DOCSHELL 0x7f4aff2bf800 == 20 [pid = 2212] [id = 605] 13:58:28 INFO - --DOCSHELL 0x7f4aff2c3000 == 19 [pid = 2212] [id = 606] 13:58:28 INFO - --DOCSHELL 0x7f4aff2c6800 == 18 [pid = 2212] [id = 607] 13:58:28 INFO - --DOCSHELL 0x7f4b2578e800 == 17 [pid = 2212] [id = 622] 13:58:28 INFO - --DOMWINDOW == 88 (0x7f4afe547c00) [pid = 2212] [serial = 1423] [outer = (nil)] [url = about:blank] 13:58:28 INFO - --DOMWINDOW == 87 (0x7f4afe0ae000) [pid = 2212] [serial = 1421] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:58:29 INFO - --DOMWINDOW == 86 (0x7f4b0ab88000) [pid = 2212] [serial = 1465] [outer = (nil)] [url = data:text/html,<html></html>] 13:58:29 INFO - --DOMWINDOW == 85 (0x7f4b0ac02800) [pid = 2212] [serial = 1466] [outer = (nil)] [url = about:blank] 13:58:29 INFO - --DOMWINDOW == 84 (0x7f4afc867c00) [pid = 2212] [serial = 1471] [outer = (nil)] [url = data:text/html,<html></html>] 13:58:29 INFO - --DOMWINDOW == 83 (0x7f4b0a662000) [pid = 2212] [serial = 1462] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 13:58:29 INFO - --DOMWINDOW == 82 (0x7f4b0ab84800) [pid = 2212] [serial = 1464] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 13:58:29 INFO - --DOMWINDOW == 81 (0x7f4b09e55000) [pid = 2212] [serial = 1457] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 13:58:29 INFO - --DOMWINDOW == 80 (0x7f4b12abb800) [pid = 2212] [serial = 1487] [outer = (nil)] [url = about:blank] 13:58:29 INFO - --DOMWINDOW == 79 (0x7f4afd342c00) [pid = 2212] [serial = 1426] [outer = (nil)] [url = about:blank] 13:58:29 INFO - --DOMWINDOW == 78 (0x7f4afd3b2800) [pid = 2212] [serial = 1427] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20autocompletion%20bug%20in%20document.body] 13:58:29 INFO - --DOMWINDOW == 77 (0x7f4afd33a800) [pid = 2212] [serial = 1425] [outer = (nil)] [url = about:blank] 13:58:29 INFO - --DOMWINDOW == 76 (0x7f4b012dc800) [pid = 2212] [serial = 1434] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:58:29 INFO - --DOMWINDOW == 75 (0x7f4afe010000) [pid = 2212] [serial = 1429] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:58:29 INFO - --DOMWINDOW == 74 (0x7f4afd341000) [pid = 2212] [serial = 1432] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:58:29 INFO - --DOMWINDOW == 73 (0x7f4afe00a000) [pid = 2212] [serial = 1441] [outer = (nil)] [url = about:blank] 13:58:29 INFO - --DOMWINDOW == 72 (0x7f4b0984dc00) [pid = 2212] [serial = 1480] [outer = (nil)] [url = about:blank] 13:58:29 INFO - --DOMWINDOW == 71 (0x7f4afe8c1400) [pid = 2212] [serial = 1477] [outer = (nil)] [url = about:blank] 13:58:29 INFO - --DOMWINDOW == 70 (0x7f4afe3e1000) [pid = 2212] [serial = 1447] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 13:58:29 INFO - --DOMWINDOW == 69 (0x7f4afe816000) [pid = 2212] [serial = 1449] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 13:58:29 INFO - --DOMWINDOW == 68 (0x7f4afe818000) [pid = 2212] [serial = 1450] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 13:58:29 INFO - --DOMWINDOW == 67 (0x7f4afe3e2000) [pid = 2212] [serial = 1448] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 13:58:29 INFO - --DOMWINDOW == 66 (0x7f4afc866c00) [pid = 2212] [serial = 1436] [outer = (nil)] [url = about:blank] 13:58:29 INFO - --DOMWINDOW == 65 (0x7f4afd03f800) [pid = 2212] [serial = 1437] [outer = (nil)] [url = about:blank] 13:58:29 INFO - --DOCSHELL 0x7f4b12e62800 == 16 [pid = 2212] [id = 619] 13:58:30 INFO - MEMORY STAT | vsize 1185MB | residentFast 328MB | heapAllocated 127MB 13:58:30 INFO - 290 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_658368_time_methods.js | took 9053ms 13:58:30 INFO - ++DOCSHELL 0x7f4afd598800 == 17 [pid = 2212] [id = 623] 13:58:30 INFO - ++DOMWINDOW == 66 (0x7f4afd3ae400) [pid = 2212] [serial = 1493] [outer = (nil)] 13:58:30 INFO - ++DOMWINDOW == 67 (0x7f4afd3b2400) [pid = 2212] [serial = 1494] [outer = 0x7f4afd3ae400] 13:58:30 INFO - 291 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_659907_console_dir.js 13:58:30 INFO - ++DOCSHELL 0x7f4afe85c800 == 18 [pid = 2212] [id = 624] 13:58:30 INFO - ++DOMWINDOW == 68 (0x7f4afe00ec00) [pid = 2212] [serial = 1495] [outer = (nil)] 13:58:30 INFO - ++DOMWINDOW == 69 (0x7f4afe0a8c00) [pid = 2212] [serial = 1496] [outer = 0x7f4afe00ec00] 13:58:30 INFO - ++DOCSHELL 0x7f4aff202800 == 19 [pid = 2212] [id = 625] 13:58:30 INFO - ++DOMWINDOW == 70 (0x7f4afe0b2000) [pid = 2212] [serial = 1497] [outer = (nil)] 13:58:30 INFO - ++DOMWINDOW == 71 (0x7f4afe1f2c00) [pid = 2212] [serial = 1498] [outer = 0x7f4afe0b2000] 13:58:31 INFO - ++DOMWINDOW == 72 (0x7f4afe4c8c00) [pid = 2212] [serial = 1499] [outer = 0x7f4afe0b2000] 13:58:31 INFO - ++DOCSHELL 0x7f4aff2ce000 == 20 [pid = 2212] [id = 626] 13:58:31 INFO - ++DOMWINDOW == 73 (0x7f4afe8ac800) [pid = 2212] [serial = 1500] [outer = (nil)] 13:58:31 INFO - ++DOMWINDOW == 74 (0x7f4afe8b6800) [pid = 2212] [serial = 1501] [outer = 0x7f4afe8ac800] 13:58:33 INFO - ++DOCSHELL 0x7f4afdada800 == 21 [pid = 2212] [id = 627] 13:58:33 INFO - ++DOMWINDOW == 75 (0x7f4afd33d400) [pid = 2212] [serial = 1502] [outer = (nil)] 13:58:33 INFO - ++DOMWINDOW == 76 (0x7f4afd341800) [pid = 2212] [serial = 1503] [outer = 0x7f4afd33d400] 13:58:33 INFO - [2212] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3476 13:58:40 INFO - --DOCSHELL 0x7f4afdada800 == 20 [pid = 2212] [id = 627] 13:58:43 INFO - --DOCSHELL 0x7f4afe2ca000 == 19 [pid = 2212] [id = 599] 13:58:43 INFO - --DOCSHELL 0x7f4aff202800 == 18 [pid = 2212] [id = 625] 13:58:43 INFO - --DOCSHELL 0x7f4aff2ce000 == 17 [pid = 2212] [id = 626] 13:58:43 INFO - --DOCSHELL 0x7f4b14954800 == 16 [pid = 2212] [id = 620] 13:58:43 INFO - --DOCSHELL 0x7f4afd9ae800 == 15 [pid = 2212] [id = 617] 13:58:43 INFO - --DOCSHELL 0x7f4afd598000 == 14 [pid = 2212] [id = 616] 13:58:43 INFO - --DOCSHELL 0x7f4b1991e000 == 13 [pid = 2212] [id = 621] 13:58:43 INFO - --DOCSHELL 0x7f4b10bdc800 == 12 [pid = 2212] [id = 618] 13:58:43 INFO - --DOCSHELL 0x7f4afd9a7000 == 11 [pid = 2212] [id = 598] 13:58:43 INFO - --DOCSHELL 0x7f4afe4f3000 == 10 [pid = 2212] [id = 600] 13:58:43 INFO - --DOMWINDOW == 75 (0x7f4afd946c00) [pid = 2212] [serial = 1428] [outer = (nil)] [url = about:blank] 13:58:43 INFO - --DOMWINDOW == 74 (0x7f4afc862400) [pid = 2212] [serial = 1470] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 13:58:43 INFO - --DOMWINDOW == 73 (0x7f4afc859c00) [pid = 2212] [serial = 1468] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 13:58:43 INFO - --DOMWINDOW == 72 (0x7f4b0a03e400) [pid = 2212] [serial = 1459] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 13:58:43 INFO - --DOMWINDOW == 71 (0x7f4b07a13800) [pid = 2212] [serial = 1455] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 13:58:43 INFO - --DOMWINDOW == 70 (0x7f4b07a11800) [pid = 2212] [serial = 1454] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 13:58:43 INFO - --DOMWINDOW == 69 (0x7f4b07a10000) [pid = 2212] [serial = 1453] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 13:58:43 INFO - --DOMWINDOW == 68 (0x7f4afe8aa400) [pid = 2212] [serial = 1452] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 13:58:43 INFO - --DOMWINDOW == 67 (0x7f4b00f2f400) [pid = 2212] [serial = 1435] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:58:43 INFO - --DOMWINDOW == 66 (0x7f4afe54f000) [pid = 2212] [serial = 1433] [outer = (nil)] [url = about:blank] 13:58:43 INFO - --DOMWINDOW == 65 (0x7f4afe1e8c00) [pid = 2212] [serial = 1431] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:58:44 INFO - --DOMWINDOW == 64 (0x7f4afe8a6000) [pid = 2212] [serial = 1451] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 13:58:44 INFO - --DOMWINDOW == 63 (0x7f4b0a865000) [pid = 2212] [serial = 1463] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 13:58:44 INFO - --DOMWINDOW == 62 (0x7f4b07a0f400) [pid = 2212] [serial = 1461] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 13:58:44 INFO - --DOMWINDOW == 61 (0x7f4afe0acc00) [pid = 2212] [serial = 1458] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 13:58:44 INFO - --DOMWINDOW == 60 (0x7f4afe3de000) [pid = 2212] [serial = 1445] [outer = (nil)] [url = chrome://devtools/content/markupview/markup-view.xhtml] 13:58:44 INFO - --DOMWINDOW == 59 (0x7f4b12ab3c00) [pid = 2212] [serial = 1486] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:58:44 INFO - --DOMWINDOW == 58 (0x7f4afe0b0400) [pid = 2212] [serial = 1443] [outer = (nil)] [url = chrome://devtools/content/inspector/inspector.xul] 13:58:44 INFO - --DOMWINDOW == 57 (0x7f4b1237cc00) [pid = 2212] [serial = 1482] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:58:44 INFO - --DOMWINDOW == 56 (0x7f4b0c4e5800) [pid = 2212] [serial = 1472] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:58:44 INFO - --DOMWINDOW == 55 (0x7f4b0984cc00) [pid = 2212] [serial = 1479] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:58:44 INFO - --DOMWINDOW == 54 (0x7f4afd3aec00) [pid = 2212] [serial = 1440] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:58:44 INFO - --DOMWINDOW == 53 (0x7f4b12378800) [pid = 2212] [serial = 1489] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:58:44 INFO - --DOMWINDOW == 52 (0x7f4b13011800) [pid = 2212] [serial = 1484] [outer = (nil)] [url = data:text/html;charset=utf-8,<script>console.timeEnd('bTimer');</script>] 13:58:44 INFO - --DOMWINDOW == 51 (0x7f4afe8bc800) [pid = 2212] [serial = 1476] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-658368-time-methods.html] 13:58:44 INFO - --DOMWINDOW == 50 (0x7f4afd3a6400) [pid = 2212] [serial = 1438] [outer = (nil)] [url = data:text/html;charset=utf-8,test%20for%20highlighter%20helper%20in%20web%20console] 13:58:44 INFO - --DOMWINDOW == 49 (0x7f4afe4be400) [pid = 2212] [serial = 1474] [outer = (nil)] [url = about:blank] 13:58:44 INFO - --DOMWINDOW == 48 (0x7f4afe4c7000) [pid = 2212] [serial = 1475] [outer = (nil)] [url = about:blank] 13:58:44 INFO - --DOMWINDOW == 47 (0x7f4afe1f2c00) [pid = 2212] [serial = 1498] [outer = (nil)] [url = about:blank] 13:58:44 INFO - --DOMWINDOW == 46 (0x7f4b15946400) [pid = 2212] [serial = 1492] [outer = (nil)] [url = data:text/html;charset=utf-8,<script>console.timeEnd('bTimer');</script>] 13:58:44 INFO - --DOMWINDOW == 45 (0x7f4b257e9800) [pid = 2212] [serial = 1491] [outer = (nil)] [url = data:text/html;charset=utf-8,<script>console.time('bTimer');</script>] 13:58:44 INFO - --DOMWINDOW == 44 (0x7f4b1404d800) [pid = 2212] [serial = 1485] [outer = (nil)] [url = about:blank] 13:58:44 INFO - --DOMWINDOW == 43 (0x7f4afd3ac800) [pid = 2212] [serial = 1439] [outer = (nil)] [url = about:blank] 13:58:44 INFO - --DOMWINDOW == 42 (0x7f4b09580c00) [pid = 2212] [serial = 1478] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-658368-time-methods.html] 13:58:44 INFO - MEMORY STAT | vsize 1181MB | residentFast 330MB | heapAllocated 127MB 13:58:44 INFO - 292 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_659907_console_dir.js | took 14124ms 13:58:44 INFO - ++DOCSHELL 0x7f4afd9b0800 == 11 [pid = 2212] [id = 628] 13:58:44 INFO - ++DOMWINDOW == 43 (0x7f4afc867c00) [pid = 2212] [serial = 1504] [outer = (nil)] 13:58:44 INFO - ++DOMWINDOW == 44 (0x7f4afd03f000) [pid = 2212] [serial = 1505] [outer = 0x7f4afc867c00] 13:58:44 INFO - 293 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_660806_history_nav.js 13:58:44 INFO - ++DOCSHELL 0x7f4afe2c8000 == 12 [pid = 2212] [id = 629] 13:58:44 INFO - ++DOMWINDOW == 45 (0x7f4afd3a4400) [pid = 2212] [serial = 1506] [outer = (nil)] 13:58:44 INFO - ++DOMWINDOW == 46 (0x7f4afd3aa400) [pid = 2212] [serial = 1507] [outer = 0x7f4afd3a4400] 13:58:45 INFO - ++DOCSHELL 0x7f4afd9a9800 == 13 [pid = 2212] [id = 630] 13:58:45 INFO - ++DOMWINDOW == 47 (0x7f4afd3ad400) [pid = 2212] [serial = 1508] [outer = (nil)] 13:58:45 INFO - ++DOMWINDOW == 48 (0x7f4afe00ac00) [pid = 2212] [serial = 1509] [outer = 0x7f4afd3ad400] 13:58:45 INFO - ++DOMWINDOW == 49 (0x7f4afe0b3400) [pid = 2212] [serial = 1510] [outer = 0x7f4afd3ad400] 13:58:45 INFO - ++DOCSHELL 0x7f4aff21e000 == 14 [pid = 2212] [id = 631] 13:58:45 INFO - ++DOMWINDOW == 50 (0x7f4afe4c6800) [pid = 2212] [serial = 1511] [outer = (nil)] 13:58:45 INFO - ++DOMWINDOW == 51 (0x7f4afe54ec00) [pid = 2212] [serial = 1512] [outer = 0x7f4afe4c6800] 13:58:48 INFO - --DOCSHELL 0x7f4aff21e000 == 13 [pid = 2212] [id = 631] 13:58:48 INFO - --DOCSHELL 0x7f4afd598800 == 12 [pid = 2212] [id = 623] 13:58:48 INFO - --DOCSHELL 0x7f4afe85c800 == 11 [pid = 2212] [id = 624] 13:58:48 INFO - --DOMWINDOW == 50 (0x7f4b1960d800) [pid = 2212] [serial = 1490] [outer = (nil)] [url = about:blank] 13:58:48 INFO - --DOMWINDOW == 49 (0x7f4b1450a400) [pid = 2212] [serial = 1488] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:58:48 INFO - --DOMWINDOW == 48 (0x7f4b1237ec00) [pid = 2212] [serial = 1483] [outer = (nil)] [url = about:blank] 13:58:48 INFO - --DOMWINDOW == 47 (0x7f4b099c0400) [pid = 2212] [serial = 1481] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:58:48 INFO - --DOMWINDOW == 46 (0x7f4b0fbae400) [pid = 2212] [serial = 1473] [outer = (nil)] [url = about:blank] 13:58:48 INFO - --DOMWINDOW == 45 (0x7f4afc85f000) [pid = 2212] [serial = 1469] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 13:58:48 INFO - --DOMWINDOW == 44 (0x7f4afc723800) [pid = 2212] [serial = 1467] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 13:58:48 INFO - --DOMWINDOW == 43 (0x7f4b0a9d2c00) [pid = 2212] [serial = 1460] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 13:58:48 INFO - --DOMWINDOW == 42 (0x7f4b089f1000) [pid = 2212] [serial = 1456] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 13:58:48 INFO - --DOMWINDOW == 41 (0x7f4afe3dec00) [pid = 2212] [serial = 1446] [outer = (nil)] [url = about:blank] 13:58:48 INFO - --DOMWINDOW == 40 (0x7f4b07a07000) [pid = 2212] [serial = 1444] [outer = (nil)] [url = about:blank] 13:58:48 INFO - --DOMWINDOW == 39 (0x7f4afe3d6400) [pid = 2212] [serial = 1442] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:58:49 INFO - --DOMWINDOW == 38 (0x7f4afd33d400) [pid = 2212] [serial = 1502] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:58:49 INFO - --DOMWINDOW == 37 (0x7f4afe00ec00) [pid = 2212] [serial = 1495] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20659907:%20Expand%20console%20object%20with%20a%20dir%20method] 13:58:49 INFO - --DOMWINDOW == 36 (0x7f4afd3ae400) [pid = 2212] [serial = 1493] [outer = (nil)] [url = about:blank] 13:58:49 INFO - --DOMWINDOW == 35 (0x7f4afd3b2400) [pid = 2212] [serial = 1494] [outer = (nil)] [url = about:blank] 13:58:49 INFO - --DOMWINDOW == 34 (0x7f4afe00ac00) [pid = 2212] [serial = 1509] [outer = (nil)] [url = about:blank] 13:58:49 INFO - --DOMWINDOW == 33 (0x7f4afe0b2000) [pid = 2212] [serial = 1497] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:58:49 INFO - --DOMWINDOW == 32 (0x7f4afe8ac800) [pid = 2212] [serial = 1500] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:58:49 INFO - MEMORY STAT | vsize 1181MB | residentFast 321MB | heapAllocated 121MB 13:58:49 INFO - 294 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_660806_history_nav.js | took 4543ms 13:58:49 INFO - ++DOCSHELL 0x7f4afd9ad000 == 12 [pid = 2212] [id = 632] 13:58:49 INFO - ++DOMWINDOW == 33 (0x7f4afc864000) [pid = 2212] [serial = 1513] [outer = (nil)] 13:58:49 INFO - ++DOMWINDOW == 34 (0x7f4afd034c00) [pid = 2212] [serial = 1514] [outer = 0x7f4afc864000] 13:58:49 INFO - 295 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_664131_console_group.js 13:58:49 INFO - ++DOCSHELL 0x7f4afe394000 == 13 [pid = 2212] [id = 633] 13:58:49 INFO - ++DOMWINDOW == 35 (0x7f4afd342800) [pid = 2212] [serial = 1515] [outer = (nil)] 13:58:49 INFO - ++DOMWINDOW == 36 (0x7f4afd3a6c00) [pid = 2212] [serial = 1516] [outer = 0x7f4afd342800] 13:58:50 INFO - ++DOCSHELL 0x7f4afd59b800 == 14 [pid = 2212] [id = 634] 13:58:50 INFO - ++DOMWINDOW == 37 (0x7f4afd3aa800) [pid = 2212] [serial = 1517] [outer = (nil)] 13:58:50 INFO - ++DOMWINDOW == 38 (0x7f4afd94c400) [pid = 2212] [serial = 1518] [outer = 0x7f4afd3aa800] 13:58:50 INFO - ++DOMWINDOW == 39 (0x7f4afe0adc00) [pid = 2212] [serial = 1519] [outer = 0x7f4afd3aa800] 13:58:50 INFO - ++DOCSHELL 0x7f4aff21d800 == 15 [pid = 2212] [id = 635] 13:58:50 INFO - ++DOMWINDOW == 40 (0x7f4afe3e3400) [pid = 2212] [serial = 1520] [outer = (nil)] 13:58:50 INFO - ++DOMWINDOW == 41 (0x7f4afe4c0c00) [pid = 2212] [serial = 1521] [outer = 0x7f4afe3e3400] 13:58:54 INFO - --DOCSHELL 0x7f4afd9b0800 == 14 [pid = 2212] [id = 628] 13:58:54 INFO - --DOCSHELL 0x7f4afe2c8000 == 13 [pid = 2212] [id = 629] 13:58:54 INFO - --DOCSHELL 0x7f4afd59b800 == 12 [pid = 2212] [id = 634] 13:58:54 INFO - --DOCSHELL 0x7f4aff21d800 == 11 [pid = 2212] [id = 635] 13:58:54 INFO - --DOCSHELL 0x7f4afd9a9800 == 10 [pid = 2212] [id = 630] 13:58:54 INFO - --DOMWINDOW == 40 (0x7f4afe4c8c00) [pid = 2212] [serial = 1499] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:58:54 INFO - --DOMWINDOW == 39 (0x7f4afe8b6800) [pid = 2212] [serial = 1501] [outer = (nil)] [url = about:blank] 13:58:54 INFO - --DOMWINDOW == 38 (0x7f4afd341800) [pid = 2212] [serial = 1503] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 13:58:54 INFO - --DOMWINDOW == 37 (0x7f4afe0a8c00) [pid = 2212] [serial = 1496] [outer = (nil)] [url = about:blank] 13:58:54 INFO - --DOMWINDOW == 36 (0x7f4afd03f000) [pid = 2212] [serial = 1505] [outer = (nil)] [url = about:blank] 13:58:54 INFO - --DOMWINDOW == 35 (0x7f4afd3aa400) [pid = 2212] [serial = 1507] [outer = (nil)] [url = about:blank] 13:58:54 INFO - --DOMWINDOW == 34 (0x7f4afd94c400) [pid = 2212] [serial = 1518] [outer = (nil)] [url = about:blank] 13:58:54 INFO - --DOMWINDOW == 33 (0x7f4afe4c6800) [pid = 2212] [serial = 1511] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:58:54 INFO - --DOMWINDOW == 32 (0x7f4afd3ad400) [pid = 2212] [serial = 1508] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:58:54 INFO - --DOMWINDOW == 31 (0x7f4afc867c00) [pid = 2212] [serial = 1504] [outer = (nil)] [url = about:blank] 13:58:54 INFO - --DOMWINDOW == 30 (0x7f4afd3a4400) [pid = 2212] [serial = 1506] [outer = (nil)] [url = data:text/html;charset=utf-8,<p>bug%20660806%20-%20history%20navigation%20must%20not%20show%20the%20autocomplete%20popup] 13:58:54 INFO - MEMORY STAT | vsize 1178MB | residentFast 308MB | heapAllocated 115MB 13:58:54 INFO - 296 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_664131_console_group.js | took 5223ms 13:58:54 INFO - ++DOCSHELL 0x7f4afd9a7800 == 11 [pid = 2212] [id = 636] 13:58:54 INFO - ++DOMWINDOW == 31 (0x7f4afc861000) [pid = 2212] [serial = 1522] [outer = (nil)] 13:58:54 INFO - ++DOMWINDOW == 32 (0x7f4afd040000) [pid = 2212] [serial = 1523] [outer = 0x7f4afc861000] 13:58:55 INFO - 297 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_686937_autocomplete_JSTerm_helpers.js 13:58:55 INFO - ++DOCSHELL 0x7f4afe3a9000 == 12 [pid = 2212] [id = 637] 13:58:55 INFO - ++DOMWINDOW == 33 (0x7f4afd3ab800) [pid = 2212] [serial = 1524] [outer = (nil)] 13:58:55 INFO - ++DOMWINDOW == 34 (0x7f4afd3b1400) [pid = 2212] [serial = 1525] [outer = 0x7f4afd3ab800] 13:58:55 INFO - ++DOCSHELL 0x7f4afd9b3800 == 13 [pid = 2212] [id = 638] 13:58:55 INFO - ++DOMWINDOW == 35 (0x7f4afd3b2400) [pid = 2212] [serial = 1526] [outer = (nil)] 13:58:55 INFO - ++DOMWINDOW == 36 (0x7f4afe008800) [pid = 2212] [serial = 1527] [outer = 0x7f4afd3b2400] 13:58:55 INFO - ++DOMWINDOW == 37 (0x7f4afe0b2400) [pid = 2212] [serial = 1528] [outer = 0x7f4afd3b2400] 13:58:55 INFO - ++DOCSHELL 0x7f4aff21e800 == 14 [pid = 2212] [id = 639] 13:58:55 INFO - ++DOMWINDOW == 38 (0x7f4afe4c5400) [pid = 2212] [serial = 1529] [outer = (nil)] 13:58:55 INFO - ++DOMWINDOW == 39 (0x7f4afe4c9400) [pid = 2212] [serial = 1530] [outer = 0x7f4afe4c5400] 13:59:02 INFO - --DOCSHELL 0x7f4afd9b3800 == 13 [pid = 2212] [id = 638] 13:59:02 INFO - --DOCSHELL 0x7f4aff21e800 == 12 [pid = 2212] [id = 639] 13:59:02 INFO - --DOCSHELL 0x7f4afd9ad000 == 11 [pid = 2212] [id = 632] 13:59:02 INFO - --DOCSHELL 0x7f4afe394000 == 10 [pid = 2212] [id = 633] 13:59:02 INFO - --DOMWINDOW == 38 (0x7f4afe0b3400) [pid = 2212] [serial = 1510] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:02 INFO - --DOMWINDOW == 37 (0x7f4afe54ec00) [pid = 2212] [serial = 1512] [outer = (nil)] [url = about:blank] 13:59:02 INFO - --DOMWINDOW == 36 (0x7f4afe008800) [pid = 2212] [serial = 1527] [outer = (nil)] [url = about:blank] 13:59:02 INFO - --DOMWINDOW == 35 (0x7f4afe3e3400) [pid = 2212] [serial = 1520] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:59:02 INFO - --DOMWINDOW == 34 (0x7f4afd3aa800) [pid = 2212] [serial = 1517] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:02 INFO - --DOMWINDOW == 33 (0x7f4afc864000) [pid = 2212] [serial = 1513] [outer = (nil)] [url = about:blank] 13:59:02 INFO - --DOMWINDOW == 32 (0x7f4afd342800) [pid = 2212] [serial = 1515] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20664131:%20Expand%20console%20object%20with%20group%20methods] 13:59:02 INFO - --DOMWINDOW == 31 (0x7f4afd034c00) [pid = 2212] [serial = 1514] [outer = (nil)] [url = about:blank] 13:59:02 INFO - --DOMWINDOW == 30 (0x7f4afd3a6c00) [pid = 2212] [serial = 1516] [outer = (nil)] [url = about:blank] 13:59:02 INFO - MEMORY STAT | vsize 1178MB | residentFast 305MB | heapAllocated 117MB 13:59:02 INFO - 298 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_686937_autocomplete_JSTerm_helpers.js | took 7645ms 13:59:02 INFO - ++DOCSHELL 0x7f4afd9ad000 == 11 [pid = 2212] [id = 640] 13:59:02 INFO - ++DOMWINDOW == 31 (0x7f4afc862c00) [pid = 2212] [serial = 1531] [outer = (nil)] 13:59:02 INFO - ++DOMWINDOW == 32 (0x7f4afd03ec00) [pid = 2212] [serial = 1532] [outer = 0x7f4afc862c00] 13:59:03 INFO - 299 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_704295.js 13:59:03 INFO - ++DOCSHELL 0x7f4afe394000 == 12 [pid = 2212] [id = 641] 13:59:03 INFO - ++DOMWINDOW == 33 (0x7f4afd3a7000) [pid = 2212] [serial = 1533] [outer = (nil)] 13:59:03 INFO - ++DOMWINDOW == 34 (0x7f4afd3af000) [pid = 2212] [serial = 1534] [outer = 0x7f4afd3a7000] 13:59:03 INFO - ++DOMWINDOW == 35 (0x7f4afd94ec00) [pid = 2212] [serial = 1535] [outer = 0x7f4afd3a7000] 13:59:03 INFO - ++DOCSHELL 0x7f4afd9ae800 == 13 [pid = 2212] [id = 642] 13:59:03 INFO - ++DOMWINDOW == 36 (0x7f4afe0b0400) [pid = 2212] [serial = 1536] [outer = (nil)] 13:59:03 INFO - ++DOMWINDOW == 37 (0x7f4afe1e7c00) [pid = 2212] [serial = 1537] [outer = 0x7f4afe0b0400] 13:59:03 INFO - ++DOMWINDOW == 38 (0x7f4afe3dc800) [pid = 2212] [serial = 1538] [outer = 0x7f4afe0b0400] 13:59:03 INFO - ++DOCSHELL 0x7f4aff290800 == 14 [pid = 2212] [id = 643] 13:59:03 INFO - ++DOMWINDOW == 39 (0x7f4afe571000) [pid = 2212] [serial = 1539] [outer = (nil)] 13:59:03 INFO - ++DOMWINDOW == 40 (0x7f4afe574c00) [pid = 2212] [serial = 1540] [outer = 0x7f4afe571000] 13:59:08 INFO - --DOCSHELL 0x7f4afd9a7800 == 13 [pid = 2212] [id = 636] 13:59:08 INFO - --DOCSHELL 0x7f4afe3a9000 == 12 [pid = 2212] [id = 637] 13:59:08 INFO - --DOCSHELL 0x7f4afd9ae800 == 11 [pid = 2212] [id = 642] 13:59:08 INFO - --DOCSHELL 0x7f4aff290800 == 10 [pid = 2212] [id = 643] 13:59:08 INFO - --DOMWINDOW == 39 (0x7f4afe0adc00) [pid = 2212] [serial = 1519] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:08 INFO - --DOMWINDOW == 38 (0x7f4afe4c0c00) [pid = 2212] [serial = 1521] [outer = (nil)] [url = about:blank] 13:59:08 INFO - --DOMWINDOW == 37 (0x7f4afd040000) [pid = 2212] [serial = 1523] [outer = (nil)] [url = about:blank] 13:59:08 INFO - --DOMWINDOW == 36 (0x7f4afd3b1400) [pid = 2212] [serial = 1525] [outer = (nil)] [url = about:blank] 13:59:08 INFO - --DOMWINDOW == 35 (0x7f4afd3af000) [pid = 2212] [serial = 1534] [outer = (nil)] [url = about:blank] 13:59:08 INFO - --DOMWINDOW == 34 (0x7f4afe1e7c00) [pid = 2212] [serial = 1537] [outer = (nil)] [url = about:blank] 13:59:08 INFO - --DOMWINDOW == 33 (0x7f4afe4c5400) [pid = 2212] [serial = 1529] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:59:08 INFO - --DOMWINDOW == 32 (0x7f4afd3b2400) [pid = 2212] [serial = 1526] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:08 INFO - --DOMWINDOW == 31 (0x7f4afc861000) [pid = 2212] [serial = 1522] [outer = (nil)] [url = about:blank] 13:59:08 INFO - --DOMWINDOW == 30 (0x7f4afd3ab800) [pid = 2212] [serial = 1524] [outer = (nil)] [url = data:text/html;charset=utf8,<p>test%20JSTerm%20Helpers%20autocomplete] 13:59:09 INFO - MEMORY STAT | vsize 1178MB | residentFast 304MB | heapAllocated 116MB 13:59:09 INFO - 300 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_704295.js | took 6016ms 13:59:09 INFO - ++DOCSHELL 0x7f4afd9b0000 == 11 [pid = 2212] [id = 644] 13:59:09 INFO - ++DOMWINDOW == 31 (0x7f4afc866000) [pid = 2212] [serial = 1541] [outer = (nil)] 13:59:09 INFO - ++DOMWINDOW == 32 (0x7f4afd041c00) [pid = 2212] [serial = 1542] [outer = 0x7f4afc866000] 13:59:09 INFO - 301 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_734061_No_input_change_and_Tab_key_pressed.js 13:59:09 INFO - ++DOCSHELL 0x7f4afe4e1800 == 12 [pid = 2212] [id = 645] 13:59:09 INFO - ++DOMWINDOW == 33 (0x7f4afd3adc00) [pid = 2212] [serial = 1543] [outer = (nil)] 13:59:09 INFO - ++DOMWINDOW == 34 (0x7f4afd3b2800) [pid = 2212] [serial = 1544] [outer = 0x7f4afd3adc00] 13:59:09 INFO - ++DOMWINDOW == 35 (0x7f4afe00ac00) [pid = 2212] [serial = 1545] [outer = 0x7f4afd3adc00] 13:59:09 INFO - ++DOCSHELL 0x7f4afe2cd800 == 13 [pid = 2212] [id = 646] 13:59:09 INFO - ++DOMWINDOW == 36 (0x7f4afe0ae000) [pid = 2212] [serial = 1546] [outer = (nil)] 13:59:09 INFO - ++DOMWINDOW == 37 (0x7f4afe0b1000) [pid = 2212] [serial = 1547] [outer = 0x7f4afe0ae000] 13:59:09 INFO - ++DOMWINDOW == 38 (0x7f4afe3dd800) [pid = 2212] [serial = 1548] [outer = 0x7f4afe0ae000] 13:59:10 INFO - ++DOCSHELL 0x7f4aff2b6800 == 14 [pid = 2212] [id = 647] 13:59:10 INFO - ++DOMWINDOW == 39 (0x7f4afe576000) [pid = 2212] [serial = 1549] [outer = (nil)] 13:59:10 INFO - ++DOMWINDOW == 40 (0x7f4afe57e800) [pid = 2212] [serial = 1550] [outer = 0x7f4afe576000] 13:59:12 INFO - --DOCSHELL 0x7f4afe394000 == 13 [pid = 2212] [id = 641] 13:59:12 INFO - --DOCSHELL 0x7f4afd9ad000 == 12 [pid = 2212] [id = 640] 13:59:12 INFO - --DOCSHELL 0x7f4aff2b6800 == 11 [pid = 2212] [id = 647] 13:59:13 INFO - --DOMWINDOW == 39 (0x7f4afe4c9400) [pid = 2212] [serial = 1530] [outer = (nil)] [url = about:blank] 13:59:13 INFO - --DOMWINDOW == 38 (0x7f4afe0b2400) [pid = 2212] [serial = 1528] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:13 INFO - --DOMWINDOW == 37 (0x7f4afd3b2800) [pid = 2212] [serial = 1544] [outer = (nil)] [url = about:blank] 13:59:13 INFO - --DOMWINDOW == 36 (0x7f4afd03ec00) [pid = 2212] [serial = 1532] [outer = (nil)] [url = about:blank] 13:59:13 INFO - --DOMWINDOW == 35 (0x7f4afe0b1000) [pid = 2212] [serial = 1547] [outer = (nil)] [url = about:blank] 13:59:13 INFO - --DOMWINDOW == 34 (0x7f4afe571000) [pid = 2212] [serial = 1539] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:59:13 INFO - --DOMWINDOW == 33 (0x7f4afe0b0400) [pid = 2212] [serial = 1536] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:13 INFO - --DOMWINDOW == 32 (0x7f4afd3a7000) [pid = 2212] [serial = 1533] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:59:13 INFO - --DOMWINDOW == 31 (0x7f4afc862c00) [pid = 2212] [serial = 1531] [outer = (nil)] [url = about:blank] 13:59:13 INFO - --DOMWINDOW == 30 (0x7f4afd94ec00) [pid = 2212] [serial = 1535] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:59:13 INFO - MEMORY STAT | vsize 1180MB | residentFast 305MB | heapAllocated 116MB 13:59:13 INFO - 302 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_734061_No_input_change_and_Tab_key_pressed.js | took 4219ms 13:59:13 INFO - ++DOCSHELL 0x7f4afd9ad000 == 12 [pid = 2212] [id = 648] 13:59:13 INFO - ++DOMWINDOW == 31 (0x7f4afc861000) [pid = 2212] [serial = 1551] [outer = (nil)] 13:59:13 INFO - ++DOMWINDOW == 32 (0x7f4afd033800) [pid = 2212] [serial = 1552] [outer = 0x7f4afc861000] 13:59:13 INFO - 303 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_737873_mixedcontent.js 13:59:13 INFO - ++DOCSHELL 0x7f4afe4f9800 == 13 [pid = 2212] [id = 649] 13:59:13 INFO - ++DOMWINDOW == 33 (0x7f4afd3ad000) [pid = 2212] [serial = 1553] [outer = (nil)] 13:59:13 INFO - ++DOMWINDOW == 34 (0x7f4afd3b2800) [pid = 2212] [serial = 1554] [outer = 0x7f4afd3ad000] 13:59:14 INFO - ++DOCSHELL 0x7f4afd5a1800 == 14 [pid = 2212] [id = 650] 13:59:14 INFO - ++DOMWINDOW == 35 (0x7f4afd943c00) [pid = 2212] [serial = 1555] [outer = (nil)] 13:59:14 INFO - ++DOMWINDOW == 36 (0x7f4afe0b0c00) [pid = 2212] [serial = 1556] [outer = 0x7f4afd943c00] 13:59:14 INFO - ++DOMWINDOW == 37 (0x7f4afe3d8400) [pid = 2212] [serial = 1557] [outer = 0x7f4afd943c00] 13:59:14 INFO - ++DOCSHELL 0x7f4aff2c6800 == 15 [pid = 2212] [id = 651] 13:59:14 INFO - ++DOMWINDOW == 38 (0x7f4afe576800) [pid = 2212] [serial = 1558] [outer = (nil)] 13:59:14 INFO - ++DOMWINDOW == 39 (0x7f4afe57f400) [pid = 2212] [serial = 1559] [outer = 0x7f4afe576800] 13:59:16 INFO - ++DOMWINDOW == 40 (0x7f4b012df800) [pid = 2212] [serial = 1560] [outer = 0x7f4afd3ad000] 13:59:16 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:59:16 INFO - ++DOCSHELL 0x7f4b0c393000 == 16 [pid = 2212] [id = 652] 13:59:16 INFO - ++DOMWINDOW == 41 (0x7f4afc722800) [pid = 2212] [serial = 1561] [outer = (nil)] 13:59:16 INFO - [2212] WARNING: non-IME selection type: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 13:59:16 INFO - [2212] WARNING: Requested underline style is not valid: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5295 13:59:16 INFO - ++DOMWINDOW == 42 (0x7f4b07a10c00) [pid = 2212] [serial = 1562] [outer = 0x7f4afc722800] 13:59:16 INFO - [2212] WARNING: Requested underline style is not valid: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 5295 13:59:16 INFO - [2212] WARNING: non-IME selection type: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/generic/nsTextFrame.cpp, line 353 13:59:17 INFO - ++DOMWINDOW == 43 (0x7f4afc725400) [pid = 2212] [serial = 1563] [outer = 0x7f4afc722800] 13:59:17 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:59:18 INFO - --DOCSHELL 0x7f4afd9b0000 == 15 [pid = 2212] [id = 644] 13:59:18 INFO - --DOCSHELL 0x7f4afd5a1800 == 14 [pid = 2212] [id = 650] 13:59:18 INFO - --DOCSHELL 0x7f4aff2c6800 == 13 [pid = 2212] [id = 651] 13:59:18 INFO - --DOCSHELL 0x7f4afe4e1800 == 12 [pid = 2212] [id = 645] 13:59:18 INFO - --DOCSHELL 0x7f4afe2cd800 == 11 [pid = 2212] [id = 646] 13:59:18 INFO - --DOMWINDOW == 42 (0x7f4afe3dc800) [pid = 2212] [serial = 1538] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:18 INFO - --DOMWINDOW == 41 (0x7f4afe574c00) [pid = 2212] [serial = 1540] [outer = (nil)] [url = about:blank] 13:59:19 INFO - --DOMWINDOW == 40 (0x7f4b07a10c00) [pid = 2212] [serial = 1562] [outer = (nil)] [url = about:blank] 13:59:19 INFO - --DOMWINDOW == 39 (0x7f4afd041c00) [pid = 2212] [serial = 1542] [outer = (nil)] [url = about:blank] 13:59:19 INFO - --DOMWINDOW == 38 (0x7f4afe00ac00) [pid = 2212] [serial = 1545] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/browser/test-console.html] 13:59:19 INFO - --DOMWINDOW == 37 (0x7f4afe0b0c00) [pid = 2212] [serial = 1556] [outer = (nil)] [url = about:blank] 13:59:19 INFO - --DOMWINDOW == 36 (0x7f4afe576000) [pid = 2212] [serial = 1549] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:59:19 INFO - --DOMWINDOW == 35 (0x7f4afe0ae000) [pid = 2212] [serial = 1546] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:19 INFO - --DOMWINDOW == 34 (0x7f4afc866000) [pid = 2212] [serial = 1541] [outer = (nil)] [url = about:blank] 13:59:19 INFO - --DOMWINDOW == 33 (0x7f4afd3adc00) [pid = 2212] [serial = 1543] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/browser/test-console.html] 13:59:19 INFO - --DOCSHELL 0x7f4b0c393000 == 10 [pid = 2212] [id = 652] 13:59:19 INFO - MEMORY STAT | vsize 1178MB | residentFast 304MB | heapAllocated 116MB 13:59:19 INFO - 304 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_737873_mixedcontent.js | took 5706ms 13:59:19 INFO - ++DOCSHELL 0x7f4afe2c9800 == 11 [pid = 2212] [id = 653] 13:59:19 INFO - ++DOMWINDOW == 34 (0x7f4afd03e400) [pid = 2212] [serial = 1564] [outer = (nil)] 13:59:19 INFO - ++DOMWINDOW == 35 (0x7f4afd342c00) [pid = 2212] [serial = 1565] [outer = 0x7f4afd03e400] 13:59:19 INFO - 305 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_752559_ineffective_iframe_sandbox_warning.js 13:59:19 INFO - ++DOCSHELL 0x7f4afe857000 == 12 [pid = 2212] [id = 654] 13:59:19 INFO - ++DOMWINDOW == 36 (0x7f4afd943400) [pid = 2212] [serial = 1566] [outer = (nil)] 13:59:19 INFO - ++DOMWINDOW == 37 (0x7f4afd94c800) [pid = 2212] [serial = 1567] [outer = 0x7f4afd943400] 13:59:19 INFO - ++DOMWINDOW == 38 (0x7f4aff424000) [pid = 2212] [serial = 1568] [outer = 0x7f4afd943400] 13:59:20 INFO - ++DOCSHELL 0x7f4afd9b6800 == 13 [pid = 2212] [id = 655] 13:59:20 INFO - ++DOMWINDOW == 39 (0x7f4afd034c00) [pid = 2212] [serial = 1569] [outer = (nil)] 13:59:20 INFO - ++DOMWINDOW == 40 (0x7f4afe0b3800) [pid = 2212] [serial = 1570] [outer = 0x7f4afd034c00] 13:59:20 INFO - ++DOCSHELL 0x7f4afd9ab000 == 14 [pid = 2212] [id = 656] 13:59:20 INFO - ++DOMWINDOW == 41 (0x7f4afe1f3000) [pid = 2212] [serial = 1571] [outer = (nil)] 13:59:20 INFO - ++DOMWINDOW == 42 (0x7f4afe3d9000) [pid = 2212] [serial = 1572] [outer = 0x7f4afe1f3000] 13:59:20 INFO - ++DOMWINDOW == 43 (0x7f4afe4c5c00) [pid = 2212] [serial = 1573] [outer = 0x7f4afe1f3000] 13:59:20 INFO - ++DOCSHELL 0x7f4b0176c000 == 15 [pid = 2212] [id = 657] 13:59:20 INFO - ++DOMWINDOW == 44 (0x7f4afe817c00) [pid = 2212] [serial = 1574] [outer = (nil)] 13:59:20 INFO - ++DOMWINDOW == 45 (0x7f4afe81b800) [pid = 2212] [serial = 1575] [outer = 0x7f4afe817c00] 13:59:22 INFO - ++DOCSHELL 0x7f4afd59e000 == 16 [pid = 2212] [id = 658] 13:59:22 INFO - ++DOMWINDOW == 46 (0x7f4b019b7800) [pid = 2212] [serial = 1576] [outer = (nil)] 13:59:22 INFO - ++DOMWINDOW == 47 (0x7f4b07a0e000) [pid = 2212] [serial = 1577] [outer = 0x7f4b019b7800] 13:59:23 INFO - ++DOMWINDOW == 48 (0x7f4b09852c00) [pid = 2212] [serial = 1578] [outer = 0x7f4b019b7800] 13:59:23 INFO - ++DOCSHELL 0x7f4afe856000 == 17 [pid = 2212] [id = 659] 13:59:23 INFO - ++DOMWINDOW == 49 (0x7f4afe009800) [pid = 2212] [serial = 1579] [outer = (nil)] 13:59:23 INFO - ++DOMWINDOW == 50 (0x7f4afc723800) [pid = 2212] [serial = 1580] [outer = 0x7f4afe009800] 13:59:23 INFO - ++DOMWINDOW == 51 (0x7f4afe009000) [pid = 2212] [serial = 1581] [outer = 0x7f4afe009800] 13:59:23 INFO - ++DOCSHELL 0x7f4afd5a1800 == 18 [pid = 2212] [id = 660] 13:59:23 INFO - ++DOMWINDOW == 52 (0x7f4afc727c00) [pid = 2212] [serial = 1582] [outer = (nil)] 13:59:23 INFO - ++DOMWINDOW == 53 (0x7f4afe1f2400) [pid = 2212] [serial = 1583] [outer = 0x7f4afc727c00] 13:59:23 INFO - ++DOMWINDOW == 54 (0x7f4afe8a2400) [pid = 2212] [serial = 1584] [outer = 0x7f4afc727c00] 13:59:24 INFO - ++DOCSHELL 0x7f4b094ab000 == 19 [pid = 2212] [id = 661] 13:59:24 INFO - ++DOMWINDOW == 55 (0x7f4b00f2e400) [pid = 2212] [serial = 1585] [outer = (nil)] 13:59:24 INFO - ++DOMWINDOW == 56 (0x7f4b00f58000) [pid = 2212] [serial = 1586] [outer = 0x7f4b00f2e400] 13:59:25 INFO - ++DOCSHELL 0x7f4b0fa33800 == 20 [pid = 2212] [id = 662] 13:59:25 INFO - ++DOMWINDOW == 57 (0x7f4b09e5ec00) [pid = 2212] [serial = 1587] [outer = (nil)] 13:59:25 INFO - ++DOMWINDOW == 58 (0x7f4b0a667000) [pid = 2212] [serial = 1588] [outer = 0x7f4b09e5ec00] 13:59:26 INFO - ++DOMWINDOW == 59 (0x7f4b09e59000) [pid = 2212] [serial = 1589] [outer = 0x7f4b09e5ec00] 13:59:26 INFO - ++DOCSHELL 0x7f4afd5a2800 == 21 [pid = 2212] [id = 663] 13:59:26 INFO - ++DOMWINDOW == 60 (0x7f4afe3e3800) [pid = 2212] [serial = 1590] [outer = (nil)] 13:59:26 INFO - ++DOMWINDOW == 61 (0x7f4afd340c00) [pid = 2212] [serial = 1591] [outer = 0x7f4afe3e3800] 13:59:26 INFO - ++DOCSHELL 0x7f4afd599000 == 22 [pid = 2212] [id = 664] 13:59:26 INFO - ++DOMWINDOW == 62 (0x7f4afd034000) [pid = 2212] [serial = 1592] [outer = (nil)] 13:59:26 INFO - ++DOMWINDOW == 63 (0x7f4b0c8f3800) [pid = 2212] [serial = 1593] [outer = 0x7f4afd034000] 13:59:27 INFO - ++DOMWINDOW == 64 (0x7f4afe008800) [pid = 2212] [serial = 1594] [outer = 0x7f4afd034000] 13:59:27 INFO - ++DOCSHELL 0x7f4b116ef800 == 23 [pid = 2212] [id = 665] 13:59:27 INFO - ++DOMWINDOW == 65 (0x7f4b0fbb6c00) [pid = 2212] [serial = 1595] [outer = (nil)] 13:59:27 INFO - ++DOMWINDOW == 66 (0x7f4b0fbbbc00) [pid = 2212] [serial = 1596] [outer = 0x7f4b0fbb6c00] 13:59:28 INFO - ++DOCSHELL 0x7f4b12761000 == 24 [pid = 2212] [id = 666] 13:59:28 INFO - ++DOMWINDOW == 67 (0x7f4b1237a800) [pid = 2212] [serial = 1597] [outer = (nil)] 13:59:28 INFO - ++DOMWINDOW == 68 (0x7f4b1237cc00) [pid = 2212] [serial = 1598] [outer = 0x7f4b1237a800] 13:59:29 INFO - ++DOMWINDOW == 69 (0x7f4b0c1a5800) [pid = 2212] [serial = 1599] [outer = 0x7f4b1237a800] 13:59:29 INFO - ++DOCSHELL 0x7f4b142ea800 == 25 [pid = 2212] [id = 667] 13:59:29 INFO - ++DOMWINDOW == 70 (0x7f4b0f70c400) [pid = 2212] [serial = 1600] [outer = (nil)] 13:59:29 INFO - ++DOMWINDOW == 71 (0x7f4b12379400) [pid = 2212] [serial = 1601] [outer = 0x7f4b0f70c400] 13:59:29 INFO - ++DOMWINDOW == 72 (0x7f4b12381400) [pid = 2212] [serial = 1602] [outer = 0x7f4b0f70c400] 13:59:29 INFO - ++DOCSHELL 0x7f4afdade000 == 26 [pid = 2212] [id = 668] 13:59:29 INFO - ++DOMWINDOW == 73 (0x7f4b1277c400) [pid = 2212] [serial = 1603] [outer = (nil)] 13:59:29 INFO - ++DOMWINDOW == 74 (0x7f4b12946c00) [pid = 2212] [serial = 1604] [outer = 0x7f4b1277c400] 13:59:30 INFO - ++DOMWINDOW == 75 (0x7f4b12947000) [pid = 2212] [serial = 1605] [outer = 0x7f4b1277c400] 13:59:30 INFO - ++DOCSHELL 0x7f4b1758a000 == 27 [pid = 2212] [id = 669] 13:59:30 INFO - ++DOMWINDOW == 76 (0x7f4b11eeb800) [pid = 2212] [serial = 1606] [outer = (nil)] 13:59:30 INFO - ++DOMWINDOW == 77 (0x7f4b12e43800) [pid = 2212] [serial = 1607] [outer = 0x7f4b11eeb800] 13:59:32 INFO - ++DOCSHELL 0x7f4b25797000 == 28 [pid = 2212] [id = 670] 13:59:32 INFO - ++DOMWINDOW == 78 (0x7f4b15caf000) [pid = 2212] [serial = 1608] [outer = (nil)] 13:59:32 INFO - ++DOMWINDOW == 79 (0x7f4b19606c00) [pid = 2212] [serial = 1609] [outer = 0x7f4b15caf000] 13:59:32 INFO - ++DOMWINDOW == 80 (0x7f4b1277b800) [pid = 2212] [serial = 1610] [outer = 0x7f4b15caf000] 13:59:32 INFO - ++DOCSHELL 0x7f4afd9b7000 == 29 [pid = 2212] [id = 671] 13:59:32 INFO - ++DOMWINDOW == 81 (0x7f4b1296f000) [pid = 2212] [serial = 1611] [outer = (nil)] 13:59:33 INFO - ++DOMWINDOW == 82 (0x7f4b196dac00) [pid = 2212] [serial = 1612] [outer = 0x7f4b1296f000] 13:59:33 INFO - ++DOMWINDOW == 83 (0x7f4b196df000) [pid = 2212] [serial = 1613] [outer = 0x7f4b1296f000] 13:59:33 INFO - ++DOCSHELL 0x7f4b2a4e6800 == 30 [pid = 2212] [id = 672] 13:59:33 INFO - ++DOMWINDOW == 84 (0x7f4afe8c2800) [pid = 2212] [serial = 1614] [outer = (nil)] 13:59:33 INFO - ++DOMWINDOW == 85 (0x7f4b17835000) [pid = 2212] [serial = 1615] [outer = 0x7f4afe8c2800] 13:59:33 INFO - ++DOCSHELL 0x7f4aff2c4800 == 31 [pid = 2212] [id = 673] 13:59:33 INFO - ++DOMWINDOW == 86 (0x7f4b257e3800) [pid = 2212] [serial = 1616] [outer = (nil)] 13:59:33 INFO - ++DOMWINDOW == 87 (0x7f4b257e5000) [pid = 2212] [serial = 1617] [outer = 0x7f4b257e3800] 13:59:33 INFO - ++DOMWINDOW == 88 (0x7f4b21056400) [pid = 2212] [serial = 1618] [outer = 0x7f4b257e3800] 13:59:33 INFO - ++DOCSHELL 0x7f4b2a4f4000 == 32 [pid = 2212] [id = 674] 13:59:33 INFO - ++DOMWINDOW == 89 (0x7f4b29dc1000) [pid = 2212] [serial = 1619] [outer = (nil)] 13:59:33 INFO - ++DOMWINDOW == 90 (0x7f4b29dc4400) [pid = 2212] [serial = 1620] [outer = 0x7f4b29dc1000] 13:59:35 INFO - ++DOCSHELL 0x7f4afdc1f000 == 33 [pid = 2212] [id = 675] 13:59:35 INFO - ++DOMWINDOW == 91 (0x7f4b2b058000) [pid = 2212] [serial = 1621] [outer = (nil)] 13:59:35 INFO - ++DOMWINDOW == 92 (0x7f4b2b0ca000) [pid = 2212] [serial = 1622] [outer = 0x7f4b2b058000] 13:59:35 INFO - ++DOMWINDOW == 93 (0x7f4b257e4000) [pid = 2212] [serial = 1623] [outer = 0x7f4b2b058000] 13:59:36 INFO - ++DOCSHELL 0x7f4afd9a0800 == 34 [pid = 2212] [id = 676] 13:59:36 INFO - ++DOMWINDOW == 94 (0x7f4b25919c00) [pid = 2212] [serial = 1624] [outer = (nil)] 13:59:36 INFO - ++DOMWINDOW == 95 (0x7f4b25fcb000) [pid = 2212] [serial = 1625] [outer = 0x7f4b25919c00] 13:59:36 INFO - ++DOMWINDOW == 96 (0x7f4b29b5b400) [pid = 2212] [serial = 1626] [outer = 0x7f4b25919c00] 13:59:36 INFO - ++DOCSHELL 0x7f4b10ad8000 == 35 [pid = 2212] [id = 677] 13:59:36 INFO - ++DOMWINDOW == 97 (0x7f4b0c4df800) [pid = 2212] [serial = 1627] [outer = (nil)] 13:59:36 INFO - ++DOMWINDOW == 98 (0x7f4b29b5a400) [pid = 2212] [serial = 1628] [outer = 0x7f4b0c4df800] 13:59:36 INFO - ++DOCSHELL 0x7f4afd58f800 == 36 [pid = 2212] [id = 678] 13:59:36 INFO - ++DOMWINDOW == 99 (0x7f4b2c16e800) [pid = 2212] [serial = 1629] [outer = (nil)] 13:59:36 INFO - ++DOMWINDOW == 100 (0x7f4b2c16f800) [pid = 2212] [serial = 1630] [outer = 0x7f4b2c16e800] 13:59:36 INFO - ++DOMWINDOW == 101 (0x7f4b2b1bcc00) [pid = 2212] [serial = 1631] [outer = 0x7f4b2c16e800] 13:59:37 INFO - ++DOCSHELL 0x7f4b10aeb000 == 37 [pid = 2212] [id = 679] 13:59:37 INFO - ++DOMWINDOW == 102 (0x7f4b2e9ec000) [pid = 2212] [serial = 1632] [outer = (nil)] 13:59:37 INFO - ++DOMWINDOW == 103 (0x7f4b2e9ee400) [pid = 2212] [serial = 1633] [outer = 0x7f4b2e9ec000] 13:59:41 INFO - --DOCSHELL 0x7f4afe4f9800 == 36 [pid = 2212] [id = 649] 13:59:41 INFO - --DOMWINDOW == 102 (0x7f4afe3dd800) [pid = 2212] [serial = 1548] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:41 INFO - --DOMWINDOW == 101 (0x7f4afe57e800) [pid = 2212] [serial = 1550] [outer = (nil)] [url = about:blank] 13:59:41 INFO - --DOMWINDOW == 100 (0x7f4b19606c00) [pid = 2212] [serial = 1609] [outer = (nil)] [url = about:blank] 13:59:41 INFO - --DOMWINDOW == 99 (0x7f4b196dac00) [pid = 2212] [serial = 1612] [outer = (nil)] [url = about:blank] 13:59:41 INFO - --DOMWINDOW == 98 (0x7f4b12946c00) [pid = 2212] [serial = 1604] [outer = (nil)] [url = about:blank] 13:59:41 INFO - --DOMWINDOW == 97 (0x7f4b1237cc00) [pid = 2212] [serial = 1598] [outer = (nil)] [url = about:blank] 13:59:41 INFO - --DOMWINDOW == 96 (0x7f4b12379400) [pid = 2212] [serial = 1601] [outer = (nil)] [url = about:blank] 13:59:41 INFO - --DOMWINDOW == 95 (0x7f4b0c8f3800) [pid = 2212] [serial = 1593] [outer = (nil)] [url = about:blank] 13:59:41 INFO - --DOMWINDOW == 94 (0x7f4b0a667000) [pid = 2212] [serial = 1588] [outer = (nil)] [url = about:blank] 13:59:41 INFO - --DOMWINDOW == 93 (0x7f4afc723800) [pid = 2212] [serial = 1580] [outer = (nil)] [url = about:blank] 13:59:41 INFO - --DOMWINDOW == 92 (0x7f4afe1f2400) [pid = 2212] [serial = 1583] [outer = (nil)] [url = about:blank] 13:59:41 INFO - --DOMWINDOW == 91 (0x7f4afe576800) [pid = 2212] [serial = 1558] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:59:41 INFO - --DOMWINDOW == 90 (0x7f4afd943c00) [pid = 2212] [serial = 1555] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:41 INFO - --DOMWINDOW == 89 (0x7f4afc861000) [pid = 2212] [serial = 1551] [outer = (nil)] [url = about:blank] 13:59:41 INFO - --DOMWINDOW == 88 (0x7f4afc722800) [pid = 2212] [serial = 1561] [outer = (nil)] [url = http://example.com/] 13:59:41 INFO - --DOMWINDOW == 87 (0x7f4afd3ad000) [pid = 2212] [serial = 1553] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-bug-737873-mixedcontent.html] 13:59:41 INFO - --DOMWINDOW == 86 (0x7f4b07a0e000) [pid = 2212] [serial = 1577] [outer = (nil)] [url = about:blank] 13:59:41 INFO - --DOMWINDOW == 85 (0x7f4afe3d9000) [pid = 2212] [serial = 1572] [outer = (nil)] [url = about:blank] 13:59:41 INFO - --DOMWINDOW == 84 (0x7f4afd033800) [pid = 2212] [serial = 1552] [outer = (nil)] [url = about:blank] 13:59:41 INFO - --DOMWINDOW == 83 (0x7f4afd94c800) [pid = 2212] [serial = 1567] [outer = (nil)] [url = about:blank] 13:59:41 INFO - --DOMWINDOW == 82 (0x7f4afc725400) [pid = 2212] [serial = 1563] [outer = (nil)] [url = http://example.com/] 13:59:41 INFO - --DOMWINDOW == 81 (0x7f4afd3b2800) [pid = 2212] [serial = 1554] [outer = (nil)] [url = about:blank] 13:59:41 INFO - --DOMWINDOW == 80 (0x7f4b25fcb000) [pid = 2212] [serial = 1625] [outer = (nil)] [url = about:blank] 13:59:41 INFO - --DOMWINDOW == 79 (0x7f4b2c16f800) [pid = 2212] [serial = 1630] [outer = (nil)] [url = about:blank] 13:59:41 INFO - --DOMWINDOW == 78 (0x7f4b2b0ca000) [pid = 2212] [serial = 1622] [outer = (nil)] [url = about:blank] 13:59:41 INFO - --DOMWINDOW == 77 (0x7f4b257e5000) [pid = 2212] [serial = 1617] [outer = (nil)] [url = about:blank] 13:59:42 INFO - --DOCSHELL 0x7f4b1758a000 == 35 [pid = 2212] [id = 669] 13:59:42 INFO - --DOCSHELL 0x7f4b116ef800 == 34 [pid = 2212] [id = 665] 13:59:42 INFO - --DOCSHELL 0x7f4b094ab000 == 33 [pid = 2212] [id = 661] 13:59:42 INFO - --DOCSHELL 0x7f4b0176c000 == 32 [pid = 2212] [id = 657] 13:59:42 INFO - --DOMWINDOW == 76 (0x7f4b012df800) [pid = 2212] [serial = 1560] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-bug-737873-mixedcontent.html] 13:59:43 INFO - MEMORY STAT | vsize 1186MB | residentFast 333MB | heapAllocated 129MB 13:59:43 INFO - 306 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_752559_ineffective_iframe_sandbox_warning.js | took 23812ms 13:59:43 INFO - ++DOCSHELL 0x7f4afcecf800 == 33 [pid = 2212] [id = 680] 13:59:43 INFO - ++DOMWINDOW == 77 (0x7f4afde69000) [pid = 2212] [serial = 1634] [outer = (nil)] 13:59:43 INFO - ++DOMWINDOW == 78 (0x7f4afe008400) [pid = 2212] [serial = 1635] [outer = 0x7f4afde69000] 13:59:43 INFO - 307 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_762593_insecure_passwords_about_blank_web_console_warning.js 13:59:43 INFO - ++DOCSHELL 0x7f4afdc19000 == 34 [pid = 2212] [id = 681] 13:59:43 INFO - ++DOMWINDOW == 79 (0x7f4afe1f4000) [pid = 2212] [serial = 1636] [outer = (nil)] 13:59:43 INFO - ++DOMWINDOW == 80 (0x7f4afe3de000) [pid = 2212] [serial = 1637] [outer = 0x7f4afe1f4000] 13:59:44 INFO - ++DOMWINDOW == 81 (0x7f4afe8b8c00) [pid = 2212] [serial = 1638] [outer = 0x7f4afe1f4000] 13:59:44 INFO - ++DOCSHELL 0x7f4afcec4000 == 35 [pid = 2212] [id = 682] 13:59:44 INFO - ++DOMWINDOW == 82 (0x7f4afe553000) [pid = 2212] [serial = 1639] [outer = (nil)] 13:59:44 INFO - ++DOMWINDOW == 83 (0x7f4afe575800) [pid = 2212] [serial = 1640] [outer = 0x7f4afe553000] 13:59:44 INFO - ++DOCSHELL 0x7f4afce93800 == 36 [pid = 2212] [id = 683] 13:59:44 INFO - ++DOMWINDOW == 84 (0x7f4afe577800) [pid = 2212] [serial = 1641] [outer = (nil)] 13:59:44 INFO - ++DOMWINDOW == 85 (0x7f4afe81c800) [pid = 2212] [serial = 1642] [outer = 0x7f4afe577800] 13:59:44 INFO - ++DOMWINDOW == 86 (0x7f4afe8b9c00) [pid = 2212] [serial = 1643] [outer = 0x7f4afe577800] 13:59:44 INFO - ++DOCSHELL 0x7f4aff2c9800 == 37 [pid = 2212] [id = 684] 13:59:44 INFO - ++DOMWINDOW == 87 (0x7f4aff33c800) [pid = 2212] [serial = 1644] [outer = (nil)] 13:59:44 INFO - ++DOMWINDOW == 88 (0x7f4aff33ec00) [pid = 2212] [serial = 1645] [outer = 0x7f4aff33c800] 13:59:48 INFO - --DOCSHELL 0x7f4b2a4f4000 == 36 [pid = 2212] [id = 674] 13:59:48 INFO - --DOCSHELL 0x7f4afd9b6800 == 35 [pid = 2212] [id = 655] 13:59:48 INFO - --DOCSHELL 0x7f4b10aeb000 == 34 [pid = 2212] [id = 679] 13:59:48 INFO - --DOCSHELL 0x7f4b2a4e6800 == 33 [pid = 2212] [id = 672] 13:59:48 INFO - --DOCSHELL 0x7f4b10ad8000 == 32 [pid = 2212] [id = 677] 13:59:48 INFO - --DOCSHELL 0x7f4afd5a2800 == 31 [pid = 2212] [id = 663] 13:59:48 INFO - --DOCSHELL 0x7f4afd9a0800 == 30 [pid = 2212] [id = 676] 13:59:48 INFO - --DOCSHELL 0x7f4afe856000 == 29 [pid = 2212] [id = 659] 13:59:48 INFO - --DOCSHELL 0x7f4b142ea800 == 28 [pid = 2212] [id = 667] 13:59:48 INFO - --DOCSHELL 0x7f4afd9b7000 == 27 [pid = 2212] [id = 671] 13:59:48 INFO - --DOCSHELL 0x7f4afd9ad000 == 26 [pid = 2212] [id = 648] 13:59:48 INFO - --DOCSHELL 0x7f4afe2c9800 == 25 [pid = 2212] [id = 653] 13:59:48 INFO - --DOCSHELL 0x7f4afe857000 == 24 [pid = 2212] [id = 654] 13:59:48 INFO - --DOCSHELL 0x7f4afd599000 == 23 [pid = 2212] [id = 664] 13:59:48 INFO - --DOCSHELL 0x7f4aff2c9800 == 22 [pid = 2212] [id = 684] 13:59:48 INFO - --DOCSHELL 0x7f4afd58f800 == 21 [pid = 2212] [id = 678] 13:59:48 INFO - --DOCSHELL 0x7f4afd9ab000 == 20 [pid = 2212] [id = 656] 13:59:48 INFO - --DOCSHELL 0x7f4b12761000 == 19 [pid = 2212] [id = 666] 13:59:48 INFO - --DOCSHELL 0x7f4b25797000 == 18 [pid = 2212] [id = 670] 13:59:48 INFO - --DOCSHELL 0x7f4afdc1f000 == 17 [pid = 2212] [id = 675] 13:59:48 INFO - --DOCSHELL 0x7f4b0fa33800 == 16 [pid = 2212] [id = 662] 13:59:48 INFO - --DOCSHELL 0x7f4aff2c4800 == 15 [pid = 2212] [id = 673] 13:59:48 INFO - --DOCSHELL 0x7f4afd59e000 == 14 [pid = 2212] [id = 658] 13:59:48 INFO - --DOCSHELL 0x7f4afdade000 == 13 [pid = 2212] [id = 668] 13:59:48 INFO - --DOCSHELL 0x7f4afd5a1800 == 12 [pid = 2212] [id = 660] 13:59:48 INFO - --DOMWINDOW == 87 (0x7f4afe57f400) [pid = 2212] [serial = 1559] [outer = (nil)] [url = about:blank] 13:59:48 INFO - --DOMWINDOW == 86 (0x7f4afe3d8400) [pid = 2212] [serial = 1557] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:48 INFO - --DOMWINDOW == 85 (0x7f4b29dc1000) [pid = 2212] [serial = 1619] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:59:48 INFO - --DOMWINDOW == 84 (0x7f4afe8c2800) [pid = 2212] [serial = 1614] [outer = (nil)] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 13:59:48 INFO - --DOMWINDOW == 83 (0x7f4b0c4df800) [pid = 2212] [serial = 1627] [outer = (nil)] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 13:59:48 INFO - --DOMWINDOW == 82 (0x7f4b2e9ec000) [pid = 2212] [serial = 1632] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:59:48 INFO - --DOMWINDOW == 81 (0x7f4afe3e3800) [pid = 2212] [serial = 1590] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 13:59:48 INFO - --DOMWINDOW == 80 (0x7f4b0fbb6c00) [pid = 2212] [serial = 1595] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:59:48 INFO - --DOMWINDOW == 79 (0x7f4afe81c800) [pid = 2212] [serial = 1642] [outer = (nil)] [url = about:blank] 13:59:48 INFO - --DOMWINDOW == 78 (0x7f4b11eeb800) [pid = 2212] [serial = 1606] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:59:48 INFO - --DOMWINDOW == 77 (0x7f4afe3de000) [pid = 2212] [serial = 1637] [outer = (nil)] [url = about:blank] 13:59:48 INFO - --DOMWINDOW == 76 (0x7f4b019b7800) [pid = 2212] [serial = 1576] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning1.html] 13:59:48 INFO - --DOMWINDOW == 75 (0x7f4afe1f3000) [pid = 2212] [serial = 1571] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:48 INFO - --DOMWINDOW == 74 (0x7f4afd943400) [pid = 2212] [serial = 1566] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning0.html] 13:59:48 INFO - --DOMWINDOW == 73 (0x7f4b25919c00) [pid = 2212] [serial = 1624] [outer = (nil)] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-nested2.html] 13:59:48 INFO - --DOMWINDOW == 72 (0x7f4b2c16e800) [pid = 2212] [serial = 1629] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:48 INFO - --DOMWINDOW == 71 (0x7f4b2b058000) [pid = 2212] [serial = 1621] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning5.html] 13:59:48 INFO - --DOMWINDOW == 70 (0x7f4b257e3800) [pid = 2212] [serial = 1616] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:48 INFO - --DOMWINDOW == 69 (0x7f4b15caf000) [pid = 2212] [serial = 1608] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning4.html] 13:59:48 INFO - --DOMWINDOW == 68 (0x7f4b1296f000) [pid = 2212] [serial = 1611] [outer = (nil)] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-nested1.html] 13:59:48 INFO - --DOMWINDOW == 67 (0x7f4b1277c400) [pid = 2212] [serial = 1603] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:48 INFO - --DOMWINDOW == 66 (0x7f4b1237a800) [pid = 2212] [serial = 1597] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning3.html] 13:59:48 INFO - --DOMWINDOW == 65 (0x7f4b0f70c400) [pid = 2212] [serial = 1600] [outer = (nil)] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 13:59:48 INFO - --DOMWINDOW == 64 (0x7f4afd034000) [pid = 2212] [serial = 1592] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:48 INFO - --DOMWINDOW == 63 (0x7f4b09e5ec00) [pid = 2212] [serial = 1587] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning2.html] 13:59:48 INFO - --DOMWINDOW == 62 (0x7f4afe009800) [pid = 2212] [serial = 1579] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 13:59:48 INFO - --DOMWINDOW == 61 (0x7f4afc727c00) [pid = 2212] [serial = 1582] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:48 INFO - --DOMWINDOW == 60 (0x7f4afd034c00) [pid = 2212] [serial = 1569] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 13:59:48 INFO - --DOMWINDOW == 59 (0x7f4afe817c00) [pid = 2212] [serial = 1574] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:59:48 INFO - --DOMWINDOW == 58 (0x7f4afd03e400) [pid = 2212] [serial = 1564] [outer = (nil)] [url = about:blank] 13:59:48 INFO - --DOMWINDOW == 57 (0x7f4b00f2e400) [pid = 2212] [serial = 1585] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:59:48 INFO - --DOMWINDOW == 56 (0x7f4afd342c00) [pid = 2212] [serial = 1565] [outer = (nil)] [url = about:blank] 13:59:48 INFO - --DOCSHELL 0x7f4afcec4000 == 11 [pid = 2212] [id = 682] 13:59:49 INFO - --DOMWINDOW == 55 (0x7f4b0c1a5800) [pid = 2212] [serial = 1599] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning3.html] 13:59:49 INFO - --DOMWINDOW == 54 (0x7f4b12381400) [pid = 2212] [serial = 1602] [outer = (nil)] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 13:59:49 INFO - --DOMWINDOW == 53 (0x7f4b1277b800) [pid = 2212] [serial = 1610] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning4.html] 13:59:49 INFO - --DOMWINDOW == 52 (0x7f4b196df000) [pid = 2212] [serial = 1613] [outer = (nil)] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-nested1.html] 13:59:49 INFO - --DOMWINDOW == 51 (0x7f4b29b5b400) [pid = 2212] [serial = 1626] [outer = (nil)] [url = http://www.example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-nested2.html] 13:59:49 INFO - --DOMWINDOW == 50 (0x7f4b257e4000) [pid = 2212] [serial = 1623] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning5.html] 13:59:49 INFO - --DOMWINDOW == 49 (0x7f4afe009000) [pid = 2212] [serial = 1581] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 13:59:49 INFO - --DOMWINDOW == 48 (0x7f4b09852c00) [pid = 2212] [serial = 1578] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning1.html] 13:59:49 INFO - --DOMWINDOW == 47 (0x7f4b09e59000) [pid = 2212] [serial = 1589] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning2.html] 13:59:49 INFO - --DOMWINDOW == 46 (0x7f4b29b5a400) [pid = 2212] [serial = 1628] [outer = (nil)] [url = about:blank] 13:59:49 INFO - --DOMWINDOW == 45 (0x7f4b17835000) [pid = 2212] [serial = 1615] [outer = (nil)] [url = about:blank] 13:59:49 INFO - --DOMWINDOW == 44 (0x7f4afd340c00) [pid = 2212] [serial = 1591] [outer = (nil)] [url = about:blank] 13:59:49 INFO - --DOMWINDOW == 43 (0x7f4afe0b3800) [pid = 2212] [serial = 1570] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning-inner.html] 13:59:49 INFO - --DOMWINDOW == 42 (0x7f4aff424000) [pid = 2212] [serial = 1568] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-752559-ineffective-iframe-sandbox-warning0.html] 13:59:49 INFO - MEMORY STAT | vsize 1180MB | residentFast 321MB | heapAllocated 121MB 13:59:49 INFO - 308 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_762593_insecure_passwords_about_blank_web_console_warning.js | took 5477ms 13:59:49 INFO - ++DOCSHELL 0x7f4afce7e000 == 12 [pid = 2212] [id = 685] 13:59:49 INFO - ++DOMWINDOW == 43 (0x7f4afcf2b800) [pid = 2212] [serial = 1646] [outer = (nil)] 13:59:49 INFO - ++DOMWINDOW == 44 (0x7f4afd036000) [pid = 2212] [serial = 1647] [outer = 0x7f4afcf2b800] 13:59:49 INFO - 309 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_764572_output_open_url.js 13:59:49 INFO - ++DOCSHELL 0x7f4afced1800 == 13 [pid = 2212] [id = 686] 13:59:49 INFO - ++DOMWINDOW == 45 (0x7f4afd3a6400) [pid = 2212] [serial = 1648] [outer = (nil)] 13:59:49 INFO - ++DOMWINDOW == 46 (0x7f4afd3aec00) [pid = 2212] [serial = 1649] [outer = 0x7f4afd3a6400] 13:59:49 INFO - ++DOMWINDOW == 47 (0x7f4afde5c800) [pid = 2212] [serial = 1650] [outer = 0x7f4afd3a6400] 13:59:49 INFO - ++DOCSHELL 0x7f4afceca800 == 14 [pid = 2212] [id = 687] 13:59:49 INFO - ++DOMWINDOW == 48 (0x7f4afde64800) [pid = 2212] [serial = 1651] [outer = (nil)] 13:59:49 INFO - ++DOMWINDOW == 49 (0x7f4afde66400) [pid = 2212] [serial = 1652] [outer = 0x7f4afde64800] 13:59:50 INFO - ++DOMWINDOW == 50 (0x7f4afe1e7c00) [pid = 2212] [serial = 1653] [outer = 0x7f4afde64800] 13:59:50 INFO - ++DOCSHELL 0x7f4afdc14000 == 15 [pid = 2212] [id = 688] 13:59:50 INFO - ++DOMWINDOW == 51 (0x7f4afe551c00) [pid = 2212] [serial = 1654] [outer = (nil)] 13:59:50 INFO - ++DOMWINDOW == 52 (0x7f4afe570c00) [pid = 2212] [serial = 1655] [outer = 0x7f4afe551c00] 13:59:52 INFO - ++DOMWINDOW == 53 (0x7f4afcf23000) [pid = 2212] [serial = 1656] [outer = 0x7f4afd3a6400] 13:59:52 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 13:59:53 INFO - ++DOCSHELL 0x7f4afced7800 == 16 [pid = 2212] [id = 689] 13:59:53 INFO - ++DOMWINDOW == 54 (0x7f4afd94e400) [pid = 2212] [serial = 1657] [outer = (nil)] 13:59:53 INFO - ++DOMWINDOW == 55 (0x7f4afde61c00) [pid = 2212] [serial = 1658] [outer = 0x7f4afd94e400] 13:59:53 INFO - ++DOMWINDOW == 56 (0x7f4afe3dd000) [pid = 2212] [serial = 1659] [outer = 0x7f4afd94e400] 13:59:55 INFO - --DOCSHELL 0x7f4afcecf800 == 15 [pid = 2212] [id = 680] 13:59:55 INFO - --DOCSHELL 0x7f4afceca800 == 14 [pid = 2212] [id = 687] 13:59:55 INFO - --DOCSHELL 0x7f4afdc19000 == 13 [pid = 2212] [id = 681] 13:59:55 INFO - --DOCSHELL 0x7f4afdc14000 == 12 [pid = 2212] [id = 688] 13:59:55 INFO - --DOCSHELL 0x7f4afce93800 == 11 [pid = 2212] [id = 683] 13:59:55 INFO - --DOMWINDOW == 55 (0x7f4b2e9ee400) [pid = 2212] [serial = 1633] [outer = (nil)] [url = about:blank] 13:59:55 INFO - --DOMWINDOW == 54 (0x7f4b2b1bcc00) [pid = 2212] [serial = 1631] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:55 INFO - --DOMWINDOW == 53 (0x7f4b29dc4400) [pid = 2212] [serial = 1620] [outer = (nil)] [url = about:blank] 13:59:55 INFO - --DOMWINDOW == 52 (0x7f4b21056400) [pid = 2212] [serial = 1618] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:55 INFO - --DOMWINDOW == 51 (0x7f4b12e43800) [pid = 2212] [serial = 1607] [outer = (nil)] [url = about:blank] 13:59:55 INFO - --DOMWINDOW == 50 (0x7f4b12947000) [pid = 2212] [serial = 1605] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:55 INFO - --DOMWINDOW == 49 (0x7f4b0fbbbc00) [pid = 2212] [serial = 1596] [outer = (nil)] [url = about:blank] 13:59:55 INFO - --DOMWINDOW == 48 (0x7f4afe008800) [pid = 2212] [serial = 1594] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:55 INFO - --DOMWINDOW == 47 (0x7f4b00f58000) [pid = 2212] [serial = 1586] [outer = (nil)] [url = about:blank] 13:59:55 INFO - --DOMWINDOW == 46 (0x7f4afe8a2400) [pid = 2212] [serial = 1584] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:55 INFO - --DOMWINDOW == 45 (0x7f4afe81b800) [pid = 2212] [serial = 1575] [outer = (nil)] [url = about:blank] 13:59:55 INFO - --DOMWINDOW == 44 (0x7f4afe4c5c00) [pid = 2212] [serial = 1573] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:56 INFO - --DOMWINDOW == 43 (0x7f4afe008400) [pid = 2212] [serial = 1635] [outer = (nil)] [url = about:blank] 13:59:56 INFO - --DOMWINDOW == 42 (0x7f4afe575800) [pid = 2212] [serial = 1640] [outer = (nil)] [url = about:blank] 13:59:56 INFO - --DOMWINDOW == 41 (0x7f4afe553000) [pid = 2212] [serial = 1639] [outer = (nil)] [url = about:blank] 13:59:56 INFO - --DOMWINDOW == 40 (0x7f4afde69000) [pid = 2212] [serial = 1634] [outer = (nil)] [url = about:blank] 13:59:56 INFO - --DOMWINDOW == 39 (0x7f4afe577800) [pid = 2212] [serial = 1641] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 13:59:56 INFO - --DOMWINDOW == 38 (0x7f4afd3aec00) [pid = 2212] [serial = 1649] [outer = (nil)] [url = about:blank] 13:59:56 INFO - --DOMWINDOW == 37 (0x7f4afe1f4000) [pid = 2212] [serial = 1636] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-762593-insecure-passwords-about-blank-web-console-warning.html] 13:59:56 INFO - --DOMWINDOW == 36 (0x7f4aff33c800) [pid = 2212] [serial = 1644] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 13:59:56 INFO - --DOMWINDOW == 35 (0x7f4afde66400) [pid = 2212] [serial = 1652] [outer = (nil)] [url = about:blank] 13:59:56 INFO - --DOMWINDOW == 34 (0x7f4afd94e400) [pid = 2212] [serial = 1657] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 13:59:56 INFO - --DOMWINDOW == 33 (0x7f4afde61c00) [pid = 2212] [serial = 1658] [outer = (nil)] [url = about:blank] 13:59:56 INFO - --DOMWINDOW == 32 (0x7f4afe8b8c00) [pid = 2212] [serial = 1638] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-762593-insecure-passwords-about-blank-web-console-warning.html] 13:59:56 INFO - MEMORY STAT | vsize 1181MB | residentFast 318MB | heapAllocated 118MB 13:59:56 INFO - 310 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_764572_output_open_url.js | took 6974ms 13:59:56 INFO - ++DOCSHELL 0x7f4afcecf800 == 12 [pid = 2212] [id = 690] 13:59:56 INFO - ++DOMWINDOW == 33 (0x7f4afcf24400) [pid = 2212] [serial = 1660] [outer = (nil)] 13:59:56 INFO - ++DOMWINDOW == 34 (0x7f4afcf29800) [pid = 2212] [serial = 1661] [outer = 0x7f4afcf24400] 13:59:56 INFO - 311 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_766001_JS_Console_in_Debugger.js 13:59:56 INFO - ++DOCSHELL 0x7f4afd9a6800 == 13 [pid = 2212] [id = 691] 13:59:56 INFO - ++DOMWINDOW == 35 (0x7f4afd33d400) [pid = 2212] [serial = 1662] [outer = (nil)] 13:59:56 INFO - ++DOMWINDOW == 36 (0x7f4afd343000) [pid = 2212] [serial = 1663] [outer = 0x7f4afd33d400] 13:59:56 INFO - ++DOMWINDOW == 37 (0x7f4afd944800) [pid = 2212] [serial = 1664] [outer = 0x7f4afd33d400] 13:59:57 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-bug-766001-js-errors.js, line 6: TypeError: document.bar is not a function 13:59:57 INFO - ++DOCSHELL 0x7f4afce84800 == 14 [pid = 2212] [id = 692] 13:59:57 INFO - ++DOMWINDOW == 38 (0x7f4afde5f000) [pid = 2212] [serial = 1665] [outer = (nil)] 13:59:57 INFO - ++DOMWINDOW == 39 (0x7f4afde62400) [pid = 2212] [serial = 1666] [outer = 0x7f4afde5f000] 13:59:57 INFO - ++DOMWINDOW == 40 (0x7f4afe0ad800) [pid = 2212] [serial = 1667] [outer = 0x7f4afde5f000] 13:59:57 INFO - ++DOCSHELL 0x7f4afe2d4800 == 15 [pid = 2212] [id = 693] 13:59:57 INFO - ++DOMWINDOW == 41 (0x7f4afe54f400) [pid = 2212] [serial = 1668] [outer = (nil)] 13:59:57 INFO - ++DOMWINDOW == 42 (0x7f4afe553400) [pid = 2212] [serial = 1669] [outer = 0x7f4afe54f400] 13:59:59 INFO - ++DOCSHELL 0x7f4aff28d000 == 16 [pid = 2212] [id = 694] 13:59:59 INFO - ++DOMWINDOW == 43 (0x7f4aff418000) [pid = 2212] [serial = 1670] [outer = (nil)] 13:59:59 INFO - ++DOMWINDOW == 44 (0x7f4aff41a400) [pid = 2212] [serial = 1671] [outer = 0x7f4aff418000] 14:00:00 INFO - ++DOCSHELL 0x7f4afce95000 == 17 [pid = 2212] [id = 695] 14:00:00 INFO - ++DOMWINDOW == 45 (0x7f4afc85f000) [pid = 2212] [serial = 1672] [outer = (nil)] 14:00:00 INFO - ++DOMWINDOW == 46 (0x7f4afc863800) [pid = 2212] [serial = 1673] [outer = 0x7f4afc85f000] 14:00:02 INFO - --DOCSHELL 0x7f4afced1800 == 16 [pid = 2212] [id = 686] 14:00:02 INFO - --DOCSHELL 0x7f4afce7e000 == 15 [pid = 2212] [id = 685] 14:00:02 INFO - --DOCSHELL 0x7f4afced7800 == 14 [pid = 2212] [id = 689] 14:00:02 INFO - --DOMWINDOW == 45 (0x7f4afde5c800) [pid = 2212] [serial = 1650] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:00:02 INFO - --DOMWINDOW == 44 (0x7f4afe3dd000) [pid = 2212] [serial = 1659] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:00:02 INFO - --DOMWINDOW == 43 (0x7f4aff33ec00) [pid = 2212] [serial = 1645] [outer = (nil)] [url = about:blank] 14:00:02 INFO - --DOMWINDOW == 42 (0x7f4afe8b9c00) [pid = 2212] [serial = 1643] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:00:04 INFO - --DOCSHELL 0x7f4afce95000 == 13 [pid = 2212] [id = 695] 14:00:04 INFO - --DOCSHELL 0x7f4aff28d000 == 12 [pid = 2212] [id = 694] 14:00:04 INFO - --DOCSHELL 0x7f4afe2d4800 == 11 [pid = 2212] [id = 693] 14:00:06 INFO - --DOMWINDOW == 41 (0x7f4afc85f000) [pid = 2212] [serial = 1672] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:00:06 INFO - --DOMWINDOW == 40 (0x7f4afe551c00) [pid = 2212] [serial = 1654] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:00:06 INFO - --DOMWINDOW == 39 (0x7f4afde64800) [pid = 2212] [serial = 1651] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:00:06 INFO - --DOMWINDOW == 38 (0x7f4afcf2b800) [pid = 2212] [serial = 1646] [outer = (nil)] [url = about:blank] 14:00:06 INFO - --DOMWINDOW == 37 (0x7f4afd3a6400) [pid = 2212] [serial = 1648] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:00:06 INFO - --DOMWINDOW == 36 (0x7f4afde62400) [pid = 2212] [serial = 1666] [outer = (nil)] [url = about:blank] 14:00:06 INFO - --DOMWINDOW == 35 (0x7f4afd036000) [pid = 2212] [serial = 1647] [outer = (nil)] [url = about:blank] 14:00:06 INFO - --DOMWINDOW == 34 (0x7f4afd343000) [pid = 2212] [serial = 1663] [outer = (nil)] [url = about:blank] 14:00:06 INFO - --DOMWINDOW == 33 (0x7f4afcf23000) [pid = 2212] [serial = 1656] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:00:06 INFO - MEMORY STAT | vsize 1177MB | residentFast 309MB | heapAllocated 120MB 14:00:06 INFO - 312 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_766001_JS_Console_in_Debugger.js | took 10021ms 14:00:06 INFO - ++DOCSHELL 0x7f4afcec8800 == 12 [pid = 2212] [id = 696] 14:00:06 INFO - ++DOMWINDOW == 34 (0x7f4afd342400) [pid = 2212] [serial = 1674] [outer = (nil)] 14:00:06 INFO - ++DOMWINDOW == 35 (0x7f4afd3a4400) [pid = 2212] [serial = 1675] [outer = 0x7f4afd342400] 14:00:06 INFO - 313 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_770099_violation.js 14:00:06 INFO - ++DOCSHELL 0x7f4afce93000 == 13 [pid = 2212] [id = 697] 14:00:06 INFO - ++DOMWINDOW == 36 (0x7f4afde5ec00) [pid = 2212] [serial = 1676] [outer = (nil)] 14:00:06 INFO - ++DOMWINDOW == 37 (0x7f4afde62800) [pid = 2212] [serial = 1677] [outer = 0x7f4afde5ec00] 14:00:07 INFO - ++DOCSHELL 0x7f4afce89800 == 14 [pid = 2212] [id = 698] 14:00:07 INFO - ++DOMWINDOW == 38 (0x7f4afe0adc00) [pid = 2212] [serial = 1678] [outer = (nil)] 14:00:07 INFO - ++DOMWINDOW == 39 (0x7f4afe0b3000) [pid = 2212] [serial = 1679] [outer = 0x7f4afe0adc00] 14:00:07 INFO - ++DOMWINDOW == 40 (0x7f4afe4bd400) [pid = 2212] [serial = 1680] [outer = 0x7f4afe0adc00] 14:00:07 INFO - ++DOCSHELL 0x7f4afe2d0000 == 15 [pid = 2212] [id = 699] 14:00:07 INFO - ++DOMWINDOW == 41 (0x7f4afe8a5c00) [pid = 2212] [serial = 1681] [outer = (nil)] 14:00:07 INFO - ++DOMWINDOW == 42 (0x7f4afe8aec00) [pid = 2212] [serial = 1682] [outer = 0x7f4afe8a5c00] 14:00:09 INFO - ++DOMWINDOW == 43 (0x7f4b07a07000) [pid = 2212] [serial = 1683] [outer = 0x7f4afde5ec00] 14:00:09 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:00:11 INFO - --DOCSHELL 0x7f4afd9a6800 == 14 [pid = 2212] [id = 691] 14:00:11 INFO - --DOCSHELL 0x7f4afce84800 == 13 [pid = 2212] [id = 692] 14:00:11 INFO - --DOCSHELL 0x7f4afcecf800 == 12 [pid = 2212] [id = 690] 14:00:11 INFO - --DOCSHELL 0x7f4afce89800 == 11 [pid = 2212] [id = 698] 14:00:11 INFO - --DOCSHELL 0x7f4afe2d0000 == 10 [pid = 2212] [id = 699] 14:00:11 INFO - --DOMWINDOW == 42 (0x7f4afc863800) [pid = 2212] [serial = 1673] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:00:11 INFO - --DOMWINDOW == 41 (0x7f4afe570c00) [pid = 2212] [serial = 1655] [outer = (nil)] [url = about:blank] 14:00:11 INFO - --DOMWINDOW == 40 (0x7f4afe1e7c00) [pid = 2212] [serial = 1653] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:00:11 INFO - --DOMWINDOW == 39 (0x7f4afe8a5c00) [pid = 2212] [serial = 1681] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:00:11 INFO - --DOMWINDOW == 38 (0x7f4afcf29800) [pid = 2212] [serial = 1661] [outer = (nil)] [url = about:blank] 14:00:11 INFO - --DOMWINDOW == 37 (0x7f4afe0b3000) [pid = 2212] [serial = 1679] [outer = (nil)] [url = about:blank] 14:00:11 INFO - --DOMWINDOW == 36 (0x7f4afe54f400) [pid = 2212] [serial = 1668] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:00:11 INFO - --DOMWINDOW == 35 (0x7f4afde5f000) [pid = 2212] [serial = 1665] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:00:11 INFO - --DOMWINDOW == 34 (0x7f4afcf24400) [pid = 2212] [serial = 1660] [outer = (nil)] [url = about:blank] 14:00:11 INFO - --DOMWINDOW == 33 (0x7f4afd33d400) [pid = 2212] [serial = 1662] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-766001-js-console-links.html] 14:00:11 INFO - --DOMWINDOW == 32 (0x7f4aff418000) [pid = 2212] [serial = 1670] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul] 14:00:11 INFO - --DOMWINDOW == 31 (0x7f4afd944800) [pid = 2212] [serial = 1664] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-766001-js-console-links.html] 14:00:12 INFO - MEMORY STAT | vsize 1177MB | residentFast 307MB | heapAllocated 117MB 14:00:12 INFO - 314 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_770099_violation.js | took 5184ms 14:00:12 INFO - ++DOCSHELL 0x7f4afcebd000 == 11 [pid = 2212] [id = 700] 14:00:12 INFO - ++DOMWINDOW == 32 (0x7f4afcf29c00) [pid = 2212] [serial = 1684] [outer = (nil)] 14:00:12 INFO - ++DOMWINDOW == 33 (0x7f4afd032c00) [pid = 2212] [serial = 1685] [outer = 0x7f4afcf29c00] 14:00:12 INFO - 315 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_782653_CSS_links_in_Style_Editor.js 14:00:12 INFO - ++DOCSHELL 0x7f4afd598000 == 12 [pid = 2212] [id = 701] 14:00:12 INFO - ++DOMWINDOW == 34 (0x7f4afd343000) [pid = 2212] [serial = 1686] [outer = (nil)] 14:00:12 INFO - ++DOMWINDOW == 35 (0x7f4afd3a9c00) [pid = 2212] [serial = 1687] [outer = 0x7f4afd343000] 14:00:12 INFO - ++DOMWINDOW == 36 (0x7f4afd94e800) [pid = 2212] [serial = 1688] [outer = 0x7f4afd343000] 14:00:13 INFO - ++DOCSHELL 0x7f4afce82800 == 13 [pid = 2212] [id = 702] 14:00:13 INFO - ++DOMWINDOW == 37 (0x7f4afd3ad000) [pid = 2212] [serial = 1689] [outer = (nil)] 14:00:13 INFO - ++DOMWINDOW == 38 (0x7f4afde67c00) [pid = 2212] [serial = 1690] [outer = 0x7f4afd3ad000] 14:00:13 INFO - ++DOMWINDOW == 39 (0x7f4afe0ae400) [pid = 2212] [serial = 1691] [outer = 0x7f4afd3ad000] 14:00:13 INFO - ++DOCSHELL 0x7f4afddad800 == 14 [pid = 2212] [id = 703] 14:00:13 INFO - ++DOMWINDOW == 40 (0x7f4afe3e3c00) [pid = 2212] [serial = 1692] [outer = (nil)] 14:00:13 INFO - ++DOMWINDOW == 41 (0x7f4afe4be800) [pid = 2212] [serial = 1693] [outer = 0x7f4afe3e3c00] 14:00:15 INFO - ++DOCSHELL 0x7f4aff214800 == 15 [pid = 2212] [id = 704] 14:00:15 INFO - ++DOMWINDOW == 42 (0x7f4aff335000) [pid = 2212] [serial = 1694] [outer = (nil)] 14:00:15 INFO - ++DOMWINDOW == 43 (0x7f4aff335c00) [pid = 2212] [serial = 1695] [outer = 0x7f4aff335000] 14:00:15 INFO - ++DOCSHELL 0x7f4afced4800 == 16 [pid = 2212] [id = 705] 14:00:15 INFO - ++DOMWINDOW == 44 (0x7f4afd033800) [pid = 2212] [serial = 1696] [outer = (nil)] 14:00:15 INFO - ++DOMWINDOW == 45 (0x7f4afd33d800) [pid = 2212] [serial = 1697] [outer = 0x7f4afd033800] 14:00:17 INFO - ++DOCSHELL 0x7f4b0c026000 == 17 [pid = 2212] [id = 706] 14:00:17 INFO - ++DOMWINDOW == 46 (0x7f4aff333000) [pid = 2212] [serial = 1698] [outer = (nil)] 14:00:17 INFO - ++DOMWINDOW == 47 (0x7f4afe817c00) [pid = 2212] [serial = 1699] [outer = 0x7f4aff333000] 14:00:20 INFO - --DOCSHELL 0x7f4afce93000 == 16 [pid = 2212] [id = 697] 14:00:20 INFO - --DOCSHELL 0x7f4afcec8800 == 15 [pid = 2212] [id = 696] 14:00:20 INFO - --DOCSHELL 0x7f4afddad800 == 14 [pid = 2212] [id = 703] 14:00:20 INFO - --DOCSHELL 0x7f4aff214800 == 13 [pid = 2212] [id = 704] 14:00:20 INFO - --DOCSHELL 0x7f4afced4800 == 12 [pid = 2212] [id = 705] 14:00:20 INFO - --DOCSHELL 0x7f4b0c026000 == 11 [pid = 2212] [id = 706] 14:00:20 INFO - --DOMWINDOW == 46 (0x7f4afe553400) [pid = 2212] [serial = 1669] [outer = (nil)] [url = about:blank] 14:00:20 INFO - --DOMWINDOW == 45 (0x7f4afe8aec00) [pid = 2212] [serial = 1682] [outer = (nil)] [url = about:blank] 14:00:20 INFO - --DOMWINDOW == 44 (0x7f4afe0ad800) [pid = 2212] [serial = 1667] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:00:20 INFO - --DOMWINDOW == 43 (0x7f4aff41a400) [pid = 2212] [serial = 1671] [outer = (nil)] [url = about:blank] 14:00:20 INFO - --DOMWINDOW == 42 (0x7f4afd3a9c00) [pid = 2212] [serial = 1687] [outer = (nil)] [url = about:blank] 14:00:20 INFO - --DOMWINDOW == 41 (0x7f4afe0adc00) [pid = 2212] [serial = 1678] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:00:20 INFO - --DOMWINDOW == 40 (0x7f4afde5ec00) [pid = 2212] [serial = 1676] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_bug_770099_violation.html] 14:00:20 INFO - --DOMWINDOW == 39 (0x7f4afd342400) [pid = 2212] [serial = 1674] [outer = (nil)] [url = about:blank] 14:00:20 INFO - --DOMWINDOW == 38 (0x7f4afde62800) [pid = 2212] [serial = 1677] [outer = (nil)] [url = about:blank] 14:00:20 INFO - --DOMWINDOW == 37 (0x7f4afde67c00) [pid = 2212] [serial = 1690] [outer = (nil)] [url = about:blank] 14:00:20 INFO - --DOMWINDOW == 36 (0x7f4afd3a4400) [pid = 2212] [serial = 1675] [outer = (nil)] [url = about:blank] 14:00:20 INFO - --DOMWINDOW == 35 (0x7f4b07a07000) [pid = 2212] [serial = 1683] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_bug_770099_violation.html] 14:00:20 INFO - MEMORY STAT | vsize 1182MB | residentFast 318MB | heapAllocated 123MB 14:00:20 INFO - 316 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_782653_CSS_links_in_Style_Editor.js | took 8483ms 14:00:20 INFO - ++DOCSHELL 0x7f4afcebc800 == 12 [pid = 2212] [id = 707] 14:00:20 INFO - ++DOMWINDOW == 36 (0x7f4afc868c00) [pid = 2212] [serial = 1700] [outer = (nil)] 14:00:20 INFO - ++DOMWINDOW == 37 (0x7f4afcf2d000) [pid = 2212] [serial = 1701] [outer = 0x7f4afc868c00] 14:00:21 INFO - 317 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_817834_add_edited_input_to_history.js 14:00:21 INFO - ++DOCSHELL 0x7f4afd9a6000 == 13 [pid = 2212] [id = 708] 14:00:21 INFO - ++DOMWINDOW == 38 (0x7f4afd342c00) [pid = 2212] [serial = 1702] [outer = (nil)] 14:00:21 INFO - ++DOMWINDOW == 39 (0x7f4afd3a6c00) [pid = 2212] [serial = 1703] [outer = 0x7f4afd342c00] 14:00:21 INFO - ++DOCSHELL 0x7f4afce89800 == 14 [pid = 2212] [id = 709] 14:00:21 INFO - ++DOMWINDOW == 40 (0x7f4afd3ac400) [pid = 2212] [serial = 1704] [outer = (nil)] 14:00:21 INFO - ++DOMWINDOW == 41 (0x7f4afde5f000) [pid = 2212] [serial = 1705] [outer = 0x7f4afd3ac400] 14:00:21 INFO - ++DOMWINDOW == 42 (0x7f4afe0b5400) [pid = 2212] [serial = 1706] [outer = 0x7f4afd3ac400] 14:00:21 INFO - ++DOCSHELL 0x7f4afe2be000 == 15 [pid = 2212] [id = 710] 14:00:21 INFO - ++DOMWINDOW == 43 (0x7f4afe551000) [pid = 2212] [serial = 1707] [outer = (nil)] 14:00:21 INFO - ++DOMWINDOW == 44 (0x7f4afe570c00) [pid = 2212] [serial = 1708] [outer = 0x7f4afe551000] 14:00:24 INFO - --DOCSHELL 0x7f4afcebd000 == 14 [pid = 2212] [id = 700] 14:00:24 INFO - --DOCSHELL 0x7f4afd598000 == 13 [pid = 2212] [id = 701] 14:00:24 INFO - --DOCSHELL 0x7f4afe2be000 == 12 [pid = 2212] [id = 710] 14:00:24 INFO - --DOCSHELL 0x7f4afce82800 == 11 [pid = 2212] [id = 702] 14:00:24 INFO - --DOMWINDOW == 43 (0x7f4afe4bd400) [pid = 2212] [serial = 1680] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:00:25 INFO - --DOMWINDOW == 42 (0x7f4afd032c00) [pid = 2212] [serial = 1685] [outer = (nil)] [url = about:blank] 14:00:25 INFO - --DOMWINDOW == 41 (0x7f4afde5f000) [pid = 2212] [serial = 1705] [outer = (nil)] [url = about:blank] 14:00:25 INFO - --DOMWINDOW == 40 (0x7f4aff335000) [pid = 2212] [serial = 1694] [outer = (nil)] [url = chrome://devtools/content/styleeditor/styleeditor.xul] 14:00:25 INFO - --DOMWINDOW == 39 (0x7f4afe3e3c00) [pid = 2212] [serial = 1692] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:00:25 INFO - --DOMWINDOW == 38 (0x7f4afd3ad000) [pid = 2212] [serial = 1689] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:00:25 INFO - --DOMWINDOW == 37 (0x7f4afd343000) [pid = 2212] [serial = 1686] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-782653-css-errors.html] 14:00:25 INFO - --DOMWINDOW == 36 (0x7f4afcf29c00) [pid = 2212] [serial = 1684] [outer = (nil)] [url = about:blank] 14:00:25 INFO - --DOMWINDOW == 35 (0x7f4afd033800) [pid = 2212] [serial = 1696] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:00:25 INFO - --DOMWINDOW == 34 (0x7f4aff333000) [pid = 2212] [serial = 1698] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:00:25 INFO - --DOMWINDOW == 33 (0x7f4afd94e800) [pid = 2212] [serial = 1688] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-782653-css-errors.html] 14:00:25 INFO - MEMORY STAT | vsize 1181MB | residentFast 315MB | heapAllocated 123MB 14:00:25 INFO - 318 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_817834_add_edited_input_to_history.js | took 4537ms 14:00:25 INFO - ++DOCSHELL 0x7f4afce94800 == 12 [pid = 2212] [id = 711] 14:00:25 INFO - ++DOMWINDOW == 34 (0x7f4afcf23000) [pid = 2212] [serial = 1709] [outer = (nil)] 14:00:25 INFO - ++DOMWINDOW == 35 (0x7f4afcf2b800) [pid = 2212] [serial = 1710] [outer = 0x7f4afcf23000] 14:00:25 INFO - 319 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_837351_securityerrors.js 14:00:25 INFO - ++DOCSHELL 0x7f4afd9b5000 == 13 [pid = 2212] [id = 712] 14:00:25 INFO - ++DOMWINDOW == 36 (0x7f4afd341c00) [pid = 2212] [serial = 1711] [outer = (nil)] 14:00:25 INFO - ++DOMWINDOW == 37 (0x7f4afd3a3800) [pid = 2212] [serial = 1712] [outer = 0x7f4afd341c00] 14:00:26 INFO - ++DOMWINDOW == 38 (0x7f4afde5e000) [pid = 2212] [serial = 1713] [outer = 0x7f4afd341c00] 14:00:26 INFO - ++DOCSHELL 0x7f4afdc22800 == 14 [pid = 2212] [id = 713] 14:00:26 INFO - ++DOMWINDOW == 39 (0x7f4afde6a800) [pid = 2212] [serial = 1714] [outer = (nil)] 14:00:26 INFO - [2212] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x805E0006: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 445 14:00:26 INFO - ++DOMWINDOW == 40 (0x7f4afde65c00) [pid = 2212] [serial = 1715] [outer = 0x7f4afde6a800] 14:00:26 INFO - ++DOCSHELL 0x7f4afcec3800 == 15 [pid = 2212] [id = 714] 14:00:26 INFO - ++DOMWINDOW == 41 (0x7f4afd3ae400) [pid = 2212] [serial = 1716] [outer = (nil)] 14:00:26 INFO - ++DOMWINDOW == 42 (0x7f4afe00cc00) [pid = 2212] [serial = 1717] [outer = 0x7f4afd3ae400] 14:00:26 INFO - ++DOMWINDOW == 43 (0x7f4afe3dd800) [pid = 2212] [serial = 1718] [outer = 0x7f4afd3ae400] 14:00:27 INFO - ++DOCSHELL 0x7f4afe85a000 == 16 [pid = 2212] [id = 715] 14:00:27 INFO - ++DOMWINDOW == 44 (0x7f4afe4bfc00) [pid = 2212] [serial = 1719] [outer = (nil)] 14:00:27 INFO - ++DOMWINDOW == 45 (0x7f4afe815000) [pid = 2212] [serial = 1720] [outer = 0x7f4afe4bfc00] 14:00:30 INFO - --DOCSHELL 0x7f4afcebc800 == 15 [pid = 2212] [id = 707] 14:00:30 INFO - --DOCSHELL 0x7f4afd9a6000 == 14 [pid = 2212] [id = 708] 14:00:30 INFO - --DOCSHELL 0x7f4afcec3800 == 13 [pid = 2212] [id = 714] 14:00:30 INFO - --DOCSHELL 0x7f4afce89800 == 12 [pid = 2212] [id = 709] 14:00:30 INFO - --DOCSHELL 0x7f4afe85a000 == 11 [pid = 2212] [id = 715] 14:00:30 INFO - --DOMWINDOW == 44 (0x7f4aff335c00) [pid = 2212] [serial = 1695] [outer = (nil)] [url = about:blank] 14:00:30 INFO - --DOMWINDOW == 43 (0x7f4afe817c00) [pid = 2212] [serial = 1699] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:00:30 INFO - --DOMWINDOW == 42 (0x7f4afd33d800) [pid = 2212] [serial = 1697] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:00:30 INFO - --DOMWINDOW == 41 (0x7f4afe4be800) [pid = 2212] [serial = 1693] [outer = (nil)] [url = about:blank] 14:00:30 INFO - --DOMWINDOW == 40 (0x7f4afe0ae400) [pid = 2212] [serial = 1691] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:00:30 INFO - --DOMWINDOW == 39 (0x7f4afcf2d000) [pid = 2212] [serial = 1701] [outer = (nil)] [url = about:blank] 14:00:30 INFO - --DOMWINDOW == 38 (0x7f4afd3a6c00) [pid = 2212] [serial = 1703] [outer = (nil)] [url = about:blank] 14:00:30 INFO - --DOMWINDOW == 37 (0x7f4afd3a3800) [pid = 2212] [serial = 1712] [outer = (nil)] [url = about:blank] 14:00:30 INFO - --DOMWINDOW == 36 (0x7f4afe00cc00) [pid = 2212] [serial = 1717] [outer = (nil)] [url = about:blank] 14:00:30 INFO - --DOMWINDOW == 35 (0x7f4afe551000) [pid = 2212] [serial = 1707] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:00:30 INFO - --DOMWINDOW == 34 (0x7f4afd3ac400) [pid = 2212] [serial = 1704] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:00:30 INFO - --DOMWINDOW == 33 (0x7f4afc868c00) [pid = 2212] [serial = 1700] [outer = (nil)] [url = about:blank] 14:00:30 INFO - --DOMWINDOW == 32 (0x7f4afd342c00) [pid = 2212] [serial = 1702] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20817834] 14:00:30 INFO - --DOCSHELL 0x7f4afdc22800 == 10 [pid = 2212] [id = 713] 14:00:30 INFO - MEMORY STAT | vsize 1177MB | residentFast 309MB | heapAllocated 118MB 14:00:30 INFO - 320 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_837351_securityerrors.js | took 5162ms 14:00:30 INFO - ++DOCSHELL 0x7f4afce90000 == 11 [pid = 2212] [id = 716] 14:00:30 INFO - ++DOMWINDOW == 33 (0x7f4afcf24000) [pid = 2212] [serial = 1721] [outer = (nil)] 14:00:31 INFO - ++DOMWINDOW == 34 (0x7f4afcf2c000) [pid = 2212] [serial = 1722] [outer = 0x7f4afcf24000] 14:00:31 INFO - 321 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_915141_toggle_response_logging_with_keyboard.js 14:00:31 INFO - ++DOCSHELL 0x7f4afd5a5000 == 12 [pid = 2212] [id = 717] 14:00:31 INFO - ++DOMWINDOW == 35 (0x7f4afd33e000) [pid = 2212] [serial = 1723] [outer = (nil)] 14:00:31 INFO - ++DOMWINDOW == 36 (0x7f4afd343c00) [pid = 2212] [serial = 1724] [outer = 0x7f4afd33e000] 14:00:31 INFO - ++DOCSHELL 0x7f4afcecc000 == 13 [pid = 2212] [id = 718] 14:00:31 INFO - ++DOMWINDOW == 37 (0x7f4afd3a3c00) [pid = 2212] [serial = 1725] [outer = (nil)] 14:00:31 INFO - ++DOMWINDOW == 38 (0x7f4afde5bc00) [pid = 2212] [serial = 1726] [outer = 0x7f4afd3a3c00] 14:00:31 INFO - ++DOMWINDOW == 39 (0x7f4afde69c00) [pid = 2212] [serial = 1727] [outer = 0x7f4afd3a3c00] 14:00:31 INFO - ++DOCSHELL 0x7f4afdda1800 == 14 [pid = 2212] [id = 719] 14:00:31 INFO - ++DOMWINDOW == 40 (0x7f4afe3d8800) [pid = 2212] [serial = 1728] [outer = (nil)] 14:00:31 INFO - ++DOMWINDOW == 41 (0x7f4afe3dec00) [pid = 2212] [serial = 1729] [outer = 0x7f4afe3d8800] 14:00:34 INFO - --DOCSHELL 0x7f4afce94800 == 13 [pid = 2212] [id = 711] 14:00:34 INFO - --DOCSHELL 0x7f4afdda1800 == 12 [pid = 2212] [id = 719] 14:00:34 INFO - --DOCSHELL 0x7f4afd9b5000 == 11 [pid = 2212] [id = 712] 14:00:35 INFO - --DOMWINDOW == 40 (0x7f4afe570c00) [pid = 2212] [serial = 1708] [outer = (nil)] [url = about:blank] 14:00:35 INFO - --DOMWINDOW == 39 (0x7f4afe0b5400) [pid = 2212] [serial = 1706] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:00:35 INFO - --DOMWINDOW == 38 (0x7f4afde65c00) [pid = 2212] [serial = 1715] [outer = (nil)] [url = about:blank] 14:00:35 INFO - --DOMWINDOW == 37 (0x7f4afcf2b800) [pid = 2212] [serial = 1710] [outer = (nil)] [url = about:blank] 14:00:35 INFO - --DOMWINDOW == 36 (0x7f4afde5bc00) [pid = 2212] [serial = 1726] [outer = (nil)] [url = about:blank] 14:00:35 INFO - --DOMWINDOW == 35 (0x7f4afd3ae400) [pid = 2212] [serial = 1716] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:00:35 INFO - --DOMWINDOW == 34 (0x7f4afe4bfc00) [pid = 2212] [serial = 1719] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:00:35 INFO - --DOMWINDOW == 33 (0x7f4afde6a800) [pid = 2212] [serial = 1714] [outer = (nil)] [url = about:blank] 14:00:35 INFO - --DOMWINDOW == 32 (0x7f4afd341c00) [pid = 2212] [serial = 1711] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-bug-837351-security-errors.html] 14:00:35 INFO - --DOMWINDOW == 31 (0x7f4afcf23000) [pid = 2212] [serial = 1709] [outer = (nil)] [url = about:blank] 14:00:35 INFO - --DOMWINDOW == 30 (0x7f4afde5e000) [pid = 2212] [serial = 1713] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-bug-837351-security-errors.html] 14:00:35 INFO - MEMORY STAT | vsize 1179MB | residentFast 308MB | heapAllocated 118MB 14:00:35 INFO - 322 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_915141_toggle_response_logging_with_keyboard.js | took 4309ms 14:00:35 INFO - ++DOCSHELL 0x7f4afce96800 == 12 [pid = 2212] [id = 720] 14:00:35 INFO - ++DOMWINDOW == 31 (0x7f4afc867800) [pid = 2212] [serial = 1730] [outer = (nil)] 14:00:35 INFO - ++DOMWINDOW == 32 (0x7f4afcf2dc00) [pid = 2212] [serial = 1731] [outer = 0x7f4afc867800] 14:00:35 INFO - 323 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_bug_922212_console_dirxml.js 14:00:35 INFO - ++DOCSHELL 0x7f4afd9a7800 == 13 [pid = 2212] [id = 721] 14:00:35 INFO - ++DOMWINDOW == 33 (0x7f4afd340c00) [pid = 2212] [serial = 1732] [outer = (nil)] 14:00:35 INFO - ++DOMWINDOW == 34 (0x7f4afd3a5c00) [pid = 2212] [serial = 1733] [outer = 0x7f4afd340c00] 14:00:36 INFO - ++DOCSHELL 0x7f4afce7f000 == 14 [pid = 2212] [id = 722] 14:00:36 INFO - ++DOMWINDOW == 35 (0x7f4afd3ad000) [pid = 2212] [serial = 1734] [outer = (nil)] 14:00:36 INFO - ++DOMWINDOW == 36 (0x7f4afde5e000) [pid = 2212] [serial = 1735] [outer = 0x7f4afd3ad000] 14:00:36 INFO - ++DOMWINDOW == 37 (0x7f4afe00a800) [pid = 2212] [serial = 1736] [outer = 0x7f4afd3ad000] 14:00:36 INFO - ++DOCSHELL 0x7f4afe2d5000 == 15 [pid = 2212] [id = 723] 14:00:36 INFO - ++DOMWINDOW == 38 (0x7f4afe3e1400) [pid = 2212] [serial = 1737] [outer = (nil)] 14:00:36 INFO - ++DOMWINDOW == 39 (0x7f4afe550000) [pid = 2212] [serial = 1738] [outer = 0x7f4afe3e1400] 14:00:39 INFO - --DOCSHELL 0x7f4afce90000 == 14 [pid = 2212] [id = 716] 14:00:39 INFO - --DOCSHELL 0x7f4afd5a5000 == 13 [pid = 2212] [id = 717] 14:00:39 INFO - --DOCSHELL 0x7f4afcecc000 == 12 [pid = 2212] [id = 718] 14:00:39 INFO - --DOCSHELL 0x7f4afe2d5000 == 11 [pid = 2212] [id = 723] 14:00:39 INFO - --DOMWINDOW == 38 (0x7f4afe3dd800) [pid = 2212] [serial = 1718] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:00:39 INFO - --DOMWINDOW == 37 (0x7f4afe815000) [pid = 2212] [serial = 1720] [outer = (nil)] [url = about:blank] 14:00:40 INFO - --DOMWINDOW == 36 (0x7f4afd343c00) [pid = 2212] [serial = 1724] [outer = (nil)] [url = about:blank] 14:00:40 INFO - --DOMWINDOW == 35 (0x7f4afcf2c000) [pid = 2212] [serial = 1722] [outer = (nil)] [url = about:blank] 14:00:40 INFO - --DOMWINDOW == 34 (0x7f4afde5e000) [pid = 2212] [serial = 1735] [outer = (nil)] [url = about:blank] 14:00:40 INFO - --DOMWINDOW == 33 (0x7f4afe3d8800) [pid = 2212] [serial = 1728] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:00:40 INFO - --DOMWINDOW == 32 (0x7f4afd3a3c00) [pid = 2212] [serial = 1725] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:00:40 INFO - --DOMWINDOW == 31 (0x7f4afd33e000) [pid = 2212] [serial = 1723] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20915141:%20Toggle%20log%20response%20bodies%20with%20keyboard] 14:00:40 INFO - --DOMWINDOW == 30 (0x7f4afcf24000) [pid = 2212] [serial = 1721] [outer = (nil)] [url = about:blank] 14:00:40 INFO - MEMORY STAT | vsize 1181MB | residentFast 311MB | heapAllocated 119MB 14:00:40 INFO - 324 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_bug_922212_console_dirxml.js | took 4573ms 14:00:40 INFO - ++DOCSHELL 0x7f4afce94800 == 12 [pid = 2212] [id = 724] 14:00:40 INFO - ++DOMWINDOW == 31 (0x7f4afcf23000) [pid = 2212] [serial = 1739] [outer = (nil)] 14:00:40 INFO - ++DOMWINDOW == 32 (0x7f4afcf30000) [pid = 2212] [serial = 1740] [outer = 0x7f4afcf23000] 14:00:40 INFO - 325 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_cached_autocomplete.js 14:00:40 INFO - ++DOCSHELL 0x7f4afd9b1000 == 13 [pid = 2212] [id = 725] 14:00:40 INFO - ++DOMWINDOW == 33 (0x7f4afd343000) [pid = 2212] [serial = 1741] [outer = (nil)] 14:00:40 INFO - ++DOMWINDOW == 34 (0x7f4afd3ae400) [pid = 2212] [serial = 1742] [outer = 0x7f4afd343000] 14:00:40 INFO - ++DOCSHELL 0x7f4afce84000 == 14 [pid = 2212] [id = 726] 14:00:40 INFO - ++DOMWINDOW == 35 (0x7f4afd942400) [pid = 2212] [serial = 1743] [outer = (nil)] 14:00:40 INFO - ++DOMWINDOW == 36 (0x7f4afde5e000) [pid = 2212] [serial = 1744] [outer = 0x7f4afd942400] 14:00:41 INFO - ++DOMWINDOW == 37 (0x7f4afe0ae400) [pid = 2212] [serial = 1745] [outer = 0x7f4afd942400] 14:00:41 INFO - ++DOCSHELL 0x7f4afe39a000 == 15 [pid = 2212] [id = 727] 14:00:41 INFO - ++DOMWINDOW == 38 (0x7f4afe552000) [pid = 2212] [serial = 1746] [outer = (nil)] 14:00:41 INFO - ++DOMWINDOW == 39 (0x7f4afe572000) [pid = 2212] [serial = 1747] [outer = 0x7f4afe552000] 14:00:44 INFO - [2212] WARNING: Must complete empty transaction when compositing!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/base/nsPresShell.cpp, line 6065 14:00:51 INFO - [2212] WARNING: Must complete empty transaction when compositing!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/base/nsPresShell.cpp, line 6065 14:00:54 INFO - --DOCSHELL 0x7f4afd9a7800 == 14 [pid = 2212] [id = 721] 14:00:54 INFO - --DOCSHELL 0x7f4afce96800 == 13 [pid = 2212] [id = 720] 14:00:54 INFO - --DOCSHELL 0x7f4afce7f000 == 12 [pid = 2212] [id = 722] 14:00:54 INFO - --DOCSHELL 0x7f4afce84000 == 11 [pid = 2212] [id = 726] 14:00:54 INFO - --DOCSHELL 0x7f4afe39a000 == 10 [pid = 2212] [id = 727] 14:00:54 INFO - --DOMWINDOW == 38 (0x7f4afe3dec00) [pid = 2212] [serial = 1729] [outer = (nil)] [url = about:blank] 14:00:54 INFO - --DOMWINDOW == 37 (0x7f4afde69c00) [pid = 2212] [serial = 1727] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:00:54 INFO - --DOMWINDOW == 36 (0x7f4afe3e1400) [pid = 2212] [serial = 1737] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:00:54 INFO - --DOMWINDOW == 35 (0x7f4afd3ad000) [pid = 2212] [serial = 1734] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:00:54 INFO - --DOMWINDOW == 34 (0x7f4afd340c00) [pid = 2212] [serial = 1732] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20922212:%20%20Add%20console.dirxml] 14:00:54 INFO - --DOMWINDOW == 33 (0x7f4afc867800) [pid = 2212] [serial = 1730] [outer = (nil)] [url = about:blank] 14:00:54 INFO - --DOMWINDOW == 32 (0x7f4afd3a5c00) [pid = 2212] [serial = 1733] [outer = (nil)] [url = about:blank] 14:00:54 INFO - --DOMWINDOW == 31 (0x7f4afcf2dc00) [pid = 2212] [serial = 1731] [outer = (nil)] [url = about:blank] 14:00:54 INFO - --DOMWINDOW == 30 (0x7f4afde5e000) [pid = 2212] [serial = 1744] [outer = (nil)] [url = about:blank] 14:00:54 INFO - MEMORY STAT | vsize 1180MB | residentFast 315MB | heapAllocated 122MB 14:00:54 INFO - 326 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_cached_autocomplete.js | took 14297ms 14:00:54 INFO - ++DOCSHELL 0x7f4afcebe000 == 11 [pid = 2212] [id = 728] 14:00:54 INFO - ++DOMWINDOW == 31 (0x7f4afcf24c00) [pid = 2212] [serial = 1748] [outer = (nil)] 14:00:54 INFO - ++DOMWINDOW == 32 (0x7f4afcf30c00) [pid = 2212] [serial = 1749] [outer = 0x7f4afcf24c00] 14:00:55 INFO - 327 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_cd_iframe.js 14:00:55 INFO - ++DOCSHELL 0x7f4afd9ab000 == 12 [pid = 2212] [id = 729] 14:00:55 INFO - ++DOMWINDOW == 33 (0x7f4afd346400) [pid = 2212] [serial = 1750] [outer = (nil)] 14:00:55 INFO - ++DOMWINDOW == 34 (0x7f4afd3b1800) [pid = 2212] [serial = 1751] [outer = 0x7f4afd346400] 14:00:55 INFO - ++DOMWINDOW == 35 (0x7f4aff332400) [pid = 2212] [serial = 1752] [outer = 0x7f4afd346400] 14:00:55 INFO - ++DOCSHELL 0x7f4afdc17000 == 13 [pid = 2212] [id = 730] 14:00:55 INFO - ++DOMWINDOW == 36 (0x7f4afde61c00) [pid = 2212] [serial = 1753] [outer = (nil)] 14:00:55 INFO - ++DOMWINDOW == 37 (0x7f4afde6a000) [pid = 2212] [serial = 1754] [outer = 0x7f4afde61c00] 14:00:55 INFO - ++DOCSHELL 0x7f4afd9a5000 == 14 [pid = 2212] [id = 731] 14:00:55 INFO - ++DOMWINDOW == 38 (0x7f4afe0b3800) [pid = 2212] [serial = 1755] [outer = (nil)] 14:00:55 INFO - ++DOMWINDOW == 39 (0x7f4afe0b6c00) [pid = 2212] [serial = 1756] [outer = 0x7f4afe0b3800] 14:00:56 INFO - ++DOMWINDOW == 40 (0x7f4afe3dd000) [pid = 2212] [serial = 1757] [outer = 0x7f4afe0b3800] 14:00:56 INFO - ++DOCSHELL 0x7f4afe84c800 == 15 [pid = 2212] [id = 732] 14:00:56 INFO - ++DOMWINDOW == 41 (0x7f4afe553000) [pid = 2212] [serial = 1758] [outer = (nil)] 14:00:56 INFO - ++DOMWINDOW == 42 (0x7f4afe573000) [pid = 2212] [serial = 1759] [outer = 0x7f4afe553000] 14:01:02 INFO - --DOCSHELL 0x7f4afce94800 == 14 [pid = 2212] [id = 724] 14:01:02 INFO - --DOCSHELL 0x7f4afd9b1000 == 13 [pid = 2212] [id = 725] 14:01:02 INFO - --DOCSHELL 0x7f4afd9a5000 == 12 [pid = 2212] [id = 731] 14:01:02 INFO - --DOCSHELL 0x7f4afe84c800 == 11 [pid = 2212] [id = 732] 14:01:02 INFO - --DOMWINDOW == 41 (0x7f4afe550000) [pid = 2212] [serial = 1738] [outer = (nil)] [url = about:blank] 14:01:02 INFO - --DOMWINDOW == 40 (0x7f4afe00a800) [pid = 2212] [serial = 1736] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:01:02 INFO - --DOMWINDOW == 39 (0x7f4afcf30000) [pid = 2212] [serial = 1740] [outer = (nil)] [url = about:blank] 14:01:02 INFO - --DOMWINDOW == 38 (0x7f4afd3ae400) [pid = 2212] [serial = 1742] [outer = (nil)] [url = about:blank] 14:01:02 INFO - --DOMWINDOW == 37 (0x7f4afd3b1800) [pid = 2212] [serial = 1751] [outer = (nil)] [url = about:blank] 14:01:02 INFO - --DOMWINDOW == 36 (0x7f4afe0b6c00) [pid = 2212] [serial = 1756] [outer = (nil)] [url = about:blank] 14:01:02 INFO - --DOMWINDOW == 35 (0x7f4afd942400) [pid = 2212] [serial = 1743] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:01:02 INFO - --DOMWINDOW == 34 (0x7f4afe552000) [pid = 2212] [serial = 1746] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:01:02 INFO - --DOMWINDOW == 33 (0x7f4afcf23000) [pid = 2212] [serial = 1739] [outer = (nil)] [url = about:blank] 14:01:02 INFO - --DOMWINDOW == 32 (0x7f4afd343000) [pid = 2212] [serial = 1741] [outer = (nil)] [url = data:text/html;charset=utf8,<p>test%20cached%20autocompletion%20results] 14:01:02 INFO - --DOCSHELL 0x7f4afdc17000 == 10 [pid = 2212] [id = 730] 14:01:02 INFO - MEMORY STAT | vsize 1180MB | residentFast 311MB | heapAllocated 118MB 14:01:02 INFO - 328 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_cd_iframe.js | took 7667ms 14:01:02 INFO - ++DOCSHELL 0x7f4afce7a000 == 11 [pid = 2212] [id = 733] 14:01:02 INFO - ++DOMWINDOW == 33 (0x7f4afc868800) [pid = 2212] [serial = 1760] [outer = (nil)] 14:01:02 INFO - ++DOMWINDOW == 34 (0x7f4afcf29800) [pid = 2212] [serial = 1761] [outer = 0x7f4afc868800] 14:01:02 INFO - 329 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_certificate_messages.js 14:01:03 INFO - ++DOCSHELL 0x7f4afd9af000 == 12 [pid = 2212] [id = 734] 14:01:03 INFO - ++DOMWINDOW == 35 (0x7f4afd040000) [pid = 2212] [serial = 1762] [outer = (nil)] 14:01:03 INFO - ++DOMWINDOW == 36 (0x7f4afd341c00) [pid = 2212] [serial = 1763] [outer = 0x7f4afd040000] 14:01:03 INFO - ++DOCSHELL 0x7f4afdc17000 == 13 [pid = 2212] [id = 735] 14:01:03 INFO - ++DOMWINDOW == 37 (0x7f4afd342c00) [pid = 2212] [serial = 1764] [outer = (nil)] 14:01:03 INFO - ++DOMWINDOW == 38 (0x7f4afd950c00) [pid = 2212] [serial = 1765] [outer = 0x7f4afd342c00] 14:01:03 INFO - ++DOMWINDOW == 39 (0x7f4afde68800) [pid = 2212] [serial = 1766] [outer = 0x7f4afd342c00] 14:01:03 INFO - ++DOCSHELL 0x7f4afe4e2800 == 14 [pid = 2212] [id = 736] 14:01:03 INFO - ++DOMWINDOW == 40 (0x7f4afe3df400) [pid = 2212] [serial = 1767] [outer = (nil)] 14:01:03 INFO - ++DOMWINDOW == 41 (0x7f4afe3e3400) [pid = 2212] [serial = 1768] [outer = 0x7f4afe3df400] 14:01:06 INFO - ++DOMWINDOW == 42 (0x7f4afde6ac00) [pid = 2212] [serial = 1769] [outer = 0x7f4afd040000] 14:01:06 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:01:08 INFO - ++DOMWINDOW == 43 (0x7f4afe573800) [pid = 2212] [serial = 1770] [outer = 0x7f4afd040000] 14:01:08 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:01:09 INFO - ++DOMWINDOW == 44 (0x7f4afe8c0800) [pid = 2212] [serial = 1771] [outer = 0x7f4afd040000] 14:01:09 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:01:10 INFO - ++DOMWINDOW == 45 (0x7f4b00f29800) [pid = 2212] [serial = 1772] [outer = 0x7f4afd040000] 14:01:10 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:01:12 INFO - --DOCSHELL 0x7f4afd9ab000 == 13 [pid = 2212] [id = 729] 14:01:12 INFO - --DOCSHELL 0x7f4afe4e2800 == 12 [pid = 2212] [id = 736] 14:01:12 INFO - --DOCSHELL 0x7f4afcebe000 == 11 [pid = 2212] [id = 728] 14:01:12 INFO - --DOMWINDOW == 44 (0x7f4afe572000) [pid = 2212] [serial = 1747] [outer = (nil)] [url = about:blank] 14:01:12 INFO - --DOMWINDOW == 43 (0x7f4afe0ae400) [pid = 2212] [serial = 1745] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:01:12 INFO - --DOMWINDOW == 42 (0x7f4afd341c00) [pid = 2212] [serial = 1763] [outer = (nil)] [url = about:blank] 14:01:12 INFO - --DOMWINDOW == 41 (0x7f4afcf30c00) [pid = 2212] [serial = 1749] [outer = (nil)] [url = about:blank] 14:01:12 INFO - --DOMWINDOW == 40 (0x7f4afd950c00) [pid = 2212] [serial = 1765] [outer = (nil)] [url = about:blank] 14:01:12 INFO - --DOMWINDOW == 39 (0x7f4afe553000) [pid = 2212] [serial = 1758] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:01:12 INFO - --DOMWINDOW == 38 (0x7f4afe0b3800) [pid = 2212] [serial = 1755] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:01:12 INFO - --DOMWINDOW == 37 (0x7f4afcf24c00) [pid = 2212] [serial = 1748] [outer = (nil)] [url = about:blank] 14:01:12 INFO - --DOMWINDOW == 36 (0x7f4afd346400) [pid = 2212] [serial = 1750] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-parent.html] 14:01:12 INFO - --DOMWINDOW == 35 (0x7f4afde61c00) [pid = 2212] [serial = 1753] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-child.html] 14:01:12 INFO - --DOMWINDOW == 34 (0x7f4aff332400) [pid = 2212] [serial = 1752] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-parent.html] 14:01:12 INFO - --DOMWINDOW == 33 (0x7f4afde6a000) [pid = 2212] [serial = 1754] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug-609872-cd-iframe-child.html] 14:01:13 INFO - MEMORY STAT | vsize 1182MB | residentFast 312MB | heapAllocated 119MB 14:01:13 INFO - 330 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_certificate_messages.js | took 10067ms 14:01:13 INFO - ++DOCSHELL 0x7f4afcec8000 == 12 [pid = 2212] [id = 737] 14:01:13 INFO - ++DOMWINDOW == 34 (0x7f4afcf26000) [pid = 2212] [serial = 1773] [outer = (nil)] 14:01:13 INFO - ++DOMWINDOW == 35 (0x7f4afcf30800) [pid = 2212] [serial = 1774] [outer = 0x7f4afcf26000] 14:01:13 INFO - 331 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_change_font_size.js 14:01:13 INFO - ++DOCSHELL 0x7f4afdc06000 == 13 [pid = 2212] [id = 738] 14:01:13 INFO - ++DOMWINDOW == 36 (0x7f4afd3a3c00) [pid = 2212] [serial = 1775] [outer = (nil)] 14:01:13 INFO - ++DOMWINDOW == 37 (0x7f4afd3b0800) [pid = 2212] [serial = 1776] [outer = 0x7f4afd3a3c00] 14:01:13 INFO - ++DOMWINDOW == 38 (0x7f4afde5d800) [pid = 2212] [serial = 1777] [outer = 0x7f4afd3a3c00] 14:01:14 INFO - ++DOCSHELL 0x7f4afe4e1800 == 14 [pid = 2212] [id = 739] 14:01:14 INFO - ++DOMWINDOW == 39 (0x7f4afe1f1c00) [pid = 2212] [serial = 1778] [outer = (nil)] 14:01:14 INFO - ++DOMWINDOW == 40 (0x7f4afe1f2800) [pid = 2212] [serial = 1779] [outer = 0x7f4afe1f1c00] 14:01:15 INFO - MEMORY STAT | vsize 1184MB | residentFast 316MB | heapAllocated 124MB 14:01:15 INFO - 332 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_change_font_size.js | took 2585ms 14:01:15 INFO - ++DOCSHELL 0x7f4afe855800 == 15 [pid = 2212] [id = 740] 14:01:15 INFO - ++DOMWINDOW == 41 (0x7f4afe0adc00) [pid = 2212] [serial = 1780] [outer = (nil)] 14:01:15 INFO - ++DOMWINDOW == 42 (0x7f4afe0b5400) [pid = 2212] [serial = 1781] [outer = 0x7f4afe0adc00] 14:01:16 INFO - 333 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_chrome.js 14:01:16 INFO - ++DOCSHELL 0x7f4afcec7800 == 16 [pid = 2212] [id = 741] 14:01:16 INFO - ++DOMWINDOW == 43 (0x7f4afe4c2000) [pid = 2212] [serial = 1782] [outer = (nil)] 14:01:16 INFO - ++DOMWINDOW == 44 (0x7f4afe552000) [pid = 2212] [serial = 1783] [outer = 0x7f4afe4c2000] 14:01:16 INFO - ++DOMWINDOW == 45 (0x7f4afe8b0800) [pid = 2212] [serial = 1784] [outer = 0x7f4afe4c2000] 14:01:17 INFO - ++DOCSHELL 0x7f4b07c67800 == 17 [pid = 2212] [id = 742] 14:01:17 INFO - ++DOMWINDOW == 46 (0x7f4afe8ab400) [pid = 2212] [serial = 1785] [outer = (nil)] 14:01:17 INFO - ++DOMWINDOW == 47 (0x7f4afe8ac000) [pid = 2212] [serial = 1786] [outer = 0x7f4afe8ab400] 14:01:17 INFO - ++DOMWINDOW == 48 (0x7f4aff339800) [pid = 2212] [serial = 1787] [outer = 0x7f4afe8ab400] 14:01:17 INFO - ++DOCSHELL 0x7f4b0c66e000 == 18 [pid = 2212] [id = 743] 14:01:17 INFO - ++DOMWINDOW == 49 (0x7f4b00f5a800) [pid = 2212] [serial = 1788] [outer = (nil)] 14:01:17 INFO - ++DOMWINDOW == 50 (0x7f4b00f61c00) [pid = 2212] [serial = 1789] [outer = 0x7f4b00f5a800] 14:01:21 INFO - --DOCSHELL 0x7f4afd9af000 == 17 [pid = 2212] [id = 734] 14:01:21 INFO - --DOCSHELL 0x7f4afdc17000 == 16 [pid = 2212] [id = 735] 14:01:21 INFO - --DOCSHELL 0x7f4b0c66e000 == 15 [pid = 2212] [id = 743] 14:01:21 INFO - --DOCSHELL 0x7f4afe4e1800 == 14 [pid = 2212] [id = 739] 14:01:21 INFO - --DOMWINDOW == 49 (0x7f4afe573000) [pid = 2212] [serial = 1759] [outer = (nil)] [url = about:blank] 14:01:21 INFO - --DOMWINDOW == 48 (0x7f4afe3dd000) [pid = 2212] [serial = 1757] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:01:21 INFO - --DOMWINDOW == 47 (0x7f4afe1f1c00) [pid = 2212] [serial = 1778] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:01:21 INFO - --DOMWINDOW == 46 (0x7f4afcf26000) [pid = 2212] [serial = 1773] [outer = (nil)] [url = about:blank] 14:01:21 INFO - --DOMWINDOW == 45 (0x7f4afd3a3c00) [pid = 2212] [serial = 1775] [outer = (nil)] [url = http://example.com/] 14:01:21 INFO - --DOMWINDOW == 44 (0x7f4afcf30800) [pid = 2212] [serial = 1774] [outer = (nil)] [url = about:blank] 14:01:21 INFO - --DOMWINDOW == 43 (0x7f4afde5d800) [pid = 2212] [serial = 1777] [outer = (nil)] [url = http://example.com/] 14:01:21 INFO - --DOMWINDOW == 42 (0x7f4afd3b0800) [pid = 2212] [serial = 1776] [outer = (nil)] [url = about:blank] 14:01:21 INFO - --DOMWINDOW == 41 (0x7f4afe3df400) [pid = 2212] [serial = 1767] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:01:21 INFO - --DOMWINDOW == 40 (0x7f4afd342c00) [pid = 2212] [serial = 1764] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:01:21 INFO - --DOMWINDOW == 39 (0x7f4afe0afc00) [pid = 2212] [serial = 1225] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:01:21 INFO - --DOMWINDOW == 38 (0x7f4afd340800) [pid = 2212] [serial = 1222] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:01:21 INFO - --DOMWINDOW == 37 (0x7f4afc868800) [pid = 2212] [serial = 1760] [outer = (nil)] [url = about:blank] 14:01:21 INFO - --DOMWINDOW == 36 (0x7f4afd040000) [pid = 2212] [serial = 1762] [outer = (nil)] [url = https://sha256ee.example.com/browser/devtools/client/webconsole/test/test-certificate-messages.html] 14:01:21 INFO - --DOMWINDOW == 35 (0x7f4afcf29800) [pid = 2212] [serial = 1761] [outer = (nil)] [url = about:blank] 14:01:21 INFO - --DOMWINDOW == 34 (0x7f4afe8ac000) [pid = 2212] [serial = 1786] [outer = (nil)] [url = about:blank] 14:01:21 INFO - --DOMWINDOW == 33 (0x7f4afe552000) [pid = 2212] [serial = 1783] [outer = (nil)] [url = about:blank] 14:01:21 INFO - --DOMWINDOW == 32 (0x7f4afe573800) [pid = 2212] [serial = 1770] [outer = (nil)] [url = https://rc4.example.com/browser/devtools/client/webconsole/test/test-certificate-messages.html] 14:01:21 INFO - --DOMWINDOW == 31 (0x7f4afe8c0800) [pid = 2212] [serial = 1771] [outer = (nil)] [url = https://rc4.example.com/browser/devtools/client/webconsole/test/test-certificate-messages.html?] 14:01:21 INFO - --DOMWINDOW == 30 (0x7f4b00f29800) [pid = 2212] [serial = 1772] [outer = (nil)] [url = https://sha256ee.example.com/browser/devtools/client/webconsole/test/test-certificate-messages.html] 14:01:21 INFO - --DOMWINDOW == 29 (0x7f4afde6ac00) [pid = 2212] [serial = 1769] [outer = (nil)] [url = https://sha1ee.example.com/browser/devtools/client/webconsole/test/test-certificate-messages.html] 14:01:21 INFO - MEMORY STAT | vsize 1184MB | residentFast 316MB | heapAllocated 121MB 14:01:21 INFO - 334 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_chrome.js | took 5681ms 14:01:21 INFO - ++DOCSHELL 0x7f4afcec3800 == 15 [pid = 2212] [id = 744] 14:01:21 INFO - ++DOMWINDOW == 30 (0x7f4afcf29400) [pid = 2212] [serial = 1790] [outer = (nil)] 14:01:21 INFO - ++DOMWINDOW == 31 (0x7f4afd03e800) [pid = 2212] [serial = 1791] [outer = 0x7f4afcf29400] 14:01:22 INFO - 335 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_clickable_urls.js 14:01:22 INFO - ++DOCSHELL 0x7f4afdad0800 == 16 [pid = 2212] [id = 745] 14:01:22 INFO - ++DOMWINDOW == 32 (0x7f4afd947c00) [pid = 2212] [serial = 1792] [outer = (nil)] 14:01:22 INFO - ++DOMWINDOW == 33 (0x7f4afde5bc00) [pid = 2212] [serial = 1793] [outer = 0x7f4afd947c00] 14:01:22 INFO - ++DOCSHELL 0x7f4afcec9800 == 17 [pid = 2212] [id = 746] 14:01:22 INFO - ++DOMWINDOW == 34 (0x7f4afde5e000) [pid = 2212] [serial = 1794] [outer = (nil)] 14:01:22 INFO - ++DOMWINDOW == 35 (0x7f4afe00b000) [pid = 2212] [serial = 1795] [outer = 0x7f4afde5e000] 14:01:22 INFO - ++DOMWINDOW == 36 (0x7f4afe3e2400) [pid = 2212] [serial = 1796] [outer = 0x7f4afde5e000] 14:01:22 INFO - ++DOCSHELL 0x7f4aff27f000 == 18 [pid = 2212] [id = 747] 14:01:22 INFO - ++DOMWINDOW == 37 (0x7f4afe8aac00) [pid = 2212] [serial = 1797] [outer = (nil)] 14:01:22 INFO - ++DOMWINDOW == 38 (0x7f4afe8ae800) [pid = 2212] [serial = 1798] [outer = 0x7f4afe8aac00] 14:01:24 INFO - ++DOCSHELL 0x7f4b07d82000 == 19 [pid = 2212] [id = 748] 14:01:24 INFO - ++DOMWINDOW == 39 (0x7f4afe8bd400) [pid = 2212] [serial = 1799] [outer = (nil)] 14:01:24 INFO - ++DOMWINDOW == 40 (0x7f4aff22a000) [pid = 2212] [serial = 1800] [outer = 0x7f4afe8bd400] 14:01:25 INFO - ++DOMWINDOW == 41 (0x7f4afc860400) [pid = 2212] [serial = 1801] [outer = 0x7f4afe8bd400] 14:01:26 INFO - ++DOCSHELL 0x7f4b0c39e800 == 20 [pid = 2212] [id = 749] 14:01:26 INFO - ++DOMWINDOW == 42 (0x7f4b00f2dc00) [pid = 2212] [serial = 1802] [outer = (nil)] 14:01:26 INFO - ++DOMWINDOW == 43 (0x7f4b07a07000) [pid = 2212] [serial = 1803] [outer = 0x7f4b00f2dc00] 14:01:27 INFO - ++DOMWINDOW == 44 (0x7f4afe8afc00) [pid = 2212] [serial = 1804] [outer = 0x7f4b00f2dc00] 14:01:28 INFO - ++DOCSHELL 0x7f4b0fa35000 == 21 [pid = 2212] [id = 750] 14:01:28 INFO - ++DOMWINDOW == 45 (0x7f4b09855800) [pid = 2212] [serial = 1805] [outer = (nil)] 14:01:28 INFO - ++DOMWINDOW == 46 (0x7f4b09bb4800) [pid = 2212] [serial = 1806] [outer = 0x7f4b09855800] 14:01:29 INFO - ++DOMWINDOW == 47 (0x7f4b09622000) [pid = 2212] [serial = 1807] [outer = 0x7f4b09855800] 14:01:30 INFO - ++DOCSHELL 0x7f4b0c01c800 == 22 [pid = 2212] [id = 751] 14:01:30 INFO - ++DOMWINDOW == 48 (0x7f4b09e54000) [pid = 2212] [serial = 1808] [outer = (nil)] 14:01:30 INFO - ++DOMWINDOW == 49 (0x7f4b09e58800) [pid = 2212] [serial = 1809] [outer = 0x7f4b09e54000] 14:01:31 INFO - ++DOMWINDOW == 50 (0x7f4b09bb5400) [pid = 2212] [serial = 1810] [outer = 0x7f4b09e54000] 14:01:32 INFO - ++DOCSHELL 0x7f4b10bc1800 == 23 [pid = 2212] [id = 752] 14:01:32 INFO - ++DOMWINDOW == 51 (0x7f4b0c1a6000) [pid = 2212] [serial = 1811] [outer = (nil)] 14:01:32 INFO - ++DOMWINDOW == 52 (0x7f4b0f7d6800) [pid = 2212] [serial = 1812] [outer = 0x7f4b0c1a6000] 14:01:32 INFO - ++DOMWINDOW == 53 (0x7f4b0c4e5800) [pid = 2212] [serial = 1813] [outer = 0x7f4b0c1a6000] 14:01:33 INFO - ++DOCSHELL 0x7f4b10adb000 == 24 [pid = 2212] [id = 753] 14:01:33 INFO - ++DOMWINDOW == 54 (0x7f4b0c8fb400) [pid = 2212] [serial = 1814] [outer = (nil)] 14:01:33 INFO - ++DOMWINDOW == 55 (0x7f4b0f98cc00) [pid = 2212] [serial = 1815] [outer = 0x7f4b0c8fb400] 14:01:34 INFO - ++DOMWINDOW == 56 (0x7f4b0fbaf000) [pid = 2212] [serial = 1816] [outer = 0x7f4b0c8fb400] 14:01:35 INFO - ++DOCSHELL 0x7f4b116ef800 == 25 [pid = 2212] [id = 754] 14:01:35 INFO - ++DOMWINDOW == 57 (0x7f4b09854000) [pid = 2212] [serial = 1817] [outer = (nil)] 14:01:35 INFO - ++DOMWINDOW == 58 (0x7f4b10b07c00) [pid = 2212] [serial = 1818] [outer = 0x7f4b09854000] 14:01:36 INFO - ++DOMWINDOW == 59 (0x7f4b10b08000) [pid = 2212] [serial = 1819] [outer = 0x7f4b09854000] 14:01:39 INFO - --DOCSHELL 0x7f4afcec8000 == 24 [pid = 2212] [id = 737] 14:01:39 INFO - --DOCSHELL 0x7f4afe855800 == 23 [pid = 2212] [id = 740] 14:01:39 INFO - --DOCSHELL 0x7f4afdc06000 == 22 [pid = 2212] [id = 738] 14:01:39 INFO - --DOCSHELL 0x7f4afce7a000 == 21 [pid = 2212] [id = 733] 14:01:39 INFO - --DOCSHELL 0x7f4afcec7800 == 20 [pid = 2212] [id = 741] 14:01:39 INFO - --DOCSHELL 0x7f4b07c67800 == 19 [pid = 2212] [id = 742] 14:01:39 INFO - --DOCSHELL 0x7f4aff27f000 == 18 [pid = 2212] [id = 747] 14:01:39 INFO - --DOMWINDOW == 58 (0x7f4afe3e3400) [pid = 2212] [serial = 1768] [outer = (nil)] [url = about:blank] 14:01:39 INFO - --DOMWINDOW == 57 (0x7f4afde68800) [pid = 2212] [serial = 1766] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:01:39 INFO - --DOMWINDOW == 56 (0x7f4afe0b4c00) [pid = 2212] [serial = 1226] [outer = (nil)] [url = about:blank] 14:01:39 INFO - --DOMWINDOW == 55 (0x7f4afd947400) [pid = 2212] [serial = 1224] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:01:39 INFO - --DOMWINDOW == 54 (0x7f4afe1f2800) [pid = 2212] [serial = 1779] [outer = (nil)] [url = about:blank] 14:01:39 INFO - --DOMWINDOW == 53 (0x7f4b00f2dc00) [pid = 2212] [serial = 1802] [outer = (nil)] [url = https://example.com/] 14:01:39 INFO - --DOMWINDOW == 52 (0x7f4b07a07000) [pid = 2212] [serial = 1803] [outer = (nil)] [url = about:blank] 14:01:39 INFO - --DOMWINDOW == 51 (0x7f4afe8afc00) [pid = 2212] [serial = 1804] [outer = (nil)] [url = https://example.com/] 14:01:39 INFO - --DOMWINDOW == 50 (0x7f4b09622000) [pid = 2212] [serial = 1807] [outer = (nil)] [url = https://example.com/] 14:01:39 INFO - --DOMWINDOW == 49 (0x7f4b09855800) [pid = 2212] [serial = 1805] [outer = (nil)] [url = https://example.com/] 14:01:39 INFO - --DOMWINDOW == 48 (0x7f4b09bb4800) [pid = 2212] [serial = 1806] [outer = (nil)] [url = about:blank] 14:01:39 INFO - --DOMWINDOW == 47 (0x7f4b0c1a6000) [pid = 2212] [serial = 1811] [outer = (nil)] [url = http://example.com/] 14:01:39 INFO - --DOMWINDOW == 46 (0x7f4b0f7d6800) [pid = 2212] [serial = 1812] [outer = (nil)] [url = about:blank] 14:01:39 INFO - --DOMWINDOW == 45 (0x7f4b0c4e5800) [pid = 2212] [serial = 1813] [outer = (nil)] [url = http://example.com/] 14:01:39 INFO - --DOMWINDOW == 44 (0x7f4b09bb5400) [pid = 2212] [serial = 1810] [outer = (nil)] [url = http://example.com/foo] 14:01:39 INFO - --DOMWINDOW == 43 (0x7f4b09e54000) [pid = 2212] [serial = 1808] [outer = (nil)] [url = http://example.com/foo] 14:01:39 INFO - --DOMWINDOW == 42 (0x7f4b09e58800) [pid = 2212] [serial = 1809] [outer = (nil)] [url = about:blank] 14:01:39 INFO - --DOMWINDOW == 41 (0x7f4b0c8fb400) [pid = 2212] [serial = 1814] [outer = (nil)] [url = http://example.com/] 14:01:39 INFO - --DOMWINDOW == 40 (0x7f4b0f98cc00) [pid = 2212] [serial = 1815] [outer = (nil)] [url = about:blank] 14:01:39 INFO - --DOMWINDOW == 39 (0x7f4b0fbaf000) [pid = 2212] [serial = 1816] [outer = (nil)] [url = http://example.com/] 14:01:39 INFO - --DOMWINDOW == 38 (0x7f4b09854000) [pid = 2212] [serial = 1817] [outer = (nil)] [url = http://example.com/] 14:01:39 INFO - --DOMWINDOW == 37 (0x7f4b10b07c00) [pid = 2212] [serial = 1818] [outer = (nil)] [url = about:blank] 14:01:39 INFO - --DOMWINDOW == 36 (0x7f4b10b08000) [pid = 2212] [serial = 1819] [outer = (nil)] [url = http://example.com/] 14:01:39 INFO - --DOMWINDOW == 35 (0x7f4afe8bd400) [pid = 2212] [serial = 1799] [outer = (nil)] [url = http://example.com/] 14:01:39 INFO - --DOMWINDOW == 34 (0x7f4aff22a000) [pid = 2212] [serial = 1800] [outer = (nil)] [url = about:blank] 14:01:39 INFO - --DOMWINDOW == 33 (0x7f4afe0b5400) [pid = 2212] [serial = 1781] [outer = (nil)] [url = about:blank] 14:01:39 INFO - --DOMWINDOW == 32 (0x7f4afe00b000) [pid = 2212] [serial = 1795] [outer = (nil)] [url = about:blank] 14:01:39 INFO - --DOMWINDOW == 31 (0x7f4afe4c2000) [pid = 2212] [serial = 1782] [outer = (nil)] [url = about:config] 14:01:39 INFO - --DOMWINDOW == 30 (0x7f4afe8ab400) [pid = 2212] [serial = 1785] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:01:39 INFO - --DOMWINDOW == 29 (0x7f4afe0adc00) [pid = 2212] [serial = 1780] [outer = (nil)] [url = about:blank] 14:01:39 INFO - --DOMWINDOW == 28 (0x7f4afc860400) [pid = 2212] [serial = 1801] [outer = (nil)] [url = http://example.com/] 14:01:39 INFO - --DOMWINDOW == 27 (0x7f4b00f5a800) [pid = 2212] [serial = 1788] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:01:40 INFO - MEMORY STAT | vsize 1188MB | residentFast 330MB | heapAllocated 123MB 14:01:40 INFO - 336 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_clickable_urls.js | took 18104ms 14:01:40 INFO - ++DOCSHELL 0x7f4afcec7800 == 19 [pid = 2212] [id = 755] 14:01:40 INFO - ++DOMWINDOW == 28 (0x7f4afd03e000) [pid = 2212] [serial = 1820] [outer = (nil)] 14:01:40 INFO - ++DOMWINDOW == 29 (0x7f4afd33e000) [pid = 2212] [serial = 1821] [outer = 0x7f4afd03e000] 14:01:40 INFO - 337 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_closure_inspection.js 14:01:40 INFO - ++DOCSHELL 0x7f4afdc1f800 == 20 [pid = 2212] [id = 756] 14:01:40 INFO - ++DOMWINDOW == 30 (0x7f4afd946400) [pid = 2212] [serial = 1822] [outer = (nil)] 14:01:40 INFO - ++DOMWINDOW == 31 (0x7f4afd951800) [pid = 2212] [serial = 1823] [outer = 0x7f4afd946400] 14:01:40 INFO - ++DOMWINDOW == 32 (0x7f4afe00cc00) [pid = 2212] [serial = 1824] [outer = 0x7f4afd946400] 14:01:41 INFO - ++DOCSHELL 0x7f4afdc21000 == 21 [pid = 2212] [id = 757] 14:01:41 INFO - ++DOMWINDOW == 33 (0x7f4afe1f2400) [pid = 2212] [serial = 1825] [outer = (nil)] 14:01:41 INFO - ++DOMWINDOW == 34 (0x7f4afe3d7400) [pid = 2212] [serial = 1826] [outer = 0x7f4afe1f2400] 14:01:41 INFO - ++DOMWINDOW == 35 (0x7f4afe4c2c00) [pid = 2212] [serial = 1827] [outer = 0x7f4afe1f2400] 14:01:41 INFO - ++DOCSHELL 0x7f4b0176f800 == 22 [pid = 2212] [id = 758] 14:01:41 INFO - ++DOMWINDOW == 36 (0x7f4afe8adc00) [pid = 2212] [serial = 1828] [outer = (nil)] 14:01:41 INFO - ++DOMWINDOW == 37 (0x7f4afe8b1800) [pid = 2212] [serial = 1829] [outer = 0x7f4afe8adc00] 14:01:43 INFO - ++DOCSHELL 0x7f4b07c19000 == 23 [pid = 2212] [id = 759] 14:01:43 INFO - ++DOMWINDOW == 38 (0x7f4afe54f000) [pid = 2212] [serial = 1830] [outer = (nil)] 14:01:43 INFO - ++DOMWINDOW == 39 (0x7f4afe814800) [pid = 2212] [serial = 1831] [outer = 0x7f4afe54f000] 14:01:43 INFO - ++DOCSHELL 0x7f4afcec3000 == 24 [pid = 2212] [id = 760] 14:01:43 INFO - ++DOMWINDOW == 40 (0x7f4afc867400) [pid = 2212] [serial = 1832] [outer = (nil)] 14:01:43 INFO - ++DOMWINDOW == 41 (0x7f4afc868800) [pid = 2212] [serial = 1833] [outer = 0x7f4afc867400] 14:01:45 INFO - --DOCSHELL 0x7f4afcec9800 == 23 [pid = 2212] [id = 746] 14:01:46 INFO - --DOCSHELL 0x7f4b116ef800 == 22 [pid = 2212] [id = 754] 14:01:46 INFO - --DOCSHELL 0x7f4b10bc1800 == 21 [pid = 2212] [id = 752] 14:01:46 INFO - --DOCSHELL 0x7f4b0c39e800 == 20 [pid = 2212] [id = 749] 14:01:46 INFO - --DOCSHELL 0x7f4afcec3800 == 19 [pid = 2212] [id = 744] 14:01:46 INFO - --DOCSHELL 0x7f4b0c01c800 == 18 [pid = 2212] [id = 751] 14:01:46 INFO - --DOCSHELL 0x7f4b0fa35000 == 17 [pid = 2212] [id = 750] 14:01:46 INFO - --DOCSHELL 0x7f4afdad0800 == 16 [pid = 2212] [id = 745] 14:01:46 INFO - --DOCSHELL 0x7f4b07d82000 == 15 [pid = 2212] [id = 748] 14:01:46 INFO - --DOCSHELL 0x7f4b10adb000 == 14 [pid = 2212] [id = 753] 14:01:46 INFO - --DOMWINDOW == 40 (0x7f4afe8b0800) [pid = 2212] [serial = 1784] [outer = (nil)] [url = about:config] 14:01:46 INFO - --DOMWINDOW == 39 (0x7f4b00f61c00) [pid = 2212] [serial = 1789] [outer = (nil)] [url = about:blank] 14:01:46 INFO - --DOMWINDOW == 38 (0x7f4aff339800) [pid = 2212] [serial = 1787] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:01:49 INFO - ++DOCSHELL 0x7f4afe853800 == 15 [pid = 2212] [id = 761] 14:01:49 INFO - ++DOMWINDOW == 39 (0x7f4afe0ae000) [pid = 2212] [serial = 1834] [outer = (nil)] 14:01:49 INFO - ++DOMWINDOW == 40 (0x7f4afe0b3800) [pid = 2212] [serial = 1835] [outer = 0x7f4afe0ae000] 14:01:50 INFO - [2212] WARNING: CacheStorage not supported on untrusted origins.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/cache/CacheStorage.cpp, line 173 14:01:50 INFO - [2212] WARNING: NS_ENSURE_SUCCESS(rv, nullptr) failed with result 0x80570027: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/js/xpconnect/wrappers/WrapperFactory.cpp, line 274 14:01:50 INFO - JavaScript warning: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/server/actors/script.js, line 3548: mutating the [[Prototype]] of an object will cause your code to run very slowly; instead create the object with the correct initial [[Prototype]] value using Object.create 14:01:55 INFO - --DOCSHELL 0x7f4afcec3000 == 14 [pid = 2212] [id = 760] 14:01:55 INFO - --DOCSHELL 0x7f4b07c19000 == 13 [pid = 2212] [id = 759] 14:01:55 INFO - --DOCSHELL 0x7f4b0176f800 == 12 [pid = 2212] [id = 758] 14:01:59 INFO - --DOCSHELL 0x7f4afdc21000 == 11 [pid = 2212] [id = 757] 14:01:59 INFO - --DOCSHELL 0x7f4afe853800 == 10 [pid = 2212] [id = 761] 14:01:59 INFO - --DOMWINDOW == 39 (0x7f4afe3e2400) [pid = 2212] [serial = 1796] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:01:59 INFO - --DOMWINDOW == 38 (0x7f4afe8ae800) [pid = 2212] [serial = 1798] [outer = (nil)] [url = about:blank] 14:01:59 INFO - --DOMWINDOW == 37 (0x7f4afd947c00) [pid = 2212] [serial = 1792] [outer = (nil)] [url = data:text/html;charset=utf8,Bug%201005909%20-%20Clickable%20URLS] 14:01:59 INFO - --DOMWINDOW == 36 (0x7f4afcf29400) [pid = 2212] [serial = 1790] [outer = (nil)] [url = about:blank] 14:01:59 INFO - --DOMWINDOW == 35 (0x7f4afde5bc00) [pid = 2212] [serial = 1793] [outer = (nil)] [url = about:blank] 14:01:59 INFO - --DOMWINDOW == 34 (0x7f4afe3d7400) [pid = 2212] [serial = 1826] [outer = (nil)] [url = about:blank] 14:01:59 INFO - --DOMWINDOW == 33 (0x7f4afd03e800) [pid = 2212] [serial = 1791] [outer = (nil)] [url = about:blank] 14:01:59 INFO - --DOMWINDOW == 32 (0x7f4afd951800) [pid = 2212] [serial = 1823] [outer = (nil)] [url = about:blank] 14:01:59 INFO - --DOMWINDOW == 31 (0x7f4afde5e000) [pid = 2212] [serial = 1794] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:01:59 INFO - --DOMWINDOW == 30 (0x7f4afe8aac00) [pid = 2212] [serial = 1797] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:01:59 INFO - --DOMWINDOW == 29 (0x7f4afc867400) [pid = 2212] [serial = 1832] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:01:59 INFO - MEMORY STAT | vsize 1179MB | residentFast 323MB | heapAllocated 129MB 14:01:59 INFO - 338 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_closure_inspection.js | took 19588ms 14:02:00 INFO - ++DOCSHELL 0x7f4afce91000 == 11 [pid = 2212] [id = 762] 14:02:00 INFO - ++DOMWINDOW == 30 (0x7f4afcf22c00) [pid = 2212] [serial = 1836] [outer = (nil)] 14:02:00 INFO - ++DOMWINDOW == 31 (0x7f4afd034800) [pid = 2212] [serial = 1837] [outer = 0x7f4afcf22c00] 14:02:00 INFO - 339 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_column_numbers.js 14:02:00 INFO - ++DOCSHELL 0x7f4afdc11000 == 12 [pid = 2212] [id = 763] 14:02:00 INFO - ++DOMWINDOW == 32 (0x7f4afd943c00) [pid = 2212] [serial = 1838] [outer = (nil)] 14:02:00 INFO - ++DOMWINDOW == 33 (0x7f4afd951800) [pid = 2212] [serial = 1839] [outer = 0x7f4afd943c00] 14:02:00 INFO - ++DOMWINDOW == 34 (0x7f4afe00b000) [pid = 2212] [serial = 1840] [outer = 0x7f4afd943c00] 14:02:00 INFO - ++DOCSHELL 0x7f4afe863800 == 13 [pid = 2212] [id = 764] 14:02:00 INFO - ++DOMWINDOW == 35 (0x7f4afe3d6400) [pid = 2212] [serial = 1841] [outer = (nil)] 14:02:00 INFO - ++DOMWINDOW == 36 (0x7f4afe3db400) [pid = 2212] [serial = 1842] [outer = 0x7f4afe3d6400] 14:02:01 INFO - ++DOMWINDOW == 37 (0x7f4afe4bf400) [pid = 2212] [serial = 1843] [outer = 0x7f4afe3d6400] 14:02:01 INFO - ++DOCSHELL 0x7f4b07c25000 == 14 [pid = 2212] [id = 765] 14:02:01 INFO - ++DOMWINDOW == 38 (0x7f4afe3dd800) [pid = 2212] [serial = 1844] [outer = (nil)] 14:02:01 INFO - ++DOMWINDOW == 39 (0x7f4afe8b1400) [pid = 2212] [serial = 1845] [outer = 0x7f4afe3dd800] 14:02:04 INFO - --DOCSHELL 0x7f4afdc1f800 == 13 [pid = 2212] [id = 756] 14:02:04 INFO - --DOCSHELL 0x7f4afe863800 == 12 [pid = 2212] [id = 764] 14:02:04 INFO - --DOCSHELL 0x7f4afcec7800 == 11 [pid = 2212] [id = 755] 14:02:04 INFO - --DOCSHELL 0x7f4b07c25000 == 10 [pid = 2212] [id = 765] 14:02:04 INFO - --DOMWINDOW == 38 (0x7f4afc868800) [pid = 2212] [serial = 1833] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:02:05 INFO - --DOMWINDOW == 37 (0x7f4afe0ae000) [pid = 2212] [serial = 1834] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:02:05 INFO - --DOMWINDOW == 36 (0x7f4afd951800) [pid = 2212] [serial = 1839] [outer = (nil)] [url = about:blank] 14:02:05 INFO - --DOMWINDOW == 35 (0x7f4afd03e000) [pid = 2212] [serial = 1820] [outer = (nil)] [url = about:blank] 14:02:05 INFO - --DOMWINDOW == 34 (0x7f4afe3db400) [pid = 2212] [serial = 1842] [outer = (nil)] [url = about:blank] 14:02:05 INFO - --DOMWINDOW == 33 (0x7f4afd946400) [pid = 2212] [serial = 1822] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-closures.html] 14:02:05 INFO - --DOMWINDOW == 32 (0x7f4afd33e000) [pid = 2212] [serial = 1821] [outer = (nil)] [url = about:blank] 14:02:05 INFO - --DOMWINDOW == 31 (0x7f4afe54f000) [pid = 2212] [serial = 1830] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul] 14:02:05 INFO - --DOMWINDOW == 30 (0x7f4afe8adc00) [pid = 2212] [serial = 1828] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:02:05 INFO - --DOMWINDOW == 29 (0x7f4afe1f2400) [pid = 2212] [serial = 1825] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:02:05 INFO - MEMORY STAT | vsize 1179MB | residentFast 317MB | heapAllocated 126MB 14:02:05 INFO - 340 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_column_numbers.js | took 5397ms 14:02:05 INFO - ++DOCSHELL 0x7f4afce92000 == 11 [pid = 2212] [id = 766] 14:02:05 INFO - ++DOMWINDOW == 30 (0x7f4afc868400) [pid = 2212] [serial = 1846] [outer = (nil)] 14:02:05 INFO - ++DOMWINDOW == 31 (0x7f4afcf2ac00) [pid = 2212] [serial = 1847] [outer = 0x7f4afc868400] 14:02:05 INFO - 341 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_completion.js 14:02:05 INFO - ++DOCSHELL 0x7f4afdc19000 == 12 [pid = 2212] [id = 767] 14:02:05 INFO - ++DOMWINDOW == 32 (0x7f4afd3ad000) [pid = 2212] [serial = 1848] [outer = (nil)] 14:02:05 INFO - ++DOMWINDOW == 33 (0x7f4afd946000) [pid = 2212] [serial = 1849] [outer = 0x7f4afd3ad000] 14:02:06 INFO - ++DOCSHELL 0x7f4afd9aa000 == 13 [pid = 2212] [id = 768] 14:02:06 INFO - ++DOMWINDOW == 34 (0x7f4afd947400) [pid = 2212] [serial = 1850] [outer = (nil)] 14:02:06 INFO - ++DOMWINDOW == 35 (0x7f4afe0b0400) [pid = 2212] [serial = 1851] [outer = 0x7f4afd947400] 14:02:06 INFO - ++DOMWINDOW == 36 (0x7f4afe017400) [pid = 2212] [serial = 1852] [outer = 0x7f4afd947400] 14:02:06 INFO - ++DOCSHELL 0x7f4aff28c000 == 14 [pid = 2212] [id = 769] 14:02:06 INFO - ++DOMWINDOW == 37 (0x7f4afe81c000) [pid = 2212] [serial = 1853] [outer = (nil)] 14:02:06 INFO - ++DOMWINDOW == 38 (0x7f4afe8a5000) [pid = 2212] [serial = 1854] [outer = 0x7f4afe81c000] 14:02:10 INFO - --DOCSHELL 0x7f4afce91000 == 13 [pid = 2212] [id = 762] 14:02:10 INFO - --DOCSHELL 0x7f4afdc11000 == 12 [pid = 2212] [id = 763] 14:02:10 INFO - --DOCSHELL 0x7f4afd9aa000 == 11 [pid = 2212] [id = 768] 14:02:10 INFO - --DOCSHELL 0x7f4aff28c000 == 10 [pid = 2212] [id = 769] 14:02:10 INFO - --DOMWINDOW == 37 (0x7f4afe8b1800) [pid = 2212] [serial = 1829] [outer = (nil)] [url = about:blank] 14:02:10 INFO - --DOMWINDOW == 36 (0x7f4afe0b3800) [pid = 2212] [serial = 1835] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:02:10 INFO - --DOMWINDOW == 35 (0x7f4afe814800) [pid = 2212] [serial = 1831] [outer = (nil)] [url = about:blank] 14:02:10 INFO - --DOMWINDOW == 34 (0x7f4afe4c2c00) [pid = 2212] [serial = 1827] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:02:10 INFO - --DOMWINDOW == 33 (0x7f4afe00cc00) [pid = 2212] [serial = 1824] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-closures.html] 14:02:10 INFO - --DOMWINDOW == 32 (0x7f4afd034800) [pid = 2212] [serial = 1837] [outer = (nil)] [url = about:blank] 14:02:10 INFO - --DOMWINDOW == 31 (0x7f4afe0b0400) [pid = 2212] [serial = 1851] [outer = (nil)] [url = about:blank] 14:02:10 INFO - --DOMWINDOW == 30 (0x7f4afe3dd800) [pid = 2212] [serial = 1844] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:02:10 INFO - --DOMWINDOW == 29 (0x7f4afe3d6400) [pid = 2212] [serial = 1841] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:02:10 INFO - --DOMWINDOW == 28 (0x7f4afcf22c00) [pid = 2212] [serial = 1836] [outer = (nil)] [url = about:blank] 14:02:10 INFO - --DOMWINDOW == 27 (0x7f4afd943c00) [pid = 2212] [serial = 1838] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-column.html] 14:02:10 INFO - --DOMWINDOW == 26 (0x7f4afe00b000) [pid = 2212] [serial = 1840] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-column.html] 14:02:11 INFO - MEMORY STAT | vsize 1178MB | residentFast 313MB | heapAllocated 118MB 14:02:11 INFO - 342 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_completion.js | took 5247ms 14:02:11 INFO - ++DOCSHELL 0x7f4afcec9000 == 11 [pid = 2212] [id = 770] 14:02:11 INFO - ++DOMWINDOW == 27 (0x7f4afcf2a000) [pid = 2212] [serial = 1855] [outer = (nil)] 14:02:11 INFO - ++DOMWINDOW == 28 (0x7f4afd03e800) [pid = 2212] [serial = 1856] [outer = 0x7f4afcf2a000] 14:02:11 INFO - 343 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_api_stackframe.js 14:02:11 INFO - ++DOCSHELL 0x7f4afcec4800 == 12 [pid = 2212] [id = 771] 14:02:11 INFO - ++DOMWINDOW == 29 (0x7f4afd946400) [pid = 2212] [serial = 1857] [outer = (nil)] 14:02:11 INFO - ++DOMWINDOW == 30 (0x7f4afd951800) [pid = 2212] [serial = 1858] [outer = 0x7f4afd946400] 14:02:11 INFO - ++DOMWINDOW == 31 (0x7f4aff335800) [pid = 2212] [serial = 1859] [outer = 0x7f4afd946400] 14:02:12 INFO - ++DOCSHELL 0x7f4afce7a000 == 13 [pid = 2212] [id = 772] 14:02:12 INFO - ++DOMWINDOW == 32 (0x7f4afe1f4000) [pid = 2212] [serial = 1860] [outer = (nil)] 14:02:12 INFO - ++DOMWINDOW == 33 (0x7f4afe3d6400) [pid = 2212] [serial = 1861] [outer = 0x7f4afe1f4000] 14:02:12 INFO - ++DOMWINDOW == 34 (0x7f4afe4bfc00) [pid = 2212] [serial = 1862] [outer = 0x7f4afe1f4000] 14:02:12 INFO - ++DOCSHELL 0x7f4aff2c3800 == 14 [pid = 2212] [id = 773] 14:02:12 INFO - ++DOMWINDOW == 35 (0x7f4afe8ab000) [pid = 2212] [serial = 1863] [outer = (nil)] 14:02:12 INFO - ++DOMWINDOW == 36 (0x7f4afe8adc00) [pid = 2212] [serial = 1864] [outer = 0x7f4afe8ab000] 14:02:15 INFO - --DOCSHELL 0x7f4aff2c3800 == 13 [pid = 2212] [id = 773] 14:02:15 INFO - --DOCSHELL 0x7f4afdc19000 == 12 [pid = 2212] [id = 767] 14:02:15 INFO - --DOCSHELL 0x7f4afce92000 == 11 [pid = 2212] [id = 766] 14:02:15 INFO - --DOMWINDOW == 35 (0x7f4afe8b1400) [pid = 2212] [serial = 1845] [outer = (nil)] [url = about:blank] 14:02:15 INFO - --DOMWINDOW == 34 (0x7f4afe4bf400) [pid = 2212] [serial = 1843] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:02:15 INFO - --DOMWINDOW == 33 (0x7f4afe3d6400) [pid = 2212] [serial = 1861] [outer = (nil)] [url = about:blank] 14:02:15 INFO - --DOMWINDOW == 32 (0x7f4afcf2ac00) [pid = 2212] [serial = 1847] [outer = (nil)] [url = about:blank] 14:02:15 INFO - --DOMWINDOW == 31 (0x7f4afd946000) [pid = 2212] [serial = 1849] [outer = (nil)] [url = about:blank] 14:02:15 INFO - --DOMWINDOW == 30 (0x7f4afd951800) [pid = 2212] [serial = 1858] [outer = (nil)] [url = about:blank] 14:02:15 INFO - --DOMWINDOW == 29 (0x7f4afe81c000) [pid = 2212] [serial = 1853] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:02:15 INFO - --DOMWINDOW == 28 (0x7f4afd947400) [pid = 2212] [serial = 1850] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:02:15 INFO - --DOMWINDOW == 27 (0x7f4afc868400) [pid = 2212] [serial = 1846] [outer = (nil)] [url = about:blank] 14:02:15 INFO - --DOMWINDOW == 26 (0x7f4afd3ad000) [pid = 2212] [serial = 1848] [outer = (nil)] [url = data:text/html;charset=utf8,<p>test%20code%20completion] 14:02:16 INFO - MEMORY STAT | vsize 1180MB | residentFast 310MB | heapAllocated 118MB 14:02:16 INFO - 344 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_api_stackframe.js | took 4639ms 14:02:16 INFO - ++DOCSHELL 0x7f4afce88000 == 12 [pid = 2212] [id = 774] 14:02:16 INFO - ++DOMWINDOW == 27 (0x7f4afc861400) [pid = 2212] [serial = 1865] [outer = (nil)] 14:02:16 INFO - ++DOMWINDOW == 28 (0x7f4afc866000) [pid = 2212] [serial = 1866] [outer = 0x7f4afc861400] 14:02:16 INFO - 345 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_custom_styles.js 14:02:16 INFO - ++DOCSHELL 0x7f4afdaef000 == 13 [pid = 2212] [id = 775] 14:02:16 INFO - ++DOMWINDOW == 29 (0x7f4afd33ac00) [pid = 2212] [serial = 1867] [outer = (nil)] 14:02:16 INFO - ++DOMWINDOW == 30 (0x7f4afd345400) [pid = 2212] [serial = 1868] [outer = 0x7f4afd33ac00] 14:02:16 INFO - ++DOCSHELL 0x7f4afe4e2800 == 14 [pid = 2212] [id = 776] 14:02:16 INFO - ++DOMWINDOW == 31 (0x7f4afde65000) [pid = 2212] [serial = 1869] [outer = (nil)] 14:02:16 INFO - ++DOMWINDOW == 32 (0x7f4afde68400) [pid = 2212] [serial = 1870] [outer = 0x7f4afde65000] 14:02:17 INFO - ++DOMWINDOW == 33 (0x7f4afe1f3000) [pid = 2212] [serial = 1871] [outer = 0x7f4afde65000] 14:02:17 INFO - ++DOCSHELL 0x7f4aff275000 == 15 [pid = 2212] [id = 777] 14:02:17 INFO - ++DOMWINDOW == 34 (0x7f4afe57f400) [pid = 2212] [serial = 1872] [outer = (nil)] 14:02:17 INFO - ++DOMWINDOW == 35 (0x7f4afe816800) [pid = 2212] [serial = 1873] [outer = 0x7f4afe57f400] 14:02:20 INFO - --DOCSHELL 0x7f4afcec4800 == 14 [pid = 2212] [id = 771] 14:02:20 INFO - --DOCSHELL 0x7f4afcec9000 == 13 [pid = 2212] [id = 770] 14:02:20 INFO - --DOCSHELL 0x7f4afce7a000 == 12 [pid = 2212] [id = 772] 14:02:20 INFO - --DOCSHELL 0x7f4aff275000 == 11 [pid = 2212] [id = 777] 14:02:20 INFO - --DOMWINDOW == 34 (0x7f4afe8a5000) [pid = 2212] [serial = 1854] [outer = (nil)] [url = about:blank] 14:02:20 INFO - --DOMWINDOW == 33 (0x7f4afe017400) [pid = 2212] [serial = 1852] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:02:20 INFO - --DOMWINDOW == 32 (0x7f4afde68400) [pid = 2212] [serial = 1870] [outer = (nil)] [url = about:blank] 14:02:20 INFO - --DOMWINDOW == 31 (0x7f4afd03e800) [pid = 2212] [serial = 1856] [outer = (nil)] [url = about:blank] 14:02:20 INFO - --DOMWINDOW == 30 (0x7f4afcf2a000) [pid = 2212] [serial = 1855] [outer = (nil)] [url = about:blank] 14:02:20 INFO - --DOMWINDOW == 29 (0x7f4afe1f4000) [pid = 2212] [serial = 1860] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:02:20 INFO - --DOMWINDOW == 28 (0x7f4afd946400) [pid = 2212] [serial = 1857] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-api-stackframe.html] 14:02:20 INFO - --DOMWINDOW == 27 (0x7f4afe8ab000) [pid = 2212] [serial = 1863] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:02:21 INFO - --DOMWINDOW == 26 (0x7f4aff335800) [pid = 2212] [serial = 1859] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-api-stackframe.html] 14:02:21 INFO - MEMORY STAT | vsize 1182MB | residentFast 310MB | heapAllocated 118MB 14:02:21 INFO - 346 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_custom_styles.js | took 4850ms 14:02:21 INFO - ++DOCSHELL 0x7f4afce92000 == 12 [pid = 2212] [id = 778] 14:02:21 INFO - ++DOMWINDOW == 27 (0x7f4afcf26000) [pid = 2212] [serial = 1874] [outer = (nil)] 14:02:21 INFO - ++DOMWINDOW == 28 (0x7f4afd03ac00) [pid = 2212] [serial = 1875] [outer = 0x7f4afcf26000] 14:02:21 INFO - 347 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_extras.js 14:02:21 INFO - ++DOCSHELL 0x7f4afddbb800 == 13 [pid = 2212] [id = 779] 14:02:21 INFO - ++DOMWINDOW == 29 (0x7f4afd3ad400) [pid = 2212] [serial = 1876] [outer = (nil)] 14:02:21 INFO - ++DOMWINDOW == 30 (0x7f4afd947400) [pid = 2212] [serial = 1877] [outer = 0x7f4afd3ad400] 14:02:21 INFO - ++DOMWINDOW == 31 (0x7f4afde6a400) [pid = 2212] [serial = 1878] [outer = 0x7f4afd3ad400] 14:02:22 INFO - ++DOCSHELL 0x7f4aff273000 == 14 [pid = 2212] [id = 780] 14:02:22 INFO - ++DOMWINDOW == 32 (0x7f4afe1f2000) [pid = 2212] [serial = 1879] [outer = (nil)] 14:02:22 INFO - ++DOMWINDOW == 33 (0x7f4afe3e4400) [pid = 2212] [serial = 1880] [outer = 0x7f4afe1f2000] 14:02:22 INFO - ++DOMWINDOW == 34 (0x7f4afe4c7000) [pid = 2212] [serial = 1881] [outer = 0x7f4afe1f2000] 14:02:22 INFO - ++DOCSHELL 0x7f4b07c67800 == 15 [pid = 2212] [id = 781] 14:02:22 INFO - ++DOMWINDOW == 35 (0x7f4afe8c3000) [pid = 2212] [serial = 1882] [outer = (nil)] 14:02:22 INFO - ++DOMWINDOW == 36 (0x7f4aff227000) [pid = 2212] [serial = 1883] [outer = 0x7f4afe8c3000] 14:02:25 INFO - --DOCSHELL 0x7f4afce88000 == 14 [pid = 2212] [id = 774] 14:02:25 INFO - --DOCSHELL 0x7f4afdaef000 == 13 [pid = 2212] [id = 775] 14:02:25 INFO - --DOCSHELL 0x7f4b07c67800 == 12 [pid = 2212] [id = 781] 14:02:25 INFO - --DOCSHELL 0x7f4afe4e2800 == 11 [pid = 2212] [id = 776] 14:02:25 INFO - --DOMWINDOW == 35 (0x7f4afe8adc00) [pid = 2212] [serial = 1864] [outer = (nil)] [url = about:blank] 14:02:25 INFO - --DOMWINDOW == 34 (0x7f4afe4bfc00) [pid = 2212] [serial = 1862] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:02:25 INFO - --DOMWINDOW == 33 (0x7f4afe3e4400) [pid = 2212] [serial = 1880] [outer = (nil)] [url = about:blank] 14:02:25 INFO - --DOMWINDOW == 32 (0x7f4afc866000) [pid = 2212] [serial = 1866] [outer = (nil)] [url = about:blank] 14:02:25 INFO - --DOMWINDOW == 31 (0x7f4afd345400) [pid = 2212] [serial = 1868] [outer = (nil)] [url = about:blank] 14:02:25 INFO - --DOMWINDOW == 30 (0x7f4afd947400) [pid = 2212] [serial = 1877] [outer = (nil)] [url = about:blank] 14:02:25 INFO - --DOMWINDOW == 29 (0x7f4afde65000) [pid = 2212] [serial = 1869] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:02:25 INFO - --DOMWINDOW == 28 (0x7f4afe57f400) [pid = 2212] [serial = 1872] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:02:25 INFO - --DOMWINDOW == 27 (0x7f4afc861400) [pid = 2212] [serial = 1865] [outer = (nil)] [url = about:blank] 14:02:25 INFO - --DOMWINDOW == 26 (0x7f4afd33ac00) [pid = 2212] [serial = 1867] [outer = (nil)] [url = data:text/html;charset=utf8,<p>test%20for%20console.log('%ccustom%20styles',%20'color:red')] 14:02:25 INFO - MEMORY STAT | vsize 1182MB | residentFast 309MB | heapAllocated 118MB 14:02:25 INFO - 348 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_extras.js | took 4455ms 14:02:25 INFO - ++DOCSHELL 0x7f4afcec2800 == 12 [pid = 2212] [id = 782] 14:02:25 INFO - ++DOMWINDOW == 27 (0x7f4afcf23800) [pid = 2212] [serial = 1884] [outer = (nil)] 14:02:25 INFO - ++DOMWINDOW == 28 (0x7f4afd03d400) [pid = 2212] [serial = 1885] [outer = 0x7f4afcf23800] 14:02:26 INFO - 349 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_logging_api.js 14:02:26 INFO - ++DOCSHELL 0x7f4afe399800 == 13 [pid = 2212] [id = 783] 14:02:26 INFO - ++DOMWINDOW == 29 (0x7f4afd950400) [pid = 2212] [serial = 1886] [outer = (nil)] 14:02:26 INFO - ++DOMWINDOW == 30 (0x7f4afde61400) [pid = 2212] [serial = 1887] [outer = 0x7f4afd950400] 14:02:26 INFO - ++DOMWINDOW == 31 (0x7f4afe012c00) [pid = 2212] [serial = 1888] [outer = 0x7f4afd950400] 14:02:26 INFO - ++DOCSHELL 0x7f4afce93000 == 14 [pid = 2212] [id = 784] 14:02:26 INFO - ++DOMWINDOW == 32 (0x7f4afe0b4400) [pid = 2212] [serial = 1889] [outer = (nil)] 14:02:26 INFO - ++DOMWINDOW == 33 (0x7f4afe1f2400) [pid = 2212] [serial = 1890] [outer = 0x7f4afe0b4400] 14:02:26 INFO - ++DOMWINDOW == 34 (0x7f4afe4c8800) [pid = 2212] [serial = 1891] [outer = 0x7f4afe0b4400] 14:02:27 INFO - ++DOCSHELL 0x7f4b07c20000 == 15 [pid = 2212] [id = 785] 14:02:27 INFO - ++DOMWINDOW == 35 (0x7f4afe8a6c00) [pid = 2212] [serial = 1892] [outer = (nil)] 14:02:27 INFO - ++DOMWINDOW == 36 (0x7f4afe8aac00) [pid = 2212] [serial = 1893] [outer = 0x7f4afe8a6c00] 14:02:32 INFO - --DOCSHELL 0x7f4afddbb800 == 14 [pid = 2212] [id = 779] 14:02:32 INFO - --DOCSHELL 0x7f4aff273000 == 13 [pid = 2212] [id = 780] 14:02:32 INFO - --DOCSHELL 0x7f4afce93000 == 12 [pid = 2212] [id = 784] 14:02:32 INFO - --DOCSHELL 0x7f4afce92000 == 11 [pid = 2212] [id = 778] 14:02:32 INFO - --DOCSHELL 0x7f4b07c20000 == 10 [pid = 2212] [id = 785] 14:02:32 INFO - --DOMWINDOW == 35 (0x7f4afe1f3000) [pid = 2212] [serial = 1871] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:02:32 INFO - --DOMWINDOW == 34 (0x7f4afe816800) [pid = 2212] [serial = 1873] [outer = (nil)] [url = about:blank] 14:02:32 INFO - --DOMWINDOW == 33 (0x7f4afe1f2400) [pid = 2212] [serial = 1890] [outer = (nil)] [url = about:blank] 14:02:32 INFO - --DOMWINDOW == 32 (0x7f4afde61400) [pid = 2212] [serial = 1887] [outer = (nil)] [url = about:blank] 14:02:32 INFO - --DOMWINDOW == 31 (0x7f4afd03ac00) [pid = 2212] [serial = 1875] [outer = (nil)] [url = about:blank] 14:02:32 INFO - --DOMWINDOW == 30 (0x7f4afe8c3000) [pid = 2212] [serial = 1882] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:02:32 INFO - --DOMWINDOW == 29 (0x7f4afe1f2000) [pid = 2212] [serial = 1879] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:02:32 INFO - --DOMWINDOW == 28 (0x7f4afcf26000) [pid = 2212] [serial = 1874] [outer = (nil)] [url = about:blank] 14:02:32 INFO - --DOMWINDOW == 27 (0x7f4afd3ad400) [pid = 2212] [serial = 1876] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-extras.html] 14:02:32 INFO - MEMORY STAT | vsize 1181MB | residentFast 309MB | heapAllocated 119MB 14:02:32 INFO - 350 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_logging_api.js | took 6429ms 14:02:32 INFO - ++DOCSHELL 0x7f4afce87800 == 11 [pid = 2212] [id = 786] 14:02:32 INFO - ++DOMWINDOW == 28 (0x7f4afcf28c00) [pid = 2212] [serial = 1894] [outer = (nil)] 14:02:32 INFO - ++DOMWINDOW == 29 (0x7f4afd034c00) [pid = 2212] [serial = 1895] [outer = 0x7f4afcf28c00] 14:02:32 INFO - 351 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_logging_workers_api.js 14:02:32 INFO - ++DOCSHELL 0x7f4afdc15800 == 12 [pid = 2212] [id = 787] 14:02:32 INFO - ++DOMWINDOW == 30 (0x7f4afd947400) [pid = 2212] [serial = 1896] [outer = (nil)] 14:02:32 INFO - ++DOMWINDOW == 31 (0x7f4afde5e000) [pid = 2212] [serial = 1897] [outer = 0x7f4afd947400] 14:02:33 INFO - ++DOMWINDOW == 32 (0x7f4afe00cc00) [pid = 2212] [serial = 1898] [outer = 0x7f4afd947400] 14:02:33 INFO - ++DOCSHELL 0x7f4afd58d000 == 13 [pid = 2212] [id = 788] 14:02:33 INFO - ++DOMWINDOW == 33 (0x7f4afe3d7800) [pid = 2212] [serial = 1899] [outer = (nil)] 14:02:33 INFO - ++DOMWINDOW == 34 (0x7f4afe3d9c00) [pid = 2212] [serial = 1900] [outer = 0x7f4afe3d7800] 14:02:33 INFO - ++DOMWINDOW == 35 (0x7f4afe570c00) [pid = 2212] [serial = 1901] [outer = 0x7f4afe3d7800] 14:02:33 INFO - ++DOCSHELL 0x7f4b07c34800 == 14 [pid = 2212] [id = 789] 14:02:33 INFO - ++DOMWINDOW == 36 (0x7f4afe8ae400) [pid = 2212] [serial = 1902] [outer = (nil)] 14:02:33 INFO - ++DOMWINDOW == 37 (0x7f4afe8b0c00) [pid = 2212] [serial = 1903] [outer = 0x7f4afe8ae400] 14:02:36 INFO - --DOCSHELL 0x7f4afcec2800 == 13 [pid = 2212] [id = 782] 14:02:36 INFO - --DOCSHELL 0x7f4afe399800 == 12 [pid = 2212] [id = 783] 14:02:36 INFO - --DOCSHELL 0x7f4b07c34800 == 11 [pid = 2212] [id = 789] 14:02:36 INFO - --DOMWINDOW == 36 (0x7f4aff227000) [pid = 2212] [serial = 1883] [outer = (nil)] [url = about:blank] 14:02:36 INFO - --DOMWINDOW == 35 (0x7f4afe4c7000) [pid = 2212] [serial = 1881] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:02:36 INFO - --DOMWINDOW == 34 (0x7f4afde6a400) [pid = 2212] [serial = 1878] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-extras.html] 14:02:36 INFO - --DOMWINDOW == 33 (0x7f4afe3d9c00) [pid = 2212] [serial = 1900] [outer = (nil)] [url = about:blank] 14:02:36 INFO - --DOMWINDOW == 32 (0x7f4afd03d400) [pid = 2212] [serial = 1885] [outer = (nil)] [url = about:blank] 14:02:36 INFO - --DOMWINDOW == 31 (0x7f4afde5e000) [pid = 2212] [serial = 1897] [outer = (nil)] [url = about:blank] 14:02:36 INFO - --DOMWINDOW == 30 (0x7f4afcf23800) [pid = 2212] [serial = 1884] [outer = (nil)] [url = about:blank] 14:02:36 INFO - --DOMWINDOW == 29 (0x7f4afd950400) [pid = 2212] [serial = 1886] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:02:37 INFO - njn: RemoveSharedWorker 14:02:37 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 14:02:37 INFO - --DOMWINDOW == 28 (0x7f4afe012c00) [pid = 2212] [serial = 1888] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:02:37 INFO - MEMORY STAT | vsize 1182MB | residentFast 310MB | heapAllocated 119MB 14:02:37 INFO - 352 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_logging_workers_api.js | took 4381ms 14:02:37 INFO - ++DOCSHELL 0x7f4afce8d000 == 12 [pid = 2212] [id = 790] 14:02:37 INFO - ++DOMWINDOW == 29 (0x7f4afc868400) [pid = 2212] [serial = 1904] [outer = (nil)] 14:02:37 INFO - ++DOMWINDOW == 30 (0x7f4afd032c00) [pid = 2212] [serial = 1905] [outer = 0x7f4afc868400] 14:02:37 INFO - 353 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_trace_async.js 14:02:37 INFO - ++DOCSHELL 0x7f4afe2d6800 == 13 [pid = 2212] [id = 791] 14:02:37 INFO - ++DOMWINDOW == 31 (0x7f4afc721c00) [pid = 2212] [serial = 1906] [outer = (nil)] 14:02:37 INFO - ++DOMWINDOW == 32 (0x7f4afd94cc00) [pid = 2212] [serial = 1907] [outer = 0x7f4afc721c00] 14:02:37 INFO - ++DOCSHELL 0x7f4afce86000 == 14 [pid = 2212] [id = 792] 14:02:37 INFO - ++DOMWINDOW == 33 (0x7f4afd951c00) [pid = 2212] [serial = 1908] [outer = (nil)] 14:02:37 INFO - ++DOMWINDOW == 34 (0x7f4afe015800) [pid = 2212] [serial = 1909] [outer = 0x7f4afd951c00] 14:02:38 INFO - ++DOMWINDOW == 35 (0x7f4afe3e2800) [pid = 2212] [serial = 1910] [outer = 0x7f4afd951c00] 14:02:38 INFO - ++DOCSHELL 0x7f4b01913800 == 15 [pid = 2212] [id = 793] 14:02:38 INFO - ++DOMWINDOW == 36 (0x7f4afe8a2c00) [pid = 2212] [serial = 1911] [outer = (nil)] 14:02:38 INFO - ++DOMWINDOW == 37 (0x7f4afe8a5c00) [pid = 2212] [serial = 1912] [outer = 0x7f4afe8a2c00] 14:02:40 INFO - ++DOMWINDOW == 38 (0x7f4afd3aec00) [pid = 2212] [serial = 1913] [outer = 0x7f4afc721c00] 14:02:40 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:02:41 INFO - MEMORY STAT | vsize 1185MB | residentFast 314MB | heapAllocated 124MB 14:02:41 INFO - 354 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_trace_async.js | took 3972ms 14:02:41 INFO - ++DOCSHELL 0x7f4b094ab800 == 16 [pid = 2212] [id = 794] 14:02:41 INFO - ++DOMWINDOW == 39 (0x7f4afe8b1000) [pid = 2212] [serial = 1914] [outer = (nil)] 14:02:41 INFO - ++DOMWINDOW == 40 (0x7f4aff226400) [pid = 2212] [serial = 1915] [outer = 0x7f4afe8b1000] 14:02:41 INFO - 355 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_console_trace_duplicates.js 14:02:41 INFO - ++DOCSHELL 0x7f4afce92800 == 17 [pid = 2212] [id = 795] 14:02:41 INFO - ++DOMWINDOW == 41 (0x7f4aff33cc00) [pid = 2212] [serial = 1916] [outer = (nil)] 14:02:41 INFO - ++DOMWINDOW == 42 (0x7f4b00f27800) [pid = 2212] [serial = 1917] [outer = 0x7f4aff33cc00] 14:02:42 INFO - ++DOCSHELL 0x7f4b0fa2f800 == 18 [pid = 2212] [id = 796] 14:02:42 INFO - ++DOMWINDOW == 43 (0x7f4b00f2a400) [pid = 2212] [serial = 1918] [outer = (nil)] 14:02:42 INFO - ++DOMWINDOW == 44 (0x7f4b012dc400) [pid = 2212] [serial = 1919] [outer = 0x7f4b00f2a400] 14:02:42 INFO - ++DOMWINDOW == 45 (0x7f4b07a08c00) [pid = 2212] [serial = 1920] [outer = 0x7f4b00f2a400] 14:02:42 INFO - ++DOCSHELL 0x7f4b10a6f000 == 19 [pid = 2212] [id = 797] 14:02:42 INFO - ++DOMWINDOW == 46 (0x7f4b09532c00) [pid = 2212] [serial = 1921] [outer = (nil)] 14:02:42 INFO - ++DOMWINDOW == 47 (0x7f4b09581000) [pid = 2212] [serial = 1922] [outer = 0x7f4b09532c00] 14:02:44 INFO - ++DOMWINDOW == 48 (0x7f4b09e57c00) [pid = 2212] [serial = 1923] [outer = 0x7f4aff33cc00] 14:02:44 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:02:46 INFO - --DOCSHELL 0x7f4afce87800 == 18 [pid = 2212] [id = 786] 14:02:46 INFO - --DOCSHELL 0x7f4afdc15800 == 17 [pid = 2212] [id = 787] 14:02:46 INFO - --DOCSHELL 0x7f4afce86000 == 16 [pid = 2212] [id = 792] 14:02:46 INFO - --DOCSHELL 0x7f4b01913800 == 15 [pid = 2212] [id = 793] 14:02:46 INFO - --DOCSHELL 0x7f4afd58d000 == 14 [pid = 2212] [id = 788] 14:02:46 INFO - --DOCSHELL 0x7f4b10a6f000 == 13 [pid = 2212] [id = 797] 14:02:46 INFO - --DOMWINDOW == 47 (0x7f4afe3d7800) [pid = 2212] [serial = 1899] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:02:46 INFO - --DOMWINDOW == 46 (0x7f4afe8ae400) [pid = 2212] [serial = 1902] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:02:46 INFO - --DOMWINDOW == 45 (0x7f4afe8a6c00) [pid = 2212] [serial = 1892] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:02:46 INFO - --DOMWINDOW == 44 (0x7f4afe0b4400) [pid = 2212] [serial = 1889] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:02:46 INFO - --DOMWINDOW == 43 (0x7f4afd947400) [pid = 2212] [serial = 1896] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-workers.html] 14:02:46 INFO - --DOMWINDOW == 42 (0x7f4afcf28c00) [pid = 2212] [serial = 1894] [outer = (nil)] [url = about:blank] 14:02:46 INFO - --DOMWINDOW == 41 (0x7f4afd034c00) [pid = 2212] [serial = 1895] [outer = (nil)] [url = about:blank] 14:02:46 INFO - --DOMWINDOW == 40 (0x7f4b012dc400) [pid = 2212] [serial = 1919] [outer = (nil)] [url = about:blank] 14:02:46 INFO - --DOMWINDOW == 39 (0x7f4afe015800) [pid = 2212] [serial = 1909] [outer = (nil)] [url = about:blank] 14:02:46 INFO - --DOMWINDOW == 38 (0x7f4afc868400) [pid = 2212] [serial = 1904] [outer = (nil)] [url = about:blank] 14:02:46 INFO - --DOMWINDOW == 37 (0x7f4afc721c00) [pid = 2212] [serial = 1906] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-trace-async.html] 14:02:46 INFO - --DOMWINDOW == 36 (0x7f4afd94cc00) [pid = 2212] [serial = 1907] [outer = (nil)] [url = about:blank] 14:02:46 INFO - --DOMWINDOW == 35 (0x7f4afd032c00) [pid = 2212] [serial = 1905] [outer = (nil)] [url = about:blank] 14:02:47 INFO - --DOMWINDOW == 34 (0x7f4afe00cc00) [pid = 2212] [serial = 1898] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-workers.html] 14:02:47 INFO - MEMORY STAT | vsize 1185MB | residentFast 317MB | heapAllocated 121MB 14:02:47 INFO - 356 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_console_trace_duplicates.js | took 5570ms 14:02:47 INFO - ++DOCSHELL 0x7f4afd594000 == 14 [pid = 2212] [id = 798] 14:02:47 INFO - ++DOMWINDOW == 35 (0x7f4afcf29000) [pid = 2212] [serial = 1924] [outer = (nil)] 14:02:47 INFO - ++DOMWINDOW == 36 (0x7f4afd33f800) [pid = 2212] [serial = 1925] [outer = 0x7f4afcf29000] 14:02:47 INFO - 357 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_context_menu_open_in_var_view.js 14:02:47 INFO - ++DOCSHELL 0x7f4afe39e800 == 15 [pid = 2212] [id = 799] 14:02:47 INFO - ++DOMWINDOW == 37 (0x7f4afd951800) [pid = 2212] [serial = 1926] [outer = (nil)] 14:02:47 INFO - ++DOMWINDOW == 38 (0x7f4afde64400) [pid = 2212] [serial = 1927] [outer = 0x7f4afd951800] 14:02:47 INFO - ++DOCSHELL 0x7f4afe854800 == 16 [pid = 2212] [id = 800] 14:02:47 INFO - ++DOMWINDOW == 39 (0x7f4afde66000) [pid = 2212] [serial = 1928] [outer = (nil)] 14:02:47 INFO - ++DOMWINDOW == 40 (0x7f4afe0b3000) [pid = 2212] [serial = 1929] [outer = 0x7f4afde66000] 14:02:48 INFO - ++DOMWINDOW == 41 (0x7f4afe3e4c00) [pid = 2212] [serial = 1930] [outer = 0x7f4afde66000] 14:02:48 INFO - ++DOCSHELL 0x7f4b07c5a800 == 17 [pid = 2212] [id = 801] 14:02:48 INFO - ++DOMWINDOW == 42 (0x7f4afe8a7000) [pid = 2212] [serial = 1931] [outer = (nil)] 14:02:48 INFO - ++DOMWINDOW == 43 (0x7f4afe8abc00) [pid = 2212] [serial = 1932] [outer = 0x7f4afe8a7000] 14:02:50 INFO - MEMORY STAT | vsize 1187MB | residentFast 321MB | heapAllocated 124MB 14:02:50 INFO - 358 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_context_menu_open_in_var_view.js | took 3382ms 14:02:50 INFO - ++DOCSHELL 0x7f4afce86000 == 18 [pid = 2212] [id = 802] 14:02:50 INFO - ++DOMWINDOW == 44 (0x7f4afc860400) [pid = 2212] [serial = 1933] [outer = (nil)] 14:02:51 INFO - ++DOMWINDOW == 45 (0x7f4afc864c00) [pid = 2212] [serial = 1934] [outer = 0x7f4afc860400] 14:02:51 INFO - 359 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_context_menu_store_as_global.js 14:02:51 INFO - ++DOCSHELL 0x7f4afe39d800 == 19 [pid = 2212] [id = 803] 14:02:51 INFO - ++DOMWINDOW == 46 (0x7f4afde5fc00) [pid = 2212] [serial = 1935] [outer = (nil)] 14:02:51 INFO - ++DOMWINDOW == 47 (0x7f4afe00b000) [pid = 2212] [serial = 1936] [outer = 0x7f4afde5fc00] 14:02:51 INFO - ++DOCSHELL 0x7f4b07d8f800 == 20 [pid = 2212] [id = 804] 14:02:51 INFO - ++DOMWINDOW == 48 (0x7f4afe544c00) [pid = 2212] [serial = 1937] [outer = (nil)] 14:02:51 INFO - ++DOMWINDOW == 49 (0x7f4afe553c00) [pid = 2212] [serial = 1938] [outer = 0x7f4afe544c00] 14:02:51 INFO - ++DOMWINDOW == 50 (0x7f4afe8ab800) [pid = 2212] [serial = 1939] [outer = 0x7f4afe544c00] 14:02:52 INFO - ++DOCSHELL 0x7f4b0fa1e800 == 21 [pid = 2212] [id = 805] 14:02:52 INFO - ++DOMWINDOW == 51 (0x7f4b019b1000) [pid = 2212] [serial = 1940] [outer = (nil)] 14:02:52 INFO - ++DOMWINDOW == 52 (0x7f4b019b8000) [pid = 2212] [serial = 1941] [outer = 0x7f4b019b1000] 14:02:55 INFO - MEMORY STAT | vsize 1189MB | residentFast 327MB | heapAllocated 130MB 14:02:55 INFO - 360 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_context_menu_store_as_global.js | took 3897ms 14:02:55 INFO - ++DOCSHELL 0x7f4b0c027000 == 22 [pid = 2212] [id = 806] 14:02:55 INFO - ++DOMWINDOW == 53 (0x7f4afe81c800) [pid = 2212] [serial = 1942] [outer = (nil)] 14:02:55 INFO - ++DOMWINDOW == 54 (0x7f4aff421800) [pid = 2212] [serial = 1943] [outer = 0x7f4afe81c800] 14:02:55 INFO - 361 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_count.js 14:02:55 INFO - ++DOCSHELL 0x7f4b10bca000 == 23 [pid = 2212] [id = 807] 14:02:55 INFO - ++DOMWINDOW == 55 (0x7f4b09621800) [pid = 2212] [serial = 1944] [outer = (nil)] 14:02:55 INFO - ++DOMWINDOW == 56 (0x7f4b0984d400) [pid = 2212] [serial = 1945] [outer = 0x7f4b09621800] 14:02:55 INFO - ++DOMWINDOW == 57 (0x7f4b09e51800) [pid = 2212] [serial = 1946] [outer = 0x7f4b09621800] 14:02:56 INFO - ++DOCSHELL 0x7f4b10bd4000 == 24 [pid = 2212] [id = 808] 14:02:56 INFO - ++DOMWINDOW == 58 (0x7f4b0984e800) [pid = 2212] [serial = 1947] [outer = (nil)] 14:02:56 INFO - ++DOMWINDOW == 59 (0x7f4b0c41bc00) [pid = 2212] [serial = 1948] [outer = 0x7f4b0984e800] 14:02:56 INFO - ++DOMWINDOW == 60 (0x7f4b00f5f000) [pid = 2212] [serial = 1949] [outer = 0x7f4b0984e800] 14:02:57 INFO - ++DOCSHELL 0x7f4b1275b000 == 25 [pid = 2212] [id = 809] 14:02:57 INFO - ++DOMWINDOW == 61 (0x7f4b0f711c00) [pid = 2212] [serial = 1950] [outer = (nil)] 14:02:57 INFO - ++DOMWINDOW == 62 (0x7f4b0f981800) [pid = 2212] [serial = 1951] [outer = 0x7f4b0f711c00] 14:03:00 INFO - --DOCSHELL 0x7f4afce8d000 == 24 [pid = 2212] [id = 790] 14:03:00 INFO - --DOCSHELL 0x7f4afd594000 == 23 [pid = 2212] [id = 798] 14:03:00 INFO - --DOCSHELL 0x7f4afe39e800 == 22 [pid = 2212] [id = 799] 14:03:00 INFO - --DOCSHELL 0x7f4afe854800 == 21 [pid = 2212] [id = 800] 14:03:00 INFO - --DOCSHELL 0x7f4b07c5a800 == 20 [pid = 2212] [id = 801] 14:03:00 INFO - --DOCSHELL 0x7f4afe2d6800 == 19 [pid = 2212] [id = 791] 14:03:00 INFO - --DOCSHELL 0x7f4afce92800 == 18 [pid = 2212] [id = 795] 14:03:00 INFO - --DOCSHELL 0x7f4b094ab800 == 17 [pid = 2212] [id = 794] 14:03:00 INFO - --DOCSHELL 0x7f4b0fa2f800 == 16 [pid = 2212] [id = 796] 14:03:00 INFO - --DOCSHELL 0x7f4b0fa1e800 == 15 [pid = 2212] [id = 805] 14:03:00 INFO - --DOCSHELL 0x7f4b1275b000 == 14 [pid = 2212] [id = 809] 14:03:00 INFO - --DOMWINDOW == 61 (0x7f4afe8b0c00) [pid = 2212] [serial = 1903] [outer = (nil)] [url = about:blank] 14:03:00 INFO - --DOMWINDOW == 60 (0x7f4afe570c00) [pid = 2212] [serial = 1901] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:00 INFO - --DOMWINDOW == 59 (0x7f4afd3aec00) [pid = 2212] [serial = 1913] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-trace-async.html] 14:03:00 INFO - --DOMWINDOW == 58 (0x7f4afe8aac00) [pid = 2212] [serial = 1893] [outer = (nil)] [url = about:blank] 14:03:00 INFO - --DOMWINDOW == 57 (0x7f4afe4c8800) [pid = 2212] [serial = 1891] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:00 INFO - --DOMWINDOW == 56 (0x7f4afe8a2c00) [pid = 2212] [serial = 1911] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:03:00 INFO - --DOMWINDOW == 55 (0x7f4afe8b1000) [pid = 2212] [serial = 1914] [outer = (nil)] [url = about:blank] 14:03:00 INFO - --DOMWINDOW == 54 (0x7f4b00f2a400) [pid = 2212] [serial = 1918] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:00 INFO - --DOMWINDOW == 53 (0x7f4b0c41bc00) [pid = 2212] [serial = 1948] [outer = (nil)] [url = about:blank] 14:03:00 INFO - --DOMWINDOW == 52 (0x7f4b09532c00) [pid = 2212] [serial = 1921] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:03:00 INFO - --DOMWINDOW == 51 (0x7f4afd951c00) [pid = 2212] [serial = 1908] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:00 INFO - --DOMWINDOW == 50 (0x7f4b00f27800) [pid = 2212] [serial = 1917] [outer = (nil)] [url = about:blank] 14:03:00 INFO - --DOMWINDOW == 49 (0x7f4aff226400) [pid = 2212] [serial = 1915] [outer = (nil)] [url = about:blank] 14:03:00 INFO - --DOMWINDOW == 48 (0x7f4afe553c00) [pid = 2212] [serial = 1938] [outer = (nil)] [url = about:blank] 14:03:00 INFO - --DOMWINDOW == 47 (0x7f4afe0b3000) [pid = 2212] [serial = 1929] [outer = (nil)] [url = about:blank] 14:03:00 INFO - --DOMWINDOW == 46 (0x7f4aff33cc00) [pid = 2212] [serial = 1916] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_939783_console_trace_duplicates.html] 14:03:00 INFO - --DOMWINDOW == 45 (0x7f4afc864c00) [pid = 2212] [serial = 1934] [outer = (nil)] [url = about:blank] 14:03:00 INFO - --DOMWINDOW == 44 (0x7f4afc860400) [pid = 2212] [serial = 1933] [outer = (nil)] [url = about:blank] 14:03:00 INFO - --DOMWINDOW == 43 (0x7f4afe8a7000) [pid = 2212] [serial = 1931] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:03:00 INFO - --DOMWINDOW == 42 (0x7f4afde66000) [pid = 2212] [serial = 1928] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:00 INFO - --DOMWINDOW == 41 (0x7f4afd951800) [pid = 2212] [serial = 1926] [outer = (nil)] [url = data:text/html,<script>%20%20console.log("foo");%20%20console.log("foo",%20window);</script>] 14:03:00 INFO - --DOMWINDOW == 40 (0x7f4afcf29000) [pid = 2212] [serial = 1924] [outer = (nil)] [url = about:blank] 14:03:00 INFO - --DOMWINDOW == 39 (0x7f4afd33f800) [pid = 2212] [serial = 1925] [outer = (nil)] [url = about:blank] 14:03:00 INFO - --DOMWINDOW == 38 (0x7f4afde64400) [pid = 2212] [serial = 1927] [outer = (nil)] [url = about:blank] 14:03:00 INFO - --DOMWINDOW == 37 (0x7f4b0984d400) [pid = 2212] [serial = 1945] [outer = (nil)] [url = about:blank] 14:03:01 INFO - --DOMWINDOW == 36 (0x7f4b09e57c00) [pid = 2212] [serial = 1923] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_939783_console_trace_duplicates.html] 14:03:01 INFO - MEMORY STAT | vsize 1187MB | residentFast 327MB | heapAllocated 123MB 14:03:01 INFO - 362 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_count.js | took 5719ms 14:03:01 INFO - ++DOCSHELL 0x7f4afcec1800 == 15 [pid = 2212] [id = 810] 14:03:01 INFO - ++DOMWINDOW == 37 (0x7f4afcf22c00) [pid = 2212] [serial = 1952] [outer = (nil)] 14:03:01 INFO - ++DOMWINDOW == 38 (0x7f4afcf29800) [pid = 2212] [serial = 1953] [outer = 0x7f4afcf22c00] 14:03:01 INFO - 363 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_dont_navigate_on_doubleclick.js 14:03:01 INFO - ++DOCSHELL 0x7f4afe2c6800 == 16 [pid = 2212] [id = 811] 14:03:01 INFO - ++DOMWINDOW == 39 (0x7f4afd3a3c00) [pid = 2212] [serial = 1954] [outer = (nil)] 14:03:01 INFO - ++DOMWINDOW == 40 (0x7f4afd945800) [pid = 2212] [serial = 1955] [outer = 0x7f4afd3a3c00] 14:03:01 INFO - ++DOCSHELL 0x7f4afcecf800 == 17 [pid = 2212] [id = 812] 14:03:01 INFO - ++DOMWINDOW == 41 (0x7f4afd947400) [pid = 2212] [serial = 1956] [outer = (nil)] 14:03:01 INFO - ++DOMWINDOW == 42 (0x7f4afde69000) [pid = 2212] [serial = 1957] [outer = 0x7f4afd947400] 14:03:01 INFO - ++DOMWINDOW == 43 (0x7f4afe3d7800) [pid = 2212] [serial = 1958] [outer = 0x7f4afd947400] 14:03:02 INFO - ++DOCSHELL 0x7f4b07c1f800 == 18 [pid = 2212] [id = 813] 14:03:02 INFO - ++DOMWINDOW == 44 (0x7f4afe812000) [pid = 2212] [serial = 1959] [outer = (nil)] 14:03:02 INFO - ++DOMWINDOW == 45 (0x7f4afe81c000) [pid = 2212] [serial = 1960] [outer = 0x7f4afe812000] 14:03:03 INFO - ++DOMWINDOW == 46 (0x7f4b0984e400) [pid = 2212] [serial = 1961] [outer = 0x7f4afd3a3c00] 14:03:03 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:03:05 INFO - --DOCSHELL 0x7f4afcecf800 == 17 [pid = 2212] [id = 812] 14:03:05 INFO - --DOCSHELL 0x7f4b07c1f800 == 16 [pid = 2212] [id = 813] 14:03:05 INFO - --DOCSHELL 0x7f4b07d8f800 == 15 [pid = 2212] [id = 804] 14:03:05 INFO - --DOCSHELL 0x7f4afce86000 == 14 [pid = 2212] [id = 802] 14:03:05 INFO - --DOCSHELL 0x7f4b10bca000 == 13 [pid = 2212] [id = 807] 14:03:05 INFO - --DOCSHELL 0x7f4afe39d800 == 12 [pid = 2212] [id = 803] 14:03:05 INFO - --DOCSHELL 0x7f4b0c027000 == 11 [pid = 2212] [id = 806] 14:03:05 INFO - --DOCSHELL 0x7f4b10bd4000 == 10 [pid = 2212] [id = 808] 14:03:05 INFO - --DOMWINDOW == 45 (0x7f4afe3e2800) [pid = 2212] [serial = 1910] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:05 INFO - --DOMWINDOW == 44 (0x7f4afe8a5c00) [pid = 2212] [serial = 1912] [outer = (nil)] [url = about:blank] 14:03:05 INFO - --DOMWINDOW == 43 (0x7f4afe3e4c00) [pid = 2212] [serial = 1930] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:05 INFO - --DOMWINDOW == 42 (0x7f4afe8abc00) [pid = 2212] [serial = 1932] [outer = (nil)] [url = about:blank] 14:03:05 INFO - --DOMWINDOW == 41 (0x7f4b07a08c00) [pid = 2212] [serial = 1920] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:05 INFO - --DOMWINDOW == 40 (0x7f4b09581000) [pid = 2212] [serial = 1922] [outer = (nil)] [url = about:blank] 14:03:05 INFO - --DOMWINDOW == 39 (0x7f4afde69000) [pid = 2212] [serial = 1957] [outer = (nil)] [url = about:blank] 14:03:05 INFO - --DOMWINDOW == 38 (0x7f4afe00b000) [pid = 2212] [serial = 1936] [outer = (nil)] [url = about:blank] 14:03:05 INFO - --DOMWINDOW == 37 (0x7f4aff421800) [pid = 2212] [serial = 1943] [outer = (nil)] [url = about:blank] 14:03:05 INFO - --DOMWINDOW == 36 (0x7f4b019b1000) [pid = 2212] [serial = 1940] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:03:05 INFO - --DOMWINDOW == 35 (0x7f4afe544c00) [pid = 2212] [serial = 1937] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:06 INFO - --DOMWINDOW == 34 (0x7f4b0f711c00) [pid = 2212] [serial = 1950] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:03:06 INFO - --DOMWINDOW == 33 (0x7f4b0984e800) [pid = 2212] [serial = 1947] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:06 INFO - --DOMWINDOW == 32 (0x7f4afde5fc00) [pid = 2212] [serial = 1935] [outer = (nil)] [url = data:text/html,<script>%20%20window.bar%20=%20{%20baz:%201%20};%20%20console.log("foo");%20%20console.log("foo",%20window.bar);</script>] 14:03:06 INFO - --DOMWINDOW == 31 (0x7f4afe81c800) [pid = 2212] [serial = 1942] [outer = (nil)] [url = about:blank] 14:03:06 INFO - --DOMWINDOW == 30 (0x7f4b09621800) [pid = 2212] [serial = 1944] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-count.html] 14:03:06 INFO - MEMORY STAT | vsize 1173MB | residentFast 310MB | heapAllocated 119MB 14:03:06 INFO - 364 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_dont_navigate_on_doubleclick.js | took 4980ms 14:03:06 INFO - ++DOCSHELL 0x7f4afdc1c800 == 11 [pid = 2212] [id = 814] 14:03:06 INFO - ++DOMWINDOW == 31 (0x7f4afd951c00) [pid = 2212] [serial = 1962] [outer = (nil)] 14:03:06 INFO - ++DOMWINDOW == 32 (0x7f4afde61400) [pid = 2212] [serial = 1963] [outer = 0x7f4afd951c00] 14:03:06 INFO - 365 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_exception_stackframe.js 14:03:06 INFO - ++DOCSHELL 0x7f4aff210800 == 12 [pid = 2212] [id = 815] 14:03:06 INFO - ++DOMWINDOW == 33 (0x7f4afd3a6c00) [pid = 2212] [serial = 1964] [outer = (nil)] 14:03:06 INFO - ++DOMWINDOW == 34 (0x7f4afe015c00) [pid = 2212] [serial = 1965] [outer = 0x7f4afd3a6c00] 14:03:07 INFO - ++DOMWINDOW == 35 (0x7f4afd341c00) [pid = 2212] [serial = 1966] [outer = 0x7f4afd3a6c00] 14:03:07 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-exception-stackframe.html, line 21: ReferenceError: nonExistingMethodCall is not defined 14:03:07 INFO - ++DOCSHELL 0x7f4afcec3000 == 13 [pid = 2212] [id = 816] 14:03:07 INFO - ++DOMWINDOW == 36 (0x7f4afe3e4c00) [pid = 2212] [serial = 1967] [outer = (nil)] 14:03:07 INFO - ++DOMWINDOW == 37 (0x7f4afe4bd800) [pid = 2212] [serial = 1968] [outer = 0x7f4afe3e4c00] 14:03:07 INFO - ++DOMWINDOW == 38 (0x7f4afe575800) [pid = 2212] [serial = 1969] [outer = 0x7f4afe3e4c00] 14:03:07 INFO - ++DOCSHELL 0x7f4b0949d800 == 14 [pid = 2212] [id = 817] 14:03:07 INFO - ++DOMWINDOW == 39 (0x7f4afe8b0c00) [pid = 2212] [serial = 1970] [outer = (nil)] 14:03:07 INFO - ++DOMWINDOW == 40 (0x7f4afe8b8c00) [pid = 2212] [serial = 1971] [outer = 0x7f4afe8b0c00] 14:03:10 INFO - --DOCSHELL 0x7f4afe2c6800 == 13 [pid = 2212] [id = 811] 14:03:10 INFO - --DOCSHELL 0x7f4afcec1800 == 12 [pid = 2212] [id = 810] 14:03:10 INFO - --DOCSHELL 0x7f4afcec3000 == 11 [pid = 2212] [id = 816] 14:03:10 INFO - --DOCSHELL 0x7f4b0949d800 == 10 [pid = 2212] [id = 817] 14:03:10 INFO - --DOMWINDOW == 39 (0x7f4b09e51800) [pid = 2212] [serial = 1946] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-count.html] 14:03:10 INFO - --DOMWINDOW == 38 (0x7f4b0f981800) [pid = 2212] [serial = 1951] [outer = (nil)] [url = about:blank] 14:03:10 INFO - --DOMWINDOW == 37 (0x7f4b00f5f000) [pid = 2212] [serial = 1949] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:10 INFO - --DOMWINDOW == 36 (0x7f4b019b8000) [pid = 2212] [serial = 1941] [outer = (nil)] [url = about:blank] 14:03:10 INFO - --DOMWINDOW == 35 (0x7f4afe8ab800) [pid = 2212] [serial = 1939] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:11 INFO - --DOMWINDOW == 34 (0x7f4afe015c00) [pid = 2212] [serial = 1965] [outer = (nil)] [url = about:blank] 14:03:11 INFO - --DOMWINDOW == 33 (0x7f4afd945800) [pid = 2212] [serial = 1955] [outer = (nil)] [url = about:blank] 14:03:11 INFO - --DOMWINDOW == 32 (0x7f4afcf29800) [pid = 2212] [serial = 1953] [outer = (nil)] [url = about:blank] 14:03:11 INFO - --DOMWINDOW == 31 (0x7f4afe4bd800) [pid = 2212] [serial = 1968] [outer = (nil)] [url = about:blank] 14:03:11 INFO - --DOMWINDOW == 30 (0x7f4afe812000) [pid = 2212] [serial = 1959] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:03:11 INFO - --DOMWINDOW == 29 (0x7f4afd947400) [pid = 2212] [serial = 1956] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:11 INFO - --DOMWINDOW == 28 (0x7f4afd3a3c00) [pid = 2212] [serial = 1954] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?_uniq=1446847381518] 14:03:11 INFO - --DOMWINDOW == 27 (0x7f4afcf22c00) [pid = 2212] [serial = 1952] [outer = (nil)] [url = about:blank] 14:03:11 INFO - --DOMWINDOW == 26 (0x7f4b0984e400) [pid = 2212] [serial = 1961] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html?_uniq=1446847381518] 14:03:11 INFO - MEMORY STAT | vsize 1173MB | residentFast 307MB | heapAllocated 118MB 14:03:11 INFO - 366 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_exception_stackframe.js | took 4637ms 14:03:11 INFO - ++DOCSHELL 0x7f4afcec1800 == 11 [pid = 2212] [id = 818] 14:03:11 INFO - ++DOMWINDOW == 27 (0x7f4afcf25800) [pid = 2212] [serial = 1972] [outer = (nil)] 14:03:11 INFO - ++DOMWINDOW == 28 (0x7f4afcf2f000) [pid = 2212] [serial = 1973] [outer = 0x7f4afcf25800] 14:03:11 INFO - 367 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_execution_scope.js 14:03:11 INFO - ++DOCSHELL 0x7f4afe2cd000 == 12 [pid = 2212] [id = 819] 14:03:11 INFO - ++DOMWINDOW == 29 (0x7f4afd947400) [pid = 2212] [serial = 1974] [outer = (nil)] 14:03:11 INFO - ++DOMWINDOW == 30 (0x7f4afde5e000) [pid = 2212] [serial = 1975] [outer = 0x7f4afd947400] 14:03:11 INFO - ++DOMWINDOW == 31 (0x7f4afe0ad400) [pid = 2212] [serial = 1976] [outer = 0x7f4afd947400] 14:03:12 INFO - ++DOCSHELL 0x7f4afcec5800 == 13 [pid = 2212] [id = 820] 14:03:12 INFO - ++DOMWINDOW == 32 (0x7f4afe3d7400) [pid = 2212] [serial = 1977] [outer = (nil)] 14:03:12 INFO - ++DOMWINDOW == 33 (0x7f4afe3de000) [pid = 2212] [serial = 1978] [outer = 0x7f4afe3d7400] 14:03:12 INFO - ++DOMWINDOW == 34 (0x7f4afe551000) [pid = 2212] [serial = 1979] [outer = 0x7f4afe3d7400] 14:03:12 INFO - ++DOCSHELL 0x7f4b07c25000 == 14 [pid = 2212] [id = 821] 14:03:12 INFO - ++DOMWINDOW == 35 (0x7f4afe8abc00) [pid = 2212] [serial = 1980] [outer = (nil)] 14:03:12 INFO - ++DOMWINDOW == 36 (0x7f4afe8aec00) [pid = 2212] [serial = 1981] [outer = 0x7f4afe8abc00] 14:03:15 INFO - --DOCSHELL 0x7f4aff210800 == 13 [pid = 2212] [id = 815] 14:03:15 INFO - --DOCSHELL 0x7f4afdc1c800 == 12 [pid = 2212] [id = 814] 14:03:15 INFO - --DOCSHELL 0x7f4b07c25000 == 11 [pid = 2212] [id = 821] 14:03:15 INFO - --DOMWINDOW == 35 (0x7f4afe81c000) [pid = 2212] [serial = 1960] [outer = (nil)] [url = about:blank] 14:03:15 INFO - --DOMWINDOW == 34 (0x7f4afe3d7800) [pid = 2212] [serial = 1958] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:15 INFO - --DOMWINDOW == 33 (0x7f4afde5e000) [pid = 2212] [serial = 1975] [outer = (nil)] [url = about:blank] 14:03:15 INFO - --DOMWINDOW == 32 (0x7f4afde61400) [pid = 2212] [serial = 1963] [outer = (nil)] [url = about:blank] 14:03:15 INFO - --DOMWINDOW == 31 (0x7f4afe3de000) [pid = 2212] [serial = 1978] [outer = (nil)] [url = about:blank] 14:03:15 INFO - --DOMWINDOW == 30 (0x7f4afe8b0c00) [pid = 2212] [serial = 1970] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:03:15 INFO - --DOMWINDOW == 29 (0x7f4afe3e4c00) [pid = 2212] [serial = 1967] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:15 INFO - --DOMWINDOW == 28 (0x7f4afd3a6c00) [pid = 2212] [serial = 1964] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-exception-stackframe.html] 14:03:15 INFO - --DOMWINDOW == 27 (0x7f4afd951c00) [pid = 2212] [serial = 1962] [outer = (nil)] [url = about:blank] 14:03:15 INFO - --DOMWINDOW == 26 (0x7f4afd341c00) [pid = 2212] [serial = 1966] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-exception-stackframe.html] 14:03:16 INFO - MEMORY STAT | vsize 1175MB | residentFast 306MB | heapAllocated 118MB 14:03:16 INFO - 368 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_execution_scope.js | took 4475ms 14:03:16 INFO - ++DOCSHELL 0x7f4afcec5000 == 12 [pid = 2212] [id = 822] 14:03:16 INFO - ++DOMWINDOW == 27 (0x7f4afcf24400) [pid = 2212] [serial = 1982] [outer = (nil)] 14:03:16 INFO - ++DOMWINDOW == 28 (0x7f4afcf2c800) [pid = 2212] [serial = 1983] [outer = 0x7f4afcf24400] 14:03:16 INFO - 369 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_expandable_timestamps.js 14:03:16 INFO - ++DOCSHELL 0x7f4afe3ae800 == 13 [pid = 2212] [id = 823] 14:03:16 INFO - ++DOMWINDOW == 29 (0x7f4afd3a4400) [pid = 2212] [serial = 1984] [outer = (nil)] 14:03:16 INFO - ++DOMWINDOW == 30 (0x7f4afd3aec00) [pid = 2212] [serial = 1985] [outer = 0x7f4afd3a4400] 14:03:16 INFO - ++DOCSHELL 0x7f4afcec3000 == 14 [pid = 2212] [id = 824] 14:03:16 INFO - ++DOMWINDOW == 31 (0x7f4afd942400) [pid = 2212] [serial = 1986] [outer = (nil)] 14:03:16 INFO - ++DOMWINDOW == 32 (0x7f4afe0aa400) [pid = 2212] [serial = 1987] [outer = 0x7f4afd942400] 14:03:16 INFO - ++DOMWINDOW == 33 (0x7f4afe3e4c00) [pid = 2212] [serial = 1988] [outer = 0x7f4afd942400] 14:03:17 INFO - ++DOCSHELL 0x7f4b07c2b000 == 15 [pid = 2212] [id = 825] 14:03:17 INFO - ++DOMWINDOW == 34 (0x7f4afe8a7000) [pid = 2212] [serial = 1989] [outer = (nil)] 14:03:17 INFO - ++DOMWINDOW == 35 (0x7f4afe8ab400) [pid = 2212] [serial = 1990] [outer = 0x7f4afe8a7000] 14:03:18 INFO - ++DOCSHELL 0x7f4b0f7b8000 == 16 [pid = 2212] [id = 826] 14:03:18 INFO - ++DOMWINDOW == 36 (0x7f4b019b0c00) [pid = 2212] [serial = 1991] [outer = (nil)] 14:03:18 INFO - ++DOMWINDOW == 37 (0x7f4b019b1c00) [pid = 2212] [serial = 1992] [outer = 0x7f4b019b0c00] 14:03:19 INFO - Handler function threw an exception: TypeError: this.disableJSNode is null 14:03:19 INFO - Stack: OptionsPanel.prototype.populatePreferences/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/toolbox-options.js:320:9 14:03:19 INFO - DebuggerClient.prototype.attachTab/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/client/main.js:433:39 14:03:19 INFO - makeInfallible/<@resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/shared/DevToolsUtils.js:87:14 14:03:19 INFO - Line: 320, column: 9 14:03:20 INFO - --DOCSHELL 0x7f4afcec1800 == 15 [pid = 2212] [id = 818] 14:03:20 INFO - --DOCSHELL 0x7f4afe2cd000 == 14 [pid = 2212] [id = 819] 14:03:20 INFO - --DOCSHELL 0x7f4afcec5800 == 13 [pid = 2212] [id = 820] 14:03:20 INFO - --DOCSHELL 0x7f4b07c2b000 == 12 [pid = 2212] [id = 825] 14:03:20 INFO - --DOCSHELL 0x7f4b0f7b8000 == 11 [pid = 2212] [id = 826] 14:03:20 INFO - --DOMWINDOW == 36 (0x7f4afe8b8c00) [pid = 2212] [serial = 1971] [outer = (nil)] [url = about:blank] 14:03:20 INFO - --DOMWINDOW == 35 (0x7f4afe575800) [pid = 2212] [serial = 1969] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:20 INFO - --DOMWINDOW == 34 (0x7f4afcf2f000) [pid = 2212] [serial = 1973] [outer = (nil)] [url = about:blank] 14:03:20 INFO - --DOMWINDOW == 33 (0x7f4afe0aa400) [pid = 2212] [serial = 1987] [outer = (nil)] [url = about:blank] 14:03:20 INFO - --DOMWINDOW == 32 (0x7f4afe8abc00) [pid = 2212] [serial = 1980] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:03:20 INFO - --DOMWINDOW == 31 (0x7f4afe3d7400) [pid = 2212] [serial = 1977] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:20 INFO - --DOMWINDOW == 30 (0x7f4afd947400) [pid = 2212] [serial = 1974] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:03:20 INFO - --DOMWINDOW == 29 (0x7f4afcf25800) [pid = 2212] [serial = 1972] [outer = (nil)] [url = about:blank] 14:03:20 INFO - --DOMWINDOW == 28 (0x7f4afe0ad400) [pid = 2212] [serial = 1976] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:03:20 INFO - MEMORY STAT | vsize 1177MB | residentFast 310MB | heapAllocated 119MB 14:03:20 INFO - 370 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_expandable_timestamps.js | took 4431ms 14:03:20 INFO - ++DOCSHELL 0x7f4afcebd000 == 12 [pid = 2212] [id = 827] 14:03:20 INFO - ++DOMWINDOW == 29 (0x7f4afcf23000) [pid = 2212] [serial = 1993] [outer = (nil)] 14:03:20 INFO - ++DOMWINDOW == 30 (0x7f4afcf2f000) [pid = 2212] [serial = 1994] [outer = 0x7f4afcf23000] 14:03:21 INFO - 371 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_filter_buttons_contextmenu.js 14:03:21 INFO - ++DOCSHELL 0x7f4afe3ab800 == 13 [pid = 2212] [id = 828] 14:03:21 INFO - ++DOMWINDOW == 31 (0x7f4afd3a6c00) [pid = 2212] [serial = 1995] [outer = (nil)] 14:03:21 INFO - ++DOMWINDOW == 32 (0x7f4afd947c00) [pid = 2212] [serial = 1996] [outer = 0x7f4afd3a6c00] 14:03:21 INFO - ++DOMWINDOW == 33 (0x7f4afe015800) [pid = 2212] [serial = 1997] [outer = 0x7f4afd3a6c00] 14:03:21 INFO - ++DOCSHELL 0x7f4aff20d800 == 14 [pid = 2212] [id = 829] 14:03:21 INFO - ++DOMWINDOW == 34 (0x7f4afd94d400) [pid = 2212] [serial = 1998] [outer = (nil)] 14:03:21 INFO - ++DOMWINDOW == 35 (0x7f4afe1f4000) [pid = 2212] [serial = 1999] [outer = 0x7f4afd94d400] 14:03:22 INFO - ++DOMWINDOW == 36 (0x7f4afe57f400) [pid = 2212] [serial = 2000] [outer = 0x7f4afd94d400] 14:03:22 INFO - ++DOCSHELL 0x7f4b09494800 == 15 [pid = 2212] [id = 830] 14:03:22 INFO - ++DOMWINDOW == 37 (0x7f4afe8c5000) [pid = 2212] [serial = 2001] [outer = (nil)] 14:03:22 INFO - ++DOMWINDOW == 38 (0x7f4aff333400) [pid = 2212] [serial = 2002] [outer = 0x7f4afe8c5000] 14:03:26 INFO - --DOCSHELL 0x7f4afe3ae800 == 14 [pid = 2212] [id = 823] 14:03:26 INFO - --DOCSHELL 0x7f4afcec5000 == 13 [pid = 2212] [id = 822] 14:03:26 INFO - --DOCSHELL 0x7f4aff20d800 == 12 [pid = 2212] [id = 829] 14:03:26 INFO - --DOCSHELL 0x7f4b09494800 == 11 [pid = 2212] [id = 830] 14:03:26 INFO - --DOCSHELL 0x7f4afcec3000 == 10 [pid = 2212] [id = 824] 14:03:26 INFO - --DOMWINDOW == 37 (0x7f4afe8aec00) [pid = 2212] [serial = 1981] [outer = (nil)] [url = about:blank] 14:03:26 INFO - --DOMWINDOW == 36 (0x7f4afe551000) [pid = 2212] [serial = 1979] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:26 INFO - --DOMWINDOW == 35 (0x7f4afe1f4000) [pid = 2212] [serial = 1999] [outer = (nil)] [url = about:blank] 14:03:26 INFO - --DOMWINDOW == 34 (0x7f4afd947c00) [pid = 2212] [serial = 1996] [outer = (nil)] [url = about:blank] 14:03:26 INFO - --DOMWINDOW == 33 (0x7f4afd3aec00) [pid = 2212] [serial = 1985] [outer = (nil)] [url = about:blank] 14:03:26 INFO - --DOMWINDOW == 32 (0x7f4afcf2c800) [pid = 2212] [serial = 1983] [outer = (nil)] [url = about:blank] 14:03:26 INFO - --DOMWINDOW == 31 (0x7f4b019b0c00) [pid = 2212] [serial = 1991] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox-options.xul] 14:03:26 INFO - --DOMWINDOW == 30 (0x7f4afe8a7000) [pid = 2212] [serial = 1989] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:03:26 INFO - --DOMWINDOW == 29 (0x7f4afd942400) [pid = 2212] [serial = 1986] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:26 INFO - --DOMWINDOW == 28 (0x7f4afd3a4400) [pid = 2212] [serial = 1984] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20bug%20722267%20-%20preference%20for%20toggling%20timestamps%20in%20messages] 14:03:26 INFO - --DOMWINDOW == 27 (0x7f4afcf24400) [pid = 2212] [serial = 1982] [outer = (nil)] [url = about:blank] 14:03:26 INFO - MEMORY STAT | vsize 1175MB | residentFast 307MB | heapAllocated 120MB 14:03:26 INFO - 372 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_filter_buttons_contextmenu.js | took 5833ms 14:03:26 INFO - ++DOCSHELL 0x7f4afcec2000 == 11 [pid = 2212] [id = 831] 14:03:26 INFO - ++DOMWINDOW == 28 (0x7f4afcf28c00) [pid = 2212] [serial = 2003] [outer = (nil)] 14:03:26 INFO - ++DOMWINDOW == 29 (0x7f4afd33e000) [pid = 2212] [serial = 2004] [outer = 0x7f4afcf28c00] 14:03:27 INFO - 373 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_for_of.js 14:03:27 INFO - ++DOCSHELL 0x7f4afe4ee800 == 12 [pid = 2212] [id = 832] 14:03:27 INFO - ++DOMWINDOW == 30 (0x7f4afde61000) [pid = 2212] [serial = 2005] [outer = (nil)] 14:03:27 INFO - ++DOMWINDOW == 31 (0x7f4afde69000) [pid = 2212] [serial = 2006] [outer = 0x7f4afde61000] 14:03:27 INFO - ++DOMWINDOW == 32 (0x7f4afe0b0c00) [pid = 2212] [serial = 2007] [outer = 0x7f4afde61000] 14:03:27 INFO - ++DOCSHELL 0x7f4afce8f000 == 13 [pid = 2212] [id = 833] 14:03:27 INFO - ++DOMWINDOW == 33 (0x7f4afe3e2000) [pid = 2212] [serial = 2008] [outer = (nil)] 14:03:27 INFO - ++DOMWINDOW == 34 (0x7f4afe4bd400) [pid = 2212] [serial = 2009] [outer = 0x7f4afe3e2000] 14:03:27 INFO - ++DOMWINDOW == 35 (0x7f4afe575800) [pid = 2212] [serial = 2010] [outer = 0x7f4afe3e2000] 14:03:28 INFO - ++DOCSHELL 0x7f4b094a6000 == 14 [pid = 2212] [id = 834] 14:03:28 INFO - ++DOMWINDOW == 36 (0x7f4afe8b7800) [pid = 2212] [serial = 2011] [outer = (nil)] 14:03:28 INFO - ++DOMWINDOW == 37 (0x7f4afe8bb000) [pid = 2212] [serial = 2012] [outer = 0x7f4afe8b7800] 14:03:30 INFO - --DOCSHELL 0x7f4afcebd000 == 13 [pid = 2212] [id = 827] 14:03:30 INFO - --DOCSHELL 0x7f4b094a6000 == 12 [pid = 2212] [id = 834] 14:03:30 INFO - --DOCSHELL 0x7f4afe3ab800 == 11 [pid = 2212] [id = 828] 14:03:31 INFO - --DOMWINDOW == 36 (0x7f4b019b1c00) [pid = 2212] [serial = 1992] [outer = (nil)] [url = about:blank] 14:03:31 INFO - --DOMWINDOW == 35 (0x7f4afe3e4c00) [pid = 2212] [serial = 1988] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:31 INFO - --DOMWINDOW == 34 (0x7f4afe8ab400) [pid = 2212] [serial = 1990] [outer = (nil)] [url = about:blank] 14:03:31 INFO - --DOMWINDOW == 33 (0x7f4afe4bd400) [pid = 2212] [serial = 2009] [outer = (nil)] [url = about:blank] 14:03:31 INFO - --DOMWINDOW == 32 (0x7f4afcf2f000) [pid = 2212] [serial = 1994] [outer = (nil)] [url = about:blank] 14:03:31 INFO - --DOMWINDOW == 31 (0x7f4afe015800) [pid = 2212] [serial = 1997] [outer = (nil)] [url = http://example.com/] 14:03:31 INFO - --DOMWINDOW == 30 (0x7f4afde69000) [pid = 2212] [serial = 2006] [outer = (nil)] [url = about:blank] 14:03:31 INFO - --DOMWINDOW == 29 (0x7f4afd94d400) [pid = 2212] [serial = 1998] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:31 INFO - --DOMWINDOW == 28 (0x7f4afe8c5000) [pid = 2212] [serial = 2001] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:03:31 INFO - --DOMWINDOW == 27 (0x7f4afcf23000) [pid = 2212] [serial = 1993] [outer = (nil)] [url = about:blank] 14:03:31 INFO - --DOMWINDOW == 26 (0x7f4afd3a6c00) [pid = 2212] [serial = 1995] [outer = (nil)] [url = http://example.com/] 14:03:31 INFO - MEMORY STAT | vsize 1177MB | residentFast 308MB | heapAllocated 119MB 14:03:31 INFO - 374 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_for_of.js | took 4392ms 14:03:31 INFO - ++DOCSHELL 0x7f4afd59a000 == 12 [pid = 2212] [id = 835] 14:03:31 INFO - ++DOMWINDOW == 27 (0x7f4afcf23000) [pid = 2212] [serial = 2013] [outer = (nil)] 14:03:31 INFO - ++DOMWINDOW == 28 (0x7f4afcf29c00) [pid = 2212] [serial = 2014] [outer = 0x7f4afcf23000] 14:03:31 INFO - 375 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_history.js 14:03:31 INFO - ++DOCSHELL 0x7f4afe851800 == 13 [pid = 2212] [id = 836] 14:03:31 INFO - ++DOMWINDOW == 29 (0x7f4afd3ad400) [pid = 2212] [serial = 2015] [outer = (nil)] 14:03:31 INFO - ++DOMWINDOW == 30 (0x7f4afd94a400) [pid = 2212] [serial = 2016] [outer = 0x7f4afd3ad400] 14:03:31 INFO - ++DOMWINDOW == 31 (0x7f4afe0ad000) [pid = 2212] [serial = 2017] [outer = 0x7f4afd3ad400] 14:03:32 INFO - ++DOCSHELL 0x7f4afce8f800 == 14 [pid = 2212] [id = 837] 14:03:32 INFO - ++DOMWINDOW == 32 (0x7f4afe1f3000) [pid = 2212] [serial = 2018] [outer = (nil)] 14:03:32 INFO - ++DOMWINDOW == 33 (0x7f4afe3d7c00) [pid = 2212] [serial = 2019] [outer = 0x7f4afe1f3000] 14:03:32 INFO - ++DOMWINDOW == 34 (0x7f4afe553c00) [pid = 2212] [serial = 2020] [outer = 0x7f4afe1f3000] 14:03:32 INFO - ++DOCSHELL 0x7f4b094a6000 == 15 [pid = 2212] [id = 838] 14:03:32 INFO - ++DOMWINDOW == 35 (0x7f4afe57e800) [pid = 2212] [serial = 2021] [outer = (nil)] 14:03:32 INFO - ++DOMWINDOW == 36 (0x7f4afe8ac000) [pid = 2212] [serial = 2022] [outer = 0x7f4afe57e800] 14:03:36 INFO - --DOCSHELL 0x7f4afcec2000 == 14 [pid = 2212] [id = 831] 14:03:36 INFO - --DOCSHELL 0x7f4afe4ee800 == 13 [pid = 2212] [id = 832] 14:03:36 INFO - --DOCSHELL 0x7f4afce8f000 == 12 [pid = 2212] [id = 833] 14:03:36 INFO - --DOCSHELL 0x7f4afce8f800 == 11 [pid = 2212] [id = 837] 14:03:36 INFO - --DOCSHELL 0x7f4b094a6000 == 10 [pid = 2212] [id = 838] 14:03:36 INFO - --DOMWINDOW == 35 (0x7f4afe57f400) [pid = 2212] [serial = 2000] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:36 INFO - --DOMWINDOW == 34 (0x7f4aff333400) [pid = 2212] [serial = 2002] [outer = (nil)] [url = about:blank] 14:03:36 INFO - --DOMWINDOW == 33 (0x7f4afe3d7c00) [pid = 2212] [serial = 2019] [outer = (nil)] [url = about:blank] 14:03:36 INFO - --DOMWINDOW == 32 (0x7f4afd94a400) [pid = 2212] [serial = 2016] [outer = (nil)] [url = about:blank] 14:03:36 INFO - --DOMWINDOW == 31 (0x7f4afe3e2000) [pid = 2212] [serial = 2008] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:36 INFO - --DOMWINDOW == 30 (0x7f4afd33e000) [pid = 2212] [serial = 2004] [outer = (nil)] [url = about:blank] 14:03:36 INFO - --DOMWINDOW == 29 (0x7f4afe8b7800) [pid = 2212] [serial = 2011] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:03:36 INFO - --DOMWINDOW == 28 (0x7f4afde61000) [pid = 2212] [serial = 2005] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-for-of.html] 14:03:36 INFO - --DOMWINDOW == 27 (0x7f4afcf28c00) [pid = 2212] [serial = 2003] [outer = (nil)] [url = about:blank] 14:03:36 INFO - --DOMWINDOW == 26 (0x7f4afe0b0c00) [pid = 2212] [serial = 2007] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-for-of.html] 14:03:36 INFO - MEMORY STAT | vsize 1177MB | residentFast 309MB | heapAllocated 119MB 14:03:36 INFO - 376 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_history.js | took 5085ms 14:03:36 INFO - ++DOCSHELL 0x7f4afce91800 == 11 [pid = 2212] [id = 839] 14:03:36 INFO - ++DOMWINDOW == 27 (0x7f4afcf24400) [pid = 2212] [serial = 2023] [outer = (nil)] 14:03:36 INFO - ++DOMWINDOW == 28 (0x7f4afcf31400) [pid = 2212] [serial = 2024] [outer = 0x7f4afcf24400] 14:03:37 INFO - 377 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_hpkp_invalid-headers.js 14:03:37 INFO - ++DOCSHELL 0x7f4afe853800 == 12 [pid = 2212] [id = 840] 14:03:37 INFO - ++DOMWINDOW == 29 (0x7f4afd947400) [pid = 2212] [serial = 2025] [outer = (nil)] 14:03:37 INFO - ++DOMWINDOW == 30 (0x7f4afde5e000) [pid = 2212] [serial = 2026] [outer = 0x7f4afd947400] 14:03:37 INFO - ++DOCSHELL 0x7f4afce80000 == 13 [pid = 2212] [id = 841] 14:03:37 INFO - ++DOMWINDOW == 31 (0x7f4afde61000) [pid = 2212] [serial = 2027] [outer = (nil)] 14:03:37 INFO - ++DOMWINDOW == 32 (0x7f4afe0b3000) [pid = 2212] [serial = 2028] [outer = 0x7f4afde61000] 14:03:37 INFO - ++DOMWINDOW == 33 (0x7f4afe54f800) [pid = 2212] [serial = 2029] [outer = 0x7f4afde61000] 14:03:37 INFO - ++DOCSHELL 0x7f4b094a6800 == 14 [pid = 2212] [id = 842] 14:03:37 INFO - ++DOMWINDOW == 34 (0x7f4afe8aac00) [pid = 2212] [serial = 2030] [outer = (nil)] 14:03:37 INFO - ++DOMWINDOW == 35 (0x7f4afe8aec00) [pid = 2212] [serial = 2031] [outer = 0x7f4afe8aac00] 14:03:39 INFO - ++DOMWINDOW == 36 (0x7f4aff338400) [pid = 2212] [serial = 2032] [outer = 0x7f4afd947400] 14:03:39 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:03:40 INFO - ++DOMWINDOW == 37 (0x7f4b07d76000) [pid = 2212] [serial = 2033] [outer = 0x7f4afd947400] 14:03:40 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:03:41 INFO - ++DOMWINDOW == 38 (0x7f4afe54cc00) [pid = 2212] [serial = 2034] [outer = 0x7f4afd947400] 14:03:41 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:03:41 INFO - ++DOMWINDOW == 39 (0x7f4b012d4c00) [pid = 2212] [serial = 2035] [outer = 0x7f4afd947400] 14:03:42 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:03:42 INFO - ++DOMWINDOW == 40 (0x7f4b0984b400) [pid = 2212] [serial = 2036] [outer = 0x7f4afd947400] 14:03:42 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:03:43 INFO - ++DOMWINDOW == 41 (0x7f4b09bbec00) [pid = 2212] [serial = 2037] [outer = 0x7f4afd947400] 14:03:43 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:03:44 INFO - ++DOMWINDOW == 42 (0x7f4b0f70c400) [pid = 2212] [serial = 2038] [outer = 0x7f4afd947400] 14:03:44 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:03:45 INFO - ++DOMWINDOW == 43 (0x7f4b0c4e6800) [pid = 2212] [serial = 2039] [outer = 0x7f4afd947400] 14:03:45 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:03:46 INFO - ++DOMWINDOW == 44 (0x7f4b0c1a7800) [pid = 2212] [serial = 2040] [outer = 0x7f4afd947400] 14:03:46 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:03:48 INFO - --DOCSHELL 0x7f4afd59a000 == 13 [pid = 2212] [id = 835] 14:03:48 INFO - --DOCSHELL 0x7f4afe851800 == 12 [pid = 2212] [id = 836] 14:03:48 INFO - --DOCSHELL 0x7f4b094a6800 == 11 [pid = 2212] [id = 842] 14:03:48 INFO - --DOMWINDOW == 43 (0x7f4afe575800) [pid = 2212] [serial = 2010] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:48 INFO - --DOMWINDOW == 42 (0x7f4afe8bb000) [pid = 2212] [serial = 2012] [outer = (nil)] [url = about:blank] 14:03:48 INFO - --DOMWINDOW == 41 (0x7f4aff338400) [pid = 2212] [serial = 2032] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?badSyntax] 14:03:48 INFO - --DOMWINDOW == 40 (0x7f4b07d76000) [pid = 2212] [serial = 2033] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?noMaxAge] 14:03:48 INFO - --DOMWINDOW == 39 (0x7f4afe54cc00) [pid = 2212] [serial = 2034] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?invalidIncludeSubDomains] 14:03:48 INFO - --DOMWINDOW == 38 (0x7f4b0f70c400) [pid = 2212] [serial = 2038] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?multipleReportURIs] 14:03:48 INFO - --DOMWINDOW == 37 (0x7f4b0c4e6800) [pid = 2212] [serial = 2039] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?pinsetDoesNotMatch] 14:03:48 INFO - --DOMWINDOW == 36 (0x7f4b09bbec00) [pid = 2212] [serial = 2037] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?multipleMaxAge] 14:03:48 INFO - --DOMWINDOW == 35 (0x7f4afde5e000) [pid = 2212] [serial = 2026] [outer = (nil)] [url = about:blank] 14:03:48 INFO - --DOMWINDOW == 34 (0x7f4afcf29c00) [pid = 2212] [serial = 2014] [outer = (nil)] [url = about:blank] 14:03:48 INFO - --DOMWINDOW == 33 (0x7f4b0984b400) [pid = 2212] [serial = 2036] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?multipleIncludeSubDomains] 14:03:48 INFO - --DOMWINDOW == 32 (0x7f4afe0b3000) [pid = 2212] [serial = 2028] [outer = (nil)] [url = about:blank] 14:03:48 INFO - --DOMWINDOW == 31 (0x7f4afd3ad400) [pid = 2212] [serial = 2015] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:03:48 INFO - --DOMWINDOW == 30 (0x7f4afe1f3000) [pid = 2212] [serial = 2018] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:48 INFO - --DOMWINDOW == 29 (0x7f4b012d4c00) [pid = 2212] [serial = 2035] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?invalidMaxAge] 14:03:48 INFO - --DOMWINDOW == 28 (0x7f4afcf23000) [pid = 2212] [serial = 2013] [outer = (nil)] [url = about:blank] 14:03:48 INFO - --DOMWINDOW == 27 (0x7f4afe57e800) [pid = 2212] [serial = 2021] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:03:48 INFO - --DOMWINDOW == 26 (0x7f4afe0ad000) [pid = 2212] [serial = 2017] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:03:48 INFO - MEMORY STAT | vsize 1180MB | residentFast 315MB | heapAllocated 121MB 14:03:48 INFO - 378 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_hpkp_invalid-headers.js | took 11828ms 14:03:48 INFO - ++DOCSHELL 0x7f4afce85800 == 12 [pid = 2212] [id = 843] 14:03:48 INFO - ++DOMWINDOW == 27 (0x7f4afd041c00) [pid = 2212] [serial = 2041] [outer = (nil)] 14:03:48 INFO - ++DOMWINDOW == 28 (0x7f4afd3af000) [pid = 2212] [serial = 2042] [outer = 0x7f4afd041c00] 14:03:49 INFO - 379 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_hsts_invalid-headers.js 14:03:49 INFO - ++DOCSHELL 0x7f4aff206800 == 13 [pid = 2212] [id = 844] 14:03:49 INFO - ++DOMWINDOW == 29 (0x7f4afde6ac00) [pid = 2212] [serial = 2043] [outer = (nil)] 14:03:49 INFO - ++DOMWINDOW == 30 (0x7f4afe015800) [pid = 2212] [serial = 2044] [outer = 0x7f4afde6ac00] 14:03:49 INFO - ++DOCSHELL 0x7f4afce88800 == 14 [pid = 2212] [id = 845] 14:03:49 INFO - ++DOMWINDOW == 31 (0x7f4afc727800) [pid = 2212] [serial = 2045] [outer = (nil)] 14:03:49 INFO - ++DOMWINDOW == 32 (0x7f4afc85b000) [pid = 2212] [serial = 2046] [outer = 0x7f4afc727800] 14:03:49 INFO - ++DOMWINDOW == 33 (0x7f4afe0b2400) [pid = 2212] [serial = 2047] [outer = 0x7f4afc727800] 14:03:50 INFO - ++DOCSHELL 0x7f4b07c20800 == 15 [pid = 2212] [id = 846] 14:03:50 INFO - ++DOMWINDOW == 34 (0x7f4afe810400) [pid = 2212] [serial = 2048] [outer = (nil)] 14:03:50 INFO - ++DOMWINDOW == 35 (0x7f4afe817400) [pid = 2212] [serial = 2049] [outer = 0x7f4afe810400] 14:03:51 INFO - ++DOMWINDOW == 36 (0x7f4b012d8000) [pid = 2212] [serial = 2050] [outer = 0x7f4afde6ac00] 14:03:51 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:03:52 INFO - ++DOMWINDOW == 37 (0x7f4b07d75800) [pid = 2212] [serial = 2051] [outer = 0x7f4afde6ac00] 14:03:52 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:03:53 INFO - ++DOMWINDOW == 38 (0x7f4b0957d000) [pid = 2212] [serial = 2052] [outer = 0x7f4afde6ac00] 14:03:53 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:03:54 INFO - ++DOMWINDOW == 39 (0x7f4b0984b000) [pid = 2212] [serial = 2053] [outer = 0x7f4afde6ac00] 14:03:54 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:03:55 INFO - ++DOMWINDOW == 40 (0x7f4b0a03e400) [pid = 2212] [serial = 2054] [outer = 0x7f4afde6ac00] 14:03:55 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:03:56 INFO - ++DOMWINDOW == 41 (0x7f4b0c41e400) [pid = 2212] [serial = 2055] [outer = 0x7f4afde6ac00] 14:03:56 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:03:58 INFO - --DOCSHELL 0x7f4afce91800 == 14 [pid = 2212] [id = 839] 14:03:58 INFO - --DOCSHELL 0x7f4afce80000 == 13 [pid = 2212] [id = 841] 14:03:58 INFO - --DOCSHELL 0x7f4afe853800 == 12 [pid = 2212] [id = 840] 14:03:58 INFO - --DOCSHELL 0x7f4b07c20800 == 11 [pid = 2212] [id = 846] 14:03:58 INFO - --DOMWINDOW == 40 (0x7f4afe8ac000) [pid = 2212] [serial = 2022] [outer = (nil)] [url = about:blank] 14:03:58 INFO - --DOMWINDOW == 39 (0x7f4afe553c00) [pid = 2212] [serial = 2020] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:58 INFO - --DOMWINDOW == 38 (0x7f4afe015800) [pid = 2212] [serial = 2044] [outer = (nil)] [url = about:blank] 14:03:58 INFO - --DOMWINDOW == 37 (0x7f4afc85b000) [pid = 2212] [serial = 2046] [outer = (nil)] [url = about:blank] 14:03:58 INFO - --DOMWINDOW == 36 (0x7f4afcf31400) [pid = 2212] [serial = 2024] [outer = (nil)] [url = about:blank] 14:03:58 INFO - --DOMWINDOW == 35 (0x7f4afcf24400) [pid = 2212] [serial = 2023] [outer = (nil)] [url = about:blank] 14:03:58 INFO - --DOMWINDOW == 34 (0x7f4b0c1a7800) [pid = 2212] [serial = 2040] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?pinsetDoesNotMatch] 14:03:58 INFO - --DOMWINDOW == 33 (0x7f4afe8aac00) [pid = 2212] [serial = 2030] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:03:58 INFO - --DOMWINDOW == 32 (0x7f4b0a03e400) [pid = 2212] [serial = 2054] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?multipleIncludeSubDomains] 14:03:58 INFO - --DOMWINDOW == 31 (0x7f4b0984b000) [pid = 2212] [serial = 2053] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?invalidMaxAge] 14:03:58 INFO - --DOMWINDOW == 30 (0x7f4b0957d000) [pid = 2212] [serial = 2052] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?invalidIncludeSubDomains] 14:03:58 INFO - --DOMWINDOW == 29 (0x7f4b07d75800) [pid = 2212] [serial = 2051] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?noMaxAge] 14:03:58 INFO - --DOMWINDOW == 28 (0x7f4b012d8000) [pid = 2212] [serial = 2050] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?badSyntax] 14:03:58 INFO - --DOMWINDOW == 27 (0x7f4afd947400) [pid = 2212] [serial = 2025] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hpkp-invalid-headers.sjs?pinsetDoesNotMatch] 14:03:58 INFO - --DOMWINDOW == 26 (0x7f4afde61000) [pid = 2212] [serial = 2027] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:03:58 INFO - MEMORY STAT | vsize 1183MB | residentFast 317MB | heapAllocated 121MB 14:03:58 INFO - 380 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_hsts_invalid-headers.js | took 9579ms 14:03:58 INFO - ++DOCSHELL 0x7f4afce89000 == 12 [pid = 2212] [id = 847] 14:03:58 INFO - ++DOMWINDOW == 27 (0x7f4afcf27800) [pid = 2212] [serial = 2056] [outer = (nil)] 14:03:58 INFO - ++DOMWINDOW == 28 (0x7f4afd036000) [pid = 2212] [serial = 2057] [outer = 0x7f4afcf27800] 14:03:58 INFO - 381 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_input_field_focus_on_panel_select.js 14:03:58 INFO - ++DOCSHELL 0x7f4aff21f000 == 13 [pid = 2212] [id = 848] 14:03:58 INFO - ++DOMWINDOW == 29 (0x7f4afd947c00) [pid = 2212] [serial = 2058] [outer = (nil)] 14:03:58 INFO - ++DOMWINDOW == 30 (0x7f4afde61000) [pid = 2212] [serial = 2059] [outer = 0x7f4afd947c00] 14:03:59 INFO - ++DOCSHELL 0x7f4afcec5000 == 14 [pid = 2212] [id = 849] 14:03:59 INFO - ++DOMWINDOW == 31 (0x7f4afde66000) [pid = 2212] [serial = 2060] [outer = (nil)] 14:03:59 INFO - ++DOMWINDOW == 32 (0x7f4afe0b3c00) [pid = 2212] [serial = 2061] [outer = 0x7f4afde66000] 14:03:59 INFO - ++DOMWINDOW == 33 (0x7f4afe553400) [pid = 2212] [serial = 2062] [outer = 0x7f4afde66000] 14:03:59 INFO - ++DOCSHELL 0x7f4b0c398800 == 15 [pid = 2212] [id = 850] 14:03:59 INFO - ++DOMWINDOW == 34 (0x7f4afe8c1c00) [pid = 2212] [serial = 2063] [outer = (nil)] 14:03:59 INFO - ++DOMWINDOW == 35 (0x7f4afe8c5c00) [pid = 2212] [serial = 2064] [outer = 0x7f4afe8c1c00] 14:04:00 INFO - ++DOCSHELL 0x7f4b10ade000 == 16 [pid = 2212] [id = 851] 14:04:00 INFO - ++DOMWINDOW == 36 (0x7f4afe553c00) [pid = 2212] [serial = 2065] [outer = (nil)] 14:04:00 INFO - ++DOMWINDOW == 37 (0x7f4b09524400) [pid = 2212] [serial = 2066] [outer = 0x7f4afe553c00] 14:04:01 INFO - ++DOCSHELL 0x7f4b07d97000 == 17 [pid = 2212] [id = 852] 14:04:01 INFO - ++DOMWINDOW == 38 (0x7f4afe0a7c00) [pid = 2212] [serial = 2067] [outer = (nil)] 14:04:01 INFO - ++DOMWINDOW == 39 (0x7f4afcf29c00) [pid = 2212] [serial = 2068] [outer = 0x7f4afe0a7c00] 14:04:03 INFO - --DOCSHELL 0x7f4afce85800 == 16 [pid = 2212] [id = 843] 14:04:03 INFO - --DOCSHELL 0x7f4aff206800 == 15 [pid = 2212] [id = 844] 14:04:03 INFO - --DOCSHELL 0x7f4afce88800 == 14 [pid = 2212] [id = 845] 14:04:04 INFO - --DOMWINDOW == 38 (0x7f4afe54f800) [pid = 2212] [serial = 2029] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:04:04 INFO - --DOMWINDOW == 37 (0x7f4afe8aec00) [pid = 2212] [serial = 2031] [outer = (nil)] [url = about:blank] 14:04:04 INFO - --DOCSHELL 0x7f4b07d97000 == 13 [pid = 2212] [id = 852] 14:04:04 INFO - --DOCSHELL 0x7f4b10ade000 == 12 [pid = 2212] [id = 851] 14:04:04 INFO - --DOCSHELL 0x7f4b0c398800 == 11 [pid = 2212] [id = 850] 14:04:05 INFO - --DOMWINDOW == 36 (0x7f4afe0b3c00) [pid = 2212] [serial = 2061] [outer = (nil)] [url = about:blank] 14:04:05 INFO - --DOMWINDOW == 35 (0x7f4afd3af000) [pid = 2212] [serial = 2042] [outer = (nil)] [url = about:blank] 14:04:05 INFO - --DOMWINDOW == 34 (0x7f4b0c41e400) [pid = 2212] [serial = 2055] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?multipleMaxAge] 14:04:05 INFO - --DOMWINDOW == 33 (0x7f4afe810400) [pid = 2212] [serial = 2048] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:04:05 INFO - --DOMWINDOW == 32 (0x7f4afd041c00) [pid = 2212] [serial = 2041] [outer = (nil)] [url = about:blank] 14:04:05 INFO - --DOMWINDOW == 31 (0x7f4afde6ac00) [pid = 2212] [serial = 2043] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_hsts-invalid-headers.sjs?multipleMaxAge] 14:04:05 INFO - --DOMWINDOW == 30 (0x7f4afe0a7c00) [pid = 2212] [serial = 2067] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:04:05 INFO - --DOMWINDOW == 29 (0x7f4afc727800) [pid = 2212] [serial = 2045] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:04:06 INFO - MEMORY STAT | vsize 1172MB | residentFast 305MB | heapAllocated 122MB 14:04:06 INFO - 382 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_input_field_focus_on_panel_select.js | took 7398ms 14:04:06 INFO - ++DOCSHELL 0x7f4afce7a000 == 12 [pid = 2212] [id = 853] 14:04:06 INFO - ++DOMWINDOW == 30 (0x7f4afc864c00) [pid = 2212] [serial = 2069] [outer = (nil)] 14:04:06 INFO - ++DOMWINDOW == 31 (0x7f4afd039800) [pid = 2212] [serial = 2070] [outer = 0x7f4afc864c00] 14:04:06 INFO - 383 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_inspect-parsed-documents.js 14:04:06 INFO - ++DOCSHELL 0x7f4afe3ae800 == 13 [pid = 2212] [id = 854] 14:04:06 INFO - ++DOMWINDOW == 32 (0x7f4afd94e400) [pid = 2212] [serial = 2071] [outer = (nil)] 14:04:06 INFO - ++DOMWINDOW == 33 (0x7f4afde64000) [pid = 2212] [serial = 2072] [outer = 0x7f4afd94e400] 14:04:06 INFO - ++DOCSHELL 0x7f4afce7c000 == 14 [pid = 2212] [id = 855] 14:04:06 INFO - ++DOMWINDOW == 34 (0x7f4afde68400) [pid = 2212] [serial = 2073] [outer = (nil)] 14:04:06 INFO - ++DOMWINDOW == 35 (0x7f4afe0b2c00) [pid = 2212] [serial = 2074] [outer = 0x7f4afde68400] 14:04:07 INFO - ++DOMWINDOW == 36 (0x7f4afe4c7000) [pid = 2212] [serial = 2075] [outer = 0x7f4afde68400] 14:04:07 INFO - ++DOCSHELL 0x7f4b07d87000 == 15 [pid = 2212] [id = 856] 14:04:07 INFO - ++DOMWINDOW == 37 (0x7f4afe8a7800) [pid = 2212] [serial = 2076] [outer = (nil)] 14:04:07 INFO - ++DOMWINDOW == 38 (0x7f4afe8a9c00) [pid = 2212] [serial = 2077] [outer = 0x7f4afe8a7800] 14:04:09 INFO - ++DOCSHELL 0x7f4b0fa2e000 == 16 [pid = 2212] [id = 857] 14:04:09 INFO - ++DOMWINDOW == 39 (0x7f4b07a0f000) [pid = 2212] [serial = 2078] [outer = (nil)] 14:04:09 INFO - ++DOMWINDOW == 40 (0x7f4afcf2a400) [pid = 2212] [serial = 2079] [outer = 0x7f4b07a0f000] 14:04:09 INFO - [2212] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3476 14:04:10 INFO - ++DOCSHELL 0x7f4afdc1d000 == 17 [pid = 2212] [id = 858] 14:04:10 INFO - ++DOMWINDOW == 41 (0x7f4afd942400) [pid = 2212] [serial = 2080] [outer = (nil)] 14:04:10 INFO - ++DOMWINDOW == 42 (0x7f4afd949000) [pid = 2212] [serial = 2081] [outer = 0x7f4afd942400] 14:04:10 INFO - [2212] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3476 14:04:12 INFO - ++DOCSHELL 0x7f4b10bcb000 == 18 [pid = 2212] [id = 859] 14:04:12 INFO - ++DOMWINDOW == 43 (0x7f4b09bfb400) [pid = 2212] [serial = 2082] [outer = (nil)] 14:04:12 INFO - ++DOMWINDOW == 44 (0x7f4b012dfc00) [pid = 2212] [serial = 2083] [outer = 0x7f4b09bfb400] 14:04:12 INFO - [2212] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80004005: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsContentUtils.cpp, line 3476 14:04:13 INFO - MEMORY STAT | vsize 1176MB | residentFast 317MB | heapAllocated 135MB 14:04:13 INFO - 384 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_inspect-parsed-documents.js | took 7279ms 14:04:13 INFO - ++DOCSHELL 0x7f4b11d14000 == 19 [pid = 2212] [id = 860] 14:04:13 INFO - ++DOMWINDOW == 45 (0x7f4aff420800) [pid = 2212] [serial = 2084] [outer = (nil)] 14:04:13 INFO - ++DOMWINDOW == 46 (0x7f4b00f26800) [pid = 2212] [serial = 2085] [outer = 0x7f4aff420800] 14:04:14 INFO - 385 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_js_input_expansion.js 14:04:14 INFO - ++DOCSHELL 0x7f4afce91800 == 20 [pid = 2212] [id = 861] 14:04:14 INFO - ++DOMWINDOW == 47 (0x7f4b09e5e000) [pid = 2212] [serial = 2086] [outer = (nil)] 14:04:14 INFO - ++DOMWINDOW == 48 (0x7f4b0a03e400) [pid = 2212] [serial = 2087] [outer = 0x7f4b09e5e000] 14:04:14 INFO - ++DOMWINDOW == 49 (0x7f4b0c41e400) [pid = 2212] [serial = 2088] [outer = 0x7f4b09e5e000] 14:04:14 INFO - ++DOCSHELL 0x7f4b1276c800 == 21 [pid = 2212] [id = 862] 14:04:14 INFO - ++DOMWINDOW == 50 (0x7f4b0c8f9000) [pid = 2212] [serial = 2089] [outer = (nil)] 14:04:14 INFO - ++DOMWINDOW == 51 (0x7f4b0f70c400) [pid = 2212] [serial = 2090] [outer = 0x7f4b0c8f9000] 14:04:15 INFO - ++DOMWINDOW == 52 (0x7f4b0fb81c00) [pid = 2212] [serial = 2091] [outer = 0x7f4b0c8f9000] 14:04:15 INFO - ++DOCSHELL 0x7f4b1325a000 == 22 [pid = 2212] [id = 863] 14:04:15 INFO - ++DOMWINDOW == 53 (0x7f4b0fbae800) [pid = 2212] [serial = 2092] [outer = (nil)] 14:04:15 INFO - ++DOMWINDOW == 54 (0x7f4b12148800) [pid = 2212] [serial = 2093] [outer = 0x7f4b0fbae800] 14:04:18 INFO - --DOCSHELL 0x7f4afcec5000 == 21 [pid = 2212] [id = 849] 14:04:18 INFO - --DOCSHELL 0x7f4afce89000 == 20 [pid = 2212] [id = 847] 14:04:18 INFO - --DOCSHELL 0x7f4afce7a000 == 19 [pid = 2212] [id = 853] 14:04:18 INFO - --DOCSHELL 0x7f4aff21f000 == 18 [pid = 2212] [id = 848] 14:04:18 INFO - --DOCSHELL 0x7f4afce7c000 == 17 [pid = 2212] [id = 855] 14:04:18 INFO - --DOCSHELL 0x7f4b07d87000 == 16 [pid = 2212] [id = 856] 14:04:18 INFO - --DOCSHELL 0x7f4b0fa2e000 == 15 [pid = 2212] [id = 857] 14:04:18 INFO - --DOCSHELL 0x7f4afdc1d000 == 14 [pid = 2212] [id = 858] 14:04:18 INFO - --DOCSHELL 0x7f4b10bcb000 == 13 [pid = 2212] [id = 859] 14:04:18 INFO - --DOCSHELL 0x7f4b1325a000 == 12 [pid = 2212] [id = 863] 14:04:18 INFO - --DOMWINDOW == 53 (0x7f4afe817400) [pid = 2212] [serial = 2049] [outer = (nil)] [url = about:blank] 14:04:18 INFO - --DOMWINDOW == 52 (0x7f4afe0b2400) [pid = 2212] [serial = 2047] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:04:18 INFO - --DOMWINDOW == 51 (0x7f4afcf29c00) [pid = 2212] [serial = 2068] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:04:19 INFO - --DOMWINDOW == 50 (0x7f4afe553c00) [pid = 2212] [serial = 2065] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul] 14:04:19 INFO - --DOMWINDOW == 49 (0x7f4afde66000) [pid = 2212] [serial = 2060] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:04:19 INFO - --DOMWINDOW == 48 (0x7f4afd947c00) [pid = 2212] [serial = 2058] [outer = (nil)] [url = data:text/html;charset=utf8,<p>hello] 14:04:19 INFO - --DOMWINDOW == 47 (0x7f4afcf27800) [pid = 2212] [serial = 2056] [outer = (nil)] [url = about:blank] 14:04:19 INFO - --DOMWINDOW == 46 (0x7f4afe0b2c00) [pid = 2212] [serial = 2074] [outer = (nil)] [url = about:blank] 14:04:19 INFO - --DOMWINDOW == 45 (0x7f4afd039800) [pid = 2212] [serial = 2070] [outer = (nil)] [url = about:blank] 14:04:19 INFO - --DOMWINDOW == 44 (0x7f4afc864c00) [pid = 2212] [serial = 2069] [outer = (nil)] [url = about:blank] 14:04:19 INFO - --DOMWINDOW == 43 (0x7f4b07a0f000) [pid = 2212] [serial = 2078] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:04:19 INFO - --DOMWINDOW == 42 (0x7f4afe8c1c00) [pid = 2212] [serial = 2063] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:04:19 INFO - --DOMWINDOW == 41 (0x7f4afde61000) [pid = 2212] [serial = 2059] [outer = (nil)] [url = about:blank] 14:04:19 INFO - --DOMWINDOW == 40 (0x7f4afd036000) [pid = 2212] [serial = 2057] [outer = (nil)] [url = about:blank] 14:04:19 INFO - --DOMWINDOW == 39 (0x7f4b0a03e400) [pid = 2212] [serial = 2087] [outer = (nil)] [url = about:blank] 14:04:19 INFO - --DOMWINDOW == 38 (0x7f4b0f70c400) [pid = 2212] [serial = 2090] [outer = (nil)] [url = about:blank] 14:04:19 INFO - MEMORY STAT | vsize 1178MB | residentFast 320MB | heapAllocated 127MB 14:04:19 INFO - 386 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_js_input_expansion.js | took 5319ms 14:04:19 INFO - ++DOCSHELL 0x7f4afce8f800 == 13 [pid = 2212] [id = 864] 14:04:19 INFO - ++DOMWINDOW == 39 (0x7f4afc863c00) [pid = 2212] [serial = 2094] [outer = (nil)] 14:04:19 INFO - ++DOMWINDOW == 40 (0x7f4afcf29c00) [pid = 2212] [serial = 2095] [outer = 0x7f4afc863c00] 14:04:19 INFO - 387 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_jsterm.js 14:04:19 INFO - ++DOCSHELL 0x7f4afe3ab800 == 14 [pid = 2212] [id = 865] 14:04:19 INFO - ++DOMWINDOW == 41 (0x7f4afd3ac400) [pid = 2212] [serial = 2096] [outer = (nil)] 14:04:19 INFO - ++DOMWINDOW == 42 (0x7f4afd947c00) [pid = 2212] [serial = 2097] [outer = 0x7f4afd3ac400] 14:04:19 INFO - ++DOMWINDOW == 43 (0x7f4afe012c00) [pid = 2212] [serial = 2098] [outer = 0x7f4afd3ac400] 14:04:20 INFO - ++DOCSHELL 0x7f4afe4f8000 == 15 [pid = 2212] [id = 866] 14:04:20 INFO - ++DOMWINDOW == 44 (0x7f4afe0b3000) [pid = 2212] [serial = 2099] [outer = (nil)] 14:04:20 INFO - ++DOMWINDOW == 45 (0x7f4afe1f1c00) [pid = 2212] [serial = 2100] [outer = 0x7f4afe0b3000] 14:04:20 INFO - ++DOMWINDOW == 46 (0x7f4afe54f400) [pid = 2212] [serial = 2101] [outer = 0x7f4afe0b3000] 14:04:20 INFO - ++DOCSHELL 0x7f4b094aa800 == 16 [pid = 2212] [id = 867] 14:04:20 INFO - ++DOMWINDOW == 47 (0x7f4afe8ac800) [pid = 2212] [serial = 2102] [outer = (nil)] 14:04:20 INFO - ++DOMWINDOW == 48 (0x7f4afe8c1c00) [pid = 2212] [serial = 2103] [outer = 0x7f4afe8ac800] 14:04:27 INFO - --DOCSHELL 0x7f4afe3ae800 == 15 [pid = 2212] [id = 854] 14:04:27 INFO - --DOCSHELL 0x7f4afe4f8000 == 14 [pid = 2212] [id = 866] 14:04:27 INFO - --DOCSHELL 0x7f4b094aa800 == 13 [pid = 2212] [id = 867] 14:04:27 INFO - --DOCSHELL 0x7f4b1276c800 == 12 [pid = 2212] [id = 862] 14:04:27 INFO - --DOCSHELL 0x7f4b11d14000 == 11 [pid = 2212] [id = 860] 14:04:27 INFO - --DOCSHELL 0x7f4afce91800 == 10 [pid = 2212] [id = 861] 14:04:27 INFO - --DOMWINDOW == 47 (0x7f4afe553400) [pid = 2212] [serial = 2062] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:04:27 INFO - --DOMWINDOW == 46 (0x7f4afe8c5c00) [pid = 2212] [serial = 2064] [outer = (nil)] [url = about:blank] 14:04:27 INFO - --DOMWINDOW == 45 (0x7f4b09524400) [pid = 2212] [serial = 2066] [outer = (nil)] [url = about:blank] 14:04:27 INFO - --DOMWINDOW == 44 (0x7f4afcf2a400) [pid = 2212] [serial = 2079] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:04:27 INFO - --DOMWINDOW == 43 (0x7f4b0c8f9000) [pid = 2212] [serial = 2089] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:04:27 INFO - --DOMWINDOW == 42 (0x7f4b09bfb400) [pid = 2212] [serial = 2082] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:04:27 INFO - --DOMWINDOW == 41 (0x7f4afd942400) [pid = 2212] [serial = 2080] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:04:27 INFO - --DOMWINDOW == 40 (0x7f4afde68400) [pid = 2212] [serial = 2073] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:04:27 INFO - --DOMWINDOW == 39 (0x7f4afd94e400) [pid = 2212] [serial = 2071] [outer = (nil)] [url = data:text/html;charset=utf8,browser_webconsole_inspect-parsed-documents.js] 14:04:27 INFO - --DOMWINDOW == 38 (0x7f4b0fbae800) [pid = 2212] [serial = 2092] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:04:27 INFO - --DOMWINDOW == 37 (0x7f4afe8a7800) [pid = 2212] [serial = 2076] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:04:27 INFO - --DOMWINDOW == 36 (0x7f4aff420800) [pid = 2212] [serial = 2084] [outer = (nil)] [url = about:blank] 14:04:27 INFO - --DOMWINDOW == 35 (0x7f4b09e5e000) [pid = 2212] [serial = 2086] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:04:27 INFO - --DOMWINDOW == 34 (0x7f4b00f26800) [pid = 2212] [serial = 2085] [outer = (nil)] [url = about:blank] 14:04:27 INFO - --DOMWINDOW == 33 (0x7f4afd947c00) [pid = 2212] [serial = 2097] [outer = (nil)] [url = about:blank] 14:04:27 INFO - --DOMWINDOW == 32 (0x7f4afe1f1c00) [pid = 2212] [serial = 2100] [outer = (nil)] [url = about:blank] 14:04:27 INFO - --DOMWINDOW == 31 (0x7f4b0c41e400) [pid = 2212] [serial = 2088] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:04:28 INFO - MEMORY STAT | vsize 1177MB | residentFast 318MB | heapAllocated 124MB 14:04:28 INFO - 388 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_jsterm.js | took 8283ms 14:04:28 INFO - ++DOCSHELL 0x7f4afce92800 == 11 [pid = 2212] [id = 868] 14:04:28 INFO - ++DOMWINDOW == 32 (0x7f4afd342800) [pid = 2212] [serial = 2104] [outer = (nil)] 14:04:28 INFO - ++DOMWINDOW == 33 (0x7f4afd3b2000) [pid = 2212] [serial = 2105] [outer = 0x7f4afd342800] 14:04:28 INFO - 389 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_live_filtering_of_message_types.js 14:04:28 INFO - ++DOCSHELL 0x7f4aff222800 == 12 [pid = 2212] [id = 869] 14:04:28 INFO - ++DOMWINDOW == 34 (0x7f4afd33d800) [pid = 2212] [serial = 2106] [outer = (nil)] 14:04:28 INFO - ++DOMWINDOW == 35 (0x7f4afe009400) [pid = 2212] [serial = 2107] [outer = 0x7f4afd33d800] 14:04:28 INFO - ++DOMWINDOW == 36 (0x7f4afe0afc00) [pid = 2212] [serial = 2108] [outer = 0x7f4afd33d800] 14:04:28 INFO - ++DOCSHELL 0x7f4afce7f000 == 13 [pid = 2212] [id = 870] 14:04:28 INFO - ++DOMWINDOW == 37 (0x7f4afe4be800) [pid = 2212] [serial = 2109] [outer = (nil)] 14:04:28 INFO - ++DOMWINDOW == 38 (0x7f4afe544c00) [pid = 2212] [serial = 2110] [outer = 0x7f4afe4be800] 14:04:28 INFO - ++DOMWINDOW == 39 (0x7f4afe814800) [pid = 2212] [serial = 2111] [outer = 0x7f4afe4be800] 14:04:29 INFO - ++DOCSHELL 0x7f4b0c398800 == 14 [pid = 2212] [id = 871] 14:04:29 INFO - ++DOMWINDOW == 40 (0x7f4afe8ba400) [pid = 2212] [serial = 2112] [outer = (nil)] 14:04:29 INFO - ++DOMWINDOW == 41 (0x7f4afe8bcc00) [pid = 2212] [serial = 2113] [outer = 0x7f4afe8ba400] 14:04:32 INFO - --DOCSHELL 0x7f4afce8f800 == 13 [pid = 2212] [id = 864] 14:04:32 INFO - --DOCSHELL 0x7f4afce7f000 == 12 [pid = 2212] [id = 870] 14:04:32 INFO - --DOCSHELL 0x7f4b0c398800 == 11 [pid = 2212] [id = 871] 14:04:32 INFO - --DOCSHELL 0x7f4afe3ab800 == 10 [pid = 2212] [id = 865] 14:04:33 INFO - --DOMWINDOW == 40 (0x7f4afe4c7000) [pid = 2212] [serial = 2075] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:04:33 INFO - --DOMWINDOW == 39 (0x7f4afe8a9c00) [pid = 2212] [serial = 2077] [outer = (nil)] [url = about:blank] 14:04:33 INFO - --DOMWINDOW == 38 (0x7f4b0fb81c00) [pid = 2212] [serial = 2091] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:04:33 INFO - --DOMWINDOW == 37 (0x7f4b12148800) [pid = 2212] [serial = 2093] [outer = (nil)] [url = about:blank] 14:04:33 INFO - --DOMWINDOW == 36 (0x7f4afde64000) [pid = 2212] [serial = 2072] [outer = (nil)] [url = about:blank] 14:04:33 INFO - --DOMWINDOW == 35 (0x7f4b012dfc00) [pid = 2212] [serial = 2083] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:04:33 INFO - --DOMWINDOW == 34 (0x7f4afd949000) [pid = 2212] [serial = 2081] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:04:33 INFO - --DOMWINDOW == 33 (0x7f4afe8ac800) [pid = 2212] [serial = 2102] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:04:33 INFO - --DOMWINDOW == 32 (0x7f4afc863c00) [pid = 2212] [serial = 2094] [outer = (nil)] [url = about:blank] 14:04:33 INFO - --DOMWINDOW == 31 (0x7f4afd3ac400) [pid = 2212] [serial = 2096] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:04:33 INFO - --DOMWINDOW == 30 (0x7f4afe0b3000) [pid = 2212] [serial = 2099] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:04:33 INFO - --DOMWINDOW == 29 (0x7f4afcf29c00) [pid = 2212] [serial = 2095] [outer = (nil)] [url = about:blank] 14:04:33 INFO - --DOMWINDOW == 28 (0x7f4afe009400) [pid = 2212] [serial = 2107] [outer = (nil)] [url = about:blank] 14:04:33 INFO - --DOMWINDOW == 27 (0x7f4afe544c00) [pid = 2212] [serial = 2110] [outer = (nil)] [url = about:blank] 14:04:33 INFO - --DOMWINDOW == 26 (0x7f4afe012c00) [pid = 2212] [serial = 2098] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:04:33 INFO - MEMORY STAT | vsize 1172MB | residentFast 308MB | heapAllocated 120MB 14:04:33 INFO - 390 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_live_filtering_of_message_types.js | took 5283ms 14:04:33 INFO - ++DOCSHELL 0x7f4afcec9800 == 11 [pid = 2212] [id = 872] 14:04:33 INFO - ++DOMWINDOW == 27 (0x7f4afcf23000) [pid = 2212] [serial = 2114] [outer = (nil)] 14:04:33 INFO - ++DOMWINDOW == 28 (0x7f4afcf2a400) [pid = 2212] [serial = 2115] [outer = 0x7f4afcf23000] 14:04:33 INFO - 391 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_live_filtering_on_search_strings.js 14:04:33 INFO - ++DOCSHELL 0x7f4aff20d800 == 12 [pid = 2212] [id = 873] 14:04:33 INFO - ++DOMWINDOW == 29 (0x7f4afd945800) [pid = 2212] [serial = 2116] [outer = (nil)] 14:04:33 INFO - ++DOMWINDOW == 30 (0x7f4afd951800) [pid = 2212] [serial = 2117] [outer = 0x7f4afd945800] 14:04:33 INFO - ++DOMWINDOW == 31 (0x7f4afe012000) [pid = 2212] [serial = 2118] [outer = 0x7f4afd945800] 14:04:34 INFO - ++DOCSHELL 0x7f4afce8f000 == 13 [pid = 2212] [id = 874] 14:04:34 INFO - ++DOMWINDOW == 32 (0x7f4afe3d6400) [pid = 2212] [serial = 2119] [outer = (nil)] 14:04:34 INFO - ++DOMWINDOW == 33 (0x7f4afe3dc400) [pid = 2212] [serial = 2120] [outer = 0x7f4afe3d6400] 14:04:34 INFO - ++DOMWINDOW == 34 (0x7f4afe550c00) [pid = 2212] [serial = 2121] [outer = 0x7f4afe3d6400] 14:04:34 INFO - ++DOCSHELL 0x7f4b0c00c000 == 14 [pid = 2212] [id = 875] 14:04:34 INFO - ++DOMWINDOW == 35 (0x7f4afe8abc00) [pid = 2212] [serial = 2122] [outer = (nil)] 14:04:34 INFO - ++DOMWINDOW == 36 (0x7f4afe8ae800) [pid = 2212] [serial = 2123] [outer = 0x7f4afe8abc00] 14:04:38 INFO - --DOCSHELL 0x7f4afce8f000 == 13 [pid = 2212] [id = 874] 14:04:38 INFO - --DOCSHELL 0x7f4b0c00c000 == 12 [pid = 2212] [id = 875] 14:04:38 INFO - --DOCSHELL 0x7f4aff222800 == 11 [pid = 2212] [id = 869] 14:04:38 INFO - --DOCSHELL 0x7f4afce92800 == 10 [pid = 2212] [id = 868] 14:04:38 INFO - --DOMWINDOW == 35 (0x7f4afe8c1c00) [pid = 2212] [serial = 2103] [outer = (nil)] [url = about:blank] 14:04:38 INFO - --DOMWINDOW == 34 (0x7f4afe54f400) [pid = 2212] [serial = 2101] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:04:39 INFO - --DOMWINDOW == 33 (0x7f4afe4be800) [pid = 2212] [serial = 2109] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:04:39 INFO - --DOMWINDOW == 32 (0x7f4afe3dc400) [pid = 2212] [serial = 2120] [outer = (nil)] [url = about:blank] 14:04:39 INFO - --DOMWINDOW == 31 (0x7f4afe8ba400) [pid = 2212] [serial = 2112] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:04:39 INFO - --DOMWINDOW == 30 (0x7f4afd33d800) [pid = 2212] [serial = 2106] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:04:39 INFO - --DOMWINDOW == 29 (0x7f4afd342800) [pid = 2212] [serial = 2104] [outer = (nil)] [url = about:blank] 14:04:39 INFO - --DOMWINDOW == 28 (0x7f4afd951800) [pid = 2212] [serial = 2117] [outer = (nil)] [url = about:blank] 14:04:39 INFO - --DOMWINDOW == 27 (0x7f4afd3b2000) [pid = 2212] [serial = 2105] [outer = (nil)] [url = about:blank] 14:04:39 INFO - --DOMWINDOW == 26 (0x7f4afe0afc00) [pid = 2212] [serial = 2108] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:04:39 INFO - MEMORY STAT | vsize 1172MB | residentFast 303MB | heapAllocated 120MB 14:04:39 INFO - 392 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_live_filtering_on_search_strings.js | took 5627ms 14:04:39 INFO - ++DOCSHELL 0x7f4afcebd800 == 11 [pid = 2212] [id = 876] 14:04:39 INFO - ++DOMWINDOW == 27 (0x7f4afcf27800) [pid = 2212] [serial = 2124] [outer = (nil)] 14:04:39 INFO - ++DOMWINDOW == 28 (0x7f4afd33ec00) [pid = 2212] [serial = 2125] [outer = 0x7f4afcf27800] 14:04:39 INFO - 393 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_log_file_filter.js 14:04:39 INFO - ++DOCSHELL 0x7f4aff219000 == 12 [pid = 2212] [id = 877] 14:04:39 INFO - ++DOMWINDOW == 29 (0x7f4afd951c00) [pid = 2212] [serial = 2126] [outer = (nil)] 14:04:39 INFO - ++DOMWINDOW == 30 (0x7f4afde66000) [pid = 2212] [serial = 2127] [outer = 0x7f4afd951c00] 14:04:40 INFO - ++DOMWINDOW == 31 (0x7f4aff423800) [pid = 2212] [serial = 2128] [outer = 0x7f4afd951c00] 14:04:40 INFO - ++DOCSHELL 0x7f4afce8b800 == 13 [pid = 2212] [id = 878] 14:04:40 INFO - ++DOMWINDOW == 32 (0x7f4afe010c00) [pid = 2212] [serial = 2129] [outer = (nil)] 14:04:40 INFO - ++DOMWINDOW == 33 (0x7f4afe0a8800) [pid = 2212] [serial = 2130] [outer = 0x7f4afe010c00] 14:04:40 INFO - ++DOMWINDOW == 34 (0x7f4afe3d8800) [pid = 2212] [serial = 2131] [outer = 0x7f4afe010c00] 14:04:41 INFO - ++DOCSHELL 0x7f4b0a7c2800 == 14 [pid = 2212] [id = 879] 14:04:41 INFO - ++DOMWINDOW == 35 (0x7f4afe81b800) [pid = 2212] [serial = 2132] [outer = (nil)] 14:04:41 INFO - ++DOMWINDOW == 36 (0x7f4afe8a3c00) [pid = 2212] [serial = 2133] [outer = 0x7f4afe81b800] 14:04:44 INFO - --DOCSHELL 0x7f4afcec9800 == 13 [pid = 2212] [id = 872] 14:04:44 INFO - --DOCSHELL 0x7f4aff20d800 == 12 [pid = 2212] [id = 873] 14:04:44 INFO - --DOCSHELL 0x7f4b0a7c2800 == 11 [pid = 2212] [id = 879] 14:04:44 INFO - --DOMWINDOW == 35 (0x7f4afe8bcc00) [pid = 2212] [serial = 2113] [outer = (nil)] [url = about:blank] 14:04:44 INFO - --DOMWINDOW == 34 (0x7f4afe814800) [pid = 2212] [serial = 2111] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:04:44 INFO - --DOMWINDOW == 33 (0x7f4afd945800) [pid = 2212] [serial = 2116] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:04:44 INFO - --DOMWINDOW == 32 (0x7f4afe3d6400) [pid = 2212] [serial = 2119] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:04:44 INFO - --DOMWINDOW == 31 (0x7f4afde66000) [pid = 2212] [serial = 2127] [outer = (nil)] [url = about:blank] 14:04:44 INFO - --DOMWINDOW == 30 (0x7f4afe0a8800) [pid = 2212] [serial = 2130] [outer = (nil)] [url = about:blank] 14:04:44 INFO - --DOMWINDOW == 29 (0x7f4afcf2a400) [pid = 2212] [serial = 2115] [outer = (nil)] [url = about:blank] 14:04:44 INFO - --DOMWINDOW == 28 (0x7f4afcf23000) [pid = 2212] [serial = 2114] [outer = (nil)] [url = about:blank] 14:04:44 INFO - --DOMWINDOW == 27 (0x7f4afe8abc00) [pid = 2212] [serial = 2122] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:04:44 INFO - --DOMWINDOW == 26 (0x7f4afe012000) [pid = 2212] [serial = 2118] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:04:44 INFO - MEMORY STAT | vsize 1174MB | residentFast 306MB | heapAllocated 120MB 14:04:44 INFO - 394 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_log_file_filter.js | took 5214ms 14:04:44 INFO - ++DOCSHELL 0x7f4afce94000 == 12 [pid = 2212] [id = 880] 14:04:44 INFO - ++DOMWINDOW == 27 (0x7f4afc868400) [pid = 2212] [serial = 2134] [outer = (nil)] 14:04:44 INFO - ++DOMWINDOW == 28 (0x7f4afd340800) [pid = 2212] [serial = 2135] [outer = 0x7f4afc868400] 14:04:45 INFO - 395 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_message_node_id.js 14:04:45 INFO - ++DOCSHELL 0x7f4aff27f000 == 13 [pid = 2212] [id = 881] 14:04:45 INFO - ++DOMWINDOW == 29 (0x7f4afde5f400) [pid = 2212] [serial = 2136] [outer = (nil)] 14:04:45 INFO - ++DOMWINDOW == 30 (0x7f4afde6ac00) [pid = 2212] [serial = 2137] [outer = 0x7f4afde5f400] 14:04:45 INFO - ++DOMWINDOW == 31 (0x7f4afe0b0c00) [pid = 2212] [serial = 2138] [outer = 0x7f4afde5f400] 14:04:45 INFO - ++DOCSHELL 0x7f4afce94800 == 14 [pid = 2212] [id = 882] 14:04:45 INFO - ++DOMWINDOW == 32 (0x7f4afe3dc400) [pid = 2212] [serial = 2139] [outer = (nil)] 14:04:45 INFO - ++DOMWINDOW == 33 (0x7f4afe3e4400) [pid = 2212] [serial = 2140] [outer = 0x7f4afe3dc400] 14:04:45 INFO - ++DOMWINDOW == 34 (0x7f4afe816000) [pid = 2212] [serial = 2141] [outer = 0x7f4afe3dc400] 14:04:45 INFO - ++DOCSHELL 0x7f4b0c676800 == 15 [pid = 2212] [id = 883] 14:04:45 INFO - ++DOMWINDOW == 35 (0x7f4aff338400) [pid = 2212] [serial = 2142] [outer = (nil)] 14:04:45 INFO - ++DOMWINDOW == 36 (0x7f4aff33c000) [pid = 2212] [serial = 2143] [outer = 0x7f4aff338400] 14:04:48 INFO - --DOCSHELL 0x7f4afcebd800 == 14 [pid = 2212] [id = 876] 14:04:48 INFO - --DOCSHELL 0x7f4aff219000 == 13 [pid = 2212] [id = 877] 14:04:48 INFO - --DOCSHELL 0x7f4b0c676800 == 12 [pid = 2212] [id = 883] 14:04:48 INFO - --DOCSHELL 0x7f4afce8b800 == 11 [pid = 2212] [id = 878] 14:04:48 INFO - --DOMWINDOW == 35 (0x7f4afe8ae800) [pid = 2212] [serial = 2123] [outer = (nil)] [url = about:blank] 14:04:48 INFO - --DOMWINDOW == 34 (0x7f4afe550c00) [pid = 2212] [serial = 2121] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:04:49 INFO - --DOMWINDOW == 33 (0x7f4afde6ac00) [pid = 2212] [serial = 2137] [outer = (nil)] [url = about:blank] 14:04:49 INFO - --DOMWINDOW == 32 (0x7f4afd33ec00) [pid = 2212] [serial = 2125] [outer = (nil)] [url = about:blank] 14:04:49 INFO - --DOMWINDOW == 31 (0x7f4afe3e4400) [pid = 2212] [serial = 2140] [outer = (nil)] [url = about:blank] 14:04:49 INFO - --DOMWINDOW == 30 (0x7f4afe81b800) [pid = 2212] [serial = 2132] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:04:49 INFO - --DOMWINDOW == 29 (0x7f4afe010c00) [pid = 2212] [serial = 2129] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:04:49 INFO - --DOMWINDOW == 28 (0x7f4afd951c00) [pid = 2212] [serial = 2126] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_923281_console_log_filter.html] 14:04:49 INFO - --DOMWINDOW == 27 (0x7f4afcf27800) [pid = 2212] [serial = 2124] [outer = (nil)] [url = about:blank] 14:04:49 INFO - --DOMWINDOW == 26 (0x7f4aff423800) [pid = 2212] [serial = 2128] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-bug_923281_console_log_filter.html] 14:04:49 INFO - MEMORY STAT | vsize 1177MB | residentFast 307MB | heapAllocated 120MB 14:04:49 INFO - 396 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_message_node_id.js | took 4336ms 14:04:49 INFO - ++DOCSHELL 0x7f4afcec4800 == 12 [pid = 2212] [id = 884] 14:04:49 INFO - ++DOMWINDOW == 27 (0x7f4afcf26800) [pid = 2212] [serial = 2144] [outer = (nil)] 14:04:49 INFO - ++DOMWINDOW == 28 (0x7f4afd33b000) [pid = 2212] [serial = 2145] [outer = 0x7f4afcf26800] 14:04:49 INFO - 397 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_netlogging.js 14:04:49 INFO - ++DOCSHELL 0x7f4aff27d800 == 13 [pid = 2212] [id = 885] 14:04:49 INFO - ++DOMWINDOW == 29 (0x7f4afde5d800) [pid = 2212] [serial = 2146] [outer = (nil)] 14:04:49 INFO - ++DOMWINDOW == 30 (0x7f4afe00b000) [pid = 2212] [serial = 2147] [outer = 0x7f4afde5d800] 14:04:49 INFO - ++DOCSHELL 0x7f4b07c6e800 == 14 [pid = 2212] [id = 886] 14:04:49 INFO - ++DOMWINDOW == 31 (0x7f4afe00f000) [pid = 2212] [serial = 2148] [outer = (nil)] 14:04:49 INFO - ++DOMWINDOW == 32 (0x7f4afe3e2000) [pid = 2212] [serial = 2149] [outer = 0x7f4afe00f000] 14:04:50 INFO - ++DOMWINDOW == 33 (0x7f4afe81ac00) [pid = 2212] [serial = 2150] [outer = 0x7f4afe00f000] 14:04:50 INFO - ++DOCSHELL 0x7f4b0c3a4000 == 15 [pid = 2212] [id = 887] 14:04:50 INFO - ++DOMWINDOW == 34 (0x7f4aff334400) [pid = 2212] [serial = 2151] [outer = (nil)] 14:04:50 INFO - ++DOMWINDOW == 35 (0x7f4aff338c00) [pid = 2212] [serial = 2152] [outer = 0x7f4aff334400] 14:04:51 INFO - ++DOMWINDOW == 36 (0x7f4b07d64400) [pid = 2212] [serial = 2153] [outer = 0x7f4afde5d800] 14:04:51 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:04:52 INFO - ++DOMWINDOW == 37 (0x7f4b099c0400) [pid = 2212] [serial = 2154] [outer = 0x7f4afde5d800] 14:04:52 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:04:53 INFO - ++DOMWINDOW == 38 (0x7f4afe3e2c00) [pid = 2212] [serial = 2155] [outer = 0x7f4afde5d800] 14:04:53 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:04:53 INFO - ++DOCSHELL 0x7f4b07d87800 == 16 [pid = 2212] [id = 888] 14:04:53 INFO - ++DOMWINDOW == 39 (0x7f4aff22c800) [pid = 2212] [serial = 2156] [outer = (nil)] 14:04:53 INFO - ++DOMWINDOW == 40 (0x7f4aff333400) [pid = 2212] [serial = 2157] [outer = 0x7f4aff22c800] 14:04:54 INFO - ++DOCSHELL 0x7f4b0f7b8800 == 17 [pid = 2212] [id = 889] 14:04:54 INFO - ++DOMWINDOW == 41 (0x7f4b09e59800) [pid = 2212] [serial = 2158] [outer = (nil)] 14:04:54 INFO - ++DOMWINDOW == 42 (0x7f4afe1f5c00) [pid = 2212] [serial = 2159] [outer = 0x7f4b09e59800] 14:04:54 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:04:55 INFO - --DOCSHELL 0x7f4b0f7b8800 == 16 [pid = 2212] [id = 889] 14:04:56 INFO - --DOCSHELL 0x7f4aff27f000 == 15 [pid = 2212] [id = 881] 14:04:56 INFO - --DOCSHELL 0x7f4afce94800 == 14 [pid = 2212] [id = 882] 14:04:56 INFO - --DOCSHELL 0x7f4afce94000 == 13 [pid = 2212] [id = 880] 14:04:56 INFO - --DOCSHELL 0x7f4b0c3a4000 == 12 [pid = 2212] [id = 887] 14:04:56 INFO - --DOCSHELL 0x7f4b07d87800 == 11 [pid = 2212] [id = 888] 14:04:56 INFO - --DOMWINDOW == 41 (0x7f4afe3d8800) [pid = 2212] [serial = 2131] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:04:56 INFO - --DOMWINDOW == 40 (0x7f4afe8a3c00) [pid = 2212] [serial = 2133] [outer = (nil)] [url = about:blank] 14:04:56 INFO - --DOMWINDOW == 39 (0x7f4afe3dc400) [pid = 2212] [serial = 2139] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:04:56 INFO - --DOMWINDOW == 38 (0x7f4afc868400) [pid = 2212] [serial = 2134] [outer = (nil)] [url = about:blank] 14:04:56 INFO - --DOMWINDOW == 37 (0x7f4afde5f400) [pid = 2212] [serial = 2136] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:04:56 INFO - --DOMWINDOW == 36 (0x7f4afd340800) [pid = 2212] [serial = 2135] [outer = (nil)] [url = about:blank] 14:04:56 INFO - --DOMWINDOW == 35 (0x7f4afe3e2000) [pid = 2212] [serial = 2149] [outer = (nil)] [url = about:blank] 14:04:56 INFO - --DOMWINDOW == 34 (0x7f4b09e59800) [pid = 2212] [serial = 2158] [outer = (nil)] [url = about:blank] 14:04:56 INFO - --DOMWINDOW == 33 (0x7f4afe1f5c00) [pid = 2212] [serial = 2159] [outer = (nil)] [url = about:blank] 14:04:56 INFO - --DOMWINDOW == 32 (0x7f4aff338400) [pid = 2212] [serial = 2142] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:04:56 INFO - --DOMWINDOW == 31 (0x7f4b07d64400) [pid = 2212] [serial = 2153] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 14:04:56 INFO - --DOMWINDOW == 30 (0x7f4afe0b0c00) [pid = 2212] [serial = 2138] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:04:56 INFO - MEMORY STAT | vsize 1179MB | residentFast 311MB | heapAllocated 121MB 14:04:56 INFO - 398 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_netlogging.js | took 7302ms 14:04:56 INFO - ++DOCSHELL 0x7f4afcec2800 == 12 [pid = 2212] [id = 890] 14:04:56 INFO - ++DOMWINDOW == 31 (0x7f4afc864c00) [pid = 2212] [serial = 2160] [outer = (nil)] 14:04:56 INFO - ++DOMWINDOW == 32 (0x7f4afcf30400) [pid = 2212] [serial = 2161] [outer = 0x7f4afc864c00] 14:04:57 INFO - 399 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_netlogging_reset_filter.js 14:04:57 INFO - ++DOCSHELL 0x7f4aff2bd800 == 13 [pid = 2212] [id = 891] 14:04:57 INFO - ++DOMWINDOW == 33 (0x7f4afd94f400) [pid = 2212] [serial = 2162] [outer = (nil)] 14:04:57 INFO - ++DOMWINDOW == 34 (0x7f4afde61c00) [pid = 2212] [serial = 2163] [outer = 0x7f4afd94f400] 14:04:57 INFO - ++DOCSHELL 0x7f4afce89800 == 14 [pid = 2212] [id = 892] 14:04:57 INFO - ++DOMWINDOW == 35 (0x7f4afcf2a400) [pid = 2212] [serial = 2164] [outer = (nil)] 14:04:57 INFO - ++DOMWINDOW == 36 (0x7f4afe1f2000) [pid = 2212] [serial = 2165] [outer = 0x7f4afcf2a400] 14:04:57 INFO - ++DOMWINDOW == 37 (0x7f4afe570400) [pid = 2212] [serial = 2166] [outer = 0x7f4afcf2a400] 14:04:57 INFO - ++DOCSHELL 0x7f4b0c66b000 == 15 [pid = 2212] [id = 893] 14:04:57 INFO - ++DOMWINDOW == 38 (0x7f4afe8b6400) [pid = 2212] [serial = 2167] [outer = (nil)] 14:04:57 INFO - ++DOMWINDOW == 39 (0x7f4afe8b8c00) [pid = 2212] [serial = 2168] [outer = 0x7f4afe8b6400] 14:04:59 INFO - ++DOMWINDOW == 40 (0x7f4aff337400) [pid = 2212] [serial = 2169] [outer = 0x7f4afd94f400] 14:04:59 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:05:00 INFO - ++DOCSHELL 0x7f4b10ad4000 == 16 [pid = 2212] [id = 894] 14:05:00 INFO - ++DOMWINDOW == 41 (0x7f4afe576000) [pid = 2212] [serial = 2170] [outer = (nil)] 14:05:00 INFO - ++DOMWINDOW == 42 (0x7f4b09846400) [pid = 2212] [serial = 2171] [outer = 0x7f4afe576000] 14:05:00 INFO - ++DOCSHELL 0x7f4afdc0c000 == 17 [pid = 2212] [id = 895] 14:05:00 INFO - ++DOMWINDOW == 43 (0x7f4afe4c2c00) [pid = 2212] [serial = 2172] [outer = (nil)] 14:05:00 INFO - ++DOMWINDOW == 44 (0x7f4afcf30000) [pid = 2212] [serial = 2173] [outer = 0x7f4afe4c2c00] 14:05:01 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:05:01 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:05:01 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:05:01 INFO - --DOCSHELL 0x7f4afdc0c000 == 16 [pid = 2212] [id = 895] 14:05:03 INFO - --DOCSHELL 0x7f4aff27d800 == 15 [pid = 2212] [id = 885] 14:05:03 INFO - --DOCSHELL 0x7f4b07c6e800 == 14 [pid = 2212] [id = 886] 14:05:03 INFO - --DOCSHELL 0x7f4b0c66b000 == 13 [pid = 2212] [id = 893] 14:05:03 INFO - --DOCSHELL 0x7f4afcec4800 == 12 [pid = 2212] [id = 884] 14:05:03 INFO - --DOCSHELL 0x7f4b10ad4000 == 11 [pid = 2212] [id = 894] 14:05:03 INFO - --DOMWINDOW == 43 (0x7f4afe816000) [pid = 2212] [serial = 2141] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:05:03 INFO - --DOMWINDOW == 42 (0x7f4aff33c000) [pid = 2212] [serial = 2143] [outer = (nil)] [url = about:blank] 14:05:03 INFO - --DOMWINDOW == 41 (0x7f4aff334400) [pid = 2212] [serial = 2151] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:05:03 INFO - --DOMWINDOW == 40 (0x7f4afe00f000) [pid = 2212] [serial = 2148] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:05:03 INFO - --DOMWINDOW == 39 (0x7f4afcf26800) [pid = 2212] [serial = 2144] [outer = (nil)] [url = about:blank] 14:05:03 INFO - --DOMWINDOW == 38 (0x7f4afde5d800) [pid = 2212] [serial = 2146] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 14:05:03 INFO - --DOMWINDOW == 37 (0x7f4aff22c800) [pid = 2212] [serial = 2156] [outer = (nil)] [url = chrome://devtools/content/netmonitor/netmonitor.xul] 14:05:03 INFO - --DOMWINDOW == 36 (0x7f4afd33b000) [pid = 2212] [serial = 2145] [outer = (nil)] [url = about:blank] 14:05:03 INFO - --DOMWINDOW == 35 (0x7f4afe00b000) [pid = 2212] [serial = 2147] [outer = (nil)] [url = about:blank] 14:05:03 INFO - --DOMWINDOW == 34 (0x7f4afe1f2000) [pid = 2212] [serial = 2165] [outer = (nil)] [url = about:blank] 14:05:03 INFO - --DOMWINDOW == 33 (0x7f4afe4c2c00) [pid = 2212] [serial = 2172] [outer = (nil)] [url = about:blank] 14:05:03 INFO - --DOMWINDOW == 32 (0x7f4afcf30000) [pid = 2212] [serial = 2173] [outer = (nil)] [url = about:blank] 14:05:03 INFO - --DOMWINDOW == 31 (0x7f4b099c0400) [pid = 2212] [serial = 2154] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 14:05:03 INFO - --DOMWINDOW == 30 (0x7f4afe3e2c00) [pid = 2212] [serial = 2155] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 14:05:03 INFO - MEMORY STAT | vsize 1179MB | residentFast 311MB | heapAllocated 122MB 14:05:03 INFO - 400 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_netlogging_reset_filter.js | took 6830ms 14:05:03 INFO - ++DOCSHELL 0x7f4afced4000 == 12 [pid = 2212] [id = 896] 14:05:03 INFO - ++DOMWINDOW == 31 (0x7f4afcf27c00) [pid = 2212] [serial = 2174] [outer = (nil)] 14:05:03 INFO - ++DOMWINDOW == 32 (0x7f4afd3ae400) [pid = 2212] [serial = 2175] [outer = 0x7f4afcf27c00] 14:05:04 INFO - 401 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_notifications.js 14:05:04 INFO - ++DOCSHELL 0x7f4b01764000 == 13 [pid = 2212] [id = 897] 14:05:04 INFO - ++DOMWINDOW == 33 (0x7f4afe009400) [pid = 2212] [serial = 2176] [outer = (nil)] 14:05:04 INFO - ++DOMWINDOW == 34 (0x7f4afe012c00) [pid = 2212] [serial = 2177] [outer = 0x7f4afe009400] 14:05:04 INFO - ++DOCSHELL 0x7f4b094ab800 == 14 [pid = 2212] [id = 898] 14:05:04 INFO - ++DOMWINDOW == 35 (0x7f4afc720800) [pid = 2212] [serial = 2178] [outer = (nil)] 14:05:04 INFO - ++DOMWINDOW == 36 (0x7f4afe4be000) [pid = 2212] [serial = 2179] [outer = 0x7f4afc720800] 14:05:04 INFO - ++DOMWINDOW == 37 (0x7f4afe816400) [pid = 2212] [serial = 2180] [outer = 0x7f4afc720800] 14:05:04 INFO - ++DOCSHELL 0x7f4b0c832800 == 15 [pid = 2212] [id = 899] 14:05:04 INFO - ++DOMWINDOW == 38 (0x7f4afe8bb400) [pid = 2212] [serial = 2181] [outer = (nil)] 14:05:04 INFO - ++DOMWINDOW == 39 (0x7f4afe8be800) [pid = 2212] [serial = 2182] [outer = 0x7f4afe8bb400] 14:05:07 INFO - --DOCSHELL 0x7f4afcec2800 == 14 [pid = 2212] [id = 890] 14:05:07 INFO - --DOCSHELL 0x7f4aff2bd800 == 13 [pid = 2212] [id = 891] 14:05:07 INFO - --DOCSHELL 0x7f4b0c832800 == 12 [pid = 2212] [id = 899] 14:05:07 INFO - --DOCSHELL 0x7f4afce89800 == 11 [pid = 2212] [id = 892] 14:05:07 INFO - --DOMWINDOW == 38 (0x7f4aff333400) [pid = 2212] [serial = 2157] [outer = (nil)] [url = about:blank] 14:05:07 INFO - --DOMWINDOW == 37 (0x7f4aff338c00) [pid = 2212] [serial = 2152] [outer = (nil)] [url = about:blank] 14:05:07 INFO - --DOMWINDOW == 36 (0x7f4afe81ac00) [pid = 2212] [serial = 2150] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:05:07 INFO - --DOMWINDOW == 35 (0x7f4afde61c00) [pid = 2212] [serial = 2163] [outer = (nil)] [url = about:blank] 14:05:07 INFO - --DOMWINDOW == 34 (0x7f4afcf30400) [pid = 2212] [serial = 2161] [outer = (nil)] [url = about:blank] 14:05:07 INFO - --DOMWINDOW == 33 (0x7f4afe4be000) [pid = 2212] [serial = 2179] [outer = (nil)] [url = about:blank] 14:05:07 INFO - --DOMWINDOW == 32 (0x7f4afcf2a400) [pid = 2212] [serial = 2164] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:05:07 INFO - --DOMWINDOW == 31 (0x7f4afe8b6400) [pid = 2212] [serial = 2167] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:05:07 INFO - --DOMWINDOW == 30 (0x7f4afd94f400) [pid = 2212] [serial = 2162] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html] 14:05:07 INFO - --DOMWINDOW == 29 (0x7f4afc864c00) [pid = 2212] [serial = 2160] [outer = (nil)] [url = about:blank] 14:05:07 INFO - --DOMWINDOW == 28 (0x7f4afe576000) [pid = 2212] [serial = 2170] [outer = (nil)] [url = chrome://devtools/content/netmonitor/netmonitor.xul] 14:05:07 INFO - --DOMWINDOW == 27 (0x7f4aff337400) [pid = 2212] [serial = 2169] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network.html] 14:05:08 INFO - MEMORY STAT | vsize 1179MB | residentFast 310MB | heapAllocated 121MB 14:05:08 INFO - 402 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_notifications.js | took 3910ms 14:05:08 INFO - ++DOCSHELL 0x7f4afcec5000 == 12 [pid = 2212] [id = 900] 14:05:08 INFO - ++DOMWINDOW == 28 (0x7f4afcf24c00) [pid = 2212] [serial = 2183] [outer = (nil)] 14:05:08 INFO - ++DOMWINDOW == 29 (0x7f4afd33d800) [pid = 2212] [serial = 2184] [outer = 0x7f4afcf24c00] 14:05:08 INFO - 403 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_open-links-without-callback.js 14:05:08 INFO - ++DOCSHELL 0x7f4aff2bd800 == 13 [pid = 2212] [id = 901] 14:05:08 INFO - ++DOMWINDOW == 30 (0x7f4afde67000) [pid = 2212] [serial = 2185] [outer = (nil)] 14:05:08 INFO - ++DOMWINDOW == 31 (0x7f4afe009c00) [pid = 2212] [serial = 2186] [outer = 0x7f4afde67000] 14:05:08 INFO - ++DOMWINDOW == 32 (0x7f4afe1f4800) [pid = 2212] [serial = 2187] [outer = 0x7f4afde67000] 14:05:08 INFO - ++DOCSHELL 0x7f4afce87000 == 14 [pid = 2212] [id = 902] 14:05:08 INFO - ++DOMWINDOW == 33 (0x7f4afe4c2c00) [pid = 2212] [serial = 2188] [outer = (nil)] 14:05:08 INFO - ++DOMWINDOW == 34 (0x7f4afe548400) [pid = 2212] [serial = 2189] [outer = 0x7f4afe4c2c00] 14:05:08 INFO - ++DOMWINDOW == 35 (0x7f4afe81a400) [pid = 2212] [serial = 2190] [outer = 0x7f4afe4c2c00] 14:05:09 INFO - ++DOCSHELL 0x7f4b0f7bd000 == 15 [pid = 2212] [id = 903] 14:05:09 INFO - ++DOMWINDOW == 36 (0x7f4afe8bd400) [pid = 2212] [serial = 2191] [outer = (nil)] 14:05:09 INFO - ++DOMWINDOW == 37 (0x7f4afe8c0c00) [pid = 2212] [serial = 2192] [outer = 0x7f4afe8bd400] 14:05:12 INFO - --DOCSHELL 0x7f4b01764000 == 14 [pid = 2212] [id = 897] 14:05:12 INFO - --DOCSHELL 0x7f4b094ab800 == 13 [pid = 2212] [id = 898] 14:05:12 INFO - --DOCSHELL 0x7f4b0f7bd000 == 12 [pid = 2212] [id = 903] 14:05:12 INFO - --DOCSHELL 0x7f4afced4000 == 11 [pid = 2212] [id = 896] 14:05:12 INFO - --DOMWINDOW == 36 (0x7f4b09846400) [pid = 2212] [serial = 2171] [outer = (nil)] [url = about:blank] 14:05:12 INFO - --DOMWINDOW == 35 (0x7f4afe8b8c00) [pid = 2212] [serial = 2168] [outer = (nil)] [url = about:blank] 14:05:12 INFO - --DOMWINDOW == 34 (0x7f4afe570400) [pid = 2212] [serial = 2166] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:05:12 INFO - --DOMWINDOW == 33 (0x7f4afe009c00) [pid = 2212] [serial = 2186] [outer = (nil)] [url = about:blank] 14:05:12 INFO - --DOMWINDOW == 32 (0x7f4afe012c00) [pid = 2212] [serial = 2177] [outer = (nil)] [url = about:blank] 14:05:12 INFO - --DOMWINDOW == 31 (0x7f4afd3ae400) [pid = 2212] [serial = 2175] [outer = (nil)] [url = about:blank] 14:05:12 INFO - --DOMWINDOW == 30 (0x7f4afe548400) [pid = 2212] [serial = 2189] [outer = (nil)] [url = about:blank] 14:05:12 INFO - --DOMWINDOW == 29 (0x7f4afc720800) [pid = 2212] [serial = 2178] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:05:12 INFO - --DOMWINDOW == 28 (0x7f4afe8bb400) [pid = 2212] [serial = 2181] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:05:12 INFO - --DOMWINDOW == 27 (0x7f4afe009400) [pid = 2212] [serial = 2176] [outer = (nil)] [url = data:text/html;charset=utf-8,<p>Web%20Console%20test%20for%20notifications] 14:05:12 INFO - --DOMWINDOW == 26 (0x7f4afcf27c00) [pid = 2212] [serial = 2174] [outer = (nil)] [url = about:blank] 14:05:12 INFO - MEMORY STAT | vsize 1181MB | residentFast 312MB | heapAllocated 121MB 14:05:12 INFO - 404 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_open-links-without-callback.js | took 4443ms 14:05:12 INFO - ++DOCSHELL 0x7f4afcec7800 == 12 [pid = 2212] [id = 904] 14:05:12 INFO - ++DOMWINDOW == 27 (0x7f4afd037000) [pid = 2212] [serial = 2193] [outer = (nil)] 14:05:12 INFO - ++DOMWINDOW == 28 (0x7f4afd3ae400) [pid = 2212] [serial = 2194] [outer = 0x7f4afd037000] 14:05:12 INFO - 405 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_01.js 14:05:13 INFO - ++DOCSHELL 0x7f4aff28c800 == 13 [pid = 2212] [id = 905] 14:05:13 INFO - ++DOMWINDOW == 29 (0x7f4afcf2ac00) [pid = 2212] [serial = 2195] [outer = (nil)] 14:05:13 INFO - ++DOMWINDOW == 30 (0x7f4afe00a800) [pid = 2212] [serial = 2196] [outer = 0x7f4afcf2ac00] 14:05:13 INFO - ++DOCSHELL 0x7f4afce80800 == 14 [pid = 2212] [id = 906] 14:05:13 INFO - ++DOMWINDOW == 31 (0x7f4afe00e400) [pid = 2212] [serial = 2197] [outer = (nil)] 14:05:13 INFO - ++DOMWINDOW == 32 (0x7f4afe4bf400) [pid = 2212] [serial = 2198] [outer = 0x7f4afe00e400] 14:05:13 INFO - ++DOMWINDOW == 33 (0x7f4afe817400) [pid = 2212] [serial = 2199] [outer = 0x7f4afe00e400] 14:05:13 INFO - ++DOCSHELL 0x7f4b0c66e000 == 15 [pid = 2212] [id = 907] 14:05:13 INFO - ++DOMWINDOW == 34 (0x7f4afe8bf800) [pid = 2212] [serial = 2200] [outer = (nil)] 14:05:13 INFO - ++DOMWINDOW == 35 (0x7f4aff336c00) [pid = 2212] [serial = 2201] [outer = 0x7f4afe8bf800] 14:05:19 INFO - ++DOCSHELL 0x7f4b10acf000 == 16 [pid = 2212] [id = 908] 14:05:19 INFO - ++DOMWINDOW == 36 (0x7f4b0ac10800) [pid = 2212] [serial = 2202] [outer = (nil)] 14:05:19 INFO - ++DOMWINDOW == 37 (0x7f4b07d76000) [pid = 2212] [serial = 2203] [outer = 0x7f4b0ac10800] 14:05:21 INFO - --DOCSHELL 0x7f4afcec5000 == 15 [pid = 2212] [id = 900] 14:05:21 INFO - --DOCSHELL 0x7f4afce87000 == 14 [pid = 2212] [id = 902] 14:05:21 INFO - --DOCSHELL 0x7f4afce80800 == 13 [pid = 2212] [id = 906] 14:05:21 INFO - --DOCSHELL 0x7f4b0c66e000 == 12 [pid = 2212] [id = 907] 14:05:21 INFO - --DOCSHELL 0x7f4aff2bd800 == 11 [pid = 2212] [id = 901] 14:05:21 INFO - --DOCSHELL 0x7f4b10acf000 == 10 [pid = 2212] [id = 908] 14:05:21 INFO - --DOMWINDOW == 36 (0x7f4afe816400) [pid = 2212] [serial = 2180] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:05:21 INFO - --DOMWINDOW == 35 (0x7f4afe8be800) [pid = 2212] [serial = 2182] [outer = (nil)] [url = about:blank] 14:05:22 INFO - --DOMWINDOW == 34 (0x7f4afd33d800) [pid = 2212] [serial = 2184] [outer = (nil)] [url = about:blank] 14:05:22 INFO - --DOMWINDOW == 33 (0x7f4afe4bf400) [pid = 2212] [serial = 2198] [outer = (nil)] [url = about:blank] 14:05:22 INFO - --DOMWINDOW == 32 (0x7f4b0ac10800) [pid = 2212] [serial = 2202] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:05:22 INFO - --DOMWINDOW == 31 (0x7f4afe8bd400) [pid = 2212] [serial = 2191] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:05:22 INFO - --DOMWINDOW == 30 (0x7f4afe4c2c00) [pid = 2212] [serial = 2188] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:05:22 INFO - --DOMWINDOW == 29 (0x7f4afcf24c00) [pid = 2212] [serial = 2183] [outer = (nil)] [url = about:blank] 14:05:22 INFO - --DOMWINDOW == 28 (0x7f4afde67000) [pid = 2212] [serial = 2185] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:05:22 INFO - --DOMWINDOW == 27 (0x7f4afe1f4800) [pid = 2212] [serial = 2187] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:05:22 INFO - MEMORY STAT | vsize 1181MB | residentFast 311MB | heapAllocated 121MB 14:05:22 INFO - 406 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_01.js | took 9426ms 14:05:22 INFO - ++DOCSHELL 0x7f4afcec5800 == 11 [pid = 2212] [id = 909] 14:05:22 INFO - ++DOMWINDOW == 28 (0x7f4afcf28400) [pid = 2212] [serial = 2204] [outer = (nil)] 14:05:22 INFO - ++DOMWINDOW == 29 (0x7f4afd040800) [pid = 2212] [serial = 2205] [outer = 0x7f4afcf28400] 14:05:22 INFO - 407 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_02.js 14:05:22 INFO - ++DOCSHELL 0x7f4aff2c0000 == 12 [pid = 2212] [id = 910] 14:05:22 INFO - ++DOMWINDOW == 30 (0x7f4afde64000) [pid = 2212] [serial = 2206] [outer = (nil)] 14:05:22 INFO - ++DOMWINDOW == 31 (0x7f4afe00bc00) [pid = 2212] [serial = 2207] [outer = 0x7f4afde64000] 14:05:22 INFO - ++DOMWINDOW == 32 (0x7f4b019b7400) [pid = 2212] [serial = 2208] [outer = 0x7f4afde64000] 14:05:23 INFO - ++DOCSHELL 0x7f4afce89800 == 13 [pid = 2212] [id = 911] 14:05:23 INFO - ++DOMWINDOW == 33 (0x7f4afe4c8800) [pid = 2212] [serial = 2209] [outer = (nil)] 14:05:23 INFO - ++DOMWINDOW == 34 (0x7f4afe54ec00) [pid = 2212] [serial = 2210] [outer = 0x7f4afe4c8800] 14:05:23 INFO - ++DOMWINDOW == 35 (0x7f4afe815000) [pid = 2212] [serial = 2211] [outer = 0x7f4afe4c8800] 14:05:23 INFO - ++DOCSHELL 0x7f4b0fa20000 == 14 [pid = 2212] [id = 912] 14:05:23 INFO - ++DOMWINDOW == 36 (0x7f4afe8c2000) [pid = 2212] [serial = 2212] [outer = (nil)] 14:05:23 INFO - ++DOMWINDOW == 37 (0x7f4afe8c5400) [pid = 2212] [serial = 2213] [outer = 0x7f4afe8c2000] 14:05:25 INFO - ++DOCSHELL 0x7f4b10bc0800 == 15 [pid = 2212] [id = 913] 14:05:25 INFO - ++DOMWINDOW == 38 (0x7f4b099c2400) [pid = 2212] [serial = 2214] [outer = (nil)] 14:05:25 INFO - ++DOMWINDOW == 39 (0x7f4b0962cc00) [pid = 2212] [serial = 2215] [outer = 0x7f4b099c2400] 14:05:26 INFO - console.warn: noSuchActor: No such actor for ID: server1.conn202.obj28 14:05:26 INFO - ++DOCSHELL 0x7f4b0949f000 == 16 [pid = 2212] [id = 914] 14:05:26 INFO - ++DOMWINDOW == 40 (0x7f4afe0b0c00) [pid = 2212] [serial = 2216] [outer = (nil)] 14:05:26 INFO - ++DOMWINDOW == 41 (0x7f4afe0ad800) [pid = 2212] [serial = 2217] [outer = 0x7f4afe0b0c00] 14:05:27 INFO - console.warn: noSuchActor: No such actor for ID: server1.conn202.obj31 14:05:27 INFO - ++DOCSHELL 0x7f4b094ab000 == 17 [pid = 2212] [id = 915] 14:05:27 INFO - ++DOMWINDOW == 42 (0x7f4aff424400) [pid = 2212] [serial = 2218] [outer = (nil)] 14:05:27 INFO - ++DOMWINDOW == 43 (0x7f4aff423800) [pid = 2212] [serial = 2219] [outer = 0x7f4aff424400] 14:05:27 INFO - console.warn: noSuchActor: No such actor for ID: server1.conn202.obj35 14:05:28 INFO - ++DOCSHELL 0x7f4b10ad4000 == 18 [pid = 2212] [id = 916] 14:05:28 INFO - ++DOMWINDOW == 44 (0x7f4b0984c000) [pid = 2212] [serial = 2220] [outer = (nil)] 14:05:28 INFO - ++DOMWINDOW == 45 (0x7f4b099b4c00) [pid = 2212] [serial = 2221] [outer = 0x7f4b0984c000] 14:05:28 INFO - console.warn: noSuchActor: No such actor for ID: server1.conn202.obj39 14:05:29 INFO - ++DOCSHELL 0x7f4b10bd4000 == 19 [pid = 2212] [id = 917] 14:05:29 INFO - ++DOMWINDOW == 46 (0x7f4b0ac10c00) [pid = 2212] [serial = 2222] [outer = (nil)] 14:05:29 INFO - ++DOMWINDOW == 47 (0x7f4afe54cc00) [pid = 2212] [serial = 2223] [outer = 0x7f4b0ac10c00] 14:05:29 INFO - console.warn: noSuchActor: No such actor for ID: server1.conn202.obj43 14:05:29 INFO - ++DOCSHELL 0x7f4b11d14000 == 20 [pid = 2212] [id = 918] 14:05:29 INFO - ++DOMWINDOW == 48 (0x7f4b0c1ae000) [pid = 2212] [serial = 2224] [outer = (nil)] 14:05:29 INFO - ++DOMWINDOW == 49 (0x7f4afcf25000) [pid = 2212] [serial = 2225] [outer = 0x7f4b0c1ae000] 14:05:30 INFO - ++DOCSHELL 0x7f4b1274e800 == 21 [pid = 2212] [id = 919] 14:05:30 INFO - ++DOMWINDOW == 50 (0x7f4b0fbb7c00) [pid = 2212] [serial = 2226] [outer = (nil)] 14:05:30 INFO - ++DOMWINDOW == 51 (0x7f4b09848400) [pid = 2212] [serial = 2227] [outer = 0x7f4b0fbb7c00] 14:05:31 INFO - ++DOCSHELL 0x7f4b12767000 == 22 [pid = 2212] [id = 920] 14:05:31 INFO - ++DOMWINDOW == 52 (0x7f4b0fbb3c00) [pid = 2212] [serial = 2228] [outer = (nil)] 14:05:31 INFO - ++DOMWINDOW == 53 (0x7f4b09bc2400) [pid = 2212] [serial = 2229] [outer = 0x7f4b0fbb3c00] 14:05:32 INFO - ++DOCSHELL 0x7f4b10ade800 == 23 [pid = 2212] [id = 921] 14:05:32 INFO - ++DOMWINDOW == 54 (0x7f4b09e5b800) [pid = 2212] [serial = 2230] [outer = (nil)] 14:05:32 INFO - ++DOMWINDOW == 55 (0x7f4b07a09000) [pid = 2212] [serial = 2231] [outer = 0x7f4b09e5b800] 14:05:33 INFO - ++DOCSHELL 0x7f4b129be000 == 24 [pid = 2212] [id = 922] 14:05:33 INFO - ++DOMWINDOW == 56 (0x7f4b09e5d400) [pid = 2212] [serial = 2232] [outer = (nil)] 14:05:33 INFO - ++DOMWINDOW == 57 (0x7f4b0ca81400) [pid = 2212] [serial = 2233] [outer = 0x7f4b09e5d400] 14:05:34 INFO - ++DOCSHELL 0x7f4b13057000 == 25 [pid = 2212] [id = 923] 14:05:34 INFO - ++DOMWINDOW == 58 (0x7f4b12378c00) [pid = 2212] [serial = 2234] [outer = (nil)] 14:05:34 INFO - ++DOMWINDOW == 59 (0x7f4b09bf1c00) [pid = 2212] [serial = 2235] [outer = 0x7f4b12378c00] 14:05:34 INFO - ++DOCSHELL 0x7f4b142ea800 == 26 [pid = 2212] [id = 924] 14:05:34 INFO - ++DOMWINDOW == 60 (0x7f4b1277cc00) [pid = 2212] [serial = 2236] [outer = (nil)] 14:05:35 INFO - ++DOMWINDOW == 61 (0x7f4b120a3c00) [pid = 2212] [serial = 2237] [outer = 0x7f4b1277cc00] 14:05:35 INFO - ++DOCSHELL 0x7f4b14965800 == 27 [pid = 2212] [id = 925] 14:05:35 INFO - ++DOMWINDOW == 62 (0x7f4b12975000) [pid = 2212] [serial = 2238] [outer = (nil)] 14:05:35 INFO - ++DOMWINDOW == 63 (0x7f4b11ee5800) [pid = 2212] [serial = 2239] [outer = 0x7f4b12975000] 14:05:36 INFO - ++DOCSHELL 0x7f4b14c3b000 == 28 [pid = 2212] [id = 926] 14:05:36 INFO - ++DOMWINDOW == 64 (0x7f4b13011800) [pid = 2212] [serial = 2240] [outer = (nil)] 14:05:36 INFO - ++DOMWINDOW == 65 (0x7f4b09622000) [pid = 2212] [serial = 2241] [outer = 0x7f4b13011800] 14:05:37 INFO - ++DOCSHELL 0x7f4b157a3800 == 29 [pid = 2212] [id = 927] 14:05:37 INFO - ++DOMWINDOW == 66 (0x7f4b149e7400) [pid = 2212] [serial = 2242] [outer = (nil)] 14:05:37 INFO - ++DOMWINDOW == 67 (0x7f4b123d3c00) [pid = 2212] [serial = 2243] [outer = 0x7f4b149e7400] 14:05:39 INFO - --DOCSHELL 0x7f4afcec7800 == 28 [pid = 2212] [id = 904] 14:05:39 INFO - --DOCSHELL 0x7f4aff28c800 == 27 [pid = 2212] [id = 905] 14:05:39 INFO - --DOCSHELL 0x7f4afce89800 == 26 [pid = 2212] [id = 911] 14:05:39 INFO - --DOCSHELL 0x7f4b0fa20000 == 25 [pid = 2212] [id = 912] 14:05:39 INFO - --DOCSHELL 0x7f4b10bc0800 == 24 [pid = 2212] [id = 913] 14:05:39 INFO - --DOCSHELL 0x7f4b0949f000 == 23 [pid = 2212] [id = 914] 14:05:39 INFO - --DOCSHELL 0x7f4b094ab000 == 22 [pid = 2212] [id = 915] 14:05:39 INFO - --DOCSHELL 0x7f4b10ad4000 == 21 [pid = 2212] [id = 916] 14:05:39 INFO - --DOCSHELL 0x7f4b14965800 == 20 [pid = 2212] [id = 925] 14:05:39 INFO - --DOCSHELL 0x7f4b14c3b000 == 19 [pid = 2212] [id = 926] 14:05:39 INFO - --DOCSHELL 0x7f4b157a3800 == 18 [pid = 2212] [id = 927] 14:05:39 INFO - --DOMWINDOW == 66 (0x7f4afe81a400) [pid = 2212] [serial = 2190] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:05:39 INFO - --DOMWINDOW == 65 (0x7f4afe8c0c00) [pid = 2212] [serial = 2192] [outer = (nil)] [url = about:blank] 14:05:39 INFO - --DOMWINDOW == 64 (0x7f4b07d76000) [pid = 2212] [serial = 2203] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:05:39 INFO - --DOMWINDOW == 63 (0x7f4afd037000) [pid = 2212] [serial = 2193] [outer = (nil)] [url = about:blank] 14:05:39 INFO - --DOMWINDOW == 62 (0x7f4afcf2ac00) [pid = 2212] [serial = 2195] [outer = (nil)] [url = data:text/html;charset=utf8,test%20for%20console%20output%20-%2001] 14:05:39 INFO - --DOMWINDOW == 61 (0x7f4afe00e400) [pid = 2212] [serial = 2197] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:05:39 INFO - --DOMWINDOW == 60 (0x7f4afe8bf800) [pid = 2212] [serial = 2200] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:05:39 INFO - --DOMWINDOW == 59 (0x7f4b099c2400) [pid = 2212] [serial = 2214] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:05:39 INFO - --DOMWINDOW == 58 (0x7f4afd3ae400) [pid = 2212] [serial = 2194] [outer = (nil)] [url = about:blank] 14:05:39 INFO - --DOMWINDOW == 57 (0x7f4afe00a800) [pid = 2212] [serial = 2196] [outer = (nil)] [url = about:blank] 14:05:39 INFO - --DOMWINDOW == 56 (0x7f4afe00bc00) [pid = 2212] [serial = 2207] [outer = (nil)] [url = about:blank] 14:05:39 INFO - --DOMWINDOW == 55 (0x7f4afe54ec00) [pid = 2212] [serial = 2210] [outer = (nil)] [url = about:blank] 14:05:39 INFO - MEMORY STAT | vsize 1183MB | residentFast 325MB | heapAllocated 126MB 14:05:39 INFO - 408 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_02.js | took 17054ms 14:05:39 INFO - ++DOCSHELL 0x7f4afcec3000 == 19 [pid = 2212] [id = 928] 14:05:39 INFO - ++DOMWINDOW == 56 (0x7f4afcf2c800) [pid = 2212] [serial = 2244] [outer = (nil)] 14:05:39 INFO - ++DOMWINDOW == 57 (0x7f4afd3a7400) [pid = 2212] [serial = 2245] [outer = 0x7f4afcf2c800] 14:05:39 INFO - 409 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_03.js 14:05:39 INFO - ++DOCSHELL 0x7f4b01917800 == 20 [pid = 2212] [id = 929] 14:05:39 INFO - ++DOMWINDOW == 58 (0x7f4afe008c00) [pid = 2212] [serial = 2246] [outer = (nil)] 14:05:39 INFO - ++DOMWINDOW == 59 (0x7f4afe011c00) [pid = 2212] [serial = 2247] [outer = 0x7f4afe008c00] 14:05:40 INFO - ++DOMWINDOW == 60 (0x7f4afe8adc00) [pid = 2212] [serial = 2248] [outer = 0x7f4afe008c00] 14:05:40 INFO - ++DOCSHELL 0x7f4afcebd800 == 21 [pid = 2212] [id = 930] 14:05:40 INFO - ++DOMWINDOW == 61 (0x7f4afe553c00) [pid = 2212] [serial = 2249] [outer = (nil)] 14:05:40 INFO - ++DOMWINDOW == 62 (0x7f4afe572c00) [pid = 2212] [serial = 2250] [outer = 0x7f4afe553c00] 14:05:40 INFO - ++DOMWINDOW == 63 (0x7f4afe8a3000) [pid = 2212] [serial = 2251] [outer = 0x7f4afe553c00] 14:05:40 INFO - ++DOCSHELL 0x7f4b0f9c2800 == 22 [pid = 2212] [id = 931] 14:05:40 INFO - ++DOMWINDOW == 64 (0x7f4aff334400) [pid = 2212] [serial = 2252] [outer = (nil)] 14:05:40 INFO - ++DOMWINDOW == 65 (0x7f4aff337400) [pid = 2212] [serial = 2253] [outer = 0x7f4aff334400] 14:05:44 INFO - ++DOCSHELL 0x7f4b0fa29000 == 23 [pid = 2212] [id = 932] 14:05:44 INFO - ++DOMWINDOW == 66 (0x7f4b0957d000) [pid = 2212] [serial = 2254] [outer = (nil)] 14:05:44 INFO - ++DOMWINDOW == 67 (0x7f4b09527400) [pid = 2212] [serial = 2255] [outer = 0x7f4b0957d000] 14:05:45 INFO - ++DOCSHELL 0x7f4b10a89000 == 24 [pid = 2212] [id = 933] 14:05:45 INFO - ++DOMWINDOW == 68 (0x7f4b0ab82000) [pid = 2212] [serial = 2256] [outer = (nil)] 14:05:45 INFO - ++DOMWINDOW == 69 (0x7f4b09e56000) [pid = 2212] [serial = 2257] [outer = 0x7f4b0ab82000] 14:05:46 INFO - ++DOCSHELL 0x7f4afce95000 == 25 [pid = 2212] [id = 934] 14:05:46 INFO - ++DOMWINDOW == 70 (0x7f4b0fbb4800) [pid = 2212] [serial = 2258] [outer = (nil)] 14:05:46 INFO - ++DOMWINDOW == 71 (0x7f4b0a9ce400) [pid = 2212] [serial = 2259] [outer = 0x7f4b0fbb4800] 14:05:47 INFO - ++DOCSHELL 0x7f4b116da800 == 26 [pid = 2212] [id = 935] 14:05:47 INFO - ++DOMWINDOW == 72 (0x7f4b11ee6400) [pid = 2212] [serial = 2260] [outer = (nil)] 14:05:47 INFO - ++DOMWINDOW == 73 (0x7f4b07d75800) [pid = 2212] [serial = 2261] [outer = 0x7f4b11ee6400] 14:05:48 INFO - ++DOCSHELL 0x7f4b1275b800 == 27 [pid = 2212] [id = 936] 14:05:48 INFO - ++DOMWINDOW == 74 (0x7f4b12374800) [pid = 2212] [serial = 2262] [outer = (nil)] 14:05:48 INFO - ++DOMWINDOW == 75 (0x7f4b0c1a5400) [pid = 2212] [serial = 2263] [outer = 0x7f4b12374800] 14:05:50 INFO - ++DOCSHELL 0x7f4b13067000 == 28 [pid = 2212] [id = 937] 14:05:50 INFO - ++DOMWINDOW == 76 (0x7f4b12e38800) [pid = 2212] [serial = 2264] [outer = (nil)] 14:05:50 INFO - ++DOMWINDOW == 77 (0x7f4b0a85f000) [pid = 2212] [serial = 2265] [outer = 0x7f4b12e38800] 14:05:51 INFO - ++DOCSHELL 0x7f4b14959000 == 29 [pid = 2212] [id = 938] 14:05:51 INFO - ++DOMWINDOW == 78 (0x7f4b14881c00) [pid = 2212] [serial = 2266] [outer = (nil)] 14:05:51 INFO - ++DOMWINDOW == 79 (0x7f4b10b07000) [pid = 2212] [serial = 2267] [outer = 0x7f4b14881c00] 14:05:52 INFO - ++DOCSHELL 0x7f4b1578d000 == 30 [pid = 2212] [id = 939] 14:05:52 INFO - ++DOMWINDOW == 80 (0x7f4b1584a400) [pid = 2212] [serial = 2268] [outer = (nil)] 14:05:52 INFO - ++DOMWINDOW == 81 (0x7f4afe819c00) [pid = 2212] [serial = 2269] [outer = 0x7f4b1584a400] 14:05:52 INFO - ++DOCSHELL 0x7f4b15b79000 == 31 [pid = 2212] [id = 940] 14:05:52 INFO - ++DOMWINDOW == 82 (0x7f4b0f70c000) [pid = 2212] [serial = 2270] [outer = (nil)] 14:05:52 INFO - ++DOMWINDOW == 83 (0x7f4b0f70ac00) [pid = 2212] [serial = 2271] [outer = 0x7f4b0f70c000] 14:05:54 INFO - --DOCSHELL 0x7f4b142ea800 == 30 [pid = 2212] [id = 924] 14:05:54 INFO - --DOCSHELL 0x7f4b129be000 == 29 [pid = 2212] [id = 922] 14:05:54 INFO - --DOCSHELL 0x7f4afcebd800 == 28 [pid = 2212] [id = 930] 14:05:54 INFO - --DOCSHELL 0x7f4b0f9c2800 == 27 [pid = 2212] [id = 931] 14:05:54 INFO - --DOCSHELL 0x7f4b13057000 == 26 [pid = 2212] [id = 923] 14:05:54 INFO - --DOCSHELL 0x7f4b1274e800 == 25 [pid = 2212] [id = 919] 14:05:54 INFO - --DOCSHELL 0x7f4aff2c0000 == 24 [pid = 2212] [id = 910] 14:05:54 INFO - --DOCSHELL 0x7f4b12767000 == 23 [pid = 2212] [id = 920] 14:05:54 INFO - --DOCSHELL 0x7f4b10ade800 == 22 [pid = 2212] [id = 921] 14:05:54 INFO - --DOCSHELL 0x7f4b10bd4000 == 21 [pid = 2212] [id = 917] 14:05:54 INFO - --DOCSHELL 0x7f4b0fa29000 == 20 [pid = 2212] [id = 932] 14:05:54 INFO - --DOCSHELL 0x7f4b11d14000 == 19 [pid = 2212] [id = 918] 14:05:54 INFO - --DOCSHELL 0x7f4b10a89000 == 18 [pid = 2212] [id = 933] 14:05:54 INFO - --DOCSHELL 0x7f4afcec5800 == 17 [pid = 2212] [id = 909] 14:05:54 INFO - --DOCSHELL 0x7f4afce95000 == 16 [pid = 2212] [id = 934] 14:05:54 INFO - --DOMWINDOW == 82 (0x7f4b0962cc00) [pid = 2212] [serial = 2215] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:05:54 INFO - --DOMWINDOW == 81 (0x7f4aff336c00) [pid = 2212] [serial = 2201] [outer = (nil)] [url = about:blank] 14:05:54 INFO - --DOMWINDOW == 80 (0x7f4afe817400) [pid = 2212] [serial = 2199] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:05:55 INFO - --DOMWINDOW == 79 (0x7f4b149e7400) [pid = 2212] [serial = 2242] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:05:55 INFO - --DOMWINDOW == 78 (0x7f4b13011800) [pid = 2212] [serial = 2240] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:05:55 INFO - --DOMWINDOW == 77 (0x7f4b12975000) [pid = 2212] [serial = 2238] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:05:55 INFO - --DOMWINDOW == 76 (0x7f4b1277cc00) [pid = 2212] [serial = 2236] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:05:55 INFO - --DOMWINDOW == 75 (0x7f4b12378c00) [pid = 2212] [serial = 2234] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:05:55 INFO - --DOMWINDOW == 74 (0x7f4b09e5d400) [pid = 2212] [serial = 2232] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:05:55 INFO - --DOMWINDOW == 73 (0x7f4b09e5b800) [pid = 2212] [serial = 2230] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:05:55 INFO - --DOMWINDOW == 72 (0x7f4b0fbb3c00) [pid = 2212] [serial = 2228] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:05:55 INFO - --DOMWINDOW == 71 (0x7f4b0fbb7c00) [pid = 2212] [serial = 2226] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:05:55 INFO - --DOMWINDOW == 70 (0x7f4b0c1ae000) [pid = 2212] [serial = 2224] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:05:55 INFO - --DOMWINDOW == 69 (0x7f4b0ac10c00) [pid = 2212] [serial = 2222] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:05:55 INFO - --DOMWINDOW == 68 (0x7f4b0984c000) [pid = 2212] [serial = 2220] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:05:55 INFO - --DOMWINDOW == 67 (0x7f4aff424400) [pid = 2212] [serial = 2218] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:05:55 INFO - --DOMWINDOW == 66 (0x7f4afe0b0c00) [pid = 2212] [serial = 2216] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:05:55 INFO - --DOMWINDOW == 65 (0x7f4afe4c8800) [pid = 2212] [serial = 2209] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:05:55 INFO - --DOMWINDOW == 64 (0x7f4afcf28400) [pid = 2212] [serial = 2204] [outer = (nil)] [url = about:blank] 14:05:55 INFO - --DOMWINDOW == 63 (0x7f4afde64000) [pid = 2212] [serial = 2206] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-02.html] 14:05:55 INFO - --DOMWINDOW == 62 (0x7f4b0957d000) [pid = 2212] [serial = 2254] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:05:55 INFO - --DOMWINDOW == 61 (0x7f4b0ab82000) [pid = 2212] [serial = 2256] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:05:55 INFO - --DOMWINDOW == 60 (0x7f4afe8c2000) [pid = 2212] [serial = 2212] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:05:55 INFO - --DOMWINDOW == 59 (0x7f4afd040800) [pid = 2212] [serial = 2205] [outer = (nil)] [url = about:blank] 14:05:55 INFO - --DOMWINDOW == 58 (0x7f4afe011c00) [pid = 2212] [serial = 2247] [outer = (nil)] [url = about:blank] 14:05:55 INFO - --DOMWINDOW == 57 (0x7f4afe572c00) [pid = 2212] [serial = 2250] [outer = (nil)] [url = about:blank] 14:05:55 INFO - --DOMWINDOW == 56 (0x7f4b019b7400) [pid = 2212] [serial = 2208] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-02.html] 14:05:55 INFO - MEMORY STAT | vsize 1185MB | residentFast 332MB | heapAllocated 128MB 14:05:55 INFO - 410 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_03.js | took 15644ms 14:05:55 INFO - ++DOCSHELL 0x7f4afce92800 == 17 [pid = 2212] [id = 941] 14:05:55 INFO - ++DOMWINDOW == 57 (0x7f4afcf2e800) [pid = 2212] [serial = 2272] [outer = (nil)] 14:05:55 INFO - ++DOMWINDOW == 58 (0x7f4afd3a6400) [pid = 2212] [serial = 2273] [outer = 0x7f4afcf2e800] 14:05:55 INFO - 411 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_04.js 14:05:55 INFO - ++DOCSHELL 0x7f4b01759800 == 18 [pid = 2212] [id = 942] 14:05:55 INFO - ++DOMWINDOW == 59 (0x7f4afde6a400) [pid = 2212] [serial = 2274] [outer = (nil)] 14:05:55 INFO - ++DOMWINDOW == 60 (0x7f4afe010000) [pid = 2212] [serial = 2275] [outer = 0x7f4afde6a400] 14:05:56 INFO - ++DOMWINDOW == 61 (0x7f4b0984cc00) [pid = 2212] [serial = 2276] [outer = 0x7f4afde6a400] 14:05:56 INFO - ++DOCSHELL 0x7f4aff280800 == 19 [pid = 2212] [id = 943] 14:05:56 INFO - ++DOMWINDOW == 62 (0x7f4afe57ec00) [pid = 2212] [serial = 2277] [outer = (nil)] 14:05:56 INFO - ++DOMWINDOW == 63 (0x7f4afe811000) [pid = 2212] [serial = 2278] [outer = 0x7f4afe57ec00] 14:05:56 INFO - ++DOMWINDOW == 64 (0x7f4afe8aa000) [pid = 2212] [serial = 2279] [outer = 0x7f4afe57ec00] 14:05:56 INFO - ++DOCSHELL 0x7f4b0fa26000 == 20 [pid = 2212] [id = 944] 14:05:56 INFO - ++DOMWINDOW == 65 (0x7f4aff416800) [pid = 2212] [serial = 2280] [outer = (nil)] 14:05:56 INFO - ++DOMWINDOW == 66 (0x7f4aff421400) [pid = 2212] [serial = 2281] [outer = 0x7f4aff416800] 14:06:00 INFO - ++DOCSHELL 0x7f4b0fa36000 == 21 [pid = 2212] [id = 945] 14:06:00 INFO - ++DOMWINDOW == 67 (0x7f4b09e58800) [pid = 2212] [serial = 2282] [outer = (nil)] 14:06:00 INFO - ++DOMWINDOW == 68 (0x7f4afcf27800) [pid = 2212] [serial = 2283] [outer = 0x7f4b09e58800] 14:06:01 INFO - ++DOCSHELL 0x7f4b10ae4000 == 22 [pid = 2212] [id = 946] 14:06:01 INFO - ++DOMWINDOW == 69 (0x7f4b0fbb4000) [pid = 2212] [serial = 2284] [outer = (nil)] 14:06:01 INFO - ++DOMWINDOW == 70 (0x7f4afc85d000) [pid = 2212] [serial = 2285] [outer = 0x7f4b0fbb4000] 14:06:02 INFO - ++DOCSHELL 0x7f4b10bc6800 == 23 [pid = 2212] [id = 947] 14:06:02 INFO - ++DOMWINDOW == 71 (0x7f4b0fbae800) [pid = 2212] [serial = 2286] [outer = (nil)] 14:06:02 INFO - ++DOMWINDOW == 72 (0x7f4b019b7800) [pid = 2212] [serial = 2287] [outer = 0x7f4b0fbae800] 14:06:03 INFO - ++DOCSHELL 0x7f4b12618800 == 24 [pid = 2212] [id = 948] 14:06:03 INFO - ++DOMWINDOW == 73 (0x7f4b12381000) [pid = 2212] [serial = 2288] [outer = (nil)] 14:06:03 INFO - ++DOMWINDOW == 74 (0x7f4b0c426000) [pid = 2212] [serial = 2289] [outer = 0x7f4b12381000] 14:06:04 INFO - ++DOCSHELL 0x7f4b129be000 == 25 [pid = 2212] [id = 949] 14:06:04 INFO - ++DOMWINDOW == 75 (0x7f4b12bb4c00) [pid = 2212] [serial = 2290] [outer = (nil)] 14:06:04 INFO - ++DOMWINDOW == 76 (0x7f4b012df400) [pid = 2212] [serial = 2291] [outer = 0x7f4b12bb4c00] 14:06:05 INFO - ++DOCSHELL 0x7f4b13057000 == 26 [pid = 2212] [id = 950] 14:06:05 INFO - ++DOMWINDOW == 77 (0x7f4b13010400) [pid = 2212] [serial = 2292] [outer = (nil)] 14:06:05 INFO - ++DOMWINDOW == 78 (0x7f4b0c8f6000) [pid = 2212] [serial = 2293] [outer = 0x7f4b13010400] 14:06:06 INFO - ++DOCSHELL 0x7f4b141ea800 == 27 [pid = 2212] [id = 951] 14:06:06 INFO - ++DOMWINDOW == 79 (0x7f4b15711800) [pid = 2212] [serial = 2294] [outer = (nil)] 14:06:06 INFO - ++DOMWINDOW == 80 (0x7f4b12376000) [pid = 2212] [serial = 2295] [outer = 0x7f4b15711800] 14:06:06 INFO - ++DOCSHELL 0x7f4b14950800 == 28 [pid = 2212] [id = 952] 14:06:06 INFO - ++DOMWINDOW == 81 (0x7f4b15ca7000) [pid = 2212] [serial = 2296] [outer = (nil)] 14:06:06 INFO - ++DOMWINDOW == 82 (0x7f4b15946400) [pid = 2212] [serial = 2297] [outer = 0x7f4b15ca7000] 14:06:08 INFO - --DOCSHELL 0x7f4afcec3000 == 27 [pid = 2212] [id = 928] 14:06:08 INFO - --DOCSHELL 0x7f4aff280800 == 26 [pid = 2212] [id = 943] 14:06:08 INFO - --DOCSHELL 0x7f4b0fa26000 == 25 [pid = 2212] [id = 944] 14:06:08 INFO - --DOCSHELL 0x7f4b15b79000 == 24 [pid = 2212] [id = 940] 14:06:08 INFO - --DOCSHELL 0x7f4b13067000 == 23 [pid = 2212] [id = 937] 14:06:08 INFO - --DOCSHELL 0x7f4b01917800 == 22 [pid = 2212] [id = 929] 14:06:08 INFO - --DOCSHELL 0x7f4b1275b800 == 21 [pid = 2212] [id = 936] 14:06:08 INFO - --DOCSHELL 0x7f4b1578d000 == 20 [pid = 2212] [id = 939] 14:06:08 INFO - --DOCSHELL 0x7f4b0fa36000 == 19 [pid = 2212] [id = 945] 14:06:08 INFO - --DOCSHELL 0x7f4b10ae4000 == 18 [pid = 2212] [id = 946] 14:06:08 INFO - --DOCSHELL 0x7f4b14959000 == 17 [pid = 2212] [id = 938] 14:06:08 INFO - --DOCSHELL 0x7f4b116da800 == 16 [pid = 2212] [id = 935] 14:06:08 INFO - --DOCSHELL 0x7f4b10bc6800 == 15 [pid = 2212] [id = 947] 14:06:08 INFO - --DOMWINDOW == 81 (0x7f4b09e56000) [pid = 2212] [serial = 2257] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:08 INFO - --DOMWINDOW == 80 (0x7f4b09527400) [pid = 2212] [serial = 2255] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:08 INFO - --DOMWINDOW == 79 (0x7f4b123d3c00) [pid = 2212] [serial = 2243] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:08 INFO - --DOMWINDOW == 78 (0x7f4b09622000) [pid = 2212] [serial = 2241] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:08 INFO - --DOMWINDOW == 77 (0x7f4b11ee5800) [pid = 2212] [serial = 2239] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:08 INFO - --DOMWINDOW == 76 (0x7f4b120a3c00) [pid = 2212] [serial = 2237] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:08 INFO - --DOMWINDOW == 75 (0x7f4b09bf1c00) [pid = 2212] [serial = 2235] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:08 INFO - --DOMWINDOW == 74 (0x7f4b0ca81400) [pid = 2212] [serial = 2233] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:08 INFO - --DOMWINDOW == 73 (0x7f4b07a09000) [pid = 2212] [serial = 2231] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:08 INFO - --DOMWINDOW == 72 (0x7f4b09bc2400) [pid = 2212] [serial = 2229] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:08 INFO - --DOMWINDOW == 71 (0x7f4b09848400) [pid = 2212] [serial = 2227] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:08 INFO - --DOMWINDOW == 70 (0x7f4afcf25000) [pid = 2212] [serial = 2225] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:08 INFO - --DOMWINDOW == 69 (0x7f4afe54cc00) [pid = 2212] [serial = 2223] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:08 INFO - --DOMWINDOW == 68 (0x7f4b099b4c00) [pid = 2212] [serial = 2221] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:08 INFO - --DOMWINDOW == 67 (0x7f4aff423800) [pid = 2212] [serial = 2219] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:08 INFO - --DOMWINDOW == 66 (0x7f4afe0ad800) [pid = 2212] [serial = 2217] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:08 INFO - --DOMWINDOW == 65 (0x7f4afe815000) [pid = 2212] [serial = 2211] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:06:08 INFO - --DOMWINDOW == 64 (0x7f4afe8c5400) [pid = 2212] [serial = 2213] [outer = (nil)] [url = about:blank] 14:06:09 INFO - --DOMWINDOW == 63 (0x7f4b14881c00) [pid = 2212] [serial = 2266] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:09 INFO - --DOMWINDOW == 62 (0x7f4afe010000) [pid = 2212] [serial = 2275] [outer = (nil)] [url = about:blank] 14:06:09 INFO - --DOMWINDOW == 61 (0x7f4afe008c00) [pid = 2212] [serial = 2246] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-03.html] 14:06:09 INFO - --DOMWINDOW == 60 (0x7f4b0fbb4800) [pid = 2212] [serial = 2258] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:09 INFO - --DOMWINDOW == 59 (0x7f4b0f70c000) [pid = 2212] [serial = 2270] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:09 INFO - --DOMWINDOW == 58 (0x7f4b12e38800) [pid = 2212] [serial = 2264] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:09 INFO - --DOMWINDOW == 57 (0x7f4b1584a400) [pid = 2212] [serial = 2268] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:09 INFO - --DOMWINDOW == 56 (0x7f4b11ee6400) [pid = 2212] [serial = 2260] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:09 INFO - --DOMWINDOW == 55 (0x7f4afe553c00) [pid = 2212] [serial = 2249] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:06:09 INFO - --DOMWINDOW == 54 (0x7f4aff334400) [pid = 2212] [serial = 2252] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:06:09 INFO - --DOMWINDOW == 53 (0x7f4afcf2c800) [pid = 2212] [serial = 2244] [outer = (nil)] [url = about:blank] 14:06:09 INFO - --DOMWINDOW == 52 (0x7f4b12374800) [pid = 2212] [serial = 2262] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:09 INFO - --DOMWINDOW == 51 (0x7f4afe811000) [pid = 2212] [serial = 2278] [outer = (nil)] [url = about:blank] 14:06:09 INFO - --DOMWINDOW == 50 (0x7f4afd3a7400) [pid = 2212] [serial = 2245] [outer = (nil)] [url = about:blank] 14:06:09 INFO - --DOMWINDOW == 49 (0x7f4afe8adc00) [pid = 2212] [serial = 2248] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-03.html] 14:06:09 INFO - MEMORY STAT | vsize 1185MB | residentFast 331MB | heapAllocated 127MB 14:06:09 INFO - 412 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_04.js | took 13582ms 14:06:09 INFO - ++DOCSHELL 0x7f4afce91800 == 16 [pid = 2212] [id = 953] 14:06:09 INFO - ++DOMWINDOW == 50 (0x7f4afd037000) [pid = 2212] [serial = 2298] [outer = (nil)] 14:06:09 INFO - ++DOMWINDOW == 51 (0x7f4afd3a7400) [pid = 2212] [serial = 2299] [outer = 0x7f4afd037000] 14:06:09 INFO - 413 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_05.js 14:06:09 INFO - ++DOCSHELL 0x7f4b01765800 == 17 [pid = 2212] [id = 954] 14:06:09 INFO - ++DOMWINDOW == 52 (0x7f4afe00f800) [pid = 2212] [serial = 2300] [outer = (nil)] 14:06:09 INFO - ++DOMWINDOW == 53 (0x7f4afe0ad400) [pid = 2212] [serial = 2301] [outer = 0x7f4afe00f800] 14:06:09 INFO - ++DOCSHELL 0x7f4afcec2800 == 18 [pid = 2212] [id = 955] 14:06:09 INFO - ++DOMWINDOW == 54 (0x7f4afe0b1400) [pid = 2212] [serial = 2302] [outer = (nil)] 14:06:09 INFO - ++DOMWINDOW == 55 (0x7f4afe4c7000) [pid = 2212] [serial = 2303] [outer = 0x7f4afe0b1400] 14:06:10 INFO - ++DOMWINDOW == 56 (0x7f4afe81c800) [pid = 2212] [serial = 2304] [outer = 0x7f4afe0b1400] 14:06:10 INFO - ++DOCSHELL 0x7f4b0f9ae000 == 19 [pid = 2212] [id = 956] 14:06:10 INFO - ++DOMWINDOW == 57 (0x7f4aff336000) [pid = 2212] [serial = 2305] [outer = (nil)] 14:06:10 INFO - ++DOMWINDOW == 58 (0x7f4aff33cc00) [pid = 2212] [serial = 2306] [outer = 0x7f4aff336000] 14:06:12 INFO - ++DOCSHELL 0x7f4b0c018000 == 20 [pid = 2212] [id = 957] 14:06:12 INFO - ++DOMWINDOW == 59 (0x7f4afe8ae000) [pid = 2212] [serial = 2307] [outer = (nil)] 14:06:12 INFO - ++DOMWINDOW == 60 (0x7f4afe8ae800) [pid = 2212] [serial = 2308] [outer = 0x7f4afe8ae000] 14:06:14 INFO - ++DOCSHELL 0x7f4b0fa39000 == 21 [pid = 2212] [id = 958] 14:06:14 INFO - ++DOMWINDOW == 61 (0x7f4b09bbf000) [pid = 2212] [serial = 2309] [outer = (nil)] 14:06:14 INFO - ++DOMWINDOW == 62 (0x7f4b012dec00) [pid = 2212] [serial = 2310] [outer = 0x7f4b09bbf000] 14:06:15 INFO - ++DOCSHELL 0x7f4afd5a4000 == 22 [pid = 2212] [id = 959] 14:06:15 INFO - ++DOMWINDOW == 63 (0x7f4b0a66a800) [pid = 2212] [serial = 2311] [outer = (nil)] 14:06:15 INFO - ++DOMWINDOW == 64 (0x7f4b0c1ae000) [pid = 2212] [serial = 2312] [outer = 0x7f4b0a66a800] 14:06:16 INFO - ++DOCSHELL 0x7f4b10ad8000 == 23 [pid = 2212] [id = 960] 14:06:16 INFO - ++DOMWINDOW == 65 (0x7f4b0c8f6800) [pid = 2212] [serial = 2313] [outer = (nil)] 14:06:16 INFO - ++DOMWINDOW == 66 (0x7f4afe8af000) [pid = 2212] [serial = 2314] [outer = 0x7f4b0c8f6800] 14:06:16 INFO - ++DOCSHELL 0x7f4b10bca000 == 24 [pid = 2212] [id = 961] 14:06:16 INFO - ++DOMWINDOW == 67 (0x7f4b0f7df000) [pid = 2212] [serial = 2315] [outer = (nil)] 14:06:17 INFO - ++DOMWINDOW == 68 (0x7f4afe3e1000) [pid = 2212] [serial = 2316] [outer = 0x7f4b0f7df000] 14:06:18 INFO - ++DOCSHELL 0x7f4aff276800 == 25 [pid = 2212] [id = 962] 14:06:18 INFO - ++DOMWINDOW == 69 (0x7f4b11ee9000) [pid = 2212] [serial = 2317] [outer = (nil)] 14:06:18 INFO - ++DOMWINDOW == 70 (0x7f4b07d76c00) [pid = 2212] [serial = 2318] [outer = 0x7f4b11ee9000] 14:06:18 INFO - ++DOCSHELL 0x7f4b12761800 == 26 [pid = 2212] [id = 963] 14:06:18 INFO - ++DOMWINDOW == 71 (0x7f4aff37c000) [pid = 2212] [serial = 2319] [outer = (nil)] 14:06:18 INFO - ++DOMWINDOW == 72 (0x7f4b09e5f800) [pid = 2212] [serial = 2320] [outer = 0x7f4aff37c000] 14:06:19 INFO - ++DOCSHELL 0x7f4b129b4800 == 27 [pid = 2212] [id = 964] 14:06:19 INFO - ++DOMWINDOW == 73 (0x7f4b12380c00) [pid = 2212] [serial = 2321] [outer = (nil)] 14:06:19 INFO - ++DOMWINDOW == 74 (0x7f4afe8b0400) [pid = 2212] [serial = 2322] [outer = 0x7f4b12380c00] 14:06:20 INFO - ++DOCSHELL 0x7f4b12e62000 == 28 [pid = 2212] [id = 965] 14:06:20 INFO - ++DOMWINDOW == 75 (0x7f4b1296f800) [pid = 2212] [serial = 2323] [outer = (nil)] 14:06:20 INFO - ++DOMWINDOW == 76 (0x7f4afe54ec00) [pid = 2212] [serial = 2324] [outer = 0x7f4b1296f800] 14:06:21 INFO - ++DOCSHELL 0x7f4b14668800 == 29 [pid = 2212] [id = 966] 14:06:21 INFO - ++DOMWINDOW == 77 (0x7f4b1300cc00) [pid = 2212] [serial = 2325] [outer = (nil)] 14:06:21 INFO - --DOCSHELL 0x7f4b14668800 == 28 [pid = 2212] [id = 966] 14:06:21 INFO - [2212] WARNING: NS_ENSURE_TRUE(currentInner) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 8464 14:06:21 INFO - --DOMWINDOW == 76 (0x7f4b1300cc00) [pid = 2212] [serial = 2325] [outer = (nil)] [url = ] 14:06:22 INFO - --DOCSHELL 0x7f4afce92800 == 27 [pid = 2212] [id = 941] 14:06:22 INFO - --DOCSHELL 0x7f4afcec2800 == 26 [pid = 2212] [id = 955] 14:06:22 INFO - --DOCSHELL 0x7f4b0f9ae000 == 25 [pid = 2212] [id = 956] 14:06:22 INFO - --DOCSHELL 0x7f4b0c018000 == 24 [pid = 2212] [id = 957] 14:06:22 INFO - --DOCSHELL 0x7f4b13057000 == 23 [pid = 2212] [id = 950] 14:06:22 INFO - --DOCSHELL 0x7f4b14950800 == 22 [pid = 2212] [id = 952] 14:06:22 INFO - --DOCSHELL 0x7f4b141ea800 == 21 [pid = 2212] [id = 951] 14:06:22 INFO - --DOCSHELL 0x7f4b12618800 == 20 [pid = 2212] [id = 948] 14:06:22 INFO - --DOCSHELL 0x7f4b129be000 == 19 [pid = 2212] [id = 949] 14:06:22 INFO - --DOCSHELL 0x7f4b0fa39000 == 18 [pid = 2212] [id = 958] 14:06:22 INFO - --DOCSHELL 0x7f4afd5a4000 == 17 [pid = 2212] [id = 959] 14:06:22 INFO - --DOCSHELL 0x7f4b10ad8000 == 16 [pid = 2212] [id = 960] 14:06:22 INFO - --DOCSHELL 0x7f4b01759800 == 15 [pid = 2212] [id = 942] 14:06:22 INFO - --DOMWINDOW == 75 (0x7f4aff337400) [pid = 2212] [serial = 2253] [outer = (nil)] [url = about:blank] 14:06:22 INFO - --DOMWINDOW == 74 (0x7f4b0f70ac00) [pid = 2212] [serial = 2271] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:22 INFO - --DOMWINDOW == 73 (0x7f4afe819c00) [pid = 2212] [serial = 2269] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:22 INFO - --DOMWINDOW == 72 (0x7f4b10b07000) [pid = 2212] [serial = 2267] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:22 INFO - --DOMWINDOW == 71 (0x7f4b0a85f000) [pid = 2212] [serial = 2265] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:22 INFO - --DOMWINDOW == 70 (0x7f4b0c1a5400) [pid = 2212] [serial = 2263] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:22 INFO - --DOMWINDOW == 69 (0x7f4b07d75800) [pid = 2212] [serial = 2261] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:22 INFO - --DOMWINDOW == 68 (0x7f4b0a9ce400) [pid = 2212] [serial = 2259] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:22 INFO - --DOMWINDOW == 67 (0x7f4afe8a3000) [pid = 2212] [serial = 2251] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:06:22 INFO - --DOMWINDOW == 66 (0x7f4b15ca7000) [pid = 2212] [serial = 2296] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:22 INFO - --DOMWINDOW == 65 (0x7f4b15711800) [pid = 2212] [serial = 2294] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:22 INFO - --DOMWINDOW == 64 (0x7f4b13010400) [pid = 2212] [serial = 2292] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:22 INFO - --DOMWINDOW == 63 (0x7f4b12bb4c00) [pid = 2212] [serial = 2290] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:22 INFO - --DOMWINDOW == 62 (0x7f4b12381000) [pid = 2212] [serial = 2288] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:22 INFO - --DOMWINDOW == 61 (0x7f4b0fbae800) [pid = 2212] [serial = 2286] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:22 INFO - --DOMWINDOW == 60 (0x7f4b0fbb4000) [pid = 2212] [serial = 2284] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:22 INFO - --DOMWINDOW == 59 (0x7f4b09e58800) [pid = 2212] [serial = 2282] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:22 INFO - --DOMWINDOW == 58 (0x7f4afe57ec00) [pid = 2212] [serial = 2277] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:06:22 INFO - --DOMWINDOW == 57 (0x7f4afcf2e800) [pid = 2212] [serial = 2272] [outer = (nil)] [url = about:blank] 14:06:22 INFO - --DOMWINDOW == 56 (0x7f4afde6a400) [pid = 2212] [serial = 2274] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-04.html] 14:06:22 INFO - --DOMWINDOW == 55 (0x7f4afe4c7000) [pid = 2212] [serial = 2303] [outer = (nil)] [url = about:blank] 14:06:22 INFO - --DOMWINDOW == 54 (0x7f4b0a66a800) [pid = 2212] [serial = 2311] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:22 INFO - --DOMWINDOW == 53 (0x7f4b0c8f6800) [pid = 2212] [serial = 2313] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:22 INFO - --DOMWINDOW == 52 (0x7f4b09bbf000) [pid = 2212] [serial = 2309] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:22 INFO - --DOMWINDOW == 51 (0x7f4aff416800) [pid = 2212] [serial = 2280] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:06:22 INFO - --DOMWINDOW == 50 (0x7f4afe8ae000) [pid = 2212] [serial = 2307] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:22 INFO - --DOMWINDOW == 49 (0x7f4afd3a6400) [pid = 2212] [serial = 2273] [outer = (nil)] [url = about:blank] 14:06:23 INFO - MEMORY STAT | vsize 1185MB | residentFast 328MB | heapAllocated 126MB 14:06:23 INFO - 414 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_05.js | took 13701ms 14:06:23 INFO - ++DOCSHELL 0x7f4afcecf800 == 16 [pid = 2212] [id = 967] 14:06:23 INFO - ++DOMWINDOW == 50 (0x7f4afcf30000) [pid = 2212] [serial = 2326] [outer = (nil)] 14:06:23 INFO - ++DOMWINDOW == 51 (0x7f4afd94b800) [pid = 2212] [serial = 2327] [outer = 0x7f4afcf30000] 14:06:23 INFO - 415 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_06.js 14:06:23 INFO - ++DOCSHELL 0x7f4b07c23800 == 17 [pid = 2212] [id = 968] 14:06:23 INFO - ++DOMWINDOW == 52 (0x7f4afe010c00) [pid = 2212] [serial = 2328] [outer = (nil)] 14:06:23 INFO - ++DOMWINDOW == 53 (0x7f4afe0ab400) [pid = 2212] [serial = 2329] [outer = 0x7f4afe010c00] 14:06:23 INFO - ++DOCSHELL 0x7f4afce97800 == 18 [pid = 2212] [id = 969] 14:06:23 INFO - ++DOMWINDOW == 54 (0x7f4afe0ad800) [pid = 2212] [serial = 2330] [outer = (nil)] 14:06:23 INFO - ++DOMWINDOW == 55 (0x7f4afe4c2c00) [pid = 2212] [serial = 2331] [outer = 0x7f4afe0ad800] 14:06:24 INFO - ++DOMWINDOW == 56 (0x7f4afe57fc00) [pid = 2212] [serial = 2332] [outer = 0x7f4afe0ad800] 14:06:24 INFO - ++DOCSHELL 0x7f4b0fa1d000 == 19 [pid = 2212] [id = 970] 14:06:24 INFO - ++DOMWINDOW == 57 (0x7f4afe8b8c00) [pid = 2212] [serial = 2333] [outer = (nil)] 14:06:24 INFO - ++DOMWINDOW == 58 (0x7f4afe8bcc00) [pid = 2212] [serial = 2334] [outer = 0x7f4afe8b8c00] 14:06:26 INFO - ++DOCSHELL 0x7f4b0a7d0800 == 20 [pid = 2212] [id = 971] 14:06:26 INFO - ++DOMWINDOW == 59 (0x7f4b09850800) [pid = 2212] [serial = 2335] [outer = (nil)] 14:06:26 INFO - ++DOMWINDOW == 60 (0x7f4b09848400) [pid = 2212] [serial = 2336] [outer = 0x7f4b09850800] 14:06:27 INFO - ++DOCSHELL 0x7f4b07c22800 == 21 [pid = 2212] [id = 972] 14:06:27 INFO - ++DOMWINDOW == 61 (0x7f4afe3d6400) [pid = 2212] [serial = 2337] [outer = (nil)] 14:06:27 INFO - ++DOMWINDOW == 62 (0x7f4afde6a000) [pid = 2212] [serial = 2338] [outer = 0x7f4afe3d6400] 14:06:28 INFO - ++DOCSHELL 0x7f4aff221000 == 22 [pid = 2212] [id = 973] 14:06:28 INFO - ++DOMWINDOW == 63 (0x7f4b00f63400) [pid = 2212] [serial = 2339] [outer = (nil)] 14:06:28 INFO - ++DOMWINDOW == 64 (0x7f4afd3aec00) [pid = 2212] [serial = 2340] [outer = 0x7f4b00f63400] 14:06:29 INFO - ++DOCSHELL 0x7f4b10ae8800 == 23 [pid = 2212] [id = 974] 14:06:29 INFO - ++DOMWINDOW == 65 (0x7f4afe4c4000) [pid = 2212] [serial = 2341] [outer = (nil)] 14:06:29 INFO - ++DOMWINDOW == 66 (0x7f4b0984c400) [pid = 2212] [serial = 2342] [outer = 0x7f4afe4c4000] 14:06:30 INFO - ++DOCSHELL 0x7f4b10bd7800 == 24 [pid = 2212] [id = 975] 14:06:30 INFO - ++DOMWINDOW == 67 (0x7f4b0ac10c00) [pid = 2212] [serial = 2343] [outer = (nil)] 14:06:30 INFO - ++DOMWINDOW == 68 (0x7f4afc861800) [pid = 2212] [serial = 2344] [outer = 0x7f4b0ac10c00] 14:06:30 INFO - ++DOCSHELL 0x7f4b12751000 == 25 [pid = 2212] [id = 976] 14:06:30 INFO - ++DOMWINDOW == 69 (0x7f4b0c4e9400) [pid = 2212] [serial = 2345] [outer = (nil)] 14:06:30 INFO - ++DOMWINDOW == 70 (0x7f4b09e52000) [pid = 2212] [serial = 2346] [outer = 0x7f4b0c4e9400] 14:06:31 INFO - ++DOCSHELL 0x7f4b1276d000 == 26 [pid = 2212] [id = 977] 14:06:31 INFO - ++DOMWINDOW == 71 (0x7f4b0f981800) [pid = 2212] [serial = 2347] [outer = (nil)] 14:06:31 INFO - ++DOMWINDOW == 72 (0x7f4b0a665400) [pid = 2212] [serial = 2348] [outer = 0x7f4b0f981800] 14:06:32 INFO - ++DOCSHELL 0x7f4b12756800 == 27 [pid = 2212] [id = 978] 14:06:32 INFO - ++DOMWINDOW == 73 (0x7f4b0fbb3000) [pid = 2212] [serial = 2349] [outer = (nil)] 14:06:32 INFO - ++DOMWINDOW == 74 (0x7f4b07d77000) [pid = 2212] [serial = 2350] [outer = 0x7f4b0fbb3000] 14:06:33 INFO - ++DOCSHELL 0x7f4b12068000 == 28 [pid = 2212] [id = 979] 14:06:33 INFO - ++DOMWINDOW == 75 (0x7f4b10b07c00) [pid = 2212] [serial = 2351] [outer = (nil)] 14:06:33 INFO - ++DOMWINDOW == 76 (0x7f4afe8b7800) [pid = 2212] [serial = 2352] [outer = 0x7f4b10b07c00] 14:06:33 INFO - ++DOCSHELL 0x7f4b14518000 == 29 [pid = 2212] [id = 980] 14:06:33 INFO - ++DOMWINDOW == 77 (0x7f4b0c4e4000) [pid = 2212] [serial = 2353] [outer = (nil)] 14:06:33 INFO - ++DOMWINDOW == 78 (0x7f4b0c4e3c00) [pid = 2212] [serial = 2354] [outer = 0x7f4b0c4e4000] 14:06:34 INFO - ++DOCSHELL 0x7f4b14959000 == 30 [pid = 2212] [id = 981] 14:06:34 INFO - ++DOMWINDOW == 79 (0x7f4b11ee5800) [pid = 2212] [serial = 2355] [outer = (nil)] 14:06:34 INFO - ++DOMWINDOW == 80 (0x7f4b0c4e6400) [pid = 2212] [serial = 2356] [outer = 0x7f4b11ee5800] 14:06:35 INFO - ++DOCSHELL 0x7f4b1578c000 == 31 [pid = 2212] [id = 982] 14:06:35 INFO - ++DOMWINDOW == 81 (0x7f4b1294ec00) [pid = 2212] [serial = 2357] [outer = (nil)] 14:06:35 INFO - --DOCSHELL 0x7f4b1578c000 == 30 [pid = 2212] [id = 982] 14:06:35 INFO - JavaScript error: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/sidebar.js, line 391: TypeError: this._tabs is null 14:06:35 INFO - [2212] WARNING: NS_ENSURE_TRUE(currentInner) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 8464 14:06:35 INFO - --DOMWINDOW == 80 (0x7f4b1294ec00) [pid = 2212] [serial = 2357] [outer = (nil)] [url = ] 14:06:35 INFO - ++DOCSHELL 0x7f4b16ec3000 == 31 [pid = 2212] [id = 983] 14:06:35 INFO - ++DOMWINDOW == 81 (0x7f4b12ab9000) [pid = 2212] [serial = 2358] [outer = (nil)] 14:06:35 INFO - --DOCSHELL 0x7f4b16ec3000 == 30 [pid = 2212] [id = 983] 14:06:35 INFO - JavaScript error: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/sidebar.js, line 391: TypeError: this._tabs is null 14:06:35 INFO - [2212] WARNING: NS_ENSURE_TRUE(currentInner) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 8464 14:06:35 INFO - --DOMWINDOW == 80 (0x7f4b12ab9000) [pid = 2212] [serial = 2358] [outer = (nil)] [url = ] 14:06:36 INFO - ++DOCSHELL 0x7f4b16ec3000 == 31 [pid = 2212] [id = 984] 14:06:36 INFO - ++DOMWINDOW == 81 (0x7f4b12bd7c00) [pid = 2212] [serial = 2359] [outer = (nil)] 14:06:36 INFO - --DOCSHELL 0x7f4b16ec3000 == 30 [pid = 2212] [id = 984] 14:06:36 INFO - JavaScript error: resource://gre/modules/commonjs/toolkit/loader.js -> resource://devtools/client/framework/sidebar.js, line 391: TypeError: this._tabs is null 14:06:36 INFO - [2212] WARNING: NS_ENSURE_TRUE(currentInner) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 8464 14:06:36 INFO - --DOMWINDOW == 80 (0x7f4b12bd7c00) [pid = 2212] [serial = 2359] [outer = (nil)] [url = ] 14:06:36 INFO - ++DOCSHELL 0x7f4b17214000 == 31 [pid = 2212] [id = 985] 14:06:36 INFO - ++DOMWINDOW == 81 (0x7f4b1300cc00) [pid = 2212] [serial = 2360] [outer = (nil)] 14:06:36 INFO - ++DOMWINDOW == 82 (0x7f4b13fd1c00) [pid = 2212] [serial = 2361] [outer = 0x7f4b1300cc00] 14:06:37 INFO - ++DOCSHELL 0x7f4b19742800 == 32 [pid = 2212] [id = 986] 14:06:37 INFO - ++DOMWINDOW == 83 (0x7f4b14a97c00) [pid = 2212] [serial = 2362] [outer = (nil)] 14:06:37 INFO - ++DOMWINDOW == 84 (0x7f4b089eb000) [pid = 2212] [serial = 2363] [outer = 0x7f4b14a97c00] 14:06:39 INFO - --DOCSHELL 0x7f4afce97800 == 31 [pid = 2212] [id = 969] 14:06:39 INFO - --DOCSHELL 0x7f4b01765800 == 30 [pid = 2212] [id = 954] 14:06:39 INFO - --DOCSHELL 0x7f4b0fa1d000 == 29 [pid = 2212] [id = 970] 14:06:39 INFO - --DOCSHELL 0x7f4b129b4800 == 28 [pid = 2212] [id = 964] 14:06:39 INFO - --DOCSHELL 0x7f4b12e62000 == 27 [pid = 2212] [id = 965] 14:06:39 INFO - --DOCSHELL 0x7f4b10bca000 == 26 [pid = 2212] [id = 961] 14:06:39 INFO - --DOCSHELL 0x7f4b12761800 == 25 [pid = 2212] [id = 963] 14:06:39 INFO - --DOCSHELL 0x7f4b0a7d0800 == 24 [pid = 2212] [id = 971] 14:06:39 INFO - --DOCSHELL 0x7f4b07c22800 == 23 [pid = 2212] [id = 972] 14:06:39 INFO - --DOCSHELL 0x7f4aff276800 == 22 [pid = 2212] [id = 962] 14:06:39 INFO - --DOCSHELL 0x7f4aff221000 == 21 [pid = 2212] [id = 973] 14:06:39 INFO - --DOCSHELL 0x7f4b10ae8800 == 20 [pid = 2212] [id = 974] 14:06:39 INFO - --DOCSHELL 0x7f4afce91800 == 19 [pid = 2212] [id = 953] 14:06:39 INFO - --DOCSHELL 0x7f4b19742800 == 18 [pid = 2212] [id = 986] 14:06:39 INFO - --DOMWINDOW == 83 (0x7f4afe8aa000) [pid = 2212] [serial = 2279] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:06:39 INFO - --DOMWINDOW == 82 (0x7f4aff421400) [pid = 2212] [serial = 2281] [outer = (nil)] [url = about:blank] 14:06:39 INFO - --DOMWINDOW == 81 (0x7f4b0984cc00) [pid = 2212] [serial = 2276] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-04.html] 14:06:39 INFO - --DOMWINDOW == 80 (0x7f4b012dec00) [pid = 2212] [serial = 2310] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:39 INFO - --DOMWINDOW == 79 (0x7f4afe8ae800) [pid = 2212] [serial = 2308] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:39 INFO - --DOMWINDOW == 78 (0x7f4afe8af000) [pid = 2212] [serial = 2314] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:39 INFO - --DOMWINDOW == 77 (0x7f4b0c1ae000) [pid = 2212] [serial = 2312] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:39 INFO - --DOMWINDOW == 76 (0x7f4b15946400) [pid = 2212] [serial = 2297] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:39 INFO - --DOMWINDOW == 75 (0x7f4b12376000) [pid = 2212] [serial = 2295] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:39 INFO - --DOMWINDOW == 74 (0x7f4b0c8f6000) [pid = 2212] [serial = 2293] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:39 INFO - --DOMWINDOW == 73 (0x7f4b012df400) [pid = 2212] [serial = 2291] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:39 INFO - --DOMWINDOW == 72 (0x7f4b0c426000) [pid = 2212] [serial = 2289] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:39 INFO - --DOMWINDOW == 71 (0x7f4b019b7800) [pid = 2212] [serial = 2287] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:39 INFO - --DOMWINDOW == 70 (0x7f4afc85d000) [pid = 2212] [serial = 2285] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:39 INFO - --DOMWINDOW == 69 (0x7f4afcf27800) [pid = 2212] [serial = 2283] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:39 INFO - --DOMWINDOW == 68 (0x7f4b1296f800) [pid = 2212] [serial = 2323] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:39 INFO - --DOMWINDOW == 67 (0x7f4b12380c00) [pid = 2212] [serial = 2321] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:39 INFO - --DOMWINDOW == 66 (0x7f4aff37c000) [pid = 2212] [serial = 2319] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:39 INFO - --DOMWINDOW == 65 (0x7f4b11ee9000) [pid = 2212] [serial = 2317] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:39 INFO - --DOMWINDOW == 64 (0x7f4b0f7df000) [pid = 2212] [serial = 2315] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:39 INFO - --DOMWINDOW == 63 (0x7f4afe0b1400) [pid = 2212] [serial = 2302] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:06:39 INFO - --DOMWINDOW == 62 (0x7f4afd037000) [pid = 2212] [serial = 2298] [outer = (nil)] [url = about:blank] 14:06:39 INFO - --DOMWINDOW == 61 (0x7f4afe00f800) [pid = 2212] [serial = 2300] [outer = (nil)] [url = data:text/html;charset=utf8,test%20for%20console%20output%20-%2005] 14:06:39 INFO - --DOMWINDOW == 60 (0x7f4aff336000) [pid = 2212] [serial = 2305] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:06:39 INFO - --DOMWINDOW == 59 (0x7f4b09850800) [pid = 2212] [serial = 2335] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:39 INFO - --DOMWINDOW == 58 (0x7f4afd3a7400) [pid = 2212] [serial = 2299] [outer = (nil)] [url = about:blank] 14:06:39 INFO - --DOMWINDOW == 57 (0x7f4afe4c2c00) [pid = 2212] [serial = 2331] [outer = (nil)] [url = about:blank] 14:06:40 INFO - MEMORY STAT | vsize 1186MB | residentFast 330MB | heapAllocated 126MB 14:06:40 INFO - 416 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_06.js | took 16591ms 14:06:40 INFO - ++DOCSHELL 0x7f4afce91800 == 19 [pid = 2212] [id = 987] 14:06:40 INFO - ++DOMWINDOW == 58 (0x7f4afcf2c800) [pid = 2212] [serial = 2364] [outer = (nil)] 14:06:40 INFO - ++DOMWINDOW == 59 (0x7f4afd3a6400) [pid = 2212] [serial = 2365] [outer = 0x7f4afcf2c800] 14:06:40 INFO - 417 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_copy_newlines.js 14:06:40 INFO - ++DOCSHELL 0x7f4b01765800 == 20 [pid = 2212] [id = 988] 14:06:40 INFO - ++DOMWINDOW == 60 (0x7f4afe009000) [pid = 2212] [serial = 2366] [outer = (nil)] 14:06:40 INFO - ++DOMWINDOW == 61 (0x7f4afe017400) [pid = 2212] [serial = 2367] [outer = 0x7f4afe009000] 14:06:40 INFO - ++DOCSHELL 0x7f4afce92800 == 21 [pid = 2212] [id = 989] 14:06:40 INFO - ++DOMWINDOW == 62 (0x7f4afe0abc00) [pid = 2212] [serial = 2368] [outer = (nil)] 14:06:40 INFO - ++DOMWINDOW == 63 (0x7f4afe544c00) [pid = 2212] [serial = 2369] [outer = 0x7f4afe0abc00] 14:06:40 INFO - ++DOMWINDOW == 64 (0x7f4afe819c00) [pid = 2212] [serial = 2370] [outer = 0x7f4afe0abc00] 14:06:41 INFO - ++DOCSHELL 0x7f4b0fa20000 == 22 [pid = 2212] [id = 990] 14:06:41 INFO - ++DOMWINDOW == 65 (0x7f4afe8bfc00) [pid = 2212] [serial = 2371] [outer = (nil)] 14:06:41 INFO - ++DOMWINDOW == 66 (0x7f4afe8c2800) [pid = 2212] [serial = 2372] [outer = 0x7f4afe8bfc00] 14:06:43 INFO - --DOCSHELL 0x7f4b17214000 == 21 [pid = 2212] [id = 985] 14:06:43 INFO - --DOCSHELL 0x7f4b0fa20000 == 20 [pid = 2212] [id = 990] 14:06:43 INFO - --DOCSHELL 0x7f4b12068000 == 19 [pid = 2212] [id = 979] 14:06:43 INFO - --DOCSHELL 0x7f4b1276d000 == 18 [pid = 2212] [id = 977] 14:06:43 INFO - --DOCSHELL 0x7f4b14518000 == 17 [pid = 2212] [id = 980] 14:06:43 INFO - --DOCSHELL 0x7f4b12751000 == 16 [pid = 2212] [id = 976] 14:06:43 INFO - --DOCSHELL 0x7f4b12756800 == 15 [pid = 2212] [id = 978] 14:06:43 INFO - --DOCSHELL 0x7f4b10bd7800 == 14 [pid = 2212] [id = 975] 14:06:43 INFO - --DOCSHELL 0x7f4afcecf800 == 13 [pid = 2212] [id = 967] 14:06:43 INFO - --DOCSHELL 0x7f4b14959000 == 12 [pid = 2212] [id = 981] 14:06:43 INFO - --DOCSHELL 0x7f4b07c23800 == 11 [pid = 2212] [id = 968] 14:06:44 INFO - --DOMWINDOW == 65 (0x7f4afe0ad400) [pid = 2212] [serial = 2301] [outer = (nil)] [url = about:blank] 14:06:44 INFO - --DOMWINDOW == 64 (0x7f4b09848400) [pid = 2212] [serial = 2336] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:44 INFO - --DOMWINDOW == 63 (0x7f4aff33cc00) [pid = 2212] [serial = 2306] [outer = (nil)] [url = about:blank] 14:06:44 INFO - --DOMWINDOW == 62 (0x7f4afe81c800) [pid = 2212] [serial = 2304] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:06:44 INFO - --DOMWINDOW == 61 (0x7f4afe54ec00) [pid = 2212] [serial = 2324] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:44 INFO - --DOMWINDOW == 60 (0x7f4afe8b0400) [pid = 2212] [serial = 2322] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:44 INFO - --DOMWINDOW == 59 (0x7f4b09e5f800) [pid = 2212] [serial = 2320] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:44 INFO - --DOMWINDOW == 58 (0x7f4b07d76c00) [pid = 2212] [serial = 2318] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:44 INFO - --DOMWINDOW == 57 (0x7f4afe3e1000) [pid = 2212] [serial = 2316] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:44 INFO - --DOMWINDOW == 56 (0x7f4b14a97c00) [pid = 2212] [serial = 2362] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:44 INFO - --DOMWINDOW == 55 (0x7f4b1300cc00) [pid = 2212] [serial = 2360] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:44 INFO - --DOMWINDOW == 54 (0x7f4b11ee5800) [pid = 2212] [serial = 2355] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:44 INFO - --DOMWINDOW == 53 (0x7f4b0c4e4000) [pid = 2212] [serial = 2353] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:44 INFO - --DOMWINDOW == 52 (0x7f4b10b07c00) [pid = 2212] [serial = 2351] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:44 INFO - --DOMWINDOW == 51 (0x7f4b0fbb3000) [pid = 2212] [serial = 2349] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:44 INFO - --DOMWINDOW == 50 (0x7f4b0f981800) [pid = 2212] [serial = 2347] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:44 INFO - --DOMWINDOW == 49 (0x7f4b0c4e9400) [pid = 2212] [serial = 2345] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:44 INFO - --DOMWINDOW == 48 (0x7f4b0ac10c00) [pid = 2212] [serial = 2343] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:44 INFO - --DOMWINDOW == 47 (0x7f4afe4c4000) [pid = 2212] [serial = 2341] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:44 INFO - --DOMWINDOW == 46 (0x7f4b00f63400) [pid = 2212] [serial = 2339] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:44 INFO - --DOMWINDOW == 45 (0x7f4afe3d6400) [pid = 2212] [serial = 2337] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:44 INFO - --DOMWINDOW == 44 (0x7f4afe0ad800) [pid = 2212] [serial = 2330] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:06:44 INFO - --DOMWINDOW == 43 (0x7f4afe010c00) [pid = 2212] [serial = 2328] [outer = (nil)] [url = data:text/html;charset=utf8,test%20for%20console%20output%20-%2006] 14:06:44 INFO - --DOMWINDOW == 42 (0x7f4afe0ab400) [pid = 2212] [serial = 2329] [outer = (nil)] [url = about:blank] 14:06:44 INFO - --DOMWINDOW == 41 (0x7f4afe544c00) [pid = 2212] [serial = 2369] [outer = (nil)] [url = about:blank] 14:06:44 INFO - --DOMWINDOW == 40 (0x7f4afcf30000) [pid = 2212] [serial = 2326] [outer = (nil)] [url = about:blank] 14:06:44 INFO - --DOMWINDOW == 39 (0x7f4afd94b800) [pid = 2212] [serial = 2327] [outer = (nil)] [url = about:blank] 14:06:44 INFO - --DOMWINDOW == 38 (0x7f4afe8b8c00) [pid = 2212] [serial = 2333] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:06:44 INFO - MEMORY STAT | vsize 1180MB | residentFast 320MB | heapAllocated 123MB 14:06:44 INFO - 418 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_copy_newlines.js | took 4488ms 14:06:44 INFO - ++DOCSHELL 0x7f4afce7d800 == 12 [pid = 2212] [id = 991] 14:06:44 INFO - ++DOMWINDOW == 39 (0x7f4afcf25c00) [pid = 2212] [serial = 2373] [outer = (nil)] 14:06:44 INFO - ++DOMWINDOW == 40 (0x7f4afd3a5c00) [pid = 2212] [serial = 2374] [outer = 0x7f4afcf25c00] 14:06:45 INFO - 419 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_01.js 14:06:45 INFO - ++DOCSHELL 0x7f4b0949b000 == 13 [pid = 2212] [id = 992] 14:06:45 INFO - ++DOMWINDOW == 41 (0x7f4afe00d400) [pid = 2212] [serial = 2375] [outer = (nil)] 14:06:45 INFO - ++DOMWINDOW == 42 (0x7f4afe0acc00) [pid = 2212] [serial = 2376] [outer = 0x7f4afe00d400] 14:06:45 INFO - ++DOMWINDOW == 43 (0x7f4b07d76c00) [pid = 2212] [serial = 2377] [outer = 0x7f4afe00d400] 14:06:45 INFO - ++DOCSHELL 0x7f4b09497800 == 14 [pid = 2212] [id = 993] 14:06:45 INFO - ++DOMWINDOW == 44 (0x7f4afe815800) [pid = 2212] [serial = 2378] [outer = (nil)] 14:06:45 INFO - ++DOMWINDOW == 45 (0x7f4afe54f800) [pid = 2212] [serial = 2379] [outer = 0x7f4afe815800] 14:06:45 INFO - ++DOCSHELL 0x7f4afcec3000 == 15 [pid = 2212] [id = 994] 14:06:45 INFO - ++DOMWINDOW == 46 (0x7f4afe8a7000) [pid = 2212] [serial = 2380] [outer = (nil)] 14:06:45 INFO - ++DOMWINDOW == 47 (0x7f4afe8a8000) [pid = 2212] [serial = 2381] [outer = 0x7f4afe8a7000] 14:06:46 INFO - ++DOMWINDOW == 48 (0x7f4afe8b6400) [pid = 2212] [serial = 2382] [outer = 0x7f4afe8a7000] 14:06:46 INFO - ++DOCSHELL 0x7f4b10a81800 == 16 [pid = 2212] [id = 995] 14:06:46 INFO - ++DOMWINDOW == 49 (0x7f4b00f24c00) [pid = 2212] [serial = 2383] [outer = (nil)] 14:06:46 INFO - ++DOMWINDOW == 50 (0x7f4b00f2ec00) [pid = 2212] [serial = 2384] [outer = 0x7f4b00f24c00] 14:06:55 INFO - --DOCSHELL 0x7f4afce92800 == 15 [pid = 2212] [id = 989] 14:06:55 INFO - --DOCSHELL 0x7f4afcec3000 == 14 [pid = 2212] [id = 994] 14:06:55 INFO - --DOCSHELL 0x7f4b10a81800 == 13 [pid = 2212] [id = 995] 14:06:55 INFO - --DOCSHELL 0x7f4b01765800 == 12 [pid = 2212] [id = 988] 14:06:56 INFO - --DOCSHELL 0x7f4afce91800 == 11 [pid = 2212] [id = 987] 14:06:56 INFO - --DOMWINDOW == 49 (0x7f4afe8bcc00) [pid = 2212] [serial = 2334] [outer = (nil)] [url = about:blank] 14:06:56 INFO - --DOMWINDOW == 48 (0x7f4b089eb000) [pid = 2212] [serial = 2363] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:56 INFO - --DOMWINDOW == 47 (0x7f4b13fd1c00) [pid = 2212] [serial = 2361] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:56 INFO - --DOMWINDOW == 46 (0x7f4b0c4e6400) [pid = 2212] [serial = 2356] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:56 INFO - --DOMWINDOW == 45 (0x7f4b0c4e3c00) [pid = 2212] [serial = 2354] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:56 INFO - --DOMWINDOW == 44 (0x7f4afe8b7800) [pid = 2212] [serial = 2352] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:56 INFO - --DOMWINDOW == 43 (0x7f4b07d77000) [pid = 2212] [serial = 2350] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:56 INFO - --DOMWINDOW == 42 (0x7f4b0a665400) [pid = 2212] [serial = 2348] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:56 INFO - --DOMWINDOW == 41 (0x7f4b09e52000) [pid = 2212] [serial = 2346] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:56 INFO - --DOMWINDOW == 40 (0x7f4afc861800) [pid = 2212] [serial = 2344] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:56 INFO - --DOMWINDOW == 39 (0x7f4b0984c400) [pid = 2212] [serial = 2342] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:56 INFO - --DOMWINDOW == 38 (0x7f4afd3aec00) [pid = 2212] [serial = 2340] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:56 INFO - --DOMWINDOW == 37 (0x7f4afde6a000) [pid = 2212] [serial = 2338] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:06:56 INFO - --DOMWINDOW == 36 (0x7f4afe57fc00) [pid = 2212] [serial = 2332] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:06:56 INFO - --DOMWINDOW == 35 (0x7f4afe8bfc00) [pid = 2212] [serial = 2371] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:06:56 INFO - --DOMWINDOW == 34 (0x7f4afe0abc00) [pid = 2212] [serial = 2368] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:06:56 INFO - --DOMWINDOW == 33 (0x7f4afcf2c800) [pid = 2212] [serial = 2364] [outer = (nil)] [url = about:blank] 14:06:56 INFO - --DOMWINDOW == 32 (0x7f4afe009000) [pid = 2212] [serial = 2366] [outer = (nil)] [url = data:text/html;charset=utf8,<p>hello%20world,%20bug%20916997] 14:06:56 INFO - --DOMWINDOW == 31 (0x7f4afd3a6400) [pid = 2212] [serial = 2365] [outer = (nil)] [url = about:blank] 14:06:56 INFO - --DOMWINDOW == 30 (0x7f4afe017400) [pid = 2212] [serial = 2367] [outer = (nil)] [url = about:blank] 14:06:56 INFO - --DOMWINDOW == 29 (0x7f4afe0acc00) [pid = 2212] [serial = 2376] [outer = (nil)] [url = about:blank] 14:06:56 INFO - --DOMWINDOW == 28 (0x7f4afe8a8000) [pid = 2212] [serial = 2381] [outer = (nil)] [url = about:blank] 14:06:56 INFO - MEMORY STAT | vsize 1180MB | residentFast 319MB | heapAllocated 125MB 14:06:56 INFO - 420 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_01.js | took 11582ms 14:06:56 INFO - ++DOCSHELL 0x7f4afcece800 == 12 [pid = 2212] [id = 996] 14:06:56 INFO - ++DOMWINDOW == 29 (0x7f4afcf2e800) [pid = 2212] [serial = 2385] [outer = (nil)] 14:06:56 INFO - ++DOMWINDOW == 30 (0x7f4afde6ac00) [pid = 2212] [serial = 2386] [outer = 0x7f4afcf2e800] 14:06:56 INFO - 421 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_02.js 14:06:56 INFO - ++DOCSHELL 0x7f4b0949b800 == 13 [pid = 2212] [id = 997] 14:06:56 INFO - ++DOMWINDOW == 31 (0x7f4afe1f2000) [pid = 2212] [serial = 2387] [outer = (nil)] 14:06:56 INFO - ++DOMWINDOW == 32 (0x7f4afe3e4000) [pid = 2212] [serial = 2388] [outer = 0x7f4afe1f2000] 14:06:57 INFO - ++DOMWINDOW == 33 (0x7f4afd94fc00) [pid = 2212] [serial = 2389] [outer = 0x7f4afe1f2000] 14:06:57 INFO - ++DOCSHELL 0x7f4b0fa20000 == 14 [pid = 2212] [id = 998] 14:06:57 INFO - ++DOMWINDOW == 34 (0x7f4afe8a3800) [pid = 2212] [serial = 2390] [outer = (nil)] 14:06:57 INFO - ++DOMWINDOW == 35 (0x7f4afe8b7800) [pid = 2212] [serial = 2391] [outer = 0x7f4afe8a3800] 14:06:57 INFO - ++DOCSHELL 0x7f4b0c023000 == 15 [pid = 2212] [id = 999] 14:06:57 INFO - ++DOMWINDOW == 36 (0x7f4afe8c3400) [pid = 2212] [serial = 2392] [outer = (nil)] 14:06:57 INFO - ++DOMWINDOW == 37 (0x7f4afe8c5000) [pid = 2212] [serial = 2393] [outer = 0x7f4afe8c3400] 14:06:57 INFO - ++DOMWINDOW == 38 (0x7f4aff332c00) [pid = 2212] [serial = 2394] [outer = 0x7f4afe8c3400] 14:06:57 INFO - ++DOCSHELL 0x7f4b10a8a000 == 16 [pid = 2212] [id = 1000] 14:06:57 INFO - ++DOMWINDOW == 39 (0x7f4b00f57c00) [pid = 2212] [serial = 2395] [outer = (nil)] 14:06:57 INFO - ++DOMWINDOW == 40 (0x7f4b00f63400) [pid = 2212] [serial = 2396] [outer = 0x7f4b00f57c00] 14:06:59 INFO - ++DOCSHELL 0x7f4afce89800 == 17 [pid = 2212] [id = 1001] 14:06:59 INFO - ++DOMWINDOW == 41 (0x7f4b0fbb6c00) [pid = 2212] [serial = 2397] [outer = (nil)] 14:06:59 INFO - ++DOMWINDOW == 42 (0x7f4b0fbb8000) [pid = 2212] [serial = 2398] [outer = 0x7f4b0fbb6c00] 14:07:00 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:07:00 INFO - ++DOCSHELL 0x7f4afcec5800 == 18 [pid = 2212] [id = 1002] 14:07:00 INFO - ++DOMWINDOW == 43 (0x7f4afc860800) [pid = 2212] [serial = 2399] [outer = (nil)] 14:07:00 INFO - ++DOMWINDOW == 44 (0x7f4afc861400) [pid = 2212] [serial = 2400] [outer = 0x7f4afc860800] 14:07:00 INFO - ++DOCSHELL 0x7f4afe3a0000 == 19 [pid = 2212] [id = 1003] 14:07:00 INFO - ++DOMWINDOW == 45 (0x7f4afc868000) [pid = 2212] [serial = 2401] [outer = (nil)] 14:07:00 INFO - ++DOCSHELL 0x7f4aff217800 == 20 [pid = 2212] [id = 1004] 14:07:00 INFO - ++DOMWINDOW == 46 (0x7f4afcf23000) [pid = 2212] [serial = 2402] [outer = (nil)] 14:07:00 INFO - ++DOCSHELL 0x7f4aff221000 == 21 [pid = 2212] [id = 1005] 14:07:00 INFO - ++DOMWINDOW == 47 (0x7f4afcf25800) [pid = 2212] [serial = 2403] [outer = (nil)] 14:07:00 INFO - ++DOCSHELL 0x7f4aff273800 == 22 [pid = 2212] [id = 1006] 14:07:00 INFO - ++DOMWINDOW == 48 (0x7f4afcf27400) [pid = 2212] [serial = 2404] [outer = (nil)] 14:07:00 INFO - ++DOCSHELL 0x7f4afce79000 == 23 [pid = 2212] [id = 1007] 14:07:00 INFO - ++DOMWINDOW == 49 (0x7f4afcf28400) [pid = 2212] [serial = 2405] [outer = (nil)] 14:07:00 INFO - ++DOMWINDOW == 50 (0x7f4afd037000) [pid = 2212] [serial = 2406] [outer = 0x7f4afc868000] 14:07:00 INFO - ++DOMWINDOW == 51 (0x7f4afd3a3800) [pid = 2212] [serial = 2407] [outer = 0x7f4afcf23000] 14:07:00 INFO - ++DOMWINDOW == 52 (0x7f4afd947000) [pid = 2212] [serial = 2408] [outer = 0x7f4afcf25800] 14:07:00 INFO - ++DOMWINDOW == 53 (0x7f4afd951c00) [pid = 2212] [serial = 2409] [outer = 0x7f4afcf27400] 14:07:00 INFO - ++DOMWINDOW == 54 (0x7f4afe00ec00) [pid = 2212] [serial = 2410] [outer = 0x7f4afcf28400] 14:07:00 INFO - ++DOCSHELL 0x7f4b10bcf800 == 24 [pid = 2212] [id = 1008] 14:07:00 INFO - ++DOMWINDOW == 55 (0x7f4b012d1400) [pid = 2212] [serial = 2411] [outer = (nil)] 14:07:00 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:07:00 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:07:00 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:07:00 INFO - ++DOCSHELL 0x7f4b1206e000 == 25 [pid = 2212] [id = 1009] 14:07:00 INFO - ++DOMWINDOW == 56 (0x7f4b09bc2400) [pid = 2212] [serial = 2412] [outer = (nil)] 14:07:00 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:07:00 INFO - ++DOMWINDOW == 57 (0x7f4b09e60c00) [pid = 2212] [serial = 2413] [outer = 0x7f4b012d1400] 14:07:01 INFO - ++DOMWINDOW == 58 (0x7f4b0c1a8800) [pid = 2212] [serial = 2414] [outer = 0x7f4b09bc2400] 14:07:01 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:07:01 INFO - ++DOCSHELL 0x7f4b10aec800 == 26 [pid = 2212] [id = 1010] 14:07:01 INFO - ++DOMWINDOW == 59 (0x7f4b0a662000) [pid = 2212] [serial = 2415] [outer = (nil)] 14:07:01 INFO - ++DOCSHELL 0x7f4b1275d000 == 27 [pid = 2212] [id = 1011] 14:07:01 INFO - ++DOMWINDOW == 60 (0x7f4b0c4e1400) [pid = 2212] [serial = 2416] [outer = (nil)] 14:07:01 INFO - ++DOCSHELL 0x7f4b12e62000 == 28 [pid = 2212] [id = 1012] 14:07:01 INFO - ++DOMWINDOW == 61 (0x7f4b0c4e2400) [pid = 2212] [serial = 2417] [outer = (nil)] 14:07:01 INFO - ++DOCSHELL 0x7f4b141ea800 == 29 [pid = 2212] [id = 1013] 14:07:01 INFO - ++DOMWINDOW == 62 (0x7f4b0c4e4000) [pid = 2212] [serial = 2418] [outer = (nil)] 14:07:01 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:07:01 INFO - ++DOCSHELL 0x7f4afcec9800 == 30 [pid = 2212] [id = 1014] 14:07:01 INFO - ++DOMWINDOW == 63 (0x7f4b0c4e6000) [pid = 2212] [serial = 2419] [outer = (nil)] 14:07:01 INFO - ++DOMWINDOW == 64 (0x7f4b0c4e7000) [pid = 2212] [serial = 2420] [outer = 0x7f4b0c4e6000] 14:07:02 INFO - ++DOMWINDOW == 65 (0x7f4b12bd7c00) [pid = 2212] [serial = 2421] [outer = 0x7f4b0a662000] 14:07:02 INFO - ++DOMWINDOW == 66 (0x7f4b12e38c00) [pid = 2212] [serial = 2422] [outer = 0x7f4b0c4e1400] 14:07:02 INFO - ++DOMWINDOW == 67 (0x7f4b12f21000) [pid = 2212] [serial = 2423] [outer = 0x7f4b0c4e2400] 14:07:02 INFO - ++DOMWINDOW == 68 (0x7f4b12f2a800) [pid = 2212] [serial = 2424] [outer = 0x7f4b0c4e4000] 14:07:02 INFO - ++DOMWINDOW == 69 (0x7f4b13008400) [pid = 2212] [serial = 2425] [outer = 0x7f4b0c4e6000] 14:07:02 INFO - [2212] WARNING: gtk_clipboard_set_with_data: assertion `targets != NULL' failed: 'glib warning', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/xre/nsSigHandlers.cpp, line 142 14:07:02 INFO - (firefox:2212): Gtk-CRITICAL **: gtk_clipboard_set_with_data: assertion `targets != NULL' failed 14:07:04 INFO - [2212] WARNING: gtk_clipboard_set_with_data: assertion `targets != NULL' failed: 'glib warning', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/xre/nsSigHandlers.cpp, line 142 14:07:04 INFO - (firefox:2212): Gtk-CRITICAL **: gtk_clipboard_set_with_data: assertion `targets != NULL' failed 14:07:06 INFO - [2212] WARNING: gtk_clipboard_set_with_data: assertion `targets != NULL' failed: 'glib warning', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/xre/nsSigHandlers.cpp, line 142 14:07:06 INFO - (firefox:2212): Gtk-CRITICAL **: gtk_clipboard_set_with_data: assertion `targets != NULL' failed 14:07:07 INFO - [2212] WARNING: gtk_clipboard_set_with_data: assertion `targets != NULL' failed: 'glib warning', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/xre/nsSigHandlers.cpp, line 142 14:07:07 INFO - (firefox:2212): Gtk-CRITICAL **: gtk_clipboard_set_with_data: assertion `targets != NULL' failed 14:07:09 INFO - --DOCSHELL 0x7f4b1275d000 == 29 [pid = 2212] [id = 1011] 14:07:09 INFO - --DOCSHELL 0x7f4b12e62000 == 28 [pid = 2212] [id = 1012] 14:07:09 INFO - --DOCSHELL 0x7f4b10aec800 == 27 [pid = 2212] [id = 1010] 14:07:09 INFO - --DOCSHELL 0x7f4b141ea800 == 26 [pid = 2212] [id = 1013] 14:07:09 INFO - --DOCSHELL 0x7f4b1206e000 == 25 [pid = 2212] [id = 1009] 14:07:09 INFO - --DOCSHELL 0x7f4b10bcf800 == 24 [pid = 2212] [id = 1008] 14:07:10 INFO - --DOCSHELL 0x7f4b09497800 == 23 [pid = 2212] [id = 993] 14:07:10 INFO - --DOCSHELL 0x7f4afcec9800 == 22 [pid = 2212] [id = 1014] 14:07:10 INFO - --DOCSHELL 0x7f4b0949b000 == 21 [pid = 2212] [id = 992] 14:07:10 INFO - --DOCSHELL 0x7f4b10a8a000 == 20 [pid = 2212] [id = 1000] 14:07:10 INFO - --DOCSHELL 0x7f4afce89800 == 19 [pid = 2212] [id = 1001] 14:07:10 INFO - --DOCSHELL 0x7f4afcec5800 == 18 [pid = 2212] [id = 1002] 14:07:10 INFO - --DOCSHELL 0x7f4afce7d800 == 17 [pid = 2212] [id = 991] 14:07:10 INFO - --DOCSHELL 0x7f4afe3a0000 == 16 [pid = 2212] [id = 1003] 14:07:10 INFO - --DOCSHELL 0x7f4aff217800 == 15 [pid = 2212] [id = 1004] 14:07:10 INFO - --DOCSHELL 0x7f4aff221000 == 14 [pid = 2212] [id = 1005] 14:07:10 INFO - --DOCSHELL 0x7f4aff273800 == 13 [pid = 2212] [id = 1006] 14:07:10 INFO - --DOCSHELL 0x7f4afce79000 == 12 [pid = 2212] [id = 1007] 14:07:10 INFO - --DOMWINDOW == 68 (0x7f4afe819c00) [pid = 2212] [serial = 2370] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:07:10 INFO - --DOMWINDOW == 67 (0x7f4afe8c2800) [pid = 2212] [serial = 2372] [outer = (nil)] [url = about:blank] 14:07:11 INFO - --DOMWINDOW == 66 (0x7f4b0c4e1400) [pid = 2212] [serial = 2416] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 14:07:11 INFO - --DOMWINDOW == 65 (0x7f4b0c4e2400) [pid = 2212] [serial = 2417] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 14:07:11 INFO - --DOMWINDOW == 64 (0x7f4b0a662000) [pid = 2212] [serial = 2415] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:07:11 INFO - --DOMWINDOW == 63 (0x7f4b0c4e4000) [pid = 2212] [serial = 2418] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 14:07:11 INFO - --DOMWINDOW == 62 (0x7f4afcf23000) [pid = 2212] [serial = 2402] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 14:07:11 INFO - --DOMWINDOW == 61 (0x7f4b00f24c00) [pid = 2212] [serial = 2383] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:07:11 INFO - --DOMWINDOW == 60 (0x7f4afe8a7000) [pid = 2212] [serial = 2380] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:07:11 INFO - --DOMWINDOW == 59 (0x7f4afcf25c00) [pid = 2212] [serial = 2373] [outer = (nil)] [url = about:blank] 14:07:11 INFO - --DOMWINDOW == 58 (0x7f4afe00d400) [pid = 2212] [serial = 2375] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 14:07:11 INFO - --DOMWINDOW == 57 (0x7f4afe815800) [pid = 2212] [serial = 2378] [outer = (nil)] [url = data:text/html,<p>hello%20from%20iframe</p>] 14:07:11 INFO - --DOMWINDOW == 56 (0x7f4b0c4e6000) [pid = 2212] [serial = 2419] [outer = (nil)] [url = data:text/html,<html></html>] 14:07:11 INFO - --DOMWINDOW == 55 (0x7f4afe8c5000) [pid = 2212] [serial = 2393] [outer = (nil)] [url = about:blank] 14:07:11 INFO - --DOMWINDOW == 54 (0x7f4b09bc2400) [pid = 2212] [serial = 2412] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:07:11 INFO - --DOMWINDOW == 53 (0x7f4afcf25800) [pid = 2212] [serial = 2403] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 14:07:11 INFO - --DOMWINDOW == 52 (0x7f4afcf27400) [pid = 2212] [serial = 2404] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 14:07:11 INFO - --DOMWINDOW == 51 (0x7f4b012d1400) [pid = 2212] [serial = 2411] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:07:11 INFO - --DOMWINDOW == 50 (0x7f4b0c4e7000) [pid = 2212] [serial = 2420] [outer = (nil)] [url = about:blank] 14:07:11 INFO - --DOMWINDOW == 49 (0x7f4b13008400) [pid = 2212] [serial = 2425] [outer = (nil)] [url = data:text/html,<html></html>] 14:07:11 INFO - --DOMWINDOW == 48 (0x7f4afe3e4000) [pid = 2212] [serial = 2388] [outer = (nil)] [url = about:blank] 14:07:11 INFO - --DOMWINDOW == 47 (0x7f4afd3a5c00) [pid = 2212] [serial = 2374] [outer = (nil)] [url = about:blank] 14:07:11 INFO - --DOMWINDOW == 46 (0x7f4afe54f800) [pid = 2212] [serial = 2379] [outer = (nil)] [url = data:text/html,<p>hello%20from%20iframe</p>] 14:07:11 INFO - --DOMWINDOW == 45 (0x7f4afc868000) [pid = 2212] [serial = 2401] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 14:07:11 INFO - --DOCSHELL 0x7f4b0fa20000 == 11 [pid = 2212] [id = 998] 14:07:11 INFO - --DOMWINDOW == 44 (0x7f4b07d76c00) [pid = 2212] [serial = 2377] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 14:07:11 INFO - MEMORY STAT | vsize 1176MB | residentFast 321MB | heapAllocated 127MB 14:07:11 INFO - 422 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_02.js | took 14785ms 14:07:11 INFO - ++DOCSHELL 0x7f4afcec5800 == 12 [pid = 2212] [id = 1015] 14:07:11 INFO - ++DOMWINDOW == 45 (0x7f4afcf27800) [pid = 2212] [serial = 2426] [outer = (nil)] 14:07:11 INFO - ++DOMWINDOW == 46 (0x7f4afd88bc00) [pid = 2212] [serial = 2427] [outer = 0x7f4afcf27800] 14:07:11 INFO - 423 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_03.js 14:07:11 INFO - ++DOCSHELL 0x7f4b07d87000 == 13 [pid = 2212] [id = 1016] 14:07:11 INFO - ++DOMWINDOW == 47 (0x7f4afd894400) [pid = 2212] [serial = 2428] [outer = (nil)] 14:07:11 INFO - ++DOMWINDOW == 48 (0x7f4afd896800) [pid = 2212] [serial = 2429] [outer = 0x7f4afd894400] 14:07:12 INFO - ++DOMWINDOW == 49 (0x7f4afde6a400) [pid = 2212] [serial = 2430] [outer = 0x7f4afd894400] 14:07:12 INFO - ++DOCSHELL 0x7f4b0f7a6000 == 14 [pid = 2212] [id = 1017] 14:07:12 INFO - ++DOMWINDOW == 50 (0x7f4afe0ae000) [pid = 2212] [serial = 2431] [outer = (nil)] 14:07:12 INFO - ++DOMWINDOW == 51 (0x7f4afe1f2400) [pid = 2212] [serial = 2432] [outer = 0x7f4afe0ae000] 14:07:12 INFO - ++DOCSHELL 0x7f4b07d9b800 == 15 [pid = 2212] [id = 1018] 14:07:12 INFO - ++DOMWINDOW == 52 (0x7f4afe54ec00) [pid = 2212] [serial = 2433] [outer = (nil)] 14:07:12 INFO - ++DOMWINDOW == 53 (0x7f4afe571800) [pid = 2212] [serial = 2434] [outer = 0x7f4afe54ec00] 14:07:12 INFO - ++DOMWINDOW == 54 (0x7f4afe8ab000) [pid = 2212] [serial = 2435] [outer = 0x7f4afe54ec00] 14:07:12 INFO - ++DOCSHELL 0x7f4b10a88800 == 16 [pid = 2212] [id = 1019] 14:07:12 INFO - ++DOMWINDOW == 55 (0x7f4aff335000) [pid = 2212] [serial = 2436] [outer = (nil)] 14:07:12 INFO - ++DOMWINDOW == 56 (0x7f4aff337800) [pid = 2212] [serial = 2437] [outer = 0x7f4aff335000] 14:07:14 INFO - ++DOCSHELL 0x7f4afce91800 == 17 [pid = 2212] [id = 1020] 14:07:14 INFO - ++DOMWINDOW == 57 (0x7f4b09e5b000) [pid = 2212] [serial = 2438] [outer = (nil)] 14:07:14 INFO - ++DOMWINDOW == 58 (0x7f4b0a662000) [pid = 2212] [serial = 2439] [outer = 0x7f4b09e5b000] 14:07:15 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:07:15 INFO - ++DOCSHELL 0x7f4afce89800 == 18 [pid = 2212] [id = 1021] 14:07:15 INFO - ++DOMWINDOW == 59 (0x7f4afc85b800) [pid = 2212] [serial = 2440] [outer = (nil)] 14:07:15 INFO - ++DOMWINDOW == 60 (0x7f4afc860c00) [pid = 2212] [serial = 2441] [outer = 0x7f4afc85b800] 14:07:15 INFO - ++DOCSHELL 0x7f4afdc09000 == 19 [pid = 2212] [id = 1022] 14:07:15 INFO - ++DOMWINDOW == 61 (0x7f4afc868000) [pid = 2212] [serial = 2442] [outer = (nil)] 14:07:15 INFO - ++DOCSHELL 0x7f4afdc1e800 == 20 [pid = 2212] [id = 1023] 14:07:15 INFO - ++DOMWINDOW == 62 (0x7f4afcf25800) [pid = 2212] [serial = 2443] [outer = (nil)] 14:07:15 INFO - ++DOCSHELL 0x7f4b0176f800 == 21 [pid = 2212] [id = 1024] 14:07:15 INFO - ++DOMWINDOW == 63 (0x7f4afcf2ac00) [pid = 2212] [serial = 2444] [outer = (nil)] 14:07:15 INFO - ++DOCSHELL 0x7f4b07c1f000 == 22 [pid = 2212] [id = 1025] 14:07:15 INFO - ++DOMWINDOW == 64 (0x7f4afcf30400) [pid = 2212] [serial = 2445] [outer = (nil)] 14:07:15 INFO - ++DOCSHELL 0x7f4b07c2b000 == 23 [pid = 2212] [id = 1026] 14:07:15 INFO - ++DOMWINDOW == 65 (0x7f4afd041c00) [pid = 2212] [serial = 2446] [outer = (nil)] 14:07:15 INFO - ++DOMWINDOW == 66 (0x7f4afd88f800) [pid = 2212] [serial = 2447] [outer = 0x7f4afc868000] 14:07:15 INFO - ++DOMWINDOW == 67 (0x7f4afd891c00) [pid = 2212] [serial = 2448] [outer = 0x7f4afcf25800] 14:07:15 INFO - ++DOMWINDOW == 68 (0x7f4afd899400) [pid = 2212] [serial = 2449] [outer = 0x7f4afcf2ac00] 14:07:15 INFO - ++DOMWINDOW == 69 (0x7f4afd943400) [pid = 2212] [serial = 2450] [outer = 0x7f4afcf30400] 14:07:15 INFO - ++DOMWINDOW == 70 (0x7f4afd951800) [pid = 2212] [serial = 2451] [outer = 0x7f4afd041c00] 14:07:15 INFO - ++DOCSHELL 0x7f4b12768000 == 24 [pid = 2212] [id = 1027] 14:07:15 INFO - ++DOMWINDOW == 71 (0x7f4b07d71400) [pid = 2212] [serial = 2452] [outer = (nil)] 14:07:15 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:07:15 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:07:15 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:07:15 INFO - ++DOCSHELL 0x7f4b12e5a000 == 25 [pid = 2212] [id = 1028] 14:07:15 INFO - ++DOMWINDOW == 72 (0x7f4b09622000) [pid = 2212] [serial = 2453] [outer = (nil)] 14:07:15 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:07:16 INFO - ++DOMWINDOW == 73 (0x7f4afd88b800) [pid = 2212] [serial = 2454] [outer = 0x7f4b07d71400] 14:07:16 INFO - ++DOMWINDOW == 74 (0x7f4afe81f000) [pid = 2212] [serial = 2455] [outer = 0x7f4b09622000] 14:07:16 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:07:16 INFO - ++DOCSHELL 0x7f4b14c3b000 == 26 [pid = 2212] [id = 1029] 14:07:16 INFO - ++DOMWINDOW == 75 (0x7f4afde64000) [pid = 2212] [serial = 2456] [outer = (nil)] 14:07:16 INFO - ++DOCSHELL 0x7f4b14c42000 == 27 [pid = 2212] [id = 1030] 14:07:16 INFO - ++DOMWINDOW == 76 (0x7f4b0c4e9400) [pid = 2212] [serial = 2457] [outer = (nil)] 14:07:16 INFO - ++DOCSHELL 0x7f4b1560f800 == 28 [pid = 2212] [id = 1031] 14:07:16 INFO - ++DOMWINDOW == 77 (0x7f4b0c4eac00) [pid = 2212] [serial = 2458] [outer = (nil)] 14:07:16 INFO - ++DOCSHELL 0x7f4b1578a000 == 29 [pid = 2212] [id = 1032] 14:07:16 INFO - ++DOMWINDOW == 78 (0x7f4b0a861800) [pid = 2212] [serial = 2459] [outer = (nil)] 14:07:16 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:07:16 INFO - ++DOCSHELL 0x7f4b1578b000 == 30 [pid = 2212] [id = 1033] 14:07:16 INFO - ++DOMWINDOW == 79 (0x7f4b0c8f3800) [pid = 2212] [serial = 2460] [outer = (nil)] 14:07:16 INFO - ++DOMWINDOW == 80 (0x7f4b0ca84400) [pid = 2212] [serial = 2461] [outer = 0x7f4b0c8f3800] 14:07:16 INFO - ++DOMWINDOW == 81 (0x7f4b0fb82800) [pid = 2212] [serial = 2462] [outer = 0x7f4afde64000] 14:07:16 INFO - ++DOMWINDOW == 82 (0x7f4b10b03800) [pid = 2212] [serial = 2463] [outer = 0x7f4b0c4e9400] 14:07:16 INFO - ++DOMWINDOW == 83 (0x7f4b10b05400) [pid = 2212] [serial = 2464] [outer = 0x7f4b0c4eac00] 14:07:16 INFO - ++DOMWINDOW == 84 (0x7f4b11db9800) [pid = 2212] [serial = 2465] [outer = 0x7f4b0a861800] 14:07:16 INFO - ++DOMWINDOW == 85 (0x7f4b11ee6400) [pid = 2212] [serial = 2466] [outer = 0x7f4b0c8f3800] 14:07:18 INFO - --DOCSHELL 0x7f4b14c42000 == 29 [pid = 2212] [id = 1030] 14:07:18 INFO - --DOCSHELL 0x7f4b1560f800 == 28 [pid = 2212] [id = 1031] 14:07:18 INFO - --DOCSHELL 0x7f4b14c3b000 == 27 [pid = 2212] [id = 1029] 14:07:18 INFO - --DOCSHELL 0x7f4b1578a000 == 26 [pid = 2212] [id = 1032] 14:07:18 INFO - --DOCSHELL 0x7f4b12e5a000 == 25 [pid = 2212] [id = 1028] 14:07:18 INFO - --DOCSHELL 0x7f4b12768000 == 24 [pid = 2212] [id = 1027] 14:07:19 INFO - --DOCSHELL 0x7f4b1578b000 == 23 [pid = 2212] [id = 1033] 14:07:19 INFO - --DOCSHELL 0x7f4afcece800 == 22 [pid = 2212] [id = 996] 14:07:19 INFO - --DOCSHELL 0x7f4b0949b800 == 21 [pid = 2212] [id = 997] 14:07:19 INFO - --DOCSHELL 0x7f4b0c023000 == 20 [pid = 2212] [id = 999] 14:07:19 INFO - --DOCSHELL 0x7f4b07d9b800 == 19 [pid = 2212] [id = 1018] 14:07:19 INFO - --DOCSHELL 0x7f4b10a88800 == 18 [pid = 2212] [id = 1019] 14:07:19 INFO - --DOCSHELL 0x7f4afce91800 == 17 [pid = 2212] [id = 1020] 14:07:19 INFO - --DOCSHELL 0x7f4afce89800 == 16 [pid = 2212] [id = 1021] 14:07:19 INFO - --DOMWINDOW == 84 (0x7f4afd037000) [pid = 2212] [serial = 2406] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 14:07:19 INFO - --DOMWINDOW == 83 (0x7f4afd3a3800) [pid = 2212] [serial = 2407] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 14:07:19 INFO - --DOMWINDOW == 82 (0x7f4afd947000) [pid = 2212] [serial = 2408] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 14:07:19 INFO - --DOMWINDOW == 81 (0x7f4afd951c00) [pid = 2212] [serial = 2409] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 14:07:19 INFO - --DOMWINDOW == 80 (0x7f4b0c1a8800) [pid = 2212] [serial = 2414] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:07:19 INFO - --DOMWINDOW == 79 (0x7f4b12bd7c00) [pid = 2212] [serial = 2421] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:07:19 INFO - --DOMWINDOW == 78 (0x7f4b12e38c00) [pid = 2212] [serial = 2422] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 14:07:19 INFO - --DOMWINDOW == 77 (0x7f4b12f21000) [pid = 2212] [serial = 2423] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 14:07:19 INFO - --DOMWINDOW == 76 (0x7f4b12f2a800) [pid = 2212] [serial = 2424] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 14:07:19 INFO - --DOMWINDOW == 75 (0x7f4afe8b6400) [pid = 2212] [serial = 2382] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:07:19 INFO - --DOMWINDOW == 74 (0x7f4b00f2ec00) [pid = 2212] [serial = 2384] [outer = (nil)] [url = about:blank] 14:07:19 INFO - --DOMWINDOW == 73 (0x7f4b09e60c00) [pid = 2212] [serial = 2413] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:07:20 INFO - --DOMWINDOW == 72 (0x7f4afcf2e800) [pid = 2212] [serial = 2385] [outer = (nil)] [url = about:blank] 14:07:20 INFO - --DOMWINDOW == 71 (0x7f4afe1f2000) [pid = 2212] [serial = 2387] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 14:07:20 INFO - --DOMWINDOW == 70 (0x7f4afe8a3800) [pid = 2212] [serial = 2390] [outer = (nil)] [url = data:text/html,<p>hello%20from%20iframe</p>] 14:07:20 INFO - --DOMWINDOW == 69 (0x7f4afcf28400) [pid = 2212] [serial = 2405] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 14:07:20 INFO - --DOMWINDOW == 68 (0x7f4afc860800) [pid = 2212] [serial = 2399] [outer = (nil)] [url = chrome://devtools/content/markupview/markup-view.xhtml] 14:07:20 INFO - --DOMWINDOW == 67 (0x7f4b0c4e9400) [pid = 2212] [serial = 2457] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 14:07:20 INFO - --DOMWINDOW == 66 (0x7f4b0a861800) [pid = 2212] [serial = 2459] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 14:07:20 INFO - --DOMWINDOW == 65 (0x7f4b0c8f3800) [pid = 2212] [serial = 2460] [outer = (nil)] [url = data:text/html,<html></html>] 14:07:20 INFO - --DOMWINDOW == 64 (0x7f4b0ca84400) [pid = 2212] [serial = 2461] [outer = (nil)] [url = about:blank] 14:07:20 INFO - --DOMWINDOW == 63 (0x7f4b09622000) [pid = 2212] [serial = 2453] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:07:20 INFO - --DOMWINDOW == 62 (0x7f4afcf25800) [pid = 2212] [serial = 2443] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 14:07:20 INFO - --DOMWINDOW == 61 (0x7f4afcf2ac00) [pid = 2212] [serial = 2444] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 14:07:20 INFO - --DOMWINDOW == 60 (0x7f4afcf30400) [pid = 2212] [serial = 2445] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 14:07:20 INFO - --DOMWINDOW == 59 (0x7f4afe8c3400) [pid = 2212] [serial = 2392] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:07:20 INFO - --DOMWINDOW == 58 (0x7f4b00f57c00) [pid = 2212] [serial = 2395] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:07:20 INFO - --DOMWINDOW == 57 (0x7f4b0fbb6c00) [pid = 2212] [serial = 2397] [outer = (nil)] [url = chrome://devtools/content/inspector/inspector.xul] 14:07:20 INFO - --DOMWINDOW == 56 (0x7f4b07d71400) [pid = 2212] [serial = 2452] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:07:20 INFO - --DOMWINDOW == 55 (0x7f4afde6ac00) [pid = 2212] [serial = 2386] [outer = (nil)] [url = about:blank] 14:07:20 INFO - --DOMWINDOW == 54 (0x7f4afe8b7800) [pid = 2212] [serial = 2391] [outer = (nil)] [url = data:text/html,<p>hello%20from%20iframe</p>] 14:07:20 INFO - --DOMWINDOW == 53 (0x7f4afd896800) [pid = 2212] [serial = 2429] [outer = (nil)] [url = about:blank] 14:07:20 INFO - --DOMWINDOW == 52 (0x7f4afe571800) [pid = 2212] [serial = 2434] [outer = (nil)] [url = about:blank] 14:07:20 INFO - --DOMWINDOW == 51 (0x7f4b11ee6400) [pid = 2212] [serial = 2466] [outer = (nil)] [url = data:text/html,<html></html>] 14:07:20 INFO - --DOCSHELL 0x7f4b0f7a6000 == 15 [pid = 2212] [id = 1017] 14:07:20 INFO - --DOMWINDOW == 50 (0x7f4afd94fc00) [pid = 2212] [serial = 2389] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 14:07:20 INFO - --DOMWINDOW == 49 (0x7f4afe00ec00) [pid = 2212] [serial = 2410] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 14:07:20 INFO - MEMORY STAT | vsize 1180MB | residentFast 328MB | heapAllocated 128MB 14:07:20 INFO - 424 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_03.js | took 8652ms 14:07:20 INFO - ++DOCSHELL 0x7f4afcec5000 == 16 [pid = 2212] [id = 1034] 14:07:20 INFO - ++DOMWINDOW == 50 (0x7f4afcf26800) [pid = 2212] [serial = 2467] [outer = (nil)] 14:07:20 INFO - ++DOMWINDOW == 51 (0x7f4afcf2e800) [pid = 2212] [serial = 2468] [outer = 0x7f4afcf26800] 14:07:20 INFO - 425 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_04.js 14:07:20 INFO - ++DOCSHELL 0x7f4b094a9000 == 17 [pid = 2212] [id = 1035] 14:07:20 INFO - ++DOMWINDOW == 52 (0x7f4afd894c00) [pid = 2212] [serial = 2469] [outer = (nil)] 14:07:20 INFO - ++DOMWINDOW == 53 (0x7f4afd899800) [pid = 2212] [serial = 2470] [outer = 0x7f4afd894c00] 14:07:21 INFO - ++DOMWINDOW == 54 (0x7f4afe00d400) [pid = 2212] [serial = 2471] [outer = 0x7f4afd894c00] 14:07:21 INFO - ++DOCSHELL 0x7f4b0fa26000 == 18 [pid = 2212] [id = 1036] 14:07:21 INFO - ++DOMWINDOW == 55 (0x7f4afe0b2800) [pid = 2212] [serial = 2472] [outer = (nil)] 14:07:21 INFO - ++DOMWINDOW == 56 (0x7f4afe1f3000) [pid = 2212] [serial = 2473] [outer = 0x7f4afe0b2800] 14:07:21 INFO - ++DOCSHELL 0x7f4b07c20000 == 19 [pid = 2212] [id = 1037] 14:07:21 INFO - ++DOMWINDOW == 57 (0x7f4afe4c5800) [pid = 2212] [serial = 2474] [outer = (nil)] 14:07:21 INFO - ++DOMWINDOW == 58 (0x7f4afe54f400) [pid = 2212] [serial = 2475] [outer = 0x7f4afe4c5800] 14:07:21 INFO - ++DOMWINDOW == 59 (0x7f4afe8aec00) [pid = 2212] [serial = 2476] [outer = 0x7f4afe4c5800] 14:07:21 INFO - ++DOCSHELL 0x7f4b10ace000 == 20 [pid = 2212] [id = 1038] 14:07:21 INFO - ++DOMWINDOW == 60 (0x7f4aff33b400) [pid = 2212] [serial = 2477] [outer = (nil)] 14:07:21 INFO - ++DOMWINDOW == 61 (0x7f4aff341000) [pid = 2212] [serial = 2478] [outer = 0x7f4aff33b400] 14:07:25 INFO - ++DOMWINDOW == 62 (0x7f4afe81a400) [pid = 2212] [serial = 2479] [outer = 0x7f4afd894c00] 14:07:25 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:07:25 INFO - ++DOCSHELL 0x7f4b10bc9800 == 21 [pid = 2212] [id = 1039] 14:07:25 INFO - ++DOMWINDOW == 63 (0x7f4afe550c00) [pid = 2212] [serial = 2480] [outer = (nil)] 14:07:25 INFO - ++DOMWINDOW == 64 (0x7f4afe8a8000) [pid = 2212] [serial = 2481] [outer = 0x7f4afe550c00] 14:07:25 INFO - ++DOCSHELL 0x7f4b10aec800 == 22 [pid = 2212] [id = 1040] 14:07:25 INFO - ++DOMWINDOW == 65 (0x7f4b09bb6c00) [pid = 2212] [serial = 2482] [outer = (nil)] 14:07:25 INFO - ++DOMWINDOW == 66 (0x7f4b09bbac00) [pid = 2212] [serial = 2483] [outer = 0x7f4b09bb6c00] 14:07:26 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:07:26 INFO - ++DOCSHELL 0x7f4b12751800 == 23 [pid = 2212] [id = 1041] 14:07:26 INFO - ++DOMWINDOW == 67 (0x7f4b09e57000) [pid = 2212] [serial = 2484] [outer = (nil)] 14:07:26 INFO - ++DOMWINDOW == 68 (0x7f4b0a867c00) [pid = 2212] [serial = 2485] [outer = 0x7f4b09e57000] 14:07:26 INFO - ++DOCSHELL 0x7f4b129ac800 == 24 [pid = 2212] [id = 1042] 14:07:26 INFO - ++DOMWINDOW == 69 (0x7f4b0f987800) [pid = 2212] [serial = 2486] [outer = (nil)] 14:07:26 INFO - ++DOCSHELL 0x7f4b129b4800 == 25 [pid = 2212] [id = 1043] 14:07:26 INFO - ++DOMWINDOW == 70 (0x7f4b0f989c00) [pid = 2212] [serial = 2487] [outer = (nil)] 14:07:26 INFO - ++DOCSHELL 0x7f4b129b7000 == 26 [pid = 2212] [id = 1044] 14:07:26 INFO - ++DOMWINDOW == 71 (0x7f4b0fbb6c00) [pid = 2212] [serial = 2488] [outer = (nil)] 14:07:26 INFO - ++DOCSHELL 0x7f4b129be800 == 27 [pid = 2212] [id = 1045] 14:07:26 INFO - ++DOMWINDOW == 72 (0x7f4b0f7dbc00) [pid = 2212] [serial = 2489] [outer = (nil)] 14:07:26 INFO - ++DOCSHELL 0x7f4b12a05000 == 28 [pid = 2212] [id = 1046] 14:07:26 INFO - ++DOMWINDOW == 73 (0x7f4b0fbb8c00) [pid = 2212] [serial = 2490] [outer = (nil)] 14:07:26 INFO - ++DOMWINDOW == 74 (0x7f4b0fbbc000) [pid = 2212] [serial = 2491] [outer = 0x7f4b0f987800] 14:07:26 INFO - ++DOMWINDOW == 75 (0x7f4b10b02800) [pid = 2212] [serial = 2492] [outer = 0x7f4b0f989c00] 14:07:26 INFO - ++DOMWINDOW == 76 (0x7f4b10b05800) [pid = 2212] [serial = 2493] [outer = 0x7f4b0fbb6c00] 14:07:26 INFO - ++DOMWINDOW == 77 (0x7f4b10b0bc00) [pid = 2212] [serial = 2494] [outer = 0x7f4b0f7dbc00] 14:07:26 INFO - ++DOMWINDOW == 78 (0x7f4b11db9c00) [pid = 2212] [serial = 2495] [outer = 0x7f4b0fbb8c00] 14:07:26 INFO - ++DOCSHELL 0x7f4b19752000 == 29 [pid = 2212] [id = 1047] 14:07:26 INFO - ++DOMWINDOW == 79 (0x7f4b12ab9000) [pid = 2212] [serial = 2496] [outer = (nil)] 14:07:26 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:07:26 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:07:27 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:07:27 INFO - ++DOCSHELL 0x7f4b20117800 == 30 [pid = 2212] [id = 1048] 14:07:27 INFO - ++DOMWINDOW == 80 (0x7f4b12e36800) [pid = 2212] [serial = 2497] [outer = (nil)] 14:07:27 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:07:27 INFO - ++DOMWINDOW == 81 (0x7f4b12f29c00) [pid = 2212] [serial = 2498] [outer = 0x7f4b12ab9000] 14:07:27 INFO - ++DOMWINDOW == 82 (0x7f4b133fc400) [pid = 2212] [serial = 2499] [outer = 0x7f4b12e36800] 14:07:27 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:07:27 INFO - ++DOCSHELL 0x7f4b2a4f4000 == 31 [pid = 2212] [id = 1049] 14:07:27 INFO - ++DOMWINDOW == 83 (0x7f4afe815800) [pid = 2212] [serial = 2500] [outer = (nil)] 14:07:27 INFO - ++DOCSHELL 0x7f4b2a4f7000 == 32 [pid = 2212] [id = 1050] 14:07:27 INFO - ++DOMWINDOW == 84 (0x7f4b196e1000) [pid = 2212] [serial = 2501] [outer = (nil)] 14:07:27 INFO - ++DOCSHELL 0x7f4b2a4f7800 == 33 [pid = 2212] [id = 1051] 14:07:27 INFO - ++DOMWINDOW == 85 (0x7f4b19997800) [pid = 2212] [serial = 2502] [outer = (nil)] 14:07:27 INFO - ++DOCSHELL 0x7f4b2a4f8000 == 34 [pid = 2212] [id = 1052] 14:07:27 INFO - ++DOMWINDOW == 86 (0x7f4b1eac9800) [pid = 2212] [serial = 2503] [outer = (nil)] 14:07:27 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:07:27 INFO - ++DOCSHELL 0x7f4b2a4f8800 == 35 [pid = 2212] [id = 1053] 14:07:27 INFO - ++DOMWINDOW == 87 (0x7f4b1ead2c00) [pid = 2212] [serial = 2504] [outer = (nil)] 14:07:27 INFO - ++DOMWINDOW == 88 (0x7f4b20196400) [pid = 2212] [serial = 2505] [outer = 0x7f4b1ead2c00] 14:07:28 INFO - ++DOMWINDOW == 89 (0x7f4b1276e400) [pid = 2212] [serial = 2506] [outer = 0x7f4afe815800] 14:07:28 INFO - ++DOMWINDOW == 90 (0x7f4b29b57400) [pid = 2212] [serial = 2507] [outer = 0x7f4b196e1000] 14:07:28 INFO - ++DOMWINDOW == 91 (0x7f4b29b59400) [pid = 2212] [serial = 2508] [outer = 0x7f4b19997800] 14:07:28 INFO - ++DOMWINDOW == 92 (0x7f4b29b5a400) [pid = 2212] [serial = 2509] [outer = 0x7f4b1eac9800] 14:07:28 INFO - ++DOMWINDOW == 93 (0x7f4b29b5b400) [pid = 2212] [serial = 2510] [outer = 0x7f4b1ead2c00] 14:07:30 INFO - --DOCSHELL 0x7f4b2a4f7000 == 34 [pid = 2212] [id = 1050] 14:07:30 INFO - --DOCSHELL 0x7f4b2a4f7800 == 33 [pid = 2212] [id = 1051] 14:07:30 INFO - --DOCSHELL 0x7f4b2a4f4000 == 32 [pid = 2212] [id = 1049] 14:07:30 INFO - --DOCSHELL 0x7f4b2a4f8000 == 31 [pid = 2212] [id = 1052] 14:07:30 INFO - --DOCSHELL 0x7f4b20117800 == 30 [pid = 2212] [id = 1048] 14:07:30 INFO - --DOCSHELL 0x7f4b19752000 == 29 [pid = 2212] [id = 1047] 14:07:32 INFO - --DOCSHELL 0x7f4b2a4f8800 == 28 [pid = 2212] [id = 1053] 14:07:32 INFO - --DOCSHELL 0x7f4b07d87000 == 27 [pid = 2212] [id = 1016] 14:07:32 INFO - --DOCSHELL 0x7f4b0fa26000 == 26 [pid = 2212] [id = 1036] 14:07:32 INFO - --DOCSHELL 0x7f4b10ace000 == 25 [pid = 2212] [id = 1038] 14:07:32 INFO - --DOCSHELL 0x7f4afcec5800 == 24 [pid = 2212] [id = 1015] 14:07:32 INFO - --DOCSHELL 0x7f4b10aec800 == 23 [pid = 2212] [id = 1040] 14:07:32 INFO - --DOCSHELL 0x7f4afdc09000 == 22 [pid = 2212] [id = 1022] 14:07:32 INFO - --DOCSHELL 0x7f4b12751800 == 21 [pid = 2212] [id = 1041] 14:07:32 INFO - --DOCSHELL 0x7f4afdc1e800 == 20 [pid = 2212] [id = 1023] 14:07:32 INFO - --DOCSHELL 0x7f4b0176f800 == 19 [pid = 2212] [id = 1024] 14:07:32 INFO - --DOCSHELL 0x7f4b07c1f000 == 18 [pid = 2212] [id = 1025] 14:07:32 INFO - --DOCSHELL 0x7f4b07c2b000 == 17 [pid = 2212] [id = 1026] 14:07:32 INFO - --DOMWINDOW == 92 (0x7f4afd891c00) [pid = 2212] [serial = 2448] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 14:07:32 INFO - --DOMWINDOW == 91 (0x7f4afd88b800) [pid = 2212] [serial = 2454] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:07:32 INFO - --DOMWINDOW == 90 (0x7f4afd899400) [pid = 2212] [serial = 2449] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 14:07:32 INFO - --DOMWINDOW == 89 (0x7f4b11db9800) [pid = 2212] [serial = 2465] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 14:07:32 INFO - --DOMWINDOW == 88 (0x7f4afd943400) [pid = 2212] [serial = 2450] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 14:07:32 INFO - --DOMWINDOW == 87 (0x7f4afe81f000) [pid = 2212] [serial = 2455] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:07:32 INFO - --DOMWINDOW == 86 (0x7f4b10b03800) [pid = 2212] [serial = 2463] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 14:07:32 INFO - --DOMWINDOW == 85 (0x7f4b0fbb8000) [pid = 2212] [serial = 2398] [outer = (nil)] [url = about:blank] 14:07:32 INFO - --DOMWINDOW == 84 (0x7f4afc861400) [pid = 2212] [serial = 2400] [outer = (nil)] [url = about:blank] 14:07:32 INFO - --DOMWINDOW == 83 (0x7f4aff332c00) [pid = 2212] [serial = 2394] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:07:32 INFO - --DOMWINDOW == 82 (0x7f4b00f63400) [pid = 2212] [serial = 2396] [outer = (nil)] [url = about:blank] 14:07:32 INFO - --DOMWINDOW == 81 (0x7f4b12e36800) [pid = 2212] [serial = 2497] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:07:32 INFO - --DOMWINDOW == 80 (0x7f4afd88bc00) [pid = 2212] [serial = 2427] [outer = (nil)] [url = about:blank] 14:07:32 INFO - --DOMWINDOW == 79 (0x7f4afe1f2400) [pid = 2212] [serial = 2432] [outer = (nil)] [url = data:text/html,<p>hello%20from%20iframe</p>] 14:07:32 INFO - --DOMWINDOW == 78 (0x7f4afd041c00) [pid = 2212] [serial = 2446] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 14:07:32 INFO - --DOMWINDOW == 77 (0x7f4afe54ec00) [pid = 2212] [serial = 2433] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:07:32 INFO - --DOMWINDOW == 76 (0x7f4afde64000) [pid = 2212] [serial = 2456] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:07:32 INFO - --DOMWINDOW == 75 (0x7f4afd894400) [pid = 2212] [serial = 2428] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 14:07:32 INFO - --DOMWINDOW == 74 (0x7f4afd899800) [pid = 2212] [serial = 2470] [outer = (nil)] [url = about:blank] 14:07:32 INFO - --DOMWINDOW == 73 (0x7f4b09e5b000) [pid = 2212] [serial = 2438] [outer = (nil)] [url = chrome://devtools/content/inspector/inspector.xul] 14:07:32 INFO - --DOMWINDOW == 72 (0x7f4afcf27800) [pid = 2212] [serial = 2426] [outer = (nil)] [url = about:blank] 14:07:32 INFO - --DOMWINDOW == 71 (0x7f4afc868000) [pid = 2212] [serial = 2442] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 14:07:32 INFO - --DOMWINDOW == 70 (0x7f4aff335000) [pid = 2212] [serial = 2436] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:07:32 INFO - --DOMWINDOW == 69 (0x7f4b0c4eac00) [pid = 2212] [serial = 2458] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 14:07:32 INFO - --DOMWINDOW == 68 (0x7f4afe0ae000) [pid = 2212] [serial = 2431] [outer = (nil)] [url = data:text/html,<p>hello%20from%20iframe</p>] 14:07:32 INFO - --DOMWINDOW == 67 (0x7f4afc85b800) [pid = 2212] [serial = 2440] [outer = (nil)] [url = chrome://devtools/content/markupview/markup-view.xhtml] 14:07:32 INFO - --DOMWINDOW == 66 (0x7f4b12ab9000) [pid = 2212] [serial = 2496] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:07:32 INFO - --DOMWINDOW == 65 (0x7f4b0f989c00) [pid = 2212] [serial = 2487] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 14:07:32 INFO - --DOMWINDOW == 64 (0x7f4b0fbb6c00) [pid = 2212] [serial = 2488] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 14:07:32 INFO - --DOMWINDOW == 63 (0x7f4b0f7dbc00) [pid = 2212] [serial = 2489] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 14:07:32 INFO - --DOMWINDOW == 62 (0x7f4afe54f400) [pid = 2212] [serial = 2475] [outer = (nil)] [url = about:blank] 14:07:32 INFO - --DOMWINDOW == 61 (0x7f4b1eac9800) [pid = 2212] [serial = 2503] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 14:07:32 INFO - --DOMWINDOW == 60 (0x7f4b1ead2c00) [pid = 2212] [serial = 2504] [outer = (nil)] [url = data:text/html,<html></html>] 14:07:32 INFO - --DOMWINDOW == 59 (0x7f4b20196400) [pid = 2212] [serial = 2505] [outer = (nil)] [url = about:blank] 14:07:32 INFO - --DOMWINDOW == 58 (0x7f4b29b5b400) [pid = 2212] [serial = 2510] [outer = (nil)] [url = data:text/html,<html></html>] 14:07:32 INFO - --DOMWINDOW == 57 (0x7f4b196e1000) [pid = 2212] [serial = 2501] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 14:07:32 INFO - --DOCSHELL 0x7f4b10bc9800 == 16 [pid = 2212] [id = 1039] 14:07:32 INFO - --DOMWINDOW == 56 (0x7f4afde6a400) [pid = 2212] [serial = 2430] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 14:07:32 INFO - --DOMWINDOW == 55 (0x7f4afd951800) [pid = 2212] [serial = 2451] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 14:07:33 INFO - MEMORY STAT | vsize 1183MB | residentFast 334MB | heapAllocated 129MB 14:07:33 INFO - 426 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_dom_elements_04.js | took 12233ms 14:07:33 INFO - ++DOCSHELL 0x7f4afce7b000 == 17 [pid = 2212] [id = 1054] 14:07:33 INFO - ++DOMWINDOW == 56 (0x7f4afc860000) [pid = 2212] [serial = 2511] [outer = (nil)] 14:07:33 INFO - ++DOMWINDOW == 57 (0x7f4afc864c00) [pid = 2212] [serial = 2512] [outer = 0x7f4afc860000] 14:07:33 INFO - 427 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_events.js 14:07:33 INFO - ++DOCSHELL 0x7f4aff280000 == 18 [pid = 2212] [id = 1055] 14:07:33 INFO - ++DOMWINDOW == 58 (0x7f4afd88dc00) [pid = 2212] [serial = 2513] [outer = (nil)] 14:07:33 INFO - ++DOMWINDOW == 59 (0x7f4afd893000) [pid = 2212] [serial = 2514] [outer = 0x7f4afd88dc00] 14:07:33 INFO - ++DOMWINDOW == 60 (0x7f4afde61400) [pid = 2212] [serial = 2515] [outer = 0x7f4afd88dc00] 14:07:34 INFO - ++DOCSHELL 0x7f4b0c841800 == 19 [pid = 2212] [id = 1056] 14:07:34 INFO - ++DOMWINDOW == 61 (0x7f4afe0b1400) [pid = 2212] [serial = 2516] [outer = (nil)] 14:07:34 INFO - ++DOMWINDOW == 62 (0x7f4afe1f2000) [pid = 2212] [serial = 2517] [outer = 0x7f4afe0b1400] 14:07:34 INFO - ++DOMWINDOW == 63 (0x7f4afe552c00) [pid = 2212] [serial = 2518] [outer = 0x7f4afe0b1400] 14:07:34 INFO - ++DOCSHELL 0x7f4b0fa25800 == 20 [pid = 2212] [id = 1057] 14:07:34 INFO - ++DOMWINDOW == 64 (0x7f4afe8c3000) [pid = 2212] [serial = 2519] [outer = (nil)] 14:07:34 INFO - ++DOMWINDOW == 65 (0x7f4aff22a000) [pid = 2212] [serial = 2520] [outer = 0x7f4afe8c3000] 14:07:37 INFO - --DOCSHELL 0x7f4afcec5000 == 19 [pid = 2212] [id = 1034] 14:07:37 INFO - --DOCSHELL 0x7f4b0fa25800 == 18 [pid = 2212] [id = 1057] 14:07:37 INFO - --DOCSHELL 0x7f4b094a9000 == 17 [pid = 2212] [id = 1035] 14:07:37 INFO - --DOCSHELL 0x7f4b129ac800 == 16 [pid = 2212] [id = 1042] 14:07:37 INFO - --DOCSHELL 0x7f4b129b4800 == 15 [pid = 2212] [id = 1043] 14:07:37 INFO - --DOCSHELL 0x7f4b129b7000 == 14 [pid = 2212] [id = 1044] 14:07:37 INFO - --DOCSHELL 0x7f4b129be800 == 13 [pid = 2212] [id = 1045] 14:07:37 INFO - --DOCSHELL 0x7f4b07c20000 == 12 [pid = 2212] [id = 1037] 14:07:37 INFO - --DOCSHELL 0x7f4b12a05000 == 11 [pid = 2212] [id = 1046] 14:07:38 INFO - --DOMWINDOW == 64 (0x7f4afe8ab000) [pid = 2212] [serial = 2435] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:07:38 INFO - --DOMWINDOW == 63 (0x7f4b0a662000) [pid = 2212] [serial = 2439] [outer = (nil)] [url = about:blank] 14:07:38 INFO - --DOMWINDOW == 62 (0x7f4b133fc400) [pid = 2212] [serial = 2499] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:07:38 INFO - --DOMWINDOW == 61 (0x7f4b10b0bc00) [pid = 2212] [serial = 2494] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 14:07:38 INFO - --DOMWINDOW == 60 (0x7f4b0fb82800) [pid = 2212] [serial = 2462] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:07:38 INFO - --DOMWINDOW == 59 (0x7f4afc860c00) [pid = 2212] [serial = 2441] [outer = (nil)] [url = about:blank] 14:07:38 INFO - --DOMWINDOW == 58 (0x7f4afd88f800) [pid = 2212] [serial = 2447] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 14:07:38 INFO - --DOMWINDOW == 57 (0x7f4b10b05400) [pid = 2212] [serial = 2464] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 14:07:38 INFO - --DOMWINDOW == 56 (0x7f4b12f29c00) [pid = 2212] [serial = 2498] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:07:38 INFO - --DOMWINDOW == 55 (0x7f4b10b02800) [pid = 2212] [serial = 2492] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 14:07:38 INFO - --DOMWINDOW == 54 (0x7f4b10b05800) [pid = 2212] [serial = 2493] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 14:07:38 INFO - --DOMWINDOW == 53 (0x7f4aff337800) [pid = 2212] [serial = 2437] [outer = (nil)] [url = about:blank] 14:07:38 INFO - --DOMWINDOW == 52 (0x7f4b29b57400) [pid = 2212] [serial = 2507] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 14:07:38 INFO - --DOMWINDOW == 51 (0x7f4b29b5a400) [pid = 2212] [serial = 2509] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 14:07:38 INFO - --DOMWINDOW == 50 (0x7f4afe1f3000) [pid = 2212] [serial = 2473] [outer = (nil)] [url = data:text/html,<p>hello%20from%20iframe</p>] 14:07:38 INFO - --DOMWINDOW == 49 (0x7f4afe0b2800) [pid = 2212] [serial = 2472] [outer = (nil)] [url = data:text/html,<p>hello%20from%20iframe</p>] 14:07:38 INFO - --DOMWINDOW == 48 (0x7f4afe4c5800) [pid = 2212] [serial = 2474] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:07:38 INFO - --DOMWINDOW == 47 (0x7f4afd894c00) [pid = 2212] [serial = 2469] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 14:07:38 INFO - --DOMWINDOW == 46 (0x7f4afe8a8000) [pid = 2212] [serial = 2481] [outer = (nil)] [url = about:blank] 14:07:38 INFO - --DOMWINDOW == 45 (0x7f4afe1f2000) [pid = 2212] [serial = 2517] [outer = (nil)] [url = about:blank] 14:07:38 INFO - --DOMWINDOW == 44 (0x7f4afd893000) [pid = 2212] [serial = 2514] [outer = (nil)] [url = about:blank] 14:07:38 INFO - --DOMWINDOW == 43 (0x7f4afcf2e800) [pid = 2212] [serial = 2468] [outer = (nil)] [url = about:blank] 14:07:38 INFO - --DOMWINDOW == 42 (0x7f4afcf26800) [pid = 2212] [serial = 2467] [outer = (nil)] [url = about:blank] 14:07:38 INFO - --DOMWINDOW == 41 (0x7f4afe550c00) [pid = 2212] [serial = 2480] [outer = (nil)] [url = data:text/html,<p>hello%20from%20iframe</p>] 14:07:38 INFO - --DOMWINDOW == 40 (0x7f4b09bb6c00) [pid = 2212] [serial = 2482] [outer = (nil)] [url = chrome://devtools/content/inspector/inspector.xul] 14:07:38 INFO - --DOMWINDOW == 39 (0x7f4aff33b400) [pid = 2212] [serial = 2477] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:07:38 INFO - --DOMWINDOW == 38 (0x7f4afe815800) [pid = 2212] [serial = 2500] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:07:38 INFO - --DOMWINDOW == 37 (0x7f4b0f987800) [pid = 2212] [serial = 2486] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 14:07:38 INFO - --DOMWINDOW == 36 (0x7f4b19997800) [pid = 2212] [serial = 2502] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 14:07:38 INFO - --DOMWINDOW == 35 (0x7f4b09e57000) [pid = 2212] [serial = 2484] [outer = (nil)] [url = chrome://devtools/content/markupview/markup-view.xhtml] 14:07:38 INFO - --DOMWINDOW == 34 (0x7f4b0fbb8c00) [pid = 2212] [serial = 2490] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 14:07:38 INFO - --DOMWINDOW == 33 (0x7f4b11db9c00) [pid = 2212] [serial = 2495] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 14:07:38 INFO - --DOMWINDOW == 32 (0x7f4afe00d400) [pid = 2212] [serial = 2471] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 14:07:38 INFO - --DOMWINDOW == 31 (0x7f4afe81a400) [pid = 2212] [serial = 2479] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-dom-elements.html] 14:07:38 INFO - MEMORY STAT | vsize 1180MB | residentFast 322MB | heapAllocated 124MB 14:07:38 INFO - 428 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_events.js | took 5306ms 14:07:38 INFO - ++DOCSHELL 0x7f4afced1000 == 12 [pid = 2212] [id = 1058] 14:07:38 INFO - ++DOMWINDOW == 32 (0x7f4afcf24000) [pid = 2212] [serial = 2521] [outer = (nil)] 14:07:38 INFO - ++DOMWINDOW == 33 (0x7f4afd3ac000) [pid = 2212] [serial = 2522] [outer = 0x7f4afcf24000] 14:07:38 INFO - 429 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_order.js 14:07:38 INFO - ++DOCSHELL 0x7f4b07d82000 == 13 [pid = 2212] [id = 1059] 14:07:38 INFO - ++DOMWINDOW == 34 (0x7f4afd891800) [pid = 2212] [serial = 2523] [outer = (nil)] 14:07:38 INFO - ++DOMWINDOW == 35 (0x7f4afd894c00) [pid = 2212] [serial = 2524] [outer = 0x7f4afd891800] 14:07:39 INFO - ++DOMWINDOW == 36 (0x7f4afde5b800) [pid = 2212] [serial = 2525] [outer = 0x7f4afd891800] 14:07:39 INFO - ++DOCSHELL 0x7f4afce79000 == 14 [pid = 2212] [id = 1060] 14:07:39 INFO - ++DOMWINDOW == 37 (0x7f4afe0a9800) [pid = 2212] [serial = 2526] [outer = (nil)] 14:07:39 INFO - ++DOMWINDOW == 38 (0x7f4afe0b5400) [pid = 2212] [serial = 2527] [outer = 0x7f4afe0a9800] 14:07:39 INFO - ++DOMWINDOW == 39 (0x7f4afe54cc00) [pid = 2212] [serial = 2528] [outer = 0x7f4afe0a9800] 14:07:39 INFO - ++DOCSHELL 0x7f4b0f83c800 == 15 [pid = 2212] [id = 1061] 14:07:39 INFO - ++DOMWINDOW == 40 (0x7f4afe8c0c00) [pid = 2212] [serial = 2529] [outer = (nil)] 14:07:39 INFO - ++DOMWINDOW == 41 (0x7f4afe8c3c00) [pid = 2212] [serial = 2530] [outer = 0x7f4afe8c0c00] 14:07:42 INFO - --DOCSHELL 0x7f4afce7b000 == 14 [pid = 2212] [id = 1054] 14:07:42 INFO - --DOCSHELL 0x7f4b0c841800 == 13 [pid = 2212] [id = 1056] 14:07:42 INFO - --DOCSHELL 0x7f4b0f83c800 == 12 [pid = 2212] [id = 1061] 14:07:42 INFO - --DOCSHELL 0x7f4aff280000 == 11 [pid = 2212] [id = 1055] 14:07:42 INFO - --DOMWINDOW == 40 (0x7f4b0a867c00) [pid = 2212] [serial = 2485] [outer = (nil)] [url = about:blank] 14:07:42 INFO - --DOMWINDOW == 39 (0x7f4b1276e400) [pid = 2212] [serial = 2506] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:07:42 INFO - --DOMWINDOW == 38 (0x7f4b29b59400) [pid = 2212] [serial = 2508] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 14:07:42 INFO - --DOMWINDOW == 37 (0x7f4afe8aec00) [pid = 2212] [serial = 2476] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:07:42 INFO - --DOMWINDOW == 36 (0x7f4aff341000) [pid = 2212] [serial = 2478] [outer = (nil)] [url = about:blank] 14:07:42 INFO - --DOMWINDOW == 35 (0x7f4b0fbbc000) [pid = 2212] [serial = 2491] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 14:07:42 INFO - --DOMWINDOW == 34 (0x7f4b09bbac00) [pid = 2212] [serial = 2483] [outer = (nil)] [url = about:blank] 14:07:43 INFO - --DOMWINDOW == 33 (0x7f4afe0b5400) [pid = 2212] [serial = 2527] [outer = (nil)] [url = about:blank] 14:07:43 INFO - --DOMWINDOW == 32 (0x7f4afc864c00) [pid = 2212] [serial = 2512] [outer = (nil)] [url = about:blank] 14:07:43 INFO - --DOMWINDOW == 31 (0x7f4afd894c00) [pid = 2212] [serial = 2524] [outer = (nil)] [url = about:blank] 14:07:43 INFO - --DOMWINDOW == 30 (0x7f4afe0b1400) [pid = 2212] [serial = 2516] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:07:43 INFO - --DOMWINDOW == 29 (0x7f4afe8c3000) [pid = 2212] [serial = 2519] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:07:43 INFO - --DOMWINDOW == 28 (0x7f4afc860000) [pid = 2212] [serial = 2511] [outer = (nil)] [url = about:blank] 14:07:43 INFO - --DOMWINDOW == 27 (0x7f4afd88dc00) [pid = 2212] [serial = 2513] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-events.html] 14:07:43 INFO - MEMORY STAT | vsize 1182MB | residentFast 319MB | heapAllocated 123MB 14:07:43 INFO - 430 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_order.js | took 4444ms 14:07:43 INFO - ++DOCSHELL 0x7f4afcec5800 == 12 [pid = 2212] [id = 1062] 14:07:43 INFO - ++DOMWINDOW == 28 (0x7f4afc867000) [pid = 2212] [serial = 2531] [outer = (nil)] 14:07:43 INFO - ++DOMWINDOW == 29 (0x7f4afcf2c800) [pid = 2212] [serial = 2532] [outer = 0x7f4afc867000] 14:07:43 INFO - 431 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_regexp.js 14:07:43 INFO - ++DOCSHELL 0x7f4b0949b000 == 13 [pid = 2212] [id = 1063] 14:07:43 INFO - ++DOMWINDOW == 30 (0x7f4afd88ec00) [pid = 2212] [serial = 2533] [outer = (nil)] 14:07:43 INFO - ++DOMWINDOW == 31 (0x7f4afd892000) [pid = 2212] [serial = 2534] [outer = 0x7f4afd88ec00] 14:07:43 INFO - ++DOMWINDOW == 32 (0x7f4afe8a4400) [pid = 2212] [serial = 2535] [outer = 0x7f4afd88ec00] 14:07:44 INFO - ++DOCSHELL 0x7f4afcec3000 == 14 [pid = 2212] [id = 1064] 14:07:44 INFO - ++DOMWINDOW == 33 (0x7f4afe00d400) [pid = 2212] [serial = 2536] [outer = (nil)] 14:07:44 INFO - ++DOMWINDOW == 34 (0x7f4afe0acc00) [pid = 2212] [serial = 2537] [outer = 0x7f4afe00d400] 14:07:44 INFO - ++DOMWINDOW == 35 (0x7f4afe4bfc00) [pid = 2212] [serial = 2538] [outer = 0x7f4afe00d400] 14:07:44 INFO - ++DOCSHELL 0x7f4b0f836800 == 15 [pid = 2212] [id = 1065] 14:07:44 INFO - ++DOMWINDOW == 36 (0x7f4afe8a6400) [pid = 2212] [serial = 2539] [outer = (nil)] 14:07:44 INFO - ++DOMWINDOW == 37 (0x7f4afe8bb800) [pid = 2212] [serial = 2540] [outer = 0x7f4afe8a6400] 14:07:46 INFO - ++DOCSHELL 0x7f4aff285000 == 16 [pid = 2212] [id = 1066] 14:07:46 INFO - ++DOMWINDOW == 38 (0x7f4afe8c2000) [pid = 2212] [serial = 2541] [outer = (nil)] 14:07:47 INFO - ++DOMWINDOW == 39 (0x7f4afd898c00) [pid = 2212] [serial = 2542] [outer = 0x7f4afe8c2000] 14:07:48 INFO - --DOCSHELL 0x7f4afced1000 == 15 [pid = 2212] [id = 1058] 14:07:48 INFO - --DOCSHELL 0x7f4afce79000 == 14 [pid = 2212] [id = 1060] 14:07:48 INFO - --DOCSHELL 0x7f4afcec3000 == 13 [pid = 2212] [id = 1064] 14:07:48 INFO - --DOCSHELL 0x7f4b0f836800 == 12 [pid = 2212] [id = 1065] 14:07:48 INFO - --DOCSHELL 0x7f4b07d82000 == 11 [pid = 2212] [id = 1059] 14:07:48 INFO - --DOCSHELL 0x7f4aff285000 == 10 [pid = 2212] [id = 1066] 14:07:48 INFO - --DOMWINDOW == 38 (0x7f4afe552c00) [pid = 2212] [serial = 2518] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:07:48 INFO - --DOMWINDOW == 37 (0x7f4aff22a000) [pid = 2212] [serial = 2520] [outer = (nil)] [url = about:blank] 14:07:48 INFO - --DOMWINDOW == 36 (0x7f4afde61400) [pid = 2212] [serial = 2515] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-events.html] 14:07:48 INFO - --DOMWINDOW == 35 (0x7f4afe0acc00) [pid = 2212] [serial = 2537] [outer = (nil)] [url = about:blank] 14:07:48 INFO - --DOMWINDOW == 34 (0x7f4afd892000) [pid = 2212] [serial = 2534] [outer = (nil)] [url = about:blank] 14:07:48 INFO - --DOMWINDOW == 33 (0x7f4afd3ac000) [pid = 2212] [serial = 2522] [outer = (nil)] [url = about:blank] 14:07:48 INFO - --DOMWINDOW == 32 (0x7f4afe0a9800) [pid = 2212] [serial = 2526] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:07:48 INFO - --DOMWINDOW == 31 (0x7f4afe8c0c00) [pid = 2212] [serial = 2529] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:07:48 INFO - --DOMWINDOW == 30 (0x7f4afd891800) [pid = 2212] [serial = 2523] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:07:48 INFO - --DOMWINDOW == 29 (0x7f4afcf24000) [pid = 2212] [serial = 2521] [outer = (nil)] [url = about:blank] 14:07:48 INFO - --DOMWINDOW == 28 (0x7f4afde5b800) [pid = 2212] [serial = 2525] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console.html] 14:07:49 INFO - MEMORY STAT | vsize 1179MB | residentFast 312MB | heapAllocated 122MB 14:07:49 INFO - 432 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_regexp.js | took 5517ms 14:07:49 INFO - ++DOCSHELL 0x7f4afcec7800 == 11 [pid = 2212] [id = 1067] 14:07:49 INFO - ++DOMWINDOW == 29 (0x7f4afd035400) [pid = 2212] [serial = 2543] [outer = (nil)] 14:07:49 INFO - ++DOMWINDOW == 30 (0x7f4afd3a3800) [pid = 2212] [serial = 2544] [outer = 0x7f4afd035400] 14:07:49 INFO - 433 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_output_table.js 14:07:49 INFO - ++DOCSHELL 0x7f4b0c00c800 == 12 [pid = 2212] [id = 1068] 14:07:49 INFO - ++DOMWINDOW == 31 (0x7f4afd895000) [pid = 2212] [serial = 2545] [outer = (nil)] 14:07:49 INFO - ++DOMWINDOW == 32 (0x7f4afd899800) [pid = 2212] [serial = 2546] [outer = 0x7f4afd895000] 14:07:49 INFO - ++DOMWINDOW == 33 (0x7f4afe816000) [pid = 2212] [serial = 2547] [outer = 0x7f4afd895000] 14:07:49 INFO - ++DOCSHELL 0x7f4afced4800 == 13 [pid = 2212] [id = 1069] 14:07:49 INFO - ++DOMWINDOW == 34 (0x7f4afe3dcc00) [pid = 2212] [serial = 2548] [outer = (nil)] 14:07:49 INFO - ++DOMWINDOW == 35 (0x7f4afe4c6400) [pid = 2212] [serial = 2549] [outer = 0x7f4afe3dcc00] 14:07:50 INFO - ++DOMWINDOW == 36 (0x7f4afe816400) [pid = 2212] [serial = 2550] [outer = 0x7f4afe3dcc00] 14:07:50 INFO - ++DOCSHELL 0x7f4b0f9c7800 == 14 [pid = 2212] [id = 1070] 14:07:50 INFO - ++DOMWINDOW == 37 (0x7f4afe8c0800) [pid = 2212] [serial = 2551] [outer = (nil)] 14:07:50 INFO - ++DOMWINDOW == 38 (0x7f4afe8c5800) [pid = 2212] [serial = 2552] [outer = 0x7f4afe8c0800] 14:07:56 INFO - MEMORY STAT | vsize 1182MB | residentFast 318MB | heapAllocated 130MB 14:07:56 INFO - 434 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_output_table.js | took 6817ms 14:07:56 INFO - ++DOCSHELL 0x7f4afe4f8000 == 15 [pid = 2212] [id = 1071] 14:07:56 INFO - ++DOMWINDOW == 39 (0x7f4afe8aa400) [pid = 2212] [serial = 2553] [outer = (nil)] 14:07:56 INFO - ++DOMWINDOW == 40 (0x7f4afe8ad000) [pid = 2212] [serial = 2554] [outer = 0x7f4afe8aa400] 14:07:56 INFO - 435 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_promise.js 14:07:56 INFO - ++DOCSHELL 0x7f4b10a86800 == 16 [pid = 2212] [id = 1072] 14:07:56 INFO - ++DOMWINDOW == 41 (0x7f4b00f58800) [pid = 2212] [serial = 2555] [outer = (nil)] 14:07:56 INFO - ++DOMWINDOW == 42 (0x7f4b00f61c00) [pid = 2212] [serial = 2556] [outer = 0x7f4b00f58800] 14:07:56 INFO - ++DOCSHELL 0x7f4b10b8e000 == 17 [pid = 2212] [id = 1073] 14:07:56 INFO - ++DOMWINDOW == 43 (0x7f4b00f65800) [pid = 2212] [serial = 2557] [outer = (nil)] 14:07:56 INFO - ++DOMWINDOW == 44 (0x7f4b089f5400) [pid = 2212] [serial = 2558] [outer = 0x7f4b00f65800] 14:07:57 INFO - ++DOMWINDOW == 45 (0x7f4b09bb8400) [pid = 2212] [serial = 2559] [outer = 0x7f4b00f65800] 14:07:57 INFO - ++DOCSHELL 0x7f4b10ba0800 == 18 [pid = 2212] [id = 1074] 14:07:57 INFO - ++DOMWINDOW == 46 (0x7f4b0c1a7000) [pid = 2212] [serial = 2560] [outer = (nil)] 14:07:57 INFO - ++DOMWINDOW == 47 (0x7f4b0c1aa400) [pid = 2212] [serial = 2561] [outer = 0x7f4b0c1a7000] 14:07:59 INFO - ++DOCSHELL 0x7f4b116ec800 == 19 [pid = 2212] [id = 1075] 14:07:59 INFO - ++DOMWINDOW == 48 (0x7f4b12374c00) [pid = 2212] [serial = 2562] [outer = (nil)] 14:07:59 INFO - ++DOMWINDOW == 49 (0x7f4b12050800) [pid = 2212] [serial = 2563] [outer = 0x7f4b12374c00] 14:08:00 INFO - --DOCSHELL 0x7f4afcec7800 == 18 [pid = 2212] [id = 1067] 14:08:00 INFO - --DOCSHELL 0x7f4b0949b000 == 17 [pid = 2212] [id = 1063] 14:08:00 INFO - --DOCSHELL 0x7f4afced4800 == 16 [pid = 2212] [id = 1069] 14:08:00 INFO - --DOCSHELL 0x7f4b0f9c7800 == 15 [pid = 2212] [id = 1070] 14:08:00 INFO - --DOCSHELL 0x7f4afcec5800 == 14 [pid = 2212] [id = 1062] 14:08:00 INFO - --DOCSHELL 0x7f4b10ba0800 == 13 [pid = 2212] [id = 1074] 14:08:00 INFO - --DOCSHELL 0x7f4b116ec800 == 12 [pid = 2212] [id = 1075] 14:08:01 INFO - --DOMWINDOW == 48 (0x7f4afe54cc00) [pid = 2212] [serial = 2528] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:08:01 INFO - --DOMWINDOW == 47 (0x7f4afe8c3c00) [pid = 2212] [serial = 2530] [outer = (nil)] [url = about:blank] 14:08:01 INFO - --DOMWINDOW == 46 (0x7f4afe8c2000) [pid = 2212] [serial = 2541] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:08:01 INFO - --DOMWINDOW == 45 (0x7f4afd899800) [pid = 2212] [serial = 2546] [outer = (nil)] [url = about:blank] 14:08:01 INFO - --DOMWINDOW == 44 (0x7f4b089f5400) [pid = 2212] [serial = 2558] [outer = (nil)] [url = about:blank] 14:08:01 INFO - --DOMWINDOW == 43 (0x7f4afe4c6400) [pid = 2212] [serial = 2549] [outer = (nil)] [url = about:blank] 14:08:01 INFO - --DOMWINDOW == 42 (0x7f4afe8a6400) [pid = 2212] [serial = 2539] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:08:01 INFO - --DOMWINDOW == 41 (0x7f4afe00d400) [pid = 2212] [serial = 2536] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:08:01 INFO - --DOMWINDOW == 40 (0x7f4afc867000) [pid = 2212] [serial = 2531] [outer = (nil)] [url = about:blank] 14:08:01 INFO - --DOMWINDOW == 39 (0x7f4afd88ec00) [pid = 2212] [serial = 2533] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-regexp.html] 14:08:01 INFO - --DOMWINDOW == 38 (0x7f4afd035400) [pid = 2212] [serial = 2543] [outer = (nil)] [url = about:blank] 14:08:01 INFO - --DOMWINDOW == 37 (0x7f4afd3a3800) [pid = 2212] [serial = 2544] [outer = (nil)] [url = about:blank] 14:08:01 INFO - --DOMWINDOW == 36 (0x7f4afcf2c800) [pid = 2212] [serial = 2532] [outer = (nil)] [url = about:blank] 14:08:01 INFO - --DOMWINDOW == 35 (0x7f4b12374c00) [pid = 2212] [serial = 2562] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:08:01 INFO - --DOMWINDOW == 34 (0x7f4afe8a4400) [pid = 2212] [serial = 2535] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-output-regexp.html] 14:08:01 INFO - MEMORY STAT | vsize 1183MB | residentFast 320MB | heapAllocated 125MB 14:08:01 INFO - 436 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_promise.js | took 5268ms 14:08:01 INFO - ++DOCSHELL 0x7f4afced1000 == 13 [pid = 2212] [id = 1076] 14:08:01 INFO - ++DOMWINDOW == 35 (0x7f4afcf29000) [pid = 2212] [serial = 2564] [outer = (nil)] 14:08:01 INFO - ++DOMWINDOW == 36 (0x7f4afd88e800) [pid = 2212] [serial = 2565] [outer = 0x7f4afcf29000] 14:08:01 INFO - 437 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_property_provider.js 14:08:01 INFO - ++DOCSHELL 0x7f4b07d97000 == 14 [pid = 2212] [id = 1077] 14:08:01 INFO - ++DOMWINDOW == 37 (0x7f4afd896c00) [pid = 2212] [serial = 2566] [outer = (nil)] 14:08:02 INFO - ++DOMWINDOW == 38 (0x7f4afd89a400) [pid = 2212] [serial = 2567] [outer = 0x7f4afd896c00] 14:08:02 INFO - [2212] WARNING: Too large an index passed to GetChildAt: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 4056 14:08:02 INFO - [2212] WARNING: NS_ENSURE_TRUE(child) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 4061 14:08:02 INFO - MEMORY STAT | vsize 1184MB | residentFast 322MB | heapAllocated 127MB 14:08:02 INFO - 438 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_property_provider.js | took 754ms 14:08:02 INFO - ++DOCSHELL 0x7f4b0f82f800 == 15 [pid = 2212] [id = 1078] 14:08:02 INFO - ++DOMWINDOW == 39 (0x7f4afe576000) [pid = 2212] [serial = 2568] [outer = (nil)] 14:08:02 INFO - ++DOMWINDOW == 40 (0x7f4afe81c800) [pid = 2212] [serial = 2569] [outer = 0x7f4afe576000] 14:08:02 INFO - 439 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_reflow.js 14:08:02 INFO - ++DOCSHELL 0x7f4b0f844800 == 16 [pid = 2212] [id = 1079] 14:08:02 INFO - ++DOMWINDOW == 41 (0x7f4afe8bd400) [pid = 2212] [serial = 2570] [outer = (nil)] 14:08:03 INFO - ++DOMWINDOW == 42 (0x7f4afe8c2400) [pid = 2212] [serial = 2571] [outer = 0x7f4afe8bd400] 14:08:03 INFO - ++DOCSHELL 0x7f4afcec7800 == 17 [pid = 2212] [id = 1080] 14:08:03 INFO - ++DOMWINDOW == 43 (0x7f4afe81f000) [pid = 2212] [serial = 2572] [outer = (nil)] 14:08:03 INFO - ++DOMWINDOW == 44 (0x7f4afe8a5000) [pid = 2212] [serial = 2573] [outer = 0x7f4afe81f000] 14:08:03 INFO - ++DOMWINDOW == 45 (0x7f4afe8ac800) [pid = 2212] [serial = 2574] [outer = 0x7f4afe81f000] 14:08:03 INFO - ++DOCSHELL 0x7f4b10add000 == 18 [pid = 2212] [id = 1081] 14:08:03 INFO - ++DOMWINDOW == 46 (0x7f4b00f5c800) [pid = 2212] [serial = 2575] [outer = (nil)] 14:08:03 INFO - ++DOMWINDOW == 47 (0x7f4b019b2800) [pid = 2212] [serial = 2576] [outer = 0x7f4b00f5c800] 14:08:06 INFO - --DOCSHELL 0x7f4b0c00c800 == 17 [pid = 2212] [id = 1068] 14:08:06 INFO - --DOCSHELL 0x7f4afced1000 == 16 [pid = 2212] [id = 1076] 14:08:06 INFO - --DOCSHELL 0x7f4b07d97000 == 15 [pid = 2212] [id = 1077] 14:08:06 INFO - --DOCSHELL 0x7f4afcec7800 == 14 [pid = 2212] [id = 1080] 14:08:06 INFO - --DOCSHELL 0x7f4b10add000 == 13 [pid = 2212] [id = 1081] 14:08:06 INFO - --DOCSHELL 0x7f4b10b8e000 == 12 [pid = 2212] [id = 1073] 14:08:06 INFO - --DOCSHELL 0x7f4b10a86800 == 11 [pid = 2212] [id = 1072] 14:08:06 INFO - --DOCSHELL 0x7f4afe4f8000 == 10 [pid = 2212] [id = 1071] 14:08:07 INFO - --DOMWINDOW == 46 (0x7f4b12050800) [pid = 2212] [serial = 2563] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:08:07 INFO - --DOMWINDOW == 45 (0x7f4afd898c00) [pid = 2212] [serial = 2542] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:08:07 INFO - --DOMWINDOW == 44 (0x7f4afe8bb800) [pid = 2212] [serial = 2540] [outer = (nil)] [url = about:blank] 14:08:07 INFO - --DOMWINDOW == 43 (0x7f4afe4bfc00) [pid = 2212] [serial = 2538] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:08:07 INFO - --DOMWINDOW == 42 (0x7f4afe8ad000) [pid = 2212] [serial = 2554] [outer = (nil)] [url = about:blank] 14:08:07 INFO - --DOMWINDOW == 41 (0x7f4afd88e800) [pid = 2212] [serial = 2565] [outer = (nil)] [url = about:blank] 14:08:07 INFO - --DOMWINDOW == 40 (0x7f4afd89a400) [pid = 2212] [serial = 2567] [outer = (nil)] [url = about:blank] 14:08:07 INFO - --DOMWINDOW == 39 (0x7f4afe8a5000) [pid = 2212] [serial = 2573] [outer = (nil)] [url = about:blank] 14:08:07 INFO - --DOMWINDOW == 38 (0x7f4b00f65800) [pid = 2212] [serial = 2557] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:08:07 INFO - --DOMWINDOW == 37 (0x7f4b0c1a7000) [pid = 2212] [serial = 2560] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:08:07 INFO - --DOMWINDOW == 36 (0x7f4afe3dcc00) [pid = 2212] [serial = 2548] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:08:07 INFO - --DOMWINDOW == 35 (0x7f4afe8c0800) [pid = 2212] [serial = 2551] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:08:07 INFO - --DOMWINDOW == 34 (0x7f4afd895000) [pid = 2212] [serial = 2545] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-table.html] 14:08:07 INFO - --DOMWINDOW == 33 (0x7f4afe8aa400) [pid = 2212] [serial = 2553] [outer = (nil)] [url = about:blank] 14:08:07 INFO - --DOMWINDOW == 32 (0x7f4afcf29000) [pid = 2212] [serial = 2564] [outer = (nil)] [url = about:blank] 14:08:07 INFO - --DOMWINDOW == 31 (0x7f4afd896c00) [pid = 2212] [serial = 2566] [outer = (nil)] [url = data:text/html;charset=utf8,<p>test%20the%20JS%20property%20provider] 14:08:07 INFO - --DOMWINDOW == 30 (0x7f4b00f58800) [pid = 2212] [serial = 2555] [outer = (nil)] [url = data:text/html;charset=utf8,test%20for%20console%20and%20promises] 14:08:07 INFO - --DOMWINDOW == 29 (0x7f4afe816000) [pid = 2212] [serial = 2547] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-console-table.html] 14:08:07 INFO - MEMORY STAT | vsize 1176MB | residentFast 313MB | heapAllocated 123MB 14:08:07 INFO - 440 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_reflow.js | took 4716ms 14:08:07 INFO - ++DOCSHELL 0x7f4afcecc800 == 11 [pid = 2212] [id = 1082] 14:08:07 INFO - ++DOMWINDOW == 30 (0x7f4afcf27400) [pid = 2212] [serial = 2577] [outer = (nil)] 14:08:07 INFO - ++DOMWINDOW == 31 (0x7f4afd341000) [pid = 2212] [serial = 2578] [outer = 0x7f4afcf27400] 14:08:07 INFO - 441 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_scratchpad_panel_link.js 14:08:07 INFO - ++DOCSHELL 0x7f4b07c5f000 == 12 [pid = 2212] [id = 1083] 14:08:07 INFO - ++DOMWINDOW == 32 (0x7f4afd896000) [pid = 2212] [serial = 2579] [outer = (nil)] 14:08:07 INFO - ++DOMWINDOW == 33 (0x7f4afd899400) [pid = 2212] [serial = 2580] [outer = 0x7f4afd896000] 14:08:08 INFO - ++DOCSHELL 0x7f4b07d87000 == 13 [pid = 2212] [id = 1084] 14:08:08 INFO - ++DOMWINDOW == 34 (0x7f4afe0b1400) [pid = 2212] [serial = 2581] [outer = (nil)] 14:08:08 INFO - ++DOMWINDOW == 35 (0x7f4afe1f2400) [pid = 2212] [serial = 2582] [outer = 0x7f4afe0b1400] 14:08:08 INFO - ++DOCSHELL 0x7f4b0f829800 == 14 [pid = 2212] [id = 1085] 14:08:08 INFO - ++DOMWINDOW == 36 (0x7f4afe0b3000) [pid = 2212] [serial = 2583] [outer = (nil)] 14:08:08 INFO - ++DOMWINDOW == 37 (0x7f4afe550c00) [pid = 2212] [serial = 2584] [outer = 0x7f4afe0b3000] 14:08:08 INFO - ++DOMWINDOW == 38 (0x7f4afe8ae000) [pid = 2212] [serial = 2585] [outer = 0x7f4afe0b3000] 14:08:08 INFO - ++DOCSHELL 0x7f4b10a7b000 == 15 [pid = 2212] [id = 1086] 14:08:08 INFO - ++DOMWINDOW == 39 (0x7f4aff33c000) [pid = 2212] [serial = 2586] [outer = (nil)] 14:08:08 INFO - ++DOMWINDOW == 40 (0x7f4aff33cc00) [pid = 2212] [serial = 2587] [outer = 0x7f4aff33c000] 14:08:10 INFO - ++DOCSHELL 0x7f4b10b9f000 == 16 [pid = 2212] [id = 1087] 14:08:10 INFO - ++DOMWINDOW == 41 (0x7f4b07d78800) [pid = 2212] [serial = 2588] [outer = (nil)] 14:08:10 INFO - ++DOMWINDOW == 42 (0x7f4aff33d400) [pid = 2212] [serial = 2589] [outer = 0x7f4b07d78800] 14:08:12 INFO - ++DOCSHELL 0x7f4afcec5000 == 17 [pid = 2212] [id = 1088] 14:08:12 INFO - ++DOMWINDOW == 43 (0x7f4afcf25800) [pid = 2212] [serial = 2590] [outer = (nil)] 14:08:12 INFO - ++DOMWINDOW == 44 (0x7f4afd33e000) [pid = 2212] [serial = 2591] [outer = 0x7f4afcf25800] 14:08:13 INFO - MEMORY STAT | vsize 1181MB | residentFast 328MB | heapAllocated 136MB 14:08:13 INFO - 442 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_scratchpad_panel_link.js | took 6072ms 14:08:13 INFO - ++DOCSHELL 0x7f4afce85800 == 18 [pid = 2212] [id = 1089] 14:08:13 INFO - ++DOMWINDOW == 45 (0x7f4afe0ab400) [pid = 2212] [serial = 2592] [outer = (nil)] 14:08:14 INFO - ++DOMWINDOW == 46 (0x7f4afe3dc800) [pid = 2212] [serial = 2593] [outer = 0x7f4afe0ab400] 14:08:14 INFO - 443 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_show_subresource_security_errors.js 14:08:14 INFO - ++DOCSHELL 0x7f4aff20d800 == 19 [pid = 2212] [id = 1090] 14:08:14 INFO - ++DOMWINDOW == 47 (0x7f4afe8aac00) [pid = 2212] [serial = 2594] [outer = (nil)] 14:08:14 INFO - ++DOMWINDOW == 48 (0x7f4afe8bf800) [pid = 2212] [serial = 2595] [outer = 0x7f4afe8aac00] 14:08:14 INFO - ++DOCSHELL 0x7f4b10bdb800 == 20 [pid = 2212] [id = 1091] 14:08:14 INFO - ++DOMWINDOW == 49 (0x7f4afe8c5000) [pid = 2212] [serial = 2596] [outer = (nil)] 14:08:14 INFO - ++DOMWINDOW == 50 (0x7f4b00f2fc00) [pid = 2212] [serial = 2597] [outer = 0x7f4afe8c5000] 14:08:14 INFO - ++DOMWINDOW == 51 (0x7f4b09528000) [pid = 2212] [serial = 2598] [outer = 0x7f4afe8c5000] 14:08:15 INFO - ++DOCSHELL 0x7f4b14518000 == 21 [pid = 2212] [id = 1092] 14:08:15 INFO - ++DOMWINDOW == 52 (0x7f4b0f7df000) [pid = 2212] [serial = 2599] [outer = (nil)] 14:08:15 INFO - ++DOMWINDOW == 53 (0x7f4b11ee8800) [pid = 2212] [serial = 2600] [outer = 0x7f4b0f7df000] 14:08:17 INFO - ++DOMWINDOW == 54 (0x7f4b20107c00) [pid = 2212] [serial = 2601] [outer = 0x7f4afe8aac00] 14:08:17 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:08:19 INFO - --DOCSHELL 0x7f4b0f82f800 == 20 [pid = 2212] [id = 1078] 14:08:19 INFO - --DOCSHELL 0x7f4b0f844800 == 19 [pid = 2212] [id = 1079] 14:08:19 INFO - --DOCSHELL 0x7f4b14518000 == 18 [pid = 2212] [id = 1092] 14:08:19 INFO - --DOCSHELL 0x7f4b10a7b000 == 17 [pid = 2212] [id = 1086] 14:08:19 INFO - --DOCSHELL 0x7f4b10b9f000 == 16 [pid = 2212] [id = 1087] 14:08:19 INFO - --DOCSHELL 0x7f4afcec5000 == 15 [pid = 2212] [id = 1088] 14:08:19 INFO - --DOCSHELL 0x7f4b07d87000 == 14 [pid = 2212] [id = 1084] 14:08:19 INFO - --DOMWINDOW == 53 (0x7f4b0c1aa400) [pid = 2212] [serial = 2561] [outer = (nil)] [url = about:blank] 14:08:19 INFO - --DOMWINDOW == 52 (0x7f4b09bb8400) [pid = 2212] [serial = 2559] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:08:19 INFO - --DOMWINDOW == 51 (0x7f4afe8c5800) [pid = 2212] [serial = 2552] [outer = (nil)] [url = about:blank] 14:08:19 INFO - --DOMWINDOW == 50 (0x7f4afe816400) [pid = 2212] [serial = 2550] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:08:19 INFO - --DOMWINDOW == 49 (0x7f4b00f61c00) [pid = 2212] [serial = 2556] [outer = (nil)] [url = about:blank] 14:08:19 INFO - --DOMWINDOW == 48 (0x7f4afe576000) [pid = 2212] [serial = 2568] [outer = (nil)] [url = about:blank] 14:08:19 INFO - --DOMWINDOW == 47 (0x7f4b00f5c800) [pid = 2212] [serial = 2575] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:08:19 INFO - --DOMWINDOW == 46 (0x7f4b00f2fc00) [pid = 2212] [serial = 2597] [outer = (nil)] [url = about:blank] 14:08:19 INFO - --DOMWINDOW == 45 (0x7f4afd341000) [pid = 2212] [serial = 2578] [outer = (nil)] [url = about:blank] 14:08:19 INFO - --DOMWINDOW == 44 (0x7f4afcf27400) [pid = 2212] [serial = 2577] [outer = (nil)] [url = about:blank] 14:08:19 INFO - --DOMWINDOW == 43 (0x7f4afe550c00) [pid = 2212] [serial = 2584] [outer = (nil)] [url = about:blank] 14:08:19 INFO - --DOMWINDOW == 42 (0x7f4b07d78800) [pid = 2212] [serial = 2588] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:08:19 INFO - --DOMWINDOW == 41 (0x7f4afe0b1400) [pid = 2212] [serial = 2581] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox-window.xul] 14:08:19 INFO - --DOMWINDOW == 40 (0x7f4afe8c2400) [pid = 2212] [serial = 2571] [outer = (nil)] [url = about:blank] 14:08:19 INFO - --DOMWINDOW == 39 (0x7f4afe81c800) [pid = 2212] [serial = 2569] [outer = (nil)] [url = about:blank] 14:08:19 INFO - --DOMWINDOW == 38 (0x7f4afe81f000) [pid = 2212] [serial = 2572] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:08:19 INFO - --DOMWINDOW == 37 (0x7f4afe8bd400) [pid = 2212] [serial = 2570] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20reflow%20activity] 14:08:20 INFO - MEMORY STAT | vsize 1181MB | residentFast 330MB | heapAllocated 131MB 14:08:20 INFO - 444 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_show_subresource_security_errors.js | took 6053ms 14:08:20 INFO - ++DOCSHELL 0x7f4b07c25000 == 15 [pid = 2212] [id = 1093] 14:08:20 INFO - ++DOMWINDOW == 38 (0x7f4afd3a3c00) [pid = 2212] [serial = 2602] [outer = (nil)] 14:08:20 INFO - ++DOMWINDOW == 39 (0x7f4afd893400) [pid = 2212] [serial = 2603] [outer = 0x7f4afd3a3c00] 14:08:20 INFO - 445 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_shows_reqs_in_netmonitor.js 14:08:20 INFO - ++DOCSHELL 0x7f4b0f82c800 == 16 [pid = 2212] [id = 1094] 14:08:20 INFO - ++DOMWINDOW == 40 (0x7f4afde61000) [pid = 2212] [serial = 2604] [outer = (nil)] 14:08:20 INFO - ++DOMWINDOW == 41 (0x7f4afde6a400) [pid = 2212] [serial = 2605] [outer = 0x7f4afde61000] 14:08:21 INFO - ++DOCSHELL 0x7f4b0f72a800 == 17 [pid = 2212] [id = 1095] 14:08:21 INFO - ++DOMWINDOW == 42 (0x7f4afe4c5800) [pid = 2212] [serial = 2606] [outer = (nil)] 14:08:21 INFO - ++DOMWINDOW == 43 (0x7f4afe4c8400) [pid = 2212] [serial = 2607] [outer = 0x7f4afe4c5800] 14:08:21 INFO - ++DOMWINDOW == 44 (0x7f4afe8a5c00) [pid = 2212] [serial = 2608] [outer = 0x7f4afe4c5800] 14:08:21 INFO - ++DOCSHELL 0x7f4b10a8c800 == 18 [pid = 2212] [id = 1096] 14:08:21 INFO - ++DOMWINDOW == 45 (0x7f4aff33a000) [pid = 2212] [serial = 2609] [outer = (nil)] 14:08:21 INFO - ++DOMWINDOW == 46 (0x7f4b00f26c00) [pid = 2212] [serial = 2610] [outer = 0x7f4aff33a000] 14:08:21 INFO - ++DOCSHELL 0x7f4b116e2000 == 19 [pid = 2212] [id = 1097] 14:08:21 INFO - ++DOMWINDOW == 47 (0x7f4b0984a000) [pid = 2212] [serial = 2611] [outer = (nil)] 14:08:22 INFO - ++DOMWINDOW == 48 (0x7f4b0c426000) [pid = 2212] [serial = 2612] [outer = 0x7f4b0984a000] 14:08:23 INFO - ++DOMWINDOW == 49 (0x7f4afe8ab000) [pid = 2212] [serial = 2613] [outer = 0x7f4afde61000] 14:08:23 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:08:23 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:08:23 INFO - ++DOCSHELL 0x7f4b10bc6800 == 20 [pid = 2212] [id = 1098] 14:08:23 INFO - ++DOMWINDOW == 50 (0x7f4afe8a7400) [pid = 2212] [serial = 2614] [outer = (nil)] 14:08:23 INFO - ++DOMWINDOW == 51 (0x7f4b07a0b000) [pid = 2212] [serial = 2615] [outer = 0x7f4afe8a7400] 14:08:24 INFO - --DOCSHELL 0x7f4b116e2000 == 19 [pid = 2212] [id = 1097] 14:08:25 INFO - MEMORY STAT | vsize 1186MB | residentFast 332MB | heapAllocated 137MB 14:08:25 INFO - 446 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_shows_reqs_in_netmonitor.js | took 5088ms 14:08:25 INFO - ++DOCSHELL 0x7f4b07c2b000 == 20 [pid = 2212] [id = 1099] 14:08:25 INFO - ++DOMWINDOW == 52 (0x7f4afe816400) [pid = 2212] [serial = 2616] [outer = (nil)] 14:08:25 INFO - ++DOMWINDOW == 53 (0x7f4afe8bd400) [pid = 2212] [serial = 2617] [outer = 0x7f4afe816400] 14:08:26 INFO - 447 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_split.js 14:08:26 INFO - ++DOCSHELL 0x7f4b10bd5000 == 21 [pid = 2212] [id = 1100] 14:08:26 INFO - ++DOMWINDOW == 54 (0x7f4aff332800) [pid = 2212] [serial = 2618] [outer = (nil)] 14:08:26 INFO - ++DOMWINDOW == 55 (0x7f4b00f57800) [pid = 2212] [serial = 2619] [outer = 0x7f4aff332800] 14:08:26 INFO - ++DOCSHELL 0x7f4b1465d000 == 22 [pid = 2212] [id = 1101] 14:08:26 INFO - ++DOMWINDOW == 56 (0x7f4afe8c5c00) [pid = 2212] [serial = 2620] [outer = (nil)] 14:08:26 INFO - ++DOMWINDOW == 57 (0x7f4b07a10c00) [pid = 2212] [serial = 2621] [outer = 0x7f4afe8c5c00] 14:08:26 INFO - ++DOMWINDOW == 58 (0x7f4b09848400) [pid = 2212] [serial = 2622] [outer = 0x7f4afe8c5c00] 14:08:28 INFO - ++DOCSHELL 0x7f4b199ba800 == 23 [pid = 2212] [id = 1102] 14:08:28 INFO - ++DOMWINDOW == 59 (0x7f4b07a10000) [pid = 2212] [serial = 2623] [outer = (nil)] 14:08:28 INFO - ++DOMWINDOW == 60 (0x7f4b143f3800) [pid = 2212] [serial = 2624] [outer = 0x7f4b07a10000] 14:08:28 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:08:28 INFO - ++DOCSHELL 0x7f4b25fa3800 == 24 [pid = 2212] [id = 1103] 14:08:28 INFO - ++DOMWINDOW == 61 (0x7f4b16f51400) [pid = 2212] [serial = 2625] [outer = (nil)] 14:08:28 INFO - ++DOMWINDOW == 62 (0x7f4b17223800) [pid = 2212] [serial = 2626] [outer = 0x7f4b16f51400] 14:08:28 INFO - ++DOCSHELL 0x7f4b29c24800 == 25 [pid = 2212] [id = 1104] 14:08:28 INFO - ++DOMWINDOW == 63 (0x7f4b15ca8800) [pid = 2212] [serial = 2627] [outer = (nil)] 14:08:28 INFO - ++DOCSHELL 0x7f4b29c2e800 == 26 [pid = 2212] [id = 1105] 14:08:28 INFO - ++DOMWINDOW == 64 (0x7f4afc724000) [pid = 2212] [serial = 2628] [outer = (nil)] 14:08:28 INFO - ++DOCSHELL 0x7f4b29c31800 == 27 [pid = 2212] [id = 1106] 14:08:28 INFO - ++DOMWINDOW == 65 (0x7f4b196e0400) [pid = 2212] [serial = 2629] [outer = (nil)] 14:08:28 INFO - ++DOCSHELL 0x7f4b29c32000 == 28 [pid = 2212] [id = 1107] 14:08:28 INFO - ++DOMWINDOW == 66 (0x7f4b19714c00) [pid = 2212] [serial = 2630] [outer = (nil)] 14:08:28 INFO - ++DOCSHELL 0x7f4b29c33800 == 29 [pid = 2212] [id = 1108] 14:08:28 INFO - ++DOMWINDOW == 67 (0x7f4b19997800) [pid = 2212] [serial = 2631] [outer = (nil)] 14:08:28 INFO - ++DOMWINDOW == 68 (0x7f4b1ead2c00) [pid = 2212] [serial = 2632] [outer = 0x7f4b15ca8800] 14:08:28 INFO - ++DOMWINDOW == 69 (0x7f4b201a3800) [pid = 2212] [serial = 2633] [outer = 0x7f4afc724000] 14:08:28 INFO - ++DOMWINDOW == 70 (0x7f4b203cd800) [pid = 2212] [serial = 2634] [outer = 0x7f4b196e0400] 14:08:28 INFO - ++DOMWINDOW == 71 (0x7f4b20da9c00) [pid = 2212] [serial = 2635] [outer = 0x7f4b19714c00] 14:08:28 INFO - ++DOMWINDOW == 72 (0x7f4b20db5000) [pid = 2212] [serial = 2636] [outer = 0x7f4b19997800] 14:08:29 INFO - ++DOCSHELL 0x7f4b2b1c8800 == 30 [pid = 2212] [id = 1109] 14:08:29 INFO - ++DOMWINDOW == 73 (0x7f4b25f57c00) [pid = 2212] [serial = 2637] [outer = (nil)] 14:08:29 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:08:29 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:08:29 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:08:29 INFO - ++DOCSHELL 0x7f4b2b60c800 == 31 [pid = 2212] [id = 1110] 14:08:29 INFO - ++DOMWINDOW == 74 (0x7f4b25fd3000) [pid = 2212] [serial = 2638] [outer = (nil)] 14:08:29 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:08:29 INFO - ++DOMWINDOW == 75 (0x7f4b29b58000) [pid = 2212] [serial = 2639] [outer = 0x7f4b25f57c00] 14:08:29 INFO - ++DOMWINDOW == 76 (0x7f4b29da0400) [pid = 2212] [serial = 2640] [outer = 0x7f4b25fd3000] 14:08:29 INFO - ++DOCSHELL 0x7f4afcf8b800 == 32 [pid = 2212] [id = 1111] 14:08:29 INFO - ++DOMWINDOW == 77 (0x7f4b29dc0400) [pid = 2212] [serial = 2641] [outer = (nil)] 14:08:29 INFO - ++DOMWINDOW == 78 (0x7f4b29dc1000) [pid = 2212] [serial = 2642] [outer = 0x7f4b29dc0400] 14:08:29 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:08:29 INFO - ++DOCSHELL 0x7f4afcf93000 == 33 [pid = 2212] [id = 1112] 14:08:29 INFO - ++DOMWINDOW == 79 (0x7f4b1584a400) [pid = 2212] [serial = 2643] [outer = (nil)] 14:08:29 INFO - ++DOCSHELL 0x7f4afcf93800 == 34 [pid = 2212] [id = 1113] 14:08:29 INFO - ++DOMWINDOW == 80 (0x7f4b29dc7c00) [pid = 2212] [serial = 2644] [outer = (nil)] 14:08:29 INFO - ++DOCSHELL 0x7f4afcf94000 == 35 [pid = 2212] [id = 1114] 14:08:29 INFO - ++DOMWINDOW == 81 (0x7f4b29dc9000) [pid = 2212] [serial = 2645] [outer = (nil)] 14:08:29 INFO - ++DOCSHELL 0x7f4afcf94800 == 36 [pid = 2212] [id = 1115] 14:08:29 INFO - ++DOMWINDOW == 82 (0x7f4b29dc9c00) [pid = 2212] [serial = 2646] [outer = (nil)] 14:08:29 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:08:29 INFO - ++DOCSHELL 0x7f4afcf95000 == 37 [pid = 2212] [id = 1116] 14:08:29 INFO - ++DOMWINDOW == 83 (0x7f4b29dcbc00) [pid = 2212] [serial = 2647] [outer = (nil)] 14:08:29 INFO - ++DOMWINDOW == 84 (0x7f4b29dcc800) [pid = 2212] [serial = 2648] [outer = 0x7f4b29dcbc00] 14:08:30 INFO - ++DOMWINDOW == 85 (0x7f4b2c171400) [pid = 2212] [serial = 2649] [outer = 0x7f4b1584a400] 14:08:30 INFO - ++DOMWINDOW == 86 (0x7f4b2c172400) [pid = 2212] [serial = 2650] [outer = 0x7f4b29dc7c00] 14:08:30 INFO - ++DOMWINDOW == 87 (0x7f4b2c173800) [pid = 2212] [serial = 2651] [outer = 0x7f4b29dc9000] 14:08:30 INFO - ++DOMWINDOW == 88 (0x7f4b2c175000) [pid = 2212] [serial = 2652] [outer = 0x7f4b29dc9c00] 14:08:30 INFO - ++DOMWINDOW == 89 (0x7f4b2c176000) [pid = 2212] [serial = 2653] [outer = 0x7f4b29dcbc00] 14:08:31 INFO - ++DOCSHELL 0x7f4afdebf800 == 38 [pid = 2212] [id = 1117] 14:08:31 INFO - ++DOMWINDOW == 90 (0x7f4b0f84bc00) [pid = 2212] [serial = 2654] [outer = (nil)] 14:08:31 INFO - ++DOMWINDOW == 91 (0x7f4b0f84cc00) [pid = 2212] [serial = 2655] [outer = 0x7f4b0f84bc00] 14:08:32 INFO - ++DOCSHELL 0x7f4afcd90800 == 39 [pid = 2212] [id = 1118] 14:08:32 INFO - ++DOMWINDOW == 92 (0x7f4afce3f400) [pid = 2212] [serial = 2656] [outer = (nil)] 14:08:32 INFO - ++DOMWINDOW == 93 (0x7f4afce40c00) [pid = 2212] [serial = 2657] [outer = 0x7f4afce3f400] 14:08:33 INFO - ++DOCSHELL 0x7f4afcfc0800 == 40 [pid = 2212] [id = 1119] 14:08:33 INFO - ++DOMWINDOW == 94 (0x7f4afab69000) [pid = 2212] [serial = 2658] [outer = (nil)] 14:08:33 INFO - ++DOMWINDOW == 95 (0x7f4afab6a800) [pid = 2212] [serial = 2659] [outer = 0x7f4afab69000] 14:08:34 INFO - --DOCSHELL 0x7f4afce85800 == 39 [pid = 2212] [id = 1089] 14:08:34 INFO - --DOCSHELL 0x7f4b10bdb800 == 38 [pid = 2212] [id = 1091] 14:08:34 INFO - --DOCSHELL 0x7f4b10a8c800 == 37 [pid = 2212] [id = 1096] 14:08:34 INFO - --DOCSHELL 0x7f4b0f829800 == 36 [pid = 2212] [id = 1085] 14:08:35 INFO - --DOCSHELL 0x7f4afcf95000 == 35 [pid = 2212] [id = 1116] 14:08:35 INFO - --DOCSHELL 0x7f4b07c5f000 == 34 [pid = 2212] [id = 1083] 14:08:35 INFO - --DOCSHELL 0x7f4afcecc800 == 33 [pid = 2212] [id = 1082] 14:08:35 INFO - --DOCSHELL 0x7f4aff20d800 == 32 [pid = 2212] [id = 1090] 14:08:35 INFO - --DOCSHELL 0x7f4b0f82c800 == 31 [pid = 2212] [id = 1094] 14:08:35 INFO - --DOCSHELL 0x7f4b0f72a800 == 30 [pid = 2212] [id = 1095] 14:08:35 INFO - --DOCSHELL 0x7f4b07c25000 == 29 [pid = 2212] [id = 1093] 14:08:35 INFO - --DOCSHELL 0x7f4b10bc6800 == 28 [pid = 2212] [id = 1098] 14:08:35 INFO - --DOMWINDOW == 94 (0x7f4aff33d400) [pid = 2212] [serial = 2589] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:08:35 INFO - --DOMWINDOW == 93 (0x7f4b019b2800) [pid = 2212] [serial = 2576] [outer = (nil)] [url = about:blank] 14:08:35 INFO - --DOMWINDOW == 92 (0x7f4afe8ac800) [pid = 2212] [serial = 2574] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:08:35 INFO - --DOMWINDOW == 91 (0x7f4afe1f2400) [pid = 2212] [serial = 2582] [outer = (nil)] [url = about:blank] 14:08:35 INFO - ++DOCSHELL 0x7f4afcd90000 == 29 [pid = 2212] [id = 1120] 14:08:35 INFO - ++DOMWINDOW == 92 (0x7f4afc726800) [pid = 2212] [serial = 2660] [outer = (nil)] 14:08:35 INFO - ++DOMWINDOW == 93 (0x7f4afc729800) [pid = 2212] [serial = 2661] [outer = 0x7f4afc726800] 14:08:36 INFO - ++DOCSHELL 0x7f4aff219800 == 30 [pid = 2212] [id = 1121] 14:08:36 INFO - ++DOMWINDOW == 94 (0x7f4afe8a3800) [pid = 2212] [serial = 2662] [outer = (nil)] 14:08:36 INFO - ++DOMWINDOW == 95 (0x7f4afe8a4c00) [pid = 2212] [serial = 2663] [outer = 0x7f4afe8a3800] 14:08:36 INFO - ++DOCSHELL 0x7f4b07c71800 == 31 [pid = 2212] [id = 1122] 14:08:36 INFO - ++DOMWINDOW == 96 (0x7f4aff341800) [pid = 2212] [serial = 2664] [outer = (nil)] 14:08:37 INFO - ++DOMWINDOW == 97 (0x7f4afe8a8400) [pid = 2212] [serial = 2665] [outer = 0x7f4aff341800] 14:08:37 INFO - ++DOCSHELL 0x7f4aff20d800 == 32 [pid = 2212] [id = 1123] 14:08:37 INFO - ++DOMWINDOW == 98 (0x7f4b0984cc00) [pid = 2212] [serial = 2666] [outer = (nil)] 14:08:37 INFO - ++DOMWINDOW == 99 (0x7f4b0984d800) [pid = 2212] [serial = 2667] [outer = 0x7f4b0984cc00] 14:08:38 INFO - [2212] WARNING: NS_ENSURE_TRUE(!mParent || mParent == docLoaderService) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 3156 14:08:38 INFO - [2212] WARNING: NS_ENSURE_TRUE(!mParent || mParent == docLoaderService) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 3156 14:08:38 INFO - ++DOCSHELL 0x7f4b0f7b8000 == 33 [pid = 2212] [id = 1124] 14:08:38 INFO - ++DOMWINDOW == 100 (0x7f4b0c8f1c00) [pid = 2212] [serial = 2668] [outer = (nil)] 14:08:38 INFO - ++DOMWINDOW == 101 (0x7f4b0f702c00) [pid = 2212] [serial = 2669] [outer = 0x7f4b0c8f1c00] 14:08:38 INFO - ++DOCSHELL 0x7f4b0fa2d800 == 34 [pid = 2212] [id = 1125] 14:08:38 INFO - ++DOMWINDOW == 102 (0x7f4b10bb2400) [pid = 2212] [serial = 2670] [outer = (nil)] 14:08:39 INFO - ++DOMWINDOW == 103 (0x7f4b12f23000) [pid = 2212] [serial = 2671] [outer = 0x7f4b10bb2400] 14:08:39 INFO - [2212] WARNING: NS_ENSURE_TRUE(!mParent || mParent == docLoaderService) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 3156 14:08:39 INFO - [2212] WARNING: NS_ENSURE_TRUE(!mParent || mParent == docLoaderService) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 3156 14:08:39 INFO - ++DOCSHELL 0x7f4b10a8c000 == 35 [pid = 2212] [id = 1126] 14:08:39 INFO - ++DOMWINDOW == 104 (0x7f4b12776800) [pid = 2212] [serial = 2672] [outer = (nil)] 14:08:39 INFO - ++DOMWINDOW == 105 (0x7f4afa944400) [pid = 2212] [serial = 2673] [outer = 0x7f4b12776800] 14:08:40 INFO - [2212] WARNING: NS_ENSURE_TRUE(!mParent || mParent == docLoaderService) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 3156 14:08:40 INFO - [2212] WARNING: NS_ENSURE_TRUE(!mParent || mParent == docLoaderService) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/docshell/base/nsDocShell.cpp, line 3156 14:08:40 INFO - --DOCSHELL 0x7f4afcf93800 == 34 [pid = 2212] [id = 1113] 14:08:40 INFO - --DOCSHELL 0x7f4afcf94000 == 33 [pid = 2212] [id = 1114] 14:08:40 INFO - --DOCSHELL 0x7f4afcf93000 == 32 [pid = 2212] [id = 1112] 14:08:40 INFO - --DOCSHELL 0x7f4afcf94800 == 31 [pid = 2212] [id = 1115] 14:08:40 INFO - --DOCSHELL 0x7f4b2b60c800 == 30 [pid = 2212] [id = 1110] 14:08:40 INFO - --DOCSHELL 0x7f4b2b1c8800 == 29 [pid = 2212] [id = 1109] 14:08:40 INFO - --DOCSHELL 0x7f4b25fa3800 == 28 [pid = 2212] [id = 1103] 14:08:40 INFO - --DOCSHELL 0x7f4afcd90800 == 27 [pid = 2212] [id = 1118] 14:08:40 INFO - --DOCSHELL 0x7f4b07c71800 == 26 [pid = 2212] [id = 1122] 14:08:41 INFO - --DOCSHELL 0x7f4b0f7b8000 == 25 [pid = 2212] [id = 1124] 14:08:41 INFO - --DOMWINDOW == 104 (0x7f4afe0ab400) [pid = 2212] [serial = 2592] [outer = (nil)] [url = about:blank] 14:08:41 INFO - --DOMWINDOW == 103 (0x7f4afe8aac00) [pid = 2212] [serial = 2594] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_bug1092055_shouldwarn.html] 14:08:41 INFO - --DOMWINDOW == 102 (0x7f4afd896000) [pid = 2212] [serial = 2579] [outer = (nil)] [url = data:text/html;charset=utf8,<p>test%20Scratchpad%20panel%20linking</p>] 14:08:41 INFO - --DOMWINDOW == 101 (0x7f4b0984a000) [pid = 2212] [serial = 2611] [outer = (nil)] [url = about:blank] 14:08:41 INFO - --DOMWINDOW == 100 (0x7f4afd3a3c00) [pid = 2212] [serial = 2602] [outer = (nil)] [url = about:blank] 14:08:41 INFO - --DOMWINDOW == 99 (0x7f4aff33c000) [pid = 2212] [serial = 2586] [outer = (nil)] [url = chrome://devtools/content/scratchpad/scratchpad.xul] 14:08:41 INFO - --DOMWINDOW == 98 (0x7f4afde6a400) [pid = 2212] [serial = 2605] [outer = (nil)] [url = about:blank] 14:08:41 INFO - --DOMWINDOW == 97 (0x7f4afd893400) [pid = 2212] [serial = 2603] [outer = (nil)] [url = about:blank] 14:08:41 INFO - --DOMWINDOW == 96 (0x7f4afde61000) [pid = 2212] [serial = 2604] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 14:08:41 INFO - --DOMWINDOW == 95 (0x7f4afe3dc800) [pid = 2212] [serial = 2593] [outer = (nil)] [url = about:blank] 14:08:41 INFO - --DOMWINDOW == 94 (0x7f4afe8bf800) [pid = 2212] [serial = 2595] [outer = (nil)] [url = about:blank] 14:08:41 INFO - --DOMWINDOW == 93 (0x7f4afd899400) [pid = 2212] [serial = 2580] [outer = (nil)] [url = about:blank] 14:08:41 INFO - --DOMWINDOW == 92 (0x7f4b29dcc800) [pid = 2212] [serial = 2648] [outer = (nil)] [url = about:blank] 14:08:41 INFO - --DOMWINDOW == 91 (0x7f4afe4c8400) [pid = 2212] [serial = 2607] [outer = (nil)] [url = about:blank] 14:08:41 INFO - --DOMWINDOW == 90 (0x7f4b07a10c00) [pid = 2212] [serial = 2621] [outer = (nil)] [url = about:blank] 14:08:41 INFO - --DOMWINDOW == 89 (0x7f4b0c426000) [pid = 2212] [serial = 2612] [outer = (nil)] [url = about:blank] 14:08:41 INFO - --DOCSHELL 0x7f4b199ba800 == 24 [pid = 2212] [id = 1102] 14:08:41 INFO - --DOCSHELL 0x7f4afdebf800 == 23 [pid = 2212] [id = 1117] 14:08:41 INFO - --DOCSHELL 0x7f4afcf8b800 == 22 [pid = 2212] [id = 1111] 14:08:41 INFO - --DOMWINDOW == 88 (0x7f4afe8ab000) [pid = 2212] [serial = 2613] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-network-request.html] 14:08:41 INFO - --DOMWINDOW == 87 (0x7f4b20107c00) [pid = 2212] [serial = 2601] [outer = (nil)] [url = https://example.com/browser/devtools/client/webconsole/test/test_bug1092055_shouldwarn.html] 14:08:42 INFO - --DOCSHELL 0x7f4afcfc0800 == 21 [pid = 2212] [id = 1119] 14:08:42 INFO - --DOCSHELL 0x7f4afcd90000 == 20 [pid = 2212] [id = 1120] 14:08:42 INFO - --DOCSHELL 0x7f4aff219800 == 19 [pid = 2212] [id = 1121] 14:08:42 INFO - --DOCSHELL 0x7f4b29c24800 == 18 [pid = 2212] [id = 1104] 14:08:42 INFO - --DOCSHELL 0x7f4b29c2e800 == 17 [pid = 2212] [id = 1105] 14:08:42 INFO - --DOCSHELL 0x7f4b29c31800 == 16 [pid = 2212] [id = 1106] 14:08:42 INFO - --DOCSHELL 0x7f4b29c32000 == 15 [pid = 2212] [id = 1107] 14:08:42 INFO - --DOCSHELL 0x7f4b29c33800 == 14 [pid = 2212] [id = 1108] 14:08:43 INFO - --DOMWINDOW == 86 (0x7f4aff33cc00) [pid = 2212] [serial = 2587] [outer = (nil)] [url = about:blank] 14:08:43 INFO - ++DOCSHELL 0x7f4afab80000 == 15 [pid = 2212] [id = 1127] 14:08:43 INFO - ++DOMWINDOW == 87 (0x7f4afa7f3000) [pid = 2212] [serial = 2674] [outer = (nil)] 14:08:43 INFO - ++DOMWINDOW == 88 (0x7f4afa7f6c00) [pid = 2212] [serial = 2675] [outer = 0x7f4afa7f3000] 14:08:43 INFO - --DOMWINDOW == 87 (0x7f4b29dcbc00) [pid = 2212] [serial = 2647] [outer = (nil)] [url = data:text/html,<html></html>] 14:08:43 INFO - --DOMWINDOW == 86 (0x7f4b1584a400) [pid = 2212] [serial = 2643] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:08:43 INFO - --DOMWINDOW == 85 (0x7f4b29dc9000) [pid = 2212] [serial = 2645] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 14:08:43 INFO - --DOMWINDOW == 84 (0x7f4b29dc7c00) [pid = 2212] [serial = 2644] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 14:08:43 INFO - --DOMWINDOW == 83 (0x7f4b25f57c00) [pid = 2212] [serial = 2637] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:08:43 INFO - --DOMWINDOW == 82 (0x7f4b19714c00) [pid = 2212] [serial = 2630] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 14:08:43 INFO - --DOMWINDOW == 81 (0x7f4b196e0400) [pid = 2212] [serial = 2629] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 14:08:43 INFO - --DOMWINDOW == 80 (0x7f4b25fd3000) [pid = 2212] [serial = 2638] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:08:43 INFO - --DOMWINDOW == 79 (0x7f4afc724000) [pid = 2212] [serial = 2628] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 14:08:43 INFO - --DOMWINDOW == 78 (0x7f4b29dc9c00) [pid = 2212] [serial = 2646] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 14:08:43 INFO - --DOMWINDOW == 77 (0x7f4afce3f400) [pid = 2212] [serial = 2656] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:08:43 INFO - --DOMWINDOW == 76 (0x7f4b19997800) [pid = 2212] [serial = 2631] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 14:08:43 INFO - --DOMWINDOW == 75 (0x7f4b15ca8800) [pid = 2212] [serial = 2627] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 14:08:43 INFO - --DOMWINDOW == 74 (0x7f4b0c8f1c00) [pid = 2212] [serial = 2668] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox-window.xul] 14:08:43 INFO - --DOMWINDOW == 73 (0x7f4aff33a000) [pid = 2212] [serial = 2609] [outer = (nil)] [url = chrome://devtools/content/netmonitor/netmonitor.xul] 14:08:43 INFO - --DOMWINDOW == 72 (0x7f4afe8c5000) [pid = 2212] [serial = 2596] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:08:43 INFO - --DOMWINDOW == 71 (0x7f4afe0b3000) [pid = 2212] [serial = 2583] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:08:43 INFO - --DOMWINDOW == 70 (0x7f4b0f7df000) [pid = 2212] [serial = 2599] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:08:43 INFO - --DOMWINDOW == 69 (0x7f4afcf25800) [pid = 2212] [serial = 2590] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:08:43 INFO - --DOMWINDOW == 68 (0x7f4afe4c5800) [pid = 2212] [serial = 2606] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:08:43 INFO - --DOMWINDOW == 67 (0x7f4afe8a7400) [pid = 2212] [serial = 2614] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:08:43 INFO - --DOMWINDOW == 66 (0x7f4b10bb2400) [pid = 2212] [serial = 2670] [outer = (nil)] [url = about:blank] 14:08:43 INFO - --DOMWINDOW == 65 (0x7f4b12776800) [pid = 2212] [serial = 2672] [outer = (nil)] [url = about:blank] 14:08:43 INFO - --DOMWINDOW == 64 (0x7f4b0984cc00) [pid = 2212] [serial = 2666] [outer = (nil)] [url = about:blank] 14:08:43 INFO - --DOMWINDOW == 63 (0x7f4aff341800) [pid = 2212] [serial = 2664] [outer = (nil)] [url = about:blank] 14:08:43 INFO - --DOMWINDOW == 62 (0x7f4b12f23000) [pid = 2212] [serial = 2671] [outer = (nil)] [url = about:blank] 14:08:43 INFO - --DOMWINDOW == 61 (0x7f4afa944400) [pid = 2212] [serial = 2673] [outer = (nil)] [url = about:blank] 14:08:43 INFO - --DOMWINDOW == 60 (0x7f4b0984d800) [pid = 2212] [serial = 2667] [outer = (nil)] [url = about:blank] 14:08:43 INFO - --DOMWINDOW == 59 (0x7f4afe8a8400) [pid = 2212] [serial = 2665] [outer = (nil)] [url = about:blank] 14:08:43 INFO - --DOMWINDOW == 58 (0x7f4b2c176000) [pid = 2212] [serial = 2653] [outer = (nil)] [url = data:text/html,<html></html>] 14:08:43 INFO - ++DOMWINDOW == 59 (0x7f4afa9e4800) [pid = 2212] [serial = 2676] [outer = 0x7f4afa7f3000] 14:08:44 INFO - ++DOCSHELL 0x7f4afcfb8000 == 16 [pid = 2212] [id = 1128] 14:08:44 INFO - ++DOMWINDOW == 60 (0x7f4afd899800) [pid = 2212] [serial = 2677] [outer = (nil)] 14:08:44 INFO - ++DOMWINDOW == 61 (0x7f4afe4bf400) [pid = 2212] [serial = 2678] [outer = 0x7f4afd899800] 14:08:45 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:08:45 INFO - ++DOCSHELL 0x7f4afded9800 == 17 [pid = 2212] [id = 1129] 14:08:45 INFO - ++DOMWINDOW == 62 (0x7f4aff338400) [pid = 2212] [serial = 2679] [outer = (nil)] 14:08:45 INFO - ++DOMWINDOW == 63 (0x7f4aff339800) [pid = 2212] [serial = 2680] [outer = 0x7f4aff338400] 14:08:45 INFO - ++DOCSHELL 0x7f4aff280800 == 18 [pid = 2212] [id = 1130] 14:08:45 INFO - ++DOMWINDOW == 64 (0x7f4aff33cc00) [pid = 2212] [serial = 2681] [outer = (nil)] 14:08:45 INFO - ++DOCSHELL 0x7f4aff281800 == 19 [pid = 2212] [id = 1131] 14:08:45 INFO - ++DOMWINDOW == 65 (0x7f4aff33dc00) [pid = 2212] [serial = 2682] [outer = (nil)] 14:08:45 INFO - ++DOCSHELL 0x7f4aff285000 == 20 [pid = 2212] [id = 1132] 14:08:45 INFO - ++DOMWINDOW == 66 (0x7f4aff341400) [pid = 2212] [serial = 2683] [outer = (nil)] 14:08:45 INFO - ++DOCSHELL 0x7f4aff28d000 == 21 [pid = 2212] [id = 1133] 14:08:45 INFO - ++DOMWINDOW == 67 (0x7f4aff341c00) [pid = 2212] [serial = 2684] [outer = (nil)] 14:08:45 INFO - ++DOCSHELL 0x7f4b01757800 == 22 [pid = 2212] [id = 1134] 14:08:45 INFO - ++DOMWINDOW == 68 (0x7f4aff374c00) [pid = 2212] [serial = 2685] [outer = (nil)] 14:08:45 INFO - ++DOMWINDOW == 69 (0x7f4aff37fc00) [pid = 2212] [serial = 2686] [outer = 0x7f4aff33cc00] 14:08:45 INFO - ++DOMWINDOW == 70 (0x7f4aff382000) [pid = 2212] [serial = 2687] [outer = 0x7f4aff33dc00] 14:08:45 INFO - ++DOMWINDOW == 71 (0x7f4aff41a000) [pid = 2212] [serial = 2688] [outer = 0x7f4aff341400] 14:08:45 INFO - ++DOMWINDOW == 72 (0x7f4aff41d000) [pid = 2212] [serial = 2689] [outer = 0x7f4aff341c00] 14:08:45 INFO - ++DOMWINDOW == 73 (0x7f4aff422000) [pid = 2212] [serial = 2690] [outer = 0x7f4aff374c00] 14:08:45 INFO - ++DOCSHELL 0x7f4b0f838800 == 23 [pid = 2212] [id = 1135] 14:08:45 INFO - ++DOMWINDOW == 74 (0x7f4b07a11000) [pid = 2212] [serial = 2691] [outer = (nil)] 14:08:45 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:08:45 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:08:45 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:08:45 INFO - ++DOCSHELL 0x7f4b0f845800 == 24 [pid = 2212] [id = 1136] 14:08:45 INFO - ++DOMWINDOW == 75 (0x7f4b07d76c00) [pid = 2212] [serial = 2692] [outer = (nil)] 14:08:45 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:08:45 INFO - ++DOMWINDOW == 76 (0x7f4b089e9400) [pid = 2212] [serial = 2693] [outer = 0x7f4b07a11000] 14:08:46 INFO - ++DOMWINDOW == 77 (0x7f4afc71b400) [pid = 2212] [serial = 2694] [outer = 0x7f4b07d76c00] 14:08:46 INFO - --DOCSHELL 0x7f4b0f845800 == 23 [pid = 2212] [id = 1136] 14:08:47 INFO - --DOCSHELL 0x7f4afcfb8000 == 22 [pid = 2212] [id = 1128] 14:08:47 INFO - --DOCSHELL 0x7f4b0fa2d800 == 21 [pid = 2212] [id = 1125] 14:08:47 INFO - --DOCSHELL 0x7f4afded9800 == 20 [pid = 2212] [id = 1129] 14:08:47 INFO - --DOCSHELL 0x7f4aff280800 == 19 [pid = 2212] [id = 1130] 14:08:47 INFO - --DOCSHELL 0x7f4aff281800 == 18 [pid = 2212] [id = 1131] 14:08:47 INFO - --DOCSHELL 0x7f4aff285000 == 17 [pid = 2212] [id = 1132] 14:08:47 INFO - --DOCSHELL 0x7f4aff28d000 == 16 [pid = 2212] [id = 1133] 14:08:47 INFO - --DOCSHELL 0x7f4b01757800 == 15 [pid = 2212] [id = 1134] 14:08:47 INFO - --DOCSHELL 0x7f4aff20d800 == 14 [pid = 2212] [id = 1123] 14:08:47 INFO - --DOCSHELL 0x7f4b1465d000 == 13 [pid = 2212] [id = 1101] 14:08:47 INFO - --DOCSHELL 0x7f4b10a8c000 == 12 [pid = 2212] [id = 1126] 14:08:47 INFO - --DOMWINDOW == 76 (0x7f4b09528000) [pid = 2212] [serial = 2598] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:08:47 INFO - --DOMWINDOW == 75 (0x7f4afe8ae000) [pid = 2212] [serial = 2585] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:08:47 INFO - --DOMWINDOW == 74 (0x7f4b11ee8800) [pid = 2212] [serial = 2600] [outer = (nil)] [url = about:blank] 14:08:47 INFO - --DOMWINDOW == 73 (0x7f4afd33e000) [pid = 2212] [serial = 2591] [outer = (nil)] [url = about:blank] 14:08:47 INFO - --DOMWINDOW == 72 (0x7f4afe8a5c00) [pid = 2212] [serial = 2608] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:08:47 INFO - --DOMWINDOW == 71 (0x7f4b07a0b000) [pid = 2212] [serial = 2615] [outer = (nil)] [url = about:blank] 14:08:47 INFO - --DOCSHELL 0x7f4b0f838800 == 11 [pid = 2212] [id = 1135] 14:08:47 INFO - --DOMWINDOW == 70 (0x7f4b2c173800) [pid = 2212] [serial = 2651] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 14:08:47 INFO - --DOMWINDOW == 69 (0x7f4b2c172400) [pid = 2212] [serial = 2650] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 14:08:47 INFO - --DOMWINDOW == 68 (0x7f4b20da9c00) [pid = 2212] [serial = 2635] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 14:08:47 INFO - --DOMWINDOW == 67 (0x7f4b203cd800) [pid = 2212] [serial = 2634] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 14:08:47 INFO - --DOMWINDOW == 66 (0x7f4b2c175000) [pid = 2212] [serial = 2652] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 14:08:47 INFO - --DOMWINDOW == 65 (0x7f4afce40c00) [pid = 2212] [serial = 2657] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:08:47 INFO - --DOMWINDOW == 64 (0x7f4b20db5000) [pid = 2212] [serial = 2636] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 14:08:47 INFO - --DOMWINDOW == 63 (0x7f4b1ead2c00) [pid = 2212] [serial = 2632] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 14:08:47 INFO - --DOMWINDOW == 62 (0x7f4b0f702c00) [pid = 2212] [serial = 2669] [outer = (nil)] [url = about:blank] 14:08:47 INFO - --DOMWINDOW == 61 (0x7f4b00f26c00) [pid = 2212] [serial = 2610] [outer = (nil)] [url = about:blank] 14:08:47 INFO - --DOMWINDOW == 60 (0x7f4b2c171400) [pid = 2212] [serial = 2649] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:08:47 INFO - --DOMWINDOW == 59 (0x7f4b29da0400) [pid = 2212] [serial = 2640] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:08:47 INFO - --DOMWINDOW == 58 (0x7f4b29b58000) [pid = 2212] [serial = 2639] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:08:47 INFO - --DOMWINDOW == 57 (0x7f4b201a3800) [pid = 2212] [serial = 2633] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 14:08:47 INFO - --DOMWINDOW == 56 (0x7f4afc71b400) [pid = 2212] [serial = 2694] [outer = 0x7f4b07d76c00] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:08:47 INFO - --DOMWINDOW == 55 (0x7f4b089e9400) [pid = 2212] [serial = 2693] [outer = 0x7f4b07a11000] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:08:47 INFO - --DOMWINDOW == 54 (0x7f4b07a11000) [pid = 2212] [serial = 2691] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:08:47 INFO - --DOMWINDOW == 53 (0x7f4b07d76c00) [pid = 2212] [serial = 2692] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:08:48 INFO - --DOMWINDOW == 52 (0x7f4b0f84bc00) [pid = 2212] [serial = 2654] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul] 14:08:48 INFO - --DOMWINDOW == 51 (0x7f4afc726800) [pid = 2212] [serial = 2660] [outer = (nil)] [url = chrome://devtools/content/performance/performance.xul] 14:08:48 INFO - --DOMWINDOW == 50 (0x7f4afe8a3800) [pid = 2212] [serial = 2662] [outer = (nil)] [url = chrome://devtools/content/netmonitor/netmonitor.xul] 14:08:48 INFO - --DOMWINDOW == 49 (0x7f4afab69000) [pid = 2212] [serial = 2658] [outer = (nil)] [url = chrome://devtools/content/styleeditor/styleeditor.xul] 14:08:48 INFO - --DOMWINDOW == 48 (0x7f4b16f51400) [pid = 2212] [serial = 2625] [outer = (nil)] [url = chrome://devtools/content/markupview/markup-view.xhtml] 14:08:48 INFO - --DOMWINDOW == 47 (0x7f4afa7f6c00) [pid = 2212] [serial = 2675] [outer = (nil)] [url = about:blank] 14:08:48 INFO - --DOMWINDOW == 46 (0x7f4aff341c00) [pid = 2212] [serial = 2684] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 14:08:48 INFO - --DOMWINDOW == 45 (0x7f4aff341400) [pid = 2212] [serial = 2683] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 14:08:48 INFO - --DOMWINDOW == 44 (0x7f4aff33cc00) [pid = 2212] [serial = 2681] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 14:08:48 INFO - --DOMWINDOW == 43 (0x7f4b07a10000) [pid = 2212] [serial = 2623] [outer = (nil)] [url = chrome://devtools/content/inspector/inspector.xul] 14:08:48 INFO - --DOMWINDOW == 42 (0x7f4b29dc0400) [pid = 2212] [serial = 2641] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:08:48 INFO - --DOMWINDOW == 41 (0x7f4afe8c5c00) [pid = 2212] [serial = 2620] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:08:49 INFO - MEMORY STAT | vsize 1178MB | residentFast 333MB | heapAllocated 130MB 14:08:49 INFO - 448 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_split.js | took 23017ms 14:08:49 INFO - ++DOCSHELL 0x7f4afab9f800 == 12 [pid = 2212] [id = 1137] 14:08:49 INFO - ++DOMWINDOW == 42 (0x7f4afa94b000) [pid = 2212] [serial = 2695] [outer = (nil)] 14:08:49 INFO - ++DOMWINDOW == 43 (0x7f4afa94fc00) [pid = 2212] [serial = 2696] [outer = 0x7f4afa94b000] 14:08:49 INFO - 449 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_split_escape_key.js 14:08:49 INFO - ++DOCSHELL 0x7f4afce7a000 == 13 [pid = 2212] [id = 1138] 14:08:49 INFO - ++DOMWINDOW == 44 (0x7f4afa9e8800) [pid = 2212] [serial = 2697] [outer = (nil)] 14:08:49 INFO - ++DOMWINDOW == 45 (0x7f4afa9eac00) [pid = 2212] [serial = 2698] [outer = 0x7f4afa9e8800] 14:08:49 INFO - ++DOCSHELL 0x7f4afab88000 == 14 [pid = 2212] [id = 1139] 14:08:49 INFO - ++DOMWINDOW == 46 (0x7f4afa9ee000) [pid = 2212] [serial = 2699] [outer = (nil)] 14:08:49 INFO - ++DOMWINDOW == 47 (0x7f4afab6a400) [pid = 2212] [serial = 2700] [outer = 0x7f4afa9ee000] 14:08:49 INFO - ++DOMWINDOW == 48 (0x7f4afc864c00) [pid = 2212] [serial = 2701] [outer = 0x7f4afa9ee000] 14:08:51 INFO - ++DOCSHELL 0x7f4afdec6800 == 15 [pid = 2212] [id = 1140] 14:08:51 INFO - ++DOMWINDOW == 49 (0x7f4afe4c4c00) [pid = 2212] [serial = 2702] [outer = (nil)] 14:08:51 INFO - ++DOMWINDOW == 50 (0x7f4aff41b800) [pid = 2212] [serial = 2703] [outer = 0x7f4afe4c4c00] 14:08:51 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:08:51 INFO - ++DOCSHELL 0x7f4b01758000 == 16 [pid = 2212] [id = 1141] 14:08:51 INFO - ++DOMWINDOW == 51 (0x7f4b00f2b000) [pid = 2212] [serial = 2704] [outer = (nil)] 14:08:51 INFO - ++DOMWINDOW == 52 (0x7f4b00f58400) [pid = 2212] [serial = 2705] [outer = 0x7f4b00f2b000] 14:08:51 INFO - ++DOCSHELL 0x7f4b07c5f000 == 17 [pid = 2212] [id = 1142] 14:08:51 INFO - ++DOMWINDOW == 53 (0x7f4b00f64000) [pid = 2212] [serial = 2706] [outer = (nil)] 14:08:51 INFO - ++DOCSHELL 0x7f4b07c61000 == 18 [pid = 2212] [id = 1143] 14:08:51 INFO - ++DOMWINDOW == 54 (0x7f4b012d3800) [pid = 2212] [serial = 2707] [outer = (nil)] 14:08:51 INFO - ++DOCSHELL 0x7f4b07c62000 == 19 [pid = 2212] [id = 1144] 14:08:51 INFO - ++DOMWINDOW == 55 (0x7f4b07a0b000) [pid = 2212] [serial = 2708] [outer = (nil)] 14:08:51 INFO - ++DOCSHELL 0x7f4b07c6b000 == 20 [pid = 2212] [id = 1145] 14:08:51 INFO - ++DOMWINDOW == 56 (0x7f4b07a0d800) [pid = 2212] [serial = 2709] [outer = (nil)] 14:08:51 INFO - ++DOCSHELL 0x7f4b07c6f000 == 21 [pid = 2212] [id = 1146] 14:08:51 INFO - ++DOMWINDOW == 57 (0x7f4b07a11400) [pid = 2212] [serial = 2710] [outer = (nil)] 14:08:51 INFO - ++DOMWINDOW == 58 (0x7f4b07a13400) [pid = 2212] [serial = 2711] [outer = 0x7f4b00f64000] 14:08:51 INFO - ++DOMWINDOW == 59 (0x7f4b07d5dc00) [pid = 2212] [serial = 2712] [outer = 0x7f4b012d3800] 14:08:51 INFO - ++DOMWINDOW == 60 (0x7f4b07d77000) [pid = 2212] [serial = 2713] [outer = 0x7f4b07a0b000] 14:08:51 INFO - ++DOMWINDOW == 61 (0x7f4b087e5c00) [pid = 2212] [serial = 2714] [outer = 0x7f4b07a0d800] 14:08:51 INFO - ++DOMWINDOW == 62 (0x7f4b089eb000) [pid = 2212] [serial = 2715] [outer = 0x7f4b07a11400] 14:08:51 INFO - ++DOCSHELL 0x7f4afab9a000 == 22 [pid = 2212] [id = 1147] 14:08:51 INFO - ++DOMWINDOW == 63 (0x7f4afa942800) [pid = 2212] [serial = 2716] [outer = (nil)] 14:08:51 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:08:51 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:08:52 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:08:52 INFO - ++DOCSHELL 0x7f4afcd9f800 == 23 [pid = 2212] [id = 1148] 14:08:52 INFO - ++DOMWINDOW == 64 (0x7f4afa9e1c00) [pid = 2212] [serial = 2717] [outer = (nil)] 14:08:52 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:08:52 INFO - ++DOMWINDOW == 65 (0x7f4afa9ee800) [pid = 2212] [serial = 2718] [outer = 0x7f4afa942800] 14:08:52 INFO - ++DOMWINDOW == 66 (0x7f4afce41000) [pid = 2212] [serial = 2719] [outer = 0x7f4afa9e1c00] 14:08:52 INFO - ++DOCSHELL 0x7f4b07c25000 == 24 [pid = 2212] [id = 1149] 14:08:52 INFO - ++DOMWINDOW == 67 (0x7f4afd950c00) [pid = 2212] [serial = 2720] [outer = (nil)] 14:08:52 INFO - ++DOMWINDOW == 68 (0x7f4afde5e400) [pid = 2212] [serial = 2721] [outer = 0x7f4afd950c00] 14:08:52 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:08:52 INFO - ++DOCSHELL 0x7f4b0c018000 == 25 [pid = 2212] [id = 1150] 14:08:52 INFO - ++DOMWINDOW == 69 (0x7f4afde6a400) [pid = 2212] [serial = 2722] [outer = (nil)] 14:08:52 INFO - ++DOCSHELL 0x7f4b0c01c800 == 26 [pid = 2212] [id = 1151] 14:08:52 INFO - ++DOMWINDOW == 70 (0x7f4afe009000) [pid = 2212] [serial = 2723] [outer = (nil)] 14:08:52 INFO - ++DOCSHELL 0x7f4b0c023000 == 27 [pid = 2212] [id = 1152] 14:08:52 INFO - ++DOMWINDOW == 71 (0x7f4afe00f800) [pid = 2212] [serial = 2724] [outer = (nil)] 14:08:52 INFO - ++DOCSHELL 0x7f4b0c38f000 == 28 [pid = 2212] [id = 1153] 14:08:52 INFO - ++DOMWINDOW == 72 (0x7f4afe017c00) [pid = 2212] [serial = 2725] [outer = (nil)] 14:08:52 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:08:52 INFO - ++DOCSHELL 0x7f4b0c398800 == 29 [pid = 2212] [id = 1154] 14:08:52 INFO - ++DOMWINDOW == 73 (0x7f4afe8a5000) [pid = 2212] [serial = 2726] [outer = (nil)] 14:08:52 INFO - ++DOMWINDOW == 74 (0x7f4afe8a7000) [pid = 2212] [serial = 2727] [outer = 0x7f4afe8a5000] 14:08:53 INFO - ++DOMWINDOW == 75 (0x7f4b0f84f800) [pid = 2212] [serial = 2728] [outer = 0x7f4afde6a400] 14:08:53 INFO - ++DOMWINDOW == 76 (0x7f4b0f850800) [pid = 2212] [serial = 2729] [outer = 0x7f4afe009000] 14:08:53 INFO - ++DOMWINDOW == 77 (0x7f4b0f851800) [pid = 2212] [serial = 2730] [outer = 0x7f4afe00f800] 14:08:53 INFO - ++DOMWINDOW == 78 (0x7f4b0f852800) [pid = 2212] [serial = 2731] [outer = 0x7f4afe017c00] 14:08:53 INFO - ++DOMWINDOW == 79 (0x7f4b0f853800) [pid = 2212] [serial = 2732] [outer = 0x7f4afe8a5000] 14:08:55 INFO - ++DOCSHELL 0x7f4afab8b800 == 30 [pid = 2212] [id = 1155] 14:08:55 INFO - ++DOMWINDOW == 80 (0x7f4b1237f800) [pid = 2212] [serial = 2733] [outer = (nil)] 14:08:55 INFO - ++DOMWINDOW == 81 (0x7f4b1237dc00) [pid = 2212] [serial = 2734] [outer = 0x7f4b1237f800] 14:08:55 INFO - ++DOCSHELL 0x7f4b10bdd000 == 31 [pid = 2212] [id = 1156] 14:08:55 INFO - ++DOMWINDOW == 82 (0x7f4aff421c00) [pid = 2212] [serial = 2735] [outer = (nil)] 14:08:55 INFO - ++DOMWINDOW == 83 (0x7f4b1237c400) [pid = 2212] [serial = 2736] [outer = 0x7f4aff421c00] 14:08:55 INFO - --DOCSHELL 0x7f4b0c01c800 == 30 [pid = 2212] [id = 1151] 14:08:55 INFO - --DOCSHELL 0x7f4b0c023000 == 29 [pid = 2212] [id = 1152] 14:08:55 INFO - --DOCSHELL 0x7f4b0c018000 == 28 [pid = 2212] [id = 1150] 14:08:55 INFO - --DOCSHELL 0x7f4b0c38f000 == 27 [pid = 2212] [id = 1153] 14:08:55 INFO - --DOCSHELL 0x7f4afcd9f800 == 26 [pid = 2212] [id = 1148] 14:08:56 INFO - --DOCSHELL 0x7f4afab9a000 == 25 [pid = 2212] [id = 1147] 14:08:57 INFO - --DOCSHELL 0x7f4b0c398800 == 24 [pid = 2212] [id = 1154] 14:08:57 INFO - --DOCSHELL 0x7f4afdec6800 == 23 [pid = 2212] [id = 1140] 14:08:57 INFO - --DOCSHELL 0x7f4afab80000 == 22 [pid = 2212] [id = 1127] 14:08:57 INFO - --DOCSHELL 0x7f4b01758000 == 21 [pid = 2212] [id = 1141] 14:08:57 INFO - --DOCSHELL 0x7f4b10bd5000 == 20 [pid = 2212] [id = 1100] 14:08:57 INFO - --DOCSHELL 0x7f4b07c2b000 == 19 [pid = 2212] [id = 1099] 14:08:57 INFO - --DOCSHELL 0x7f4b07c25000 == 18 [pid = 2212] [id = 1149] 14:08:57 INFO - --DOCSHELL 0x7f4afab8b800 == 17 [pid = 2212] [id = 1155] 14:08:57 INFO - --DOCSHELL 0x7f4b10bdd000 == 16 [pid = 2212] [id = 1156] 14:08:57 INFO - --DOCSHELL 0x7f4b07c5f000 == 15 [pid = 2212] [id = 1142] 14:08:57 INFO - --DOCSHELL 0x7f4b07c61000 == 14 [pid = 2212] [id = 1143] 14:08:57 INFO - --DOCSHELL 0x7f4b07c62000 == 13 [pid = 2212] [id = 1144] 14:08:57 INFO - --DOCSHELL 0x7f4b07c6b000 == 12 [pid = 2212] [id = 1145] 14:08:57 INFO - --DOMWINDOW == 82 (0x7f4b143f3800) [pid = 2212] [serial = 2624] [outer = (nil)] [url = about:blank] 14:08:57 INFO - --DOMWINDOW == 81 (0x7f4b29dc1000) [pid = 2212] [serial = 2642] [outer = (nil)] [url = about:blank] 14:08:57 INFO - --DOMWINDOW == 80 (0x7f4afe8a4c00) [pid = 2212] [serial = 2663] [outer = (nil)] [url = about:blank] 14:08:57 INFO - --DOMWINDOW == 79 (0x7f4afab6a800) [pid = 2212] [serial = 2659] [outer = (nil)] [url = about:blank] 14:08:57 INFO - --DOMWINDOW == 78 (0x7f4b0f84cc00) [pid = 2212] [serial = 2655] [outer = (nil)] [url = about:blank] 14:08:57 INFO - --DOMWINDOW == 77 (0x7f4b09848400) [pid = 2212] [serial = 2622] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:08:57 INFO - --DOMWINDOW == 76 (0x7f4b17223800) [pid = 2212] [serial = 2626] [outer = (nil)] [url = about:blank] 14:08:57 INFO - --DOMWINDOW == 75 (0x7f4aff41d000) [pid = 2212] [serial = 2689] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 14:08:57 INFO - --DOMWINDOW == 74 (0x7f4aff41a000) [pid = 2212] [serial = 2688] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 14:08:57 INFO - --DOMWINDOW == 73 (0x7f4aff37fc00) [pid = 2212] [serial = 2686] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 14:08:57 INFO - --DOMWINDOW == 72 (0x7f4afc729800) [pid = 2212] [serial = 2661] [outer = (nil)] [url = about:blank] 14:08:58 INFO - --DOMWINDOW == 71 (0x7f4aff332800) [pid = 2212] [serial = 2618] [outer = (nil)] [url = data:text/html;charset=utf-8,Web%20Console%20test%20for%20splitting] 14:08:58 INFO - --DOMWINDOW == 70 (0x7f4afe816400) [pid = 2212] [serial = 2616] [outer = (nil)] [url = about:blank] 14:08:58 INFO - --DOMWINDOW == 69 (0x7f4aff374c00) [pid = 2212] [serial = 2685] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 14:08:58 INFO - --DOMWINDOW == 68 (0x7f4aff33dc00) [pid = 2212] [serial = 2682] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 14:08:58 INFO - --DOMWINDOW == 67 (0x7f4aff338400) [pid = 2212] [serial = 2679] [outer = (nil)] [url = chrome://devtools/content/markupview/markup-view.xhtml] 14:08:58 INFO - --DOMWINDOW == 66 (0x7f4afa7f3000) [pid = 2212] [serial = 2674] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:08:58 INFO - --DOMWINDOW == 65 (0x7f4afab6a400) [pid = 2212] [serial = 2700] [outer = (nil)] [url = about:blank] 14:08:58 INFO - --DOMWINDOW == 64 (0x7f4afe009000) [pid = 2212] [serial = 2723] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 14:08:58 INFO - --DOMWINDOW == 63 (0x7f4afe017c00) [pid = 2212] [serial = 2725] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 14:08:58 INFO - --DOMWINDOW == 62 (0x7f4afe8a5000) [pid = 2212] [serial = 2726] [outer = (nil)] [url = data:text/html,<html></html>] 14:08:58 INFO - --DOMWINDOW == 61 (0x7f4afe8a7000) [pid = 2212] [serial = 2727] [outer = (nil)] [url = about:blank] 14:08:58 INFO - --DOMWINDOW == 60 (0x7f4afa942800) [pid = 2212] [serial = 2716] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:08:58 INFO - --DOMWINDOW == 59 (0x7f4b07a0d800) [pid = 2212] [serial = 2709] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 14:08:58 INFO - --DOMWINDOW == 58 (0x7f4b07a0b000) [pid = 2212] [serial = 2708] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 14:08:58 INFO - --DOMWINDOW == 57 (0x7f4b00f64000) [pid = 2212] [serial = 2706] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 14:08:58 INFO - --DOMWINDOW == 56 (0x7f4afd899800) [pid = 2212] [serial = 2677] [outer = (nil)] [url = chrome://devtools/content/inspector/inspector.xul] 14:08:58 INFO - --DOMWINDOW == 55 (0x7f4b1237f800) [pid = 2212] [serial = 2733] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:08:58 INFO - --DOMWINDOW == 54 (0x7f4b0f853800) [pid = 2212] [serial = 2732] [outer = (nil)] [url = data:text/html,<html></html>] 14:08:58 INFO - --DOMWINDOW == 53 (0x7f4b00f57800) [pid = 2212] [serial = 2619] [outer = (nil)] [url = about:blank] 14:08:58 INFO - --DOMWINDOW == 52 (0x7f4afe8bd400) [pid = 2212] [serial = 2617] [outer = (nil)] [url = about:blank] 14:08:58 INFO - --DOMWINDOW == 51 (0x7f4aff422000) [pid = 2212] [serial = 2690] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 14:08:58 INFO - MEMORY STAT | vsize 1181MB | residentFast 335MB | heapAllocated 134MB 14:08:58 INFO - 450 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_split_escape_key.js | took 9245ms 14:08:58 INFO - ++DOCSHELL 0x7f4afab8b800 == 13 [pid = 2212] [id = 1157] 14:08:58 INFO - ++DOMWINDOW == 52 (0x7f4afa94d000) [pid = 2212] [serial = 2737] [outer = (nil)] 14:08:58 INFO - ++DOMWINDOW == 53 (0x7f4afa9e5000) [pid = 2212] [serial = 2738] [outer = 0x7f4afa94d000] 14:08:58 INFO - 451 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_split_focus.js 14:08:58 INFO - ++DOCSHELL 0x7f4afce91800 == 14 [pid = 2212] [id = 1158] 14:08:58 INFO - ++DOMWINDOW == 54 (0x7f4afa9f0c00) [pid = 2212] [serial = 2739] [outer = (nil)] 14:08:58 INFO - ++DOMWINDOW == 55 (0x7f4afab65800) [pid = 2212] [serial = 2740] [outer = 0x7f4afa9f0c00] 14:08:59 INFO - ++DOCSHELL 0x7f4afab93000 == 15 [pid = 2212] [id = 1159] 14:08:59 INFO - ++DOMWINDOW == 56 (0x7f4afab66800) [pid = 2212] [serial = 2741] [outer = (nil)] 14:08:59 INFO - ++DOMWINDOW == 57 (0x7f4afc71b800) [pid = 2212] [serial = 2742] [outer = 0x7f4afab66800] 14:08:59 INFO - ++DOMWINDOW == 58 (0x7f4afc861400) [pid = 2212] [serial = 2743] [outer = 0x7f4afab66800] 14:09:00 INFO - ++DOCSHELL 0x7f4afcf8a800 == 16 [pid = 2212] [id = 1160] 14:09:00 INFO - ++DOMWINDOW == 59 (0x7f4afe54ec00) [pid = 2212] [serial = 2744] [outer = (nil)] 14:09:00 INFO - ++DOMWINDOW == 60 (0x7f4afe8a8c00) [pid = 2212] [serial = 2745] [outer = 0x7f4afe54ec00] 14:09:01 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:01 INFO - ++DOCSHELL 0x7f4afcfc1000 == 17 [pid = 2212] [id = 1161] 14:09:01 INFO - ++DOMWINDOW == 61 (0x7f4afc866c00) [pid = 2212] [serial = 2746] [outer = (nil)] 14:09:01 INFO - ++DOMWINDOW == 62 (0x7f4afce32c00) [pid = 2212] [serial = 2747] [outer = 0x7f4afc866c00] 14:09:01 INFO - ++DOCSHELL 0x7f4afdec5800 == 18 [pid = 2212] [id = 1162] 14:09:01 INFO - ++DOMWINDOW == 63 (0x7f4afce34400) [pid = 2212] [serial = 2748] [outer = (nil)] 14:09:01 INFO - ++DOCSHELL 0x7f4afdec6000 == 19 [pid = 2212] [id = 1163] 14:09:01 INFO - ++DOMWINDOW == 64 (0x7f4afd3ad400) [pid = 2212] [serial = 2749] [outer = (nil)] 14:09:01 INFO - ++DOCSHELL 0x7f4afdec6800 == 20 [pid = 2212] [id = 1164] 14:09:01 INFO - ++DOMWINDOW == 65 (0x7f4afd891000) [pid = 2212] [serial = 2750] [outer = (nil)] 14:09:01 INFO - ++DOCSHELL 0x7f4afdec7000 == 21 [pid = 2212] [id = 1165] 14:09:01 INFO - ++DOMWINDOW == 66 (0x7f4afe0ab000) [pid = 2212] [serial = 2751] [outer = (nil)] 14:09:01 INFO - ++DOCSHELL 0x7f4afdec8000 == 22 [pid = 2212] [id = 1166] 14:09:01 INFO - ++DOMWINDOW == 67 (0x7f4afe0b2400) [pid = 2212] [serial = 2752] [outer = (nil)] 14:09:01 INFO - ++DOMWINDOW == 68 (0x7f4afe552c00) [pid = 2212] [serial = 2753] [outer = 0x7f4afce34400] 14:09:01 INFO - ++DOMWINDOW == 69 (0x7f4b019ba800) [pid = 2212] [serial = 2754] [outer = 0x7f4afd3ad400] 14:09:01 INFO - ++DOMWINDOW == 70 (0x7f4b019bec00) [pid = 2212] [serial = 2755] [outer = 0x7f4afd891000] 14:09:01 INFO - ++DOMWINDOW == 71 (0x7f4b07a08c00) [pid = 2212] [serial = 2756] [outer = 0x7f4afe0ab000] 14:09:01 INFO - ++DOMWINDOW == 72 (0x7f4b08988400) [pid = 2212] [serial = 2757] [outer = 0x7f4afe0b2400] 14:09:01 INFO - ++DOCSHELL 0x7f4b10a6f800 == 23 [pid = 2212] [id = 1167] 14:09:01 INFO - ++DOMWINDOW == 73 (0x7f4b0c8f3800) [pid = 2212] [serial = 2758] [outer = (nil)] 14:09:01 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:01 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:01 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:01 INFO - ++DOCSHELL 0x7f4afded7000 == 24 [pid = 2212] [id = 1168] 14:09:01 INFO - ++DOMWINDOW == 74 (0x7f4afe54f800) [pid = 2212] [serial = 2759] [outer = (nil)] 14:09:01 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:01 INFO - ++DOMWINDOW == 75 (0x7f4b0f84bc00) [pid = 2212] [serial = 2760] [outer = 0x7f4b0c8f3800] 14:09:02 INFO - [2212] WARNING: No inner window available!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsGlobalWindow.cpp, line 9211 14:09:02 INFO - ++DOMWINDOW == 76 (0x7f4afab69800) [pid = 2212] [serial = 2761] [outer = 0x7f4afe54f800] 14:09:02 INFO - ++DOCSHELL 0x7f4afcfb9800 == 25 [pid = 2212] [id = 1169] 14:09:02 INFO - ++DOMWINDOW == 77 (0x7f4afc727000) [pid = 2212] [serial = 2762] [outer = (nil)] 14:09:02 INFO - ++DOMWINDOW == 78 (0x7f4afc85fc00) [pid = 2212] [serial = 2763] [outer = 0x7f4afc727000] 14:09:02 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:02 INFO - ++DOCSHELL 0x7f4afcfc0800 == 26 [pid = 2212] [id = 1170] 14:09:02 INFO - ++DOMWINDOW == 79 (0x7f4afd88b400) [pid = 2212] [serial = 2764] [outer = (nil)] 14:09:02 INFO - ++DOCSHELL 0x7f4afcfc2800 == 27 [pid = 2212] [id = 1171] 14:09:02 INFO - ++DOMWINDOW == 80 (0x7f4afd88dc00) [pid = 2212] [serial = 2765] [outer = (nil)] 14:09:02 INFO - ++DOCSHELL 0x7f4afcfc3000 == 28 [pid = 2212] [id = 1172] 14:09:02 INFO - ++DOMWINDOW == 81 (0x7f4afd88e400) [pid = 2212] [serial = 2766] [outer = (nil)] 14:09:02 INFO - ++DOCSHELL 0x7f4afcfc3800 == 29 [pid = 2212] [id = 1173] 14:09:02 INFO - ++DOMWINDOW == 82 (0x7f4afd890c00) [pid = 2212] [serial = 2767] [outer = (nil)] 14:09:02 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:02 INFO - ++DOCSHELL 0x7f4afcfc4000 == 30 [pid = 2212] [id = 1174] 14:09:02 INFO - ++DOMWINDOW == 83 (0x7f4afd892800) [pid = 2212] [serial = 2768] [outer = (nil)] 14:09:02 INFO - ++DOMWINDOW == 84 (0x7f4afe009000) [pid = 2212] [serial = 2769] [outer = 0x7f4afd892800] 14:09:03 INFO - ++DOMWINDOW == 85 (0x7f4b1294e800) [pid = 2212] [serial = 2770] [outer = 0x7f4afd88b400] 14:09:03 INFO - ++DOMWINDOW == 86 (0x7f4b12951000) [pid = 2212] [serial = 2771] [outer = 0x7f4afd88dc00] 14:09:03 INFO - ++DOMWINDOW == 87 (0x7f4b1296fc00) [pid = 2212] [serial = 2772] [outer = 0x7f4afd88e400] 14:09:03 INFO - ++DOMWINDOW == 88 (0x7f4b12973c00) [pid = 2212] [serial = 2773] [outer = 0x7f4afd890c00] 14:09:03 INFO - ++DOMWINDOW == 89 (0x7f4b12ab3c00) [pid = 2212] [serial = 2774] [outer = 0x7f4afd892800] 14:09:04 INFO - --DOCSHELL 0x7f4afcfc2800 == 29 [pid = 2212] [id = 1171] 14:09:04 INFO - --DOCSHELL 0x7f4afcfc3000 == 28 [pid = 2212] [id = 1172] 14:09:04 INFO - --DOCSHELL 0x7f4afcfc0800 == 27 [pid = 2212] [id = 1170] 14:09:04 INFO - --DOCSHELL 0x7f4afcfc3800 == 26 [pid = 2212] [id = 1173] 14:09:04 INFO - --DOCSHELL 0x7f4afded7000 == 25 [pid = 2212] [id = 1168] 14:09:04 INFO - --DOCSHELL 0x7f4b10a6f800 == 24 [pid = 2212] [id = 1167] 14:09:06 INFO - --DOCSHELL 0x7f4afcfc4000 == 23 [pid = 2212] [id = 1174] 14:09:06 INFO - --DOCSHELL 0x7f4afcf8a800 == 22 [pid = 2212] [id = 1160] 14:09:06 INFO - --DOCSHELL 0x7f4afab88000 == 21 [pid = 2212] [id = 1139] 14:09:06 INFO - --DOCSHELL 0x7f4afcfc1000 == 20 [pid = 2212] [id = 1161] 14:09:06 INFO - --DOCSHELL 0x7f4afcfb9800 == 19 [pid = 2212] [id = 1169] 14:09:06 INFO - --DOCSHELL 0x7f4afab9f800 == 18 [pid = 2212] [id = 1137] 14:09:06 INFO - --DOCSHELL 0x7f4afce7a000 == 17 [pid = 2212] [id = 1138] 14:09:06 INFO - --DOCSHELL 0x7f4b07c6f000 == 16 [pid = 2212] [id = 1146] 14:09:06 INFO - --DOCSHELL 0x7f4afdec5800 == 15 [pid = 2212] [id = 1162] 14:09:06 INFO - --DOCSHELL 0x7f4afdec6000 == 14 [pid = 2212] [id = 1163] 14:09:06 INFO - --DOCSHELL 0x7f4afdec6800 == 13 [pid = 2212] [id = 1164] 14:09:06 INFO - --DOCSHELL 0x7f4afdec7000 == 12 [pid = 2212] [id = 1165] 14:09:06 INFO - --DOCSHELL 0x7f4afdec8000 == 11 [pid = 2212] [id = 1166] 14:09:06 INFO - --DOMWINDOW == 88 (0x7f4b07d77000) [pid = 2212] [serial = 2713] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 14:09:06 INFO - --DOMWINDOW == 87 (0x7f4b087e5c00) [pid = 2212] [serial = 2714] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 14:09:06 INFO - --DOMWINDOW == 86 (0x7f4b1237dc00) [pid = 2212] [serial = 2734] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:09:06 INFO - --DOMWINDOW == 85 (0x7f4b0f850800) [pid = 2212] [serial = 2729] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 14:09:06 INFO - --DOMWINDOW == 84 (0x7f4b0f852800) [pid = 2212] [serial = 2731] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 14:09:06 INFO - --DOMWINDOW == 83 (0x7f4b07a13400) [pid = 2212] [serial = 2711] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 14:09:06 INFO - --DOMWINDOW == 82 (0x7f4afa9ee800) [pid = 2212] [serial = 2718] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:09:06 INFO - --DOMWINDOW == 81 (0x7f4aff382000) [pid = 2212] [serial = 2687] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 14:09:06 INFO - --DOMWINDOW == 80 (0x7f4afe4bf400) [pid = 2212] [serial = 2678] [outer = (nil)] [url = about:blank] 14:09:06 INFO - --DOMWINDOW == 79 (0x7f4afa9e4800) [pid = 2212] [serial = 2676] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:09:06 INFO - --DOMWINDOW == 78 (0x7f4aff339800) [pid = 2212] [serial = 2680] [outer = (nil)] [url = about:blank] 14:09:06 INFO - --DOMWINDOW == 77 (0x7f4afd88b400) [pid = 2212] [serial = 2764] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:09:06 INFO - --DOMWINDOW == 76 (0x7f4afd88dc00) [pid = 2212] [serial = 2765] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 14:09:06 INFO - --DOMWINDOW == 75 (0x7f4afd890c00) [pid = 2212] [serial = 2767] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 14:09:06 INFO - --DOMWINDOW == 74 (0x7f4afd892800) [pid = 2212] [serial = 2768] [outer = (nil)] [url = data:text/html,<html></html>] 14:09:06 INFO - --DOMWINDOW == 73 (0x7f4afe54f800) [pid = 2212] [serial = 2759] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:09:06 INFO - --DOMWINDOW == 72 (0x7f4afa9eac00) [pid = 2212] [serial = 2698] [outer = (nil)] [url = about:blank] 14:09:06 INFO - --DOMWINDOW == 71 (0x7f4afa94fc00) [pid = 2212] [serial = 2696] [outer = (nil)] [url = about:blank] 14:09:06 INFO - --DOMWINDOW == 70 (0x7f4aff421c00) [pid = 2212] [serial = 2735] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:09:06 INFO - --DOMWINDOW == 69 (0x7f4b07a11400) [pid = 2212] [serial = 2710] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 14:09:06 INFO - --DOMWINDOW == 68 (0x7f4afe4c4c00) [pid = 2212] [serial = 2702] [outer = (nil)] [url = chrome://devtools/content/inspector/inspector.xul] 14:09:06 INFO - --DOMWINDOW == 67 (0x7f4afc71b800) [pid = 2212] [serial = 2742] [outer = (nil)] [url = about:blank] 14:09:06 INFO - --DOMWINDOW == 66 (0x7f4afa9e8800) [pid = 2212] [serial = 2697] [outer = (nil)] [url = data:text/html;charset=utf-8,<p>Web%20Console%20test%20for%20splitting] 14:09:06 INFO - --DOMWINDOW == 65 (0x7f4afde6a400) [pid = 2212] [serial = 2722] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:09:06 INFO - --DOMWINDOW == 64 (0x7f4afe00f800) [pid = 2212] [serial = 2724] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 14:09:06 INFO - --DOMWINDOW == 63 (0x7f4afa94b000) [pid = 2212] [serial = 2695] [outer = (nil)] [url = about:blank] 14:09:06 INFO - --DOMWINDOW == 62 (0x7f4b00f2b000) [pid = 2212] [serial = 2704] [outer = (nil)] [url = chrome://devtools/content/markupview/markup-view.xhtml] 14:09:06 INFO - --DOMWINDOW == 61 (0x7f4afa9e1c00) [pid = 2212] [serial = 2717] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:09:06 INFO - --DOMWINDOW == 60 (0x7f4afa9ee000) [pid = 2212] [serial = 2699] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:09:06 INFO - --DOMWINDOW == 59 (0x7f4afd950c00) [pid = 2212] [serial = 2720] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:09:06 INFO - --DOMWINDOW == 58 (0x7f4b012d3800) [pid = 2212] [serial = 2707] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 14:09:06 INFO - --DOMWINDOW == 57 (0x7f4afce34400) [pid = 2212] [serial = 2748] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 14:09:06 INFO - --DOMWINDOW == 56 (0x7f4afd3ad400) [pid = 2212] [serial = 2749] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 14:09:06 INFO - --DOMWINDOW == 55 (0x7f4afd891000) [pid = 2212] [serial = 2750] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 14:09:06 INFO - --DOMWINDOW == 54 (0x7f4afe0ab000) [pid = 2212] [serial = 2751] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 14:09:06 INFO - --DOMWINDOW == 53 (0x7f4b0c8f3800) [pid = 2212] [serial = 2758] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:09:06 INFO - --DOMWINDOW == 52 (0x7f4afe009000) [pid = 2212] [serial = 2769] [outer = (nil)] [url = about:blank] 14:09:06 INFO - --DOMWINDOW == 51 (0x7f4b12ab3c00) [pid = 2212] [serial = 2774] [outer = (nil)] [url = data:text/html,<html></html>] 14:09:06 INFO - --DOMWINDOW == 50 (0x7f4b089eb000) [pid = 2212] [serial = 2715] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 14:09:07 INFO - MEMORY STAT | vsize 1180MB | residentFast 336MB | heapAllocated 134MB 14:09:07 INFO - 452 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_split_focus.js | took 8252ms 14:09:07 INFO - ++DOCSHELL 0x7f4afcd8d000 == 12 [pid = 2212] [id = 1175] 14:09:07 INFO - ++DOMWINDOW == 51 (0x7f4afa950000) [pid = 2212] [serial = 2775] [outer = (nil)] 14:09:07 INFO - ++DOMWINDOW == 52 (0x7f4afa9e8800) [pid = 2212] [serial = 2776] [outer = 0x7f4afa950000] 14:09:07 INFO - 453 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_split_persist.js 14:09:07 INFO - ++DOCSHELL 0x7f4afcf93800 == 13 [pid = 2212] [id = 1176] 14:09:07 INFO - ++DOMWINDOW == 53 (0x7f4afab67000) [pid = 2212] [serial = 2777] [outer = (nil)] 14:09:07 INFO - ++DOMWINDOW == 54 (0x7f4afab69c00) [pid = 2212] [serial = 2778] [outer = 0x7f4afab67000] 14:09:07 INFO - ++DOCSHELL 0x7f4afab97000 == 14 [pid = 2212] [id = 1177] 14:09:07 INFO - ++DOMWINDOW == 55 (0x7f4afc721000) [pid = 2212] [serial = 2779] [outer = (nil)] 14:09:07 INFO - ++DOMWINDOW == 56 (0x7f4afc721c00) [pid = 2212] [serial = 2780] [outer = 0x7f4afc721000] 14:09:07 INFO - ++DOMWINDOW == 57 (0x7f4afc868400) [pid = 2212] [serial = 2781] [outer = 0x7f4afc721000] 14:09:08 INFO - ++DOCSHELL 0x7f4afcfa0800 == 15 [pid = 2212] [id = 1178] 14:09:08 INFO - ++DOMWINDOW == 58 (0x7f4afa7f1800) [pid = 2212] [serial = 2782] [outer = (nil)] 14:09:08 INFO - ++DOMWINDOW == 59 (0x7f4b07a11800) [pid = 2212] [serial = 2783] [outer = 0x7f4afa7f1800] 14:09:09 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:09 INFO - ++DOCSHELL 0x7f4afd99e800 == 16 [pid = 2212] [id = 1179] 14:09:09 INFO - ++DOMWINDOW == 60 (0x7f4afce37000) [pid = 2212] [serial = 2784] [outer = (nil)] 14:09:09 INFO - ++DOMWINDOW == 61 (0x7f4afce37c00) [pid = 2212] [serial = 2785] [outer = 0x7f4afce37000] 14:09:09 INFO - ++DOCSHELL 0x7f4afdecf000 == 17 [pid = 2212] [id = 1180] 14:09:09 INFO - ++DOMWINDOW == 62 (0x7f4afce39800) [pid = 2212] [serial = 2786] [outer = (nil)] 14:09:09 INFO - ++DOCSHELL 0x7f4afded0000 == 18 [pid = 2212] [id = 1181] 14:09:09 INFO - ++DOMWINDOW == 63 (0x7f4afce3b000) [pid = 2212] [serial = 2787] [outer = (nil)] 14:09:09 INFO - ++DOCSHELL 0x7f4afded1000 == 19 [pid = 2212] [id = 1182] 14:09:09 INFO - ++DOMWINDOW == 64 (0x7f4afe0b3400) [pid = 2212] [serial = 2788] [outer = (nil)] 14:09:09 INFO - ++DOCSHELL 0x7f4afded2000 == 20 [pid = 2212] [id = 1183] 14:09:09 INFO - ++DOMWINDOW == 65 (0x7f4afe3e2c00) [pid = 2212] [serial = 2789] [outer = (nil)] 14:09:09 INFO - ++DOCSHELL 0x7f4afded2800 == 21 [pid = 2212] [id = 1184] 14:09:09 INFO - ++DOMWINDOW == 66 (0x7f4afe4bf400) [pid = 2212] [serial = 2790] [outer = (nil)] 14:09:09 INFO - ++DOMWINDOW == 67 (0x7f4afe573000) [pid = 2212] [serial = 2791] [outer = 0x7f4afce39800] 14:09:09 INFO - ++DOMWINDOW == 68 (0x7f4b07a13400) [pid = 2212] [serial = 2792] [outer = 0x7f4afce3b000] 14:09:09 INFO - ++DOMWINDOW == 69 (0x7f4b07d77000) [pid = 2212] [serial = 2793] [outer = 0x7f4afe0b3400] 14:09:09 INFO - ++DOMWINDOW == 70 (0x7f4b087e9000) [pid = 2212] [serial = 2794] [outer = 0x7f4afe3e2c00] 14:09:09 INFO - ++DOMWINDOW == 71 (0x7f4b0984c000) [pid = 2212] [serial = 2795] [outer = 0x7f4afe4bf400] 14:09:09 INFO - ++DOCSHELL 0x7f4b10ad0000 == 22 [pid = 2212] [id = 1185] 14:09:09 INFO - ++DOMWINDOW == 72 (0x7f4b0c4e3800) [pid = 2212] [serial = 2796] [outer = (nil)] 14:09:09 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:09 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:10 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:10 INFO - ++DOCSHELL 0x7f4b10ada000 == 23 [pid = 2212] [id = 1186] 14:09:10 INFO - ++DOMWINDOW == 73 (0x7f4b09850800) [pid = 2212] [serial = 2797] [outer = (nil)] 14:09:10 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:10 INFO - ++DOMWINDOW == 74 (0x7f4b0f711000) [pid = 2212] [serial = 2798] [outer = 0x7f4b0c4e3800] 14:09:10 INFO - ++DOMWINDOW == 75 (0x7f4b0f852000) [pid = 2212] [serial = 2799] [outer = 0x7f4b09850800] 14:09:10 INFO - ++DOCSHELL 0x7f4afcd92000 == 24 [pid = 2212] [id = 1187] 14:09:10 INFO - ++DOMWINDOW == 76 (0x7f4afa9e4000) [pid = 2212] [serial = 2800] [outer = (nil)] 14:09:10 INFO - ++DOMWINDOW == 77 (0x7f4afa9e8c00) [pid = 2212] [serial = 2801] [outer = 0x7f4afa9e4000] 14:09:11 INFO - --DOCSHELL 0x7f4b10ada000 == 23 [pid = 2212] [id = 1186] 14:09:12 INFO - --DOCSHELL 0x7f4afab8b800 == 22 [pid = 2212] [id = 1157] 14:09:12 INFO - --DOCSHELL 0x7f4afab97000 == 21 [pid = 2212] [id = 1177] 14:09:12 INFO - --DOCSHELL 0x7f4afcfa0800 == 20 [pid = 2212] [id = 1178] 14:09:12 INFO - --DOCSHELL 0x7f4afce91800 == 19 [pid = 2212] [id = 1158] 14:09:12 INFO - --DOCSHELL 0x7f4afab93000 == 18 [pid = 2212] [id = 1159] 14:09:12 INFO - --DOCSHELL 0x7f4afd99e800 == 17 [pid = 2212] [id = 1179] 14:09:12 INFO - --DOCSHELL 0x7f4afdecf000 == 16 [pid = 2212] [id = 1180] 14:09:12 INFO - --DOCSHELL 0x7f4afded0000 == 15 [pid = 2212] [id = 1181] 14:09:12 INFO - --DOCSHELL 0x7f4afded1000 == 14 [pid = 2212] [id = 1182] 14:09:12 INFO - --DOCSHELL 0x7f4afded2000 == 13 [pid = 2212] [id = 1183] 14:09:12 INFO - --DOCSHELL 0x7f4afded2800 == 12 [pid = 2212] [id = 1184] 14:09:12 INFO - --DOMWINDOW == 76 (0x7f4afce41000) [pid = 2212] [serial = 2719] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:09:12 INFO - --DOMWINDOW == 75 (0x7f4b0f84f800) [pid = 2212] [serial = 2728] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:09:12 INFO - --DOMWINDOW == 74 (0x7f4b0f851800) [pid = 2212] [serial = 2730] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 14:09:12 INFO - --DOMWINDOW == 73 (0x7f4b019ba800) [pid = 2212] [serial = 2754] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 14:09:12 INFO - --DOMWINDOW == 72 (0x7f4b019bec00) [pid = 2212] [serial = 2755] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 14:09:12 INFO - --DOMWINDOW == 71 (0x7f4b07a08c00) [pid = 2212] [serial = 2756] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 14:09:12 INFO - --DOMWINDOW == 70 (0x7f4b0f84bc00) [pid = 2212] [serial = 2760] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:09:12 INFO - --DOMWINDOW == 69 (0x7f4afab69800) [pid = 2212] [serial = 2761] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:09:12 INFO - --DOMWINDOW == 68 (0x7f4b1294e800) [pid = 2212] [serial = 2770] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:09:12 INFO - --DOMWINDOW == 67 (0x7f4b12951000) [pid = 2212] [serial = 2771] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 14:09:12 INFO - --DOMWINDOW == 66 (0x7f4afc864c00) [pid = 2212] [serial = 2701] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:09:12 INFO - --DOMWINDOW == 65 (0x7f4aff41b800) [pid = 2212] [serial = 2703] [outer = (nil)] [url = about:blank] 14:09:12 INFO - --DOMWINDOW == 64 (0x7f4b00f58400) [pid = 2212] [serial = 2705] [outer = (nil)] [url = about:blank] 14:09:12 INFO - --DOMWINDOW == 63 (0x7f4b07d5dc00) [pid = 2212] [serial = 2712] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 14:09:12 INFO - --DOMWINDOW == 62 (0x7f4b12973c00) [pid = 2212] [serial = 2773] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 14:09:12 INFO - --DOMWINDOW == 61 (0x7f4b1237c400) [pid = 2212] [serial = 2736] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/VariablesView.xul] 14:09:12 INFO - --DOMWINDOW == 60 (0x7f4afe552c00) [pid = 2212] [serial = 2753] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 14:09:12 INFO - --DOMWINDOW == 59 (0x7f4afde5e400) [pid = 2212] [serial = 2721] [outer = (nil)] [url = about:blank] 14:09:12 INFO - --DOCSHELL 0x7f4b10ad0000 == 11 [pid = 2212] [id = 1185] 14:09:12 INFO - --DOMWINDOW == 58 (0x7f4b0f711000) [pid = 2212] [serial = 2798] [outer = 0x7f4b0c4e3800] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:09:12 INFO - --DOMWINDOW == 57 (0x7f4b0f852000) [pid = 2212] [serial = 2799] [outer = 0x7f4b09850800] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:09:12 INFO - --DOMWINDOW == 56 (0x7f4b0c4e3800) [pid = 2212] [serial = 2796] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:09:12 INFO - --DOMWINDOW == 55 (0x7f4b09850800) [pid = 2212] [serial = 2797] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:09:12 INFO - ++DOCSHELL 0x7f4afab80000 == 12 [pid = 2212] [id = 1188] 14:09:12 INFO - ++DOMWINDOW == 56 (0x7f4afa7ef800) [pid = 2212] [serial = 2802] [outer = (nil)] 14:09:12 INFO - ++DOMWINDOW == 57 (0x7f4afa7fb000) [pid = 2212] [serial = 2803] [outer = 0x7f4afa7ef800] 14:09:12 INFO - --DOMWINDOW == 56 (0x7f4afce39800) [pid = 2212] [serial = 2786] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 14:09:12 INFO - --DOMWINDOW == 55 (0x7f4afce3b000) [pid = 2212] [serial = 2787] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 14:09:12 INFO - --DOMWINDOW == 54 (0x7f4afe0b3400) [pid = 2212] [serial = 2788] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 14:09:12 INFO - --DOMWINDOW == 53 (0x7f4afe3e2c00) [pid = 2212] [serial = 2789] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 14:09:12 INFO - --DOMWINDOW == 52 (0x7f4afe4bf400) [pid = 2212] [serial = 2790] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 14:09:12 INFO - --DOMWINDOW == 51 (0x7f4afd88e400) [pid = 2212] [serial = 2766] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 14:09:12 INFO - --DOMWINDOW == 50 (0x7f4afc866c00) [pid = 2212] [serial = 2746] [outer = (nil)] [url = chrome://devtools/content/markupview/markup-view.xhtml] 14:09:12 INFO - --DOMWINDOW == 49 (0x7f4afa9e5000) [pid = 2212] [serial = 2738] [outer = (nil)] [url = about:blank] 14:09:12 INFO - --DOMWINDOW == 48 (0x7f4afab65800) [pid = 2212] [serial = 2740] [outer = (nil)] [url = about:blank] 14:09:12 INFO - --DOMWINDOW == 47 (0x7f4afc721c00) [pid = 2212] [serial = 2780] [outer = (nil)] [url = about:blank] 14:09:12 INFO - --DOMWINDOW == 46 (0x7f4afab66800) [pid = 2212] [serial = 2741] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:09:12 INFO - --DOMWINDOW == 45 (0x7f4afc727000) [pid = 2212] [serial = 2762] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:09:12 INFO - --DOMWINDOW == 44 (0x7f4afe54ec00) [pid = 2212] [serial = 2744] [outer = (nil)] [url = chrome://devtools/content/inspector/inspector.xul] 14:09:12 INFO - --DOMWINDOW == 43 (0x7f4afe0b2400) [pid = 2212] [serial = 2752] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 14:09:12 INFO - --DOMWINDOW == 42 (0x7f4afa94d000) [pid = 2212] [serial = 2737] [outer = (nil)] [url = about:blank] 14:09:12 INFO - --DOMWINDOW == 41 (0x7f4afa9f0c00) [pid = 2212] [serial = 2739] [outer = (nil)] [url = data:text/html;charset=utf-8,<p>Web%20Console%20test%20for%20splitting</p>] 14:09:12 INFO - --DOMWINDOW == 40 (0x7f4b08988400) [pid = 2212] [serial = 2757] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 14:09:12 INFO - ++DOCSHELL 0x7f4afab97000 == 13 [pid = 2212] [id = 1189] 14:09:12 INFO - ++DOMWINDOW == 41 (0x7f4afa7fd800) [pid = 2212] [serial = 2804] [outer = (nil)] 14:09:12 INFO - ++DOMWINDOW == 42 (0x7f4afa9e6c00) [pid = 2212] [serial = 2805] [outer = 0x7f4afa7fd800] 14:09:13 INFO - ++DOMWINDOW == 43 (0x7f4afa9ec800) [pid = 2212] [serial = 2806] [outer = 0x7f4afa7fd800] 14:09:14 INFO - ++DOCSHELL 0x7f4afab89800 == 14 [pid = 2212] [id = 1190] 14:09:14 INFO - ++DOMWINDOW == 44 (0x7f4afab6f400) [pid = 2212] [serial = 2807] [outer = (nil)] 14:09:14 INFO - ++DOMWINDOW == 45 (0x7f4afab71000) [pid = 2212] [serial = 2808] [outer = 0x7f4afab6f400] 14:09:14 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:14 INFO - ++DOCSHELL 0x7f4afd59c800 == 15 [pid = 2212] [id = 1191] 14:09:14 INFO - ++DOMWINDOW == 46 (0x7f4afe0a8800) [pid = 2212] [serial = 2809] [outer = (nil)] 14:09:14 INFO - ++DOMWINDOW == 47 (0x7f4afe3d7c00) [pid = 2212] [serial = 2810] [outer = 0x7f4afe0a8800] 14:09:14 INFO - ++DOCSHELL 0x7f4afdec2800 == 16 [pid = 2212] [id = 1192] 14:09:14 INFO - ++DOMWINDOW == 48 (0x7f4b00f31000) [pid = 2212] [serial = 2811] [outer = (nil)] 14:09:14 INFO - ++DOCSHELL 0x7f4afdec3000 == 17 [pid = 2212] [id = 1193] 14:09:14 INFO - ++DOMWINDOW == 49 (0x7f4b07a08c00) [pid = 2212] [serial = 2812] [outer = (nil)] 14:09:14 INFO - ++DOCSHELL 0x7f4afdec8000 == 18 [pid = 2212] [id = 1194] 14:09:14 INFO - ++DOMWINDOW == 50 (0x7f4b0957d800) [pid = 2212] [serial = 2813] [outer = (nil)] 14:09:14 INFO - ++DOCSHELL 0x7f4afdece800 == 19 [pid = 2212] [id = 1195] 14:09:14 INFO - ++DOMWINDOW == 51 (0x7f4b09582800) [pid = 2212] [serial = 2814] [outer = (nil)] 14:09:14 INFO - ++DOCSHELL 0x7f4afded7000 == 20 [pid = 2212] [id = 1196] 14:09:14 INFO - ++DOMWINDOW == 52 (0x7f4b09846800) [pid = 2212] [serial = 2815] [outer = (nil)] 14:09:14 INFO - ++DOMWINDOW == 53 (0x7f4b09849400) [pid = 2212] [serial = 2816] [outer = 0x7f4b00f31000] 14:09:14 INFO - ++DOMWINDOW == 54 (0x7f4b0984b000) [pid = 2212] [serial = 2817] [outer = 0x7f4b07a08c00] 14:09:14 INFO - ++DOMWINDOW == 55 (0x7f4b0984d400) [pid = 2212] [serial = 2818] [outer = 0x7f4b0957d800] 14:09:14 INFO - ++DOMWINDOW == 56 (0x7f4b0984f000) [pid = 2212] [serial = 2819] [outer = 0x7f4b09582800] 14:09:14 INFO - ++DOMWINDOW == 57 (0x7f4b099be800) [pid = 2212] [serial = 2820] [outer = 0x7f4b09846800] 14:09:14 INFO - ++DOCSHELL 0x7f4b0f83e000 == 21 [pid = 2212] [id = 1197] 14:09:14 INFO - ++DOMWINDOW == 58 (0x7f4b0a668400) [pid = 2212] [serial = 2821] [outer = (nil)] 14:09:14 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:14 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:15 INFO - ++DOCSHELL 0x7f4b0f840000 == 22 [pid = 2212] [id = 1198] 14:09:15 INFO - ++DOMWINDOW == 59 (0x7f4b0a9ce000) [pid = 2212] [serial = 2822] [outer = (nil)] 14:09:15 INFO - ++DOMWINDOW == 60 (0x7f4b0a9d3c00) [pid = 2212] [serial = 2823] [outer = 0x7f4b0a9ce000] 14:09:15 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:15 INFO - ++DOCSHELL 0x7f4b0f847800 == 23 [pid = 2212] [id = 1199] 14:09:15 INFO - ++DOMWINDOW == 61 (0x7f4afe572c00) [pid = 2212] [serial = 2824] [outer = (nil)] 14:09:15 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:15 INFO - ++DOMWINDOW == 62 (0x7f4b0ac0dc00) [pid = 2212] [serial = 2825] [outer = 0x7f4b0a668400] 14:09:15 INFO - ++DOMWINDOW == 63 (0x7f4b019b2800) [pid = 2212] [serial = 2826] [outer = 0x7f4afe572c00] 14:09:15 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:15 INFO - ++DOCSHELL 0x7f4b07d92000 == 24 [pid = 2212] [id = 1200] 14:09:15 INFO - ++DOMWINDOW == 64 (0x7f4afc71c800) [pid = 2212] [serial = 2827] [outer = (nil)] 14:09:15 INFO - ++DOCSHELL 0x7f4b07d94800 == 25 [pid = 2212] [id = 1201] 14:09:15 INFO - ++DOMWINDOW == 65 (0x7f4b0c4e4800) [pid = 2212] [serial = 2828] [outer = (nil)] 14:09:15 INFO - ++DOCSHELL 0x7f4b07d97000 == 26 [pid = 2212] [id = 1202] 14:09:15 INFO - ++DOMWINDOW == 66 (0x7f4b0c4e5800) [pid = 2212] [serial = 2829] [outer = (nil)] 14:09:15 INFO - ++DOCSHELL 0x7f4b0949a800 == 27 [pid = 2212] [id = 1203] 14:09:15 INFO - ++DOMWINDOW == 67 (0x7f4b0c4e6000) [pid = 2212] [serial = 2830] [outer = (nil)] 14:09:15 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:15 INFO - ++DOCSHELL 0x7f4b094a6800 == 28 [pid = 2212] [id = 1204] 14:09:15 INFO - ++DOMWINDOW == 68 (0x7f4b0f84b800) [pid = 2212] [serial = 2831] [outer = (nil)] 14:09:15 INFO - ++DOMWINDOW == 69 (0x7f4b0f84c000) [pid = 2212] [serial = 2832] [outer = 0x7f4b0f84b800] 14:09:16 INFO - ++DOMWINDOW == 70 (0x7f4b0984e400) [pid = 2212] [serial = 2833] [outer = 0x7f4afc71c800] 14:09:16 INFO - ++DOMWINDOW == 71 (0x7f4b12bb3800) [pid = 2212] [serial = 2834] [outer = 0x7f4b0c4e4800] 14:09:16 INFO - ++DOMWINDOW == 72 (0x7f4b12bd0000) [pid = 2212] [serial = 2835] [outer = 0x7f4b0c4e5800] 14:09:16 INFO - ++DOMWINDOW == 73 (0x7f4b12bd4800) [pid = 2212] [serial = 2836] [outer = 0x7f4b0c4e6000] 14:09:16 INFO - ++DOMWINDOW == 74 (0x7f4b12e36800) [pid = 2212] [serial = 2837] [outer = 0x7f4b0f84b800] 14:09:17 INFO - --DOCSHELL 0x7f4b07d94800 == 27 [pid = 2212] [id = 1201] 14:09:17 INFO - --DOCSHELL 0x7f4b07d97000 == 26 [pid = 2212] [id = 1202] 14:09:17 INFO - --DOCSHELL 0x7f4b07d92000 == 25 [pid = 2212] [id = 1200] 14:09:17 INFO - --DOCSHELL 0x7f4b0949a800 == 24 [pid = 2212] [id = 1203] 14:09:17 INFO - --DOCSHELL 0x7f4b0f847800 == 23 [pid = 2212] [id = 1199] 14:09:17 INFO - --DOCSHELL 0x7f4b0f83e000 == 22 [pid = 2212] [id = 1197] 14:09:18 INFO - --DOCSHELL 0x7f4b094a6800 == 21 [pid = 2212] [id = 1204] 14:09:18 INFO - --DOCSHELL 0x7f4afab97000 == 20 [pid = 2212] [id = 1189] 14:09:18 INFO - --DOCSHELL 0x7f4afab89800 == 19 [pid = 2212] [id = 1190] 14:09:18 INFO - --DOCSHELL 0x7f4afd59c800 == 18 [pid = 2212] [id = 1191] 14:09:18 INFO - --DOCSHELL 0x7f4b0f840000 == 17 [pid = 2212] [id = 1198] 14:09:18 INFO - --DOCSHELL 0x7f4afdec2800 == 16 [pid = 2212] [id = 1192] 14:09:18 INFO - --DOCSHELL 0x7f4afdec3000 == 15 [pid = 2212] [id = 1193] 14:09:18 INFO - --DOCSHELL 0x7f4afdec8000 == 14 [pid = 2212] [id = 1194] 14:09:18 INFO - --DOCSHELL 0x7f4afdece800 == 13 [pid = 2212] [id = 1195] 14:09:18 INFO - --DOCSHELL 0x7f4afded7000 == 12 [pid = 2212] [id = 1196] 14:09:18 INFO - --DOMWINDOW == 73 (0x7f4afc861400) [pid = 2212] [serial = 2743] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:09:18 INFO - --DOMWINDOW == 72 (0x7f4afe8a8c00) [pid = 2212] [serial = 2745] [outer = (nil)] [url = about:blank] 14:09:18 INFO - --DOMWINDOW == 71 (0x7f4afe573000) [pid = 2212] [serial = 2791] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 14:09:18 INFO - --DOMWINDOW == 70 (0x7f4b07a13400) [pid = 2212] [serial = 2792] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 14:09:18 INFO - --DOMWINDOW == 69 (0x7f4afce32c00) [pid = 2212] [serial = 2747] [outer = (nil)] [url = about:blank] 14:09:18 INFO - --DOMWINDOW == 68 (0x7f4b07d77000) [pid = 2212] [serial = 2793] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 14:09:18 INFO - --DOMWINDOW == 67 (0x7f4b087e9000) [pid = 2212] [serial = 2794] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 14:09:18 INFO - --DOMWINDOW == 66 (0x7f4afc85fc00) [pid = 2212] [serial = 2763] [outer = (nil)] [url = about:blank] 14:09:18 INFO - --DOMWINDOW == 65 (0x7f4b1296fc00) [pid = 2212] [serial = 2772] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 14:09:18 INFO - --DOMWINDOW == 64 (0x7f4b0984c000) [pid = 2212] [serial = 2795] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 14:09:19 INFO - ++DOCSHELL 0x7f4afab88000 == 13 [pid = 2212] [id = 1205] 14:09:19 INFO - ++DOMWINDOW == 65 (0x7f4afa7f2800) [pid = 2212] [serial = 2838] [outer = (nil)] 14:09:19 INFO - ++DOMWINDOW == 66 (0x7f4afa7fe800) [pid = 2212] [serial = 2839] [outer = 0x7f4afa7f2800] 14:09:19 INFO - --DOMWINDOW == 65 (0x7f4afa9e6c00) [pid = 2212] [serial = 2805] [outer = (nil)] [url = about:blank] 14:09:19 INFO - --DOMWINDOW == 64 (0x7f4afa9e4000) [pid = 2212] [serial = 2800] [outer = (nil)] [url = about:blank] 14:09:19 INFO - --DOMWINDOW == 63 (0x7f4afce37000) [pid = 2212] [serial = 2784] [outer = (nil)] [url = chrome://devtools/content/markupview/markup-view.xhtml] 14:09:19 INFO - --DOMWINDOW == 62 (0x7f4afc721000) [pid = 2212] [serial = 2779] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:09:19 INFO - --DOMWINDOW == 61 (0x7f4b0a668400) [pid = 2212] [serial = 2821] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:09:19 INFO - --DOMWINDOW == 60 (0x7f4b0f84c000) [pid = 2212] [serial = 2832] [outer = (nil)] [url = about:blank] 14:09:19 INFO - --DOMWINDOW == 59 (0x7f4afa7f1800) [pid = 2212] [serial = 2782] [outer = (nil)] [url = chrome://devtools/content/inspector/inspector.xul] 14:09:19 INFO - --DOMWINDOW == 58 (0x7f4b0c4e6000) [pid = 2212] [serial = 2830] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 14:09:19 INFO - --DOMWINDOW == 57 (0x7f4b0c4e4800) [pid = 2212] [serial = 2828] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 14:09:19 INFO - --DOMWINDOW == 56 (0x7f4afe572c00) [pid = 2212] [serial = 2824] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:09:19 INFO - --DOMWINDOW == 55 (0x7f4b0957d800) [pid = 2212] [serial = 2813] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 14:09:19 INFO - --DOMWINDOW == 54 (0x7f4b07a08c00) [pid = 2212] [serial = 2812] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 14:09:19 INFO - --DOMWINDOW == 53 (0x7f4b09582800) [pid = 2212] [serial = 2814] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 14:09:19 INFO - --DOMWINDOW == 52 (0x7f4b12e36800) [pid = 2212] [serial = 2837] [outer = (nil)] [url = data:text/html,<html></html>] 14:09:19 INFO - --DOMWINDOW == 51 (0x7f4b0f84b800) [pid = 2212] [serial = 2831] [outer = (nil)] [url = data:text/html,<html></html>] 14:09:19 INFO - ++DOCSHELL 0x7f4afcd9f800 == 14 [pid = 2212] [id = 1206] 14:09:19 INFO - ++DOMWINDOW == 52 (0x7f4afa94a800) [pid = 2212] [serial = 2840] [outer = (nil)] 14:09:19 INFO - ++DOMWINDOW == 53 (0x7f4afab6b400) [pid = 2212] [serial = 2841] [outer = 0x7f4afa94a800] 14:09:19 INFO - ++DOMWINDOW == 54 (0x7f4afab6d400) [pid = 2212] [serial = 2842] [outer = 0x7f4afa94a800] 14:09:21 INFO - ++DOCSHELL 0x7f4afab87800 == 15 [pid = 2212] [id = 1207] 14:09:21 INFO - ++DOMWINDOW == 55 (0x7f4afab67800) [pid = 2212] [serial = 2843] [outer = (nil)] 14:09:21 INFO - ++DOMWINDOW == 56 (0x7f4b09e5d000) [pid = 2212] [serial = 2844] [outer = 0x7f4afab67800] 14:09:21 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:21 INFO - ++DOCSHELL 0x7f4afcfba000 == 16 [pid = 2212] [id = 1208] 14:09:21 INFO - ++DOMWINDOW == 57 (0x7f4afce37800) [pid = 2212] [serial = 2845] [outer = (nil)] 14:09:21 INFO - ++DOMWINDOW == 58 (0x7f4afce3b000) [pid = 2212] [serial = 2846] [outer = 0x7f4afce37800] 14:09:21 INFO - ++DOCSHELL 0x7f4afd59c800 == 17 [pid = 2212] [id = 1209] 14:09:21 INFO - ++DOMWINDOW == 59 (0x7f4afd892400) [pid = 2212] [serial = 2847] [outer = (nil)] 14:09:21 INFO - ++DOCSHELL 0x7f4afd5a1000 == 18 [pid = 2212] [id = 1210] 14:09:21 INFO - ++DOMWINDOW == 60 (0x7f4afd897800) [pid = 2212] [serial = 2848] [outer = (nil)] 14:09:21 INFO - ++DOCSHELL 0x7f4afd99d800 == 19 [pid = 2212] [id = 1211] 14:09:21 INFO - ++DOMWINDOW == 61 (0x7f4afd899400) [pid = 2212] [serial = 2849] [outer = (nil)] 14:09:21 INFO - ++DOCSHELL 0x7f4afd9a1000 == 20 [pid = 2212] [id = 1212] 14:09:21 INFO - ++DOMWINDOW == 62 (0x7f4afd950c00) [pid = 2212] [serial = 2850] [outer = (nil)] 14:09:21 INFO - ++DOCSHELL 0x7f4afdebb800 == 21 [pid = 2212] [id = 1213] 14:09:21 INFO - ++DOMWINDOW == 63 (0x7f4afe8bac00) [pid = 2212] [serial = 2851] [outer = (nil)] 14:09:21 INFO - ++DOMWINDOW == 64 (0x7f4afe8c5400) [pid = 2212] [serial = 2852] [outer = 0x7f4afd892400] 14:09:21 INFO - ++DOMWINDOW == 65 (0x7f4b0a044400) [pid = 2212] [serial = 2853] [outer = 0x7f4afd897800] 14:09:21 INFO - ++DOMWINDOW == 66 (0x7f4b0a66a800) [pid = 2212] [serial = 2854] [outer = 0x7f4afd899400] 14:09:21 INFO - ++DOMWINDOW == 67 (0x7f4b0a861c00) [pid = 2212] [serial = 2855] [outer = 0x7f4afd950c00] 14:09:21 INFO - ++DOMWINDOW == 68 (0x7f4b0c1af800) [pid = 2212] [serial = 2856] [outer = 0x7f4afe8bac00] 14:09:21 INFO - ++DOCSHELL 0x7f4b10b91800 == 22 [pid = 2212] [id = 1214] 14:09:21 INFO - ++DOMWINDOW == 69 (0x7f4b12778800) [pid = 2212] [serial = 2857] [outer = (nil)] 14:09:22 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:22 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:22 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:22 INFO - ++DOCSHELL 0x7f4b10b99800 == 23 [pid = 2212] [id = 1215] 14:09:22 INFO - ++DOMWINDOW == 70 (0x7f4b12975000) [pid = 2212] [serial = 2858] [outer = (nil)] 14:09:22 INFO - [2212] WARNING: Please do not use mouseenter/leave events in chrome. They are slower than mouseover/out!: '!nsContentUtils::IsChromeDoc(d)', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/events/EventListenerManager.cpp, line 385 14:09:22 INFO - ++DOMWINDOW == 71 (0x7f4b12bae800) [pid = 2212] [serial = 2859] [outer = 0x7f4b12778800] 14:09:22 INFO - ++DOMWINDOW == 72 (0x7f4b13fce400) [pid = 2212] [serial = 2860] [outer = 0x7f4b12975000] 14:09:22 INFO - --DOCSHELL 0x7f4b10b99800 == 22 [pid = 2212] [id = 1215] 14:09:22 INFO - --DOCSHELL 0x7f4b10b91800 == 21 [pid = 2212] [id = 1214] 14:09:23 INFO - --DOCSHELL 0x7f4afcd92000 == 20 [pid = 2212] [id = 1187] 14:09:23 INFO - --DOCSHELL 0x7f4afab87800 == 19 [pid = 2212] [id = 1207] 14:09:23 INFO - --DOCSHELL 0x7f4afcfba000 == 18 [pid = 2212] [id = 1208] 14:09:23 INFO - --DOCSHELL 0x7f4afd59c800 == 17 [pid = 2212] [id = 1209] 14:09:23 INFO - --DOCSHELL 0x7f4afd5a1000 == 16 [pid = 2212] [id = 1210] 14:09:23 INFO - --DOCSHELL 0x7f4afd99d800 == 15 [pid = 2212] [id = 1211] 14:09:23 INFO - --DOCSHELL 0x7f4afd9a1000 == 14 [pid = 2212] [id = 1212] 14:09:24 INFO - --DOMWINDOW == 71 (0x7f4afc868400) [pid = 2212] [serial = 2781] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:09:24 INFO - --DOMWINDOW == 70 (0x7f4b07a11800) [pid = 2212] [serial = 2783] [outer = (nil)] [url = about:blank] 14:09:24 INFO - --DOMWINDOW == 69 (0x7f4afce37c00) [pid = 2212] [serial = 2785] [outer = (nil)] [url = about:blank] 14:09:24 INFO - --DOMWINDOW == 68 (0x7f4b0984b000) [pid = 2212] [serial = 2817] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 14:09:24 INFO - --DOMWINDOW == 67 (0x7f4b0984d400) [pid = 2212] [serial = 2818] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 14:09:24 INFO - --DOMWINDOW == 66 (0x7f4b0984f000) [pid = 2212] [serial = 2819] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 14:09:24 INFO - --DOMWINDOW == 65 (0x7f4b0ac0dc00) [pid = 2212] [serial = 2825] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:09:24 INFO - --DOMWINDOW == 64 (0x7f4b019b2800) [pid = 2212] [serial = 2826] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:09:24 INFO - --DOMWINDOW == 63 (0x7f4b12bb3800) [pid = 2212] [serial = 2834] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/spectrum-frame.xhtml] 14:09:24 INFO - --DOMWINDOW == 62 (0x7f4b12bd4800) [pid = 2212] [serial = 2836] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/filter-frame.xhtml] 14:09:24 INFO - --DOMWINDOW == 61 (0x7f4afa9e8c00) [pid = 2212] [serial = 2801] [outer = (nil)] [url = about:blank] 14:09:24 INFO - --DOMWINDOW == 60 (0x7f4b13fce400) [pid = 2212] [serial = 2860] [outer = 0x7f4b12975000] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:09:24 INFO - --DOMWINDOW == 59 (0x7f4b12bae800) [pid = 2212] [serial = 2859] [outer = 0x7f4b12778800] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:09:24 INFO - --DOMWINDOW == 58 (0x7f4b12975000) [pid = 2212] [serial = 2858] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:09:24 INFO - --DOMWINDOW == 57 (0x7f4b12778800) [pid = 2212] [serial = 2857] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:09:24 INFO - --DOMWINDOW == 56 (0x7f4afd892400) [pid = 2212] [serial = 2847] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 14:09:24 INFO - --DOMWINDOW == 55 (0x7f4afd899400) [pid = 2212] [serial = 2849] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 14:09:24 INFO - --DOMWINDOW == 54 (0x7f4afd950c00) [pid = 2212] [serial = 2850] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 14:09:24 INFO - --DOMWINDOW == 53 (0x7f4afe8bac00) [pid = 2212] [serial = 2851] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 14:09:24 INFO - --DOMWINDOW == 52 (0x7f4afab6b400) [pid = 2212] [serial = 2841] [outer = (nil)] [url = about:blank] 14:09:24 INFO - --DOMWINDOW == 51 (0x7f4afab6f400) [pid = 2212] [serial = 2807] [outer = (nil)] [url = chrome://devtools/content/inspector/inspector.xul] 14:09:24 INFO - --DOMWINDOW == 50 (0x7f4b09846800) [pid = 2212] [serial = 2815] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 14:09:24 INFO - --DOMWINDOW == 49 (0x7f4b0c4e5800) [pid = 2212] [serial = 2829] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 14:09:24 INFO - --DOMWINDOW == 48 (0x7f4afc71c800) [pid = 2212] [serial = 2827] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:09:24 INFO - --DOMWINDOW == 47 (0x7f4b00f31000) [pid = 2212] [serial = 2811] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 14:09:24 INFO - --DOMWINDOW == 46 (0x7f4afe0a8800) [pid = 2212] [serial = 2809] [outer = (nil)] [url = chrome://devtools/content/markupview/markup-view.xhtml] 14:09:24 INFO - --DOMWINDOW == 45 (0x7f4b099be800) [pid = 2212] [serial = 2820] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 14:09:24 INFO - MEMORY STAT | vsize 1179MB | residentFast 329MB | heapAllocated 131MB 14:09:24 INFO - 454 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_split_persist.js | took 17543ms 14:09:24 INFO - ++DOCSHELL 0x7f4afab84000 == 15 [pid = 2212] [id = 1216] 14:09:24 INFO - ++DOMWINDOW == 46 (0x7f4afa9e1800) [pid = 2212] [serial = 2861] [outer = (nil)] 14:09:24 INFO - ++DOMWINDOW == 47 (0x7f4afa9e7400) [pid = 2212] [serial = 2862] [outer = 0x7f4afa9e1800] 14:09:24 INFO - 455 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_start_netmon_first.js 14:09:25 INFO - ++DOCSHELL 0x7f4afcf94800 == 16 [pid = 2212] [id = 1217] 14:09:25 INFO - ++DOMWINDOW == 48 (0x7f4afab6f000) [pid = 2212] [serial = 2863] [outer = (nil)] 14:09:25 INFO - ++DOMWINDOW == 49 (0x7f4afc71c000) [pid = 2212] [serial = 2864] [outer = 0x7f4afab6f000] 14:09:25 INFO - ++DOCSHELL 0x7f4afab9a800 == 17 [pid = 2212] [id = 1218] 14:09:25 INFO - ++DOMWINDOW == 50 (0x7f4afc725c00) [pid = 2212] [serial = 2865] [outer = (nil)] 14:09:25 INFO - ++DOMWINDOW == 51 (0x7f4afc85c800) [pid = 2212] [serial = 2866] [outer = 0x7f4afc725c00] 14:09:25 INFO - ++DOMWINDOW == 52 (0x7f4afcf22c00) [pid = 2212] [serial = 2867] [outer = 0x7f4afc725c00] 14:09:25 INFO - ++DOCSHELL 0x7f4afdec6000 == 18 [pid = 2212] [id = 1219] 14:09:25 INFO - ++DOMWINDOW == 53 (0x7f4afd33b000) [pid = 2212] [serial = 2868] [outer = (nil)] 14:09:25 INFO - ++DOMWINDOW == 54 (0x7f4afd88b400) [pid = 2212] [serial = 2869] [outer = 0x7f4afd33b000] 14:09:28 INFO - --DOCSHELL 0x7f4afab80000 == 17 [pid = 2212] [id = 1188] 14:09:28 INFO - --DOCSHELL 0x7f4afcf93800 == 16 [pid = 2212] [id = 1176] 14:09:28 INFO - --DOCSHELL 0x7f4afcd9f800 == 15 [pid = 2212] [id = 1206] 14:09:28 INFO - --DOCSHELL 0x7f4afab9a800 == 14 [pid = 2212] [id = 1218] 14:09:28 INFO - --DOCSHELL 0x7f4afdec6000 == 13 [pid = 2212] [id = 1219] 14:09:28 INFO - --DOCSHELL 0x7f4afcd8d000 == 12 [pid = 2212] [id = 1175] 14:09:28 INFO - --DOCSHELL 0x7f4afab88000 == 11 [pid = 2212] [id = 1205] 14:09:28 INFO - --DOCSHELL 0x7f4afdebb800 == 10 [pid = 2212] [id = 1213] 14:09:28 INFO - --DOMWINDOW == 53 (0x7f4afab71000) [pid = 2212] [serial = 2808] [outer = (nil)] [url = about:blank] 14:09:28 INFO - --DOMWINDOW == 52 (0x7f4afe8c5400) [pid = 2212] [serial = 2852] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 14:09:28 INFO - --DOMWINDOW == 51 (0x7f4b0a66a800) [pid = 2212] [serial = 2854] [outer = (nil)] [url = chrome://devtools/content/fontinspector/font-inspector.xhtml] 14:09:28 INFO - --DOMWINDOW == 50 (0x7f4b0a861c00) [pid = 2212] [serial = 2855] [outer = (nil)] [url = chrome://devtools/content/layoutview/view.xhtml] 14:09:28 INFO - --DOMWINDOW == 49 (0x7f4b0c1af800) [pid = 2212] [serial = 2856] [outer = (nil)] [url = chrome://devtools/content/animationinspector/animation-inspector.xhtml] 14:09:28 INFO - --DOMWINDOW == 48 (0x7f4b12bd0000) [pid = 2212] [serial = 2835] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/cubic-bezier-frame.xhtml] 14:09:28 INFO - --DOMWINDOW == 47 (0x7f4b0984e400) [pid = 2212] [serial = 2833] [outer = (nil)] [url = chrome://devtools/content/shared/widgets/mdn-docs-frame.xhtml] 14:09:28 INFO - --DOMWINDOW == 46 (0x7f4b09849400) [pid = 2212] [serial = 2816] [outer = (nil)] [url = chrome://devtools/content/styleinspector/cssruleview.xhtml] 14:09:28 INFO - --DOMWINDOW == 45 (0x7f4afe3d7c00) [pid = 2212] [serial = 2810] [outer = (nil)] [url = about:blank] 14:09:29 INFO - --DOMWINDOW == 44 (0x7f4afc85c800) [pid = 2212] [serial = 2866] [outer = (nil)] [url = about:blank] 14:09:29 INFO - --DOMWINDOW == 43 (0x7f4afa7fe800) [pid = 2212] [serial = 2839] [outer = (nil)] [url = about:blank] 14:09:29 INFO - --DOMWINDOW == 42 (0x7f4afa7fb000) [pid = 2212] [serial = 2803] [outer = (nil)] [url = about:blank] 14:09:29 INFO - --DOMWINDOW == 41 (0x7f4afab69c00) [pid = 2212] [serial = 2778] [outer = (nil)] [url = about:blank] 14:09:29 INFO - --DOMWINDOW == 40 (0x7f4afa9e8800) [pid = 2212] [serial = 2776] [outer = (nil)] [url = about:blank] 14:09:29 INFO - --DOMWINDOW == 39 (0x7f4afd897800) [pid = 2212] [serial = 2848] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 14:09:29 INFO - --DOMWINDOW == 38 (0x7f4afce37800) [pid = 2212] [serial = 2845] [outer = (nil)] [url = chrome://devtools/content/markupview/markup-view.xhtml] 14:09:29 INFO - --DOMWINDOW == 37 (0x7f4afa94a800) [pid = 2212] [serial = 2840] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:09:29 INFO - --DOMWINDOW == 36 (0x7f4afab67800) [pid = 2212] [serial = 2843] [outer = (nil)] [url = chrome://devtools/content/inspector/inspector.xul] 14:09:29 INFO - --DOMWINDOW == 35 (0x7f4afa7fd800) [pid = 2212] [serial = 2804] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:09:29 INFO - --DOMWINDOW == 34 (0x7f4b0a9ce000) [pid = 2212] [serial = 2822] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:09:29 INFO - --DOMWINDOW == 33 (0x7f4afa7f2800) [pid = 2212] [serial = 2838] [outer = (nil)] [url = data:text/html;charset=utf-8,<p>Web%20Console%20test%20for%20splitting</p>] 14:09:29 INFO - --DOMWINDOW == 32 (0x7f4afa7ef800) [pid = 2212] [serial = 2802] [outer = (nil)] [url = data:text/html;charset=utf-8,<p>Web%20Console%20test%20for%20splitting</p>] 14:09:29 INFO - --DOMWINDOW == 31 (0x7f4afab67000) [pid = 2212] [serial = 2777] [outer = (nil)] [url = data:text/html;charset=utf-8,<p>Web%20Console%20test%20for%20splitting</p>] 14:09:29 INFO - --DOMWINDOW == 30 (0x7f4afa950000) [pid = 2212] [serial = 2775] [outer = (nil)] [url = about:blank] 14:09:29 INFO - MEMORY STAT | vsize 1176MB | residentFast 321MB | heapAllocated 129MB 14:09:29 INFO - 456 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_start_netmon_first.js | took 4463ms 14:09:29 INFO - ++DOCSHELL 0x7f4afcd86800 == 11 [pid = 2212] [id = 1220] 14:09:29 INFO - ++DOMWINDOW == 31 (0x7f4afa94b400) [pid = 2212] [serial = 2870] [outer = (nil)] 14:09:29 INFO - ++DOMWINDOW == 32 (0x7f4afa9e2800) [pid = 2212] [serial = 2871] [outer = 0x7f4afa94b400] 14:09:29 INFO - 457 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_trackingprotection_errors.js 14:09:29 INFO - ++DOCSHELL 0x7f4afcfb8800 == 12 [pid = 2212] [id = 1221] 14:09:29 INFO - ++DOMWINDOW == 33 (0x7f4afc71cc00) [pid = 2212] [serial = 2872] [outer = (nil)] 14:09:29 INFO - ++DOMWINDOW == 34 (0x7f4afc728800) [pid = 2212] [serial = 2873] [outer = 0x7f4afc71cc00] 14:09:30 INFO - ++DOMWINDOW == 35 (0x7f4afce41000) [pid = 2212] [serial = 2874] [outer = 0x7f4afc71cc00] 14:09:30 INFO - ++DOCSHELL 0x7f4afab8b000 == 13 [pid = 2212] [id = 1222] 14:09:30 INFO - ++DOMWINDOW == 36 (0x7f4afd947000) [pid = 2212] [serial = 2875] [outer = (nil)] 14:09:30 INFO - ++DOMWINDOW == 37 (0x7f4afd94fc00) [pid = 2212] [serial = 2876] [outer = 0x7f4afd947000] 14:09:30 INFO - ++DOCSHELL 0x7f4afdebf000 == 14 [pid = 2212] [id = 1223] 14:09:30 INFO - ++DOMWINDOW == 38 (0x7f4afc859800) [pid = 2212] [serial = 2877] [outer = (nil)] 14:09:30 INFO - ++DOMWINDOW == 39 (0x7f4afd033400) [pid = 2212] [serial = 2878] [outer = 0x7f4afc859800] 14:09:30 INFO - [2212] WARNING: NS_ENSURE_TRUE(aSecondURI) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/ThirdPartyUtil.cpp, line 98 14:09:30 INFO - [2212] WARNING: NS_ENSURE_TRUE(aSecondURI) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/ThirdPartyUtil.cpp, line 98 14:09:30 INFO - [2212] WARNING: RasterImage::Init failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/image/ImageFactory.cpp, line 109 14:09:30 INFO - [2212] WARNING: Image width or height is non-positive: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/layout/base/nsLayoutUtils.cpp, line 6417 14:09:30 INFO - ++DOMWINDOW == 40 (0x7f4afe54f400) [pid = 2212] [serial = 2879] [outer = 0x7f4afc859800] 14:09:31 INFO - ++DOCSHELL 0x7f4b0c3ab800 == 15 [pid = 2212] [id = 1224] 14:09:31 INFO - ++DOMWINDOW == 41 (0x7f4aff333c00) [pid = 2212] [serial = 2880] [outer = (nil)] 14:09:31 INFO - ++DOMWINDOW == 42 (0x7f4aff337000) [pid = 2212] [serial = 2881] [outer = 0x7f4aff333c00] 14:09:33 INFO - MEMORY STAT | vsize 1179MB | residentFast 324MB | heapAllocated 134MB 14:09:33 INFO - 458 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_trackingprotection_errors.js | took 4049ms 14:09:33 INFO - ++DOCSHELL 0x7f4afcfa9000 == 16 [pid = 2212] [id = 1225] 14:09:33 INFO - ++DOMWINDOW == 43 (0x7f4afc862800) [pid = 2212] [serial = 2882] [outer = (nil)] 14:09:33 INFO - ++DOMWINDOW == 44 (0x7f4afce38000) [pid = 2212] [serial = 2883] [outer = 0x7f4afc862800] 14:09:34 INFO - 459 INFO TEST-START | devtools/client/webconsole/test/browser_webconsole_view_source.js 14:09:34 INFO - ++DOCSHELL 0x7f4afdeda800 == 17 [pid = 2212] [id = 1226] 14:09:34 INFO - ++DOMWINDOW == 45 (0x7f4afd88f800) [pid = 2212] [serial = 2884] [outer = (nil)] 14:09:34 INFO - ++DOMWINDOW == 46 (0x7f4afde5e400) [pid = 2212] [serial = 2885] [outer = 0x7f4afd88f800] 14:09:34 INFO - ++DOMWINDOW == 47 (0x7f4afe544c00) [pid = 2212] [serial = 2886] [outer = 0x7f4afd88f800] 14:09:34 INFO - ++DOCSHELL 0x7f4b0c836800 == 18 [pid = 2212] [id = 1227] 14:09:34 INFO - ++DOMWINDOW == 48 (0x7f4afe8b6800) [pid = 2212] [serial = 2887] [outer = (nil)] 14:09:34 INFO - ++DOMWINDOW == 49 (0x7f4afe8bf800) [pid = 2212] [serial = 2888] [outer = 0x7f4afe8b6800] 14:09:35 INFO - ++DOMWINDOW == 50 (0x7f4afe8b9400) [pid = 2212] [serial = 2889] [outer = 0x7f4afe8b6800] 14:09:35 INFO - ++DOCSHELL 0x7f4b0fa2c800 == 19 [pid = 2212] [id = 1228] 14:09:35 INFO - ++DOMWINDOW == 51 (0x7f4b0984ac00) [pid = 2212] [serial = 2890] [outer = (nil)] 14:09:35 INFO - ++DOMWINDOW == 52 (0x7f4b09bee400) [pid = 2212] [serial = 2891] [outer = 0x7f4b0984ac00] 14:09:37 INFO - JavaScript error: http://example.com/browser/devtools/client/webconsole/test/test-error.html, line 16: ReferenceError: fooBazBaz is not defined 14:09:37 INFO - ++DOCSHELL 0x7f4b10adc000 == 20 [pid = 2212] [id = 1229] 14:09:37 INFO - ++DOMWINDOW == 53 (0x7f4aff336000) [pid = 2212] [serial = 2892] [outer = (nil)] 14:09:37 INFO - ++DOMWINDOW == 54 (0x7f4b12375400) [pid = 2212] [serial = 2893] [outer = 0x7f4aff336000] 14:09:37 INFO - ++DOCSHELL 0x7f4b10ba1800 == 21 [pid = 2212] [id = 1230] 14:09:37 INFO - ++DOMWINDOW == 55 (0x7f4afe8a2800) [pid = 2212] [serial = 2894] [outer = (nil)] 14:09:37 INFO - ++DOMWINDOW == 56 (0x7f4afe8a3000) [pid = 2212] [serial = 2895] [outer = 0x7f4afe8a2800] 14:09:39 INFO - --DOCSHELL 0x7f4b0c3ab800 == 20 [pid = 2212] [id = 1224] 14:09:40 INFO - --DOCSHELL 0x7f4afab8b000 == 19 [pid = 2212] [id = 1222] 14:09:40 INFO - --DOCSHELL 0x7f4afcd86800 == 18 [pid = 2212] [id = 1220] 14:09:40 INFO - --DOCSHELL 0x7f4afcfb8800 == 17 [pid = 2212] [id = 1221] 14:09:40 INFO - --DOCSHELL 0x7f4afdebf000 == 16 [pid = 2212] [id = 1223] 14:09:40 INFO - --DOCSHELL 0x7f4afab84000 == 15 [pid = 2212] [id = 1216] 14:09:40 INFO - --DOCSHELL 0x7f4afcf94800 == 14 [pid = 2212] [id = 1217] 14:09:40 INFO - --DOMWINDOW == 55 (0x7f4afa9ec800) [pid = 2212] [serial = 2806] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:09:40 INFO - --DOMWINDOW == 54 (0x7f4afce3b000) [pid = 2212] [serial = 2846] [outer = (nil)] [url = about:blank] 14:09:40 INFO - --DOMWINDOW == 53 (0x7f4b0a9d3c00) [pid = 2212] [serial = 2823] [outer = (nil)] [url = about:blank] 14:09:40 INFO - --DOMWINDOW == 52 (0x7f4b0a044400) [pid = 2212] [serial = 2853] [outer = (nil)] [url = chrome://devtools/content/styleinspector/computedview.xhtml] 14:09:40 INFO - --DOMWINDOW == 51 (0x7f4b09e5d000) [pid = 2212] [serial = 2844] [outer = (nil)] [url = about:blank] 14:09:40 INFO - --DOMWINDOW == 50 (0x7f4afab6d400) [pid = 2212] [serial = 2842] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:09:40 INFO - ++DOCSHELL 0x7f4afcda0000 == 15 [pid = 2212] [id = 1231] 14:09:40 INFO - ++DOMWINDOW == 51 (0x7f4afab68c00) [pid = 2212] [serial = 2896] [outer = (nil)] 14:09:40 INFO - ++DOMWINDOW == 52 (0x7f4afab6c800) [pid = 2212] [serial = 2897] [outer = 0x7f4afab68c00] 14:09:40 INFO - ++DOMWINDOW == 53 (0x7f4afc862400) [pid = 2212] [serial = 2898] [outer = 0x7f4afab68c00] 14:09:41 INFO - ++DOMWINDOW == 54 (0x7f4afe81c800) [pid = 2212] [serial = 2899] [outer = 0x7f4afab68c00] 14:09:41 INFO - [2212] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:09:42 INFO - --DOCSHELL 0x7f4b10ba1800 == 14 [pid = 2212] [id = 1230] 14:09:42 INFO - --DOCSHELL 0x7f4b10adc000 == 13 [pid = 2212] [id = 1229] 14:09:42 INFO - --DOCSHELL 0x7f4b0fa2c800 == 12 [pid = 2212] [id = 1228] 14:09:42 INFO - MEMORY STAT | vsize 1175MB | residentFast 325MB | heapAllocated 137MB 14:09:42 INFO - 460 INFO TEST-OK | devtools/client/webconsole/test/browser_webconsole_view_source.js | took 8789ms 14:09:42 INFO - ++DOCSHELL 0x7f4afcfc5000 == 13 [pid = 2212] [id = 1232] 14:09:42 INFO - ++DOMWINDOW == 55 (0x7f4afa9ebc00) [pid = 2212] [serial = 2900] [outer = (nil)] 14:09:42 INFO - ++DOMWINDOW == 56 (0x7f4afce38800) [pid = 2212] [serial = 2901] [outer = 0x7f4afa9ebc00] 14:09:43 INFO - ++DOMWINDOW == 57 (0x7f4afe0ad800) [pid = 2212] [serial = 2902] [outer = 0x7f4b15847c00] 14:09:43 INFO - ++DOMWINDOW == 58 (0x7f4afe3d7800) [pid = 2212] [serial = 2903] [outer = 0x7f4b15848400] 14:09:43 INFO - --DOCSHELL 0x7f4b1589b800 == 12 [pid = 2212] [id = 12] 14:09:43 INFO - ++DOMWINDOW == 59 (0x7f4afe0b3000) [pid = 2212] [serial = 2904] [outer = 0x7f4b15847c00] 14:09:43 INFO - ++DOMWINDOW == 60 (0x7f4afe57fc00) [pid = 2212] [serial = 2905] [outer = 0x7f4b15848400] 14:09:44 INFO - --DOCSHELL 0x7f4b14522000 == 11 [pid = 2212] [id = 13] 14:09:44 INFO - --DOCSHELL 0x7f4b0c836800 == 10 [pid = 2212] [id = 1227] 14:09:44 INFO - --DOCSHELL 0x7f4b12a11000 == 9 [pid = 2212] [id = 8] 14:09:46 INFO - --DOCSHELL 0x7f4afcfa9000 == 8 [pid = 2212] [id = 1225] 14:09:46 INFO - --DOCSHELL 0x7f4afdeda800 == 7 [pid = 2212] [id = 1226] 14:09:46 INFO - --DOMWINDOW == 59 (0x7f4afe3d7800) [pid = 2212] [serial = 2903] [outer = 0x7f4b15848400] [url = about:blank] 14:09:46 INFO - --DOMWINDOW == 58 (0x7f4b12e37400) [pid = 2212] [serial = 11] [outer = 0x7f4b15848400] [url = about:blank] 14:09:46 INFO - --DOMWINDOW == 57 (0x7f4afe0ad800) [pid = 2212] [serial = 2902] [outer = 0x7f4b15847c00] [url = about:blank] 14:09:46 INFO - --DOMWINDOW == 56 (0x7f4b12e36c00) [pid = 2212] [serial = 10] [outer = 0x7f4b15847c00] [url = about:blank] 14:09:49 INFO - --DOMWINDOW == 55 (0x7f4afe8b9400) [pid = 2212] [serial = 2889] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:09:49 INFO - --DOMWINDOW == 54 (0x7f4aff337000) [pid = 2212] [serial = 2881] [outer = (nil)] [url = about:blank] 14:09:49 INFO - --DOMWINDOW == 53 (0x7f4afc725c00) [pid = 2212] [serial = 2865] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:09:49 INFO - --DOMWINDOW == 52 (0x7f4afd33b000) [pid = 2212] [serial = 2868] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:09:49 INFO - --DOMWINDOW == 51 (0x7f4afa9e1800) [pid = 2212] [serial = 2861] [outer = (nil)] [url = about:blank] 14:09:49 INFO - --DOMWINDOW == 50 (0x7f4afab6f000) [pid = 2212] [serial = 2863] [outer = (nil)] [url = data:text/html;charset=utf8,<p>hello] 14:09:49 INFO - --DOMWINDOW == 49 (0x7f4afd88f800) [pid = 2212] [serial = 2884] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-error.html] 14:09:49 INFO - --DOMWINDOW == 48 (0x7f4b0952c400) [pid = 2212] [serial = 31] [outer = (nil)] [url = about:blank] 14:09:49 INFO - --DOMWINDOW == 47 (0x7f4afc862800) [pid = 2212] [serial = 2882] [outer = (nil)] [url = about:blank] 14:09:49 INFO - --DOMWINDOW == 46 (0x7f4b0c8f6c00) [pid = 2212] [serial = 18] [outer = (nil)] [url = about:newtab] 14:09:49 INFO - --DOMWINDOW == 45 (0x7f4afe8bf800) [pid = 2212] [serial = 2888] [outer = (nil)] [url = about:blank] 14:09:49 INFO - --DOMWINDOW == 44 (0x7f4afc862400) [pid = 2212] [serial = 2898] [outer = (nil)] [url = about:blank] 14:09:49 INFO - --DOMWINDOW == 43 (0x7f4afd033400) [pid = 2212] [serial = 2878] [outer = (nil)] [url = about:blank] 14:09:49 INFO - --DOMWINDOW == 42 (0x7f4b0c4e8c00) [pid = 2212] [serial = 22] [outer = (nil)] [url = about:newtab] 14:09:49 INFO - --DOMWINDOW == 41 (0x7f4afce38000) [pid = 2212] [serial = 2883] [outer = (nil)] [url = about:blank] 14:09:49 INFO - --DOMWINDOW == 40 (0x7f4afc728800) [pid = 2212] [serial = 2873] [outer = (nil)] [url = about:blank] 14:09:49 INFO - --DOMWINDOW == 39 (0x7f4afe8a3000) [pid = 2212] [serial = 2895] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:09:49 INFO - --DOMWINDOW == 38 (0x7f4afe8b6800) [pid = 2212] [serial = 2887] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:09:49 INFO - --DOMWINDOW == 37 (0x7f4aff336000) [pid = 2212] [serial = 2892] [outer = (nil)] [url = chrome://devtools/content/debugger/debugger.xul] 14:09:49 INFO - --DOMWINDOW == 36 (0x7f4afe8a2800) [pid = 2212] [serial = 2894] [outer = (nil)] [url = data:text/html;charset=utf8,<!DOCTYPE%20html><html%20dir='ltr'>%20%20<head>%20%20%20%20<style>%20%20%20%20%20%20html,%20body%20{%20height:%20100%;%20}%20%20%20%20%20%20body%20{%20margin:%200;%20overflow:%20hidden;%20}%20%20%20%20%20%20.CodeMirror%20{%20width:%20100%;%20height:%20100%%20!important;%20line-height:%201.25%20!important;}%20%20%20%20</style><link%20rel='stylesheet'%20href='chrome://devtools/skin/common.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/codemirror.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/dialog/dialog.css'><link%20rel='stylesheet'%20href='chrome://devtools/content/sourceeditor/codemirror/mozilla.css'>%20%20</head>%20%20<body%20class='theme-body%20devtools-monospace'></body></html>] 14:09:49 INFO - --DOMWINDOW == 35 (0x7f4afe81c800) [pid = 2212] [serial = 2899] [outer = (nil)] [url = view-source:http://example.com/browser/devtools/client/webconsole/test/test-error.html] 14:09:49 INFO - --DOMWINDOW == 34 (0x7f4afab68c00) [pid = 2212] [serial = 2896] [outer = (nil)] [url = view-source:http://example.com/browser/devtools/client/webconsole/test/test-error.html] 14:09:49 INFO - --DOMWINDOW == 33 (0x7f4b12375400) [pid = 2212] [serial = 2893] [outer = (nil)] [url = about:blank] 14:09:49 INFO - --DOMWINDOW == 32 (0x7f4afde5e400) [pid = 2212] [serial = 2885] [outer = (nil)] [url = about:blank] 14:09:49 INFO - --DOMWINDOW == 31 (0x7f4b0984ac00) [pid = 2212] [serial = 2890] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:09:49 INFO - --DOMWINDOW == 30 (0x7f4afab6c800) [pid = 2212] [serial = 2897] [outer = (nil)] [url = about:blank] 14:09:49 INFO - --DOMWINDOW == 29 (0x7f4b09bed000) [pid = 2212] [serial = 28] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,<window%20id='win'/>] 14:09:49 INFO - --DOMWINDOW == 28 (0x7f4b0952f000) [pid = 2212] [serial = 32] [outer = (nil)] [url = about:blank] 14:09:49 INFO - --DOMWINDOW == 27 (0x7f4afc859800) [pid = 2212] [serial = 2877] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:09:49 INFO - --DOMWINDOW == 26 (0x7f4afc71cc00) [pid = 2212] [serial = 2872] [outer = (nil)] [url = http://tracking.example.org/browser/devtools/client/webconsole/test/test-trackingprotection-securityerrors.html] 14:09:49 INFO - --DOMWINDOW == 25 (0x7f4afa94b400) [pid = 2212] [serial = 2870] [outer = (nil)] [url = about:blank] 14:09:49 INFO - --DOMWINDOW == 24 (0x7f4afa9e2800) [pid = 2212] [serial = 2871] [outer = (nil)] [url = about:blank] 14:09:49 INFO - --DOMWINDOW == 23 (0x7f4afd947000) [pid = 2212] [serial = 2875] [outer = (nil)] [url = about:blank] 14:09:49 INFO - --DOMWINDOW == 22 (0x7f4afd94fc00) [pid = 2212] [serial = 2876] [outer = (nil)] [url = about:blank] 14:09:49 INFO - --DOMWINDOW == 21 (0x7f4aff333c00) [pid = 2212] [serial = 2880] [outer = (nil)] [url = chrome://devtools/content/webconsole/webconsole.xul] 14:09:49 INFO - --DOMWINDOW == 20 (0x7f4afa9e7400) [pid = 2212] [serial = 2862] [outer = (nil)] [url = about:blank] 14:09:49 INFO - --DOMWINDOW == 19 (0x7f4afc71c000) [pid = 2212] [serial = 2864] [outer = (nil)] [url = about:blank] 14:09:49 INFO - --DOMWINDOW == 18 (0x7f4b09524000) [pid = 2212] [serial = 30] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,<window%20id='win'/>] 14:09:49 INFO - --DOMWINDOW == 17 (0x7f4afe54f400) [pid = 2212] [serial = 2879] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:09:49 INFO - --DOMWINDOW == 16 (0x7f4b09bee400) [pid = 2212] [serial = 2891] [outer = (nil)] [url = about:blank] 14:09:49 INFO - --DOMWINDOW == 15 (0x7f4afcf22c00) [pid = 2212] [serial = 2867] [outer = (nil)] [url = chrome://devtools/content/framework/toolbox.xul] 14:09:49 INFO - --DOMWINDOW == 14 (0x7f4afd88b400) [pid = 2212] [serial = 2869] [outer = (nil)] [url = about:blank] 14:09:50 INFO - --DOMWINDOW == 13 (0x7f4afe544c00) [pid = 2212] [serial = 2886] [outer = (nil)] [url = http://example.com/browser/devtools/client/webconsole/test/test-error.html] 14:09:50 INFO - --DOMWINDOW == 12 (0x7f4afce41000) [pid = 2212] [serial = 2874] [outer = (nil)] [url = http://tracking.example.org/browser/devtools/client/webconsole/test/test-trackingprotection-securityerrors.html] 14:09:50 INFO - --DOCSHELL 0x7f4afcda0000 == 6 [pid = 2212] [id = 1231] 14:09:57 INFO - Completed ShutdownLeaks collections in process 2212 14:09:57 INFO - JavaScript error: resource://gre/modules/PerformanceStats.jsm, line 208: NS_ERROR_NOT_AVAILABLE: Component returned failure code: 0x80040111 (NS_ERROR_NOT_AVAILABLE) [nsIPerformanceStatsService.isMonitoringJank] 14:09:57 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 14:09:57 INFO - --DOCSHELL 0x7f4b1205b000 == 5 [pid = 2212] [id = 6] 14:09:57 INFO - --DOCSHELL 0x7f4b25786000 == 4 [pid = 2212] [id = 1] 14:09:58 INFO - --DOCSHELL 0x7f4b15b60800 == 3 [pid = 2212] [id = 4] 14:09:58 INFO - --DOCSHELL 0x7f4b15b60000 == 2 [pid = 2212] [id = 3] 14:09:58 INFO - --DOCSHELL 0x7f4afcfc5000 == 1 [pid = 2212] [id = 1232] 14:09:58 INFO - --DOCSHELL 0x7f4b19742000 == 0 [pid = 2212] [id = 2] 14:09:58 INFO - JavaScript error: resource://gre/modules/PerformanceStats.jsm, line 492: Error: forget() called twice 14:09:59 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 14:09:59 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 14:09:59 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 14:09:59 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 14:10:00 INFO - [2212] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 769 14:10:02 INFO - --DOMWINDOW == 11 (0x7f4afe0b3000) [pid = 2212] [serial = 2904] [outer = 0x7f4b15847c00] [url = about:blank] 14:10:02 INFO - --DOMWINDOW == 10 (0x7f4afe57fc00) [pid = 2212] [serial = 2905] [outer = 0x7f4b15848400] [url = about:blank] 14:10:02 INFO - --DOMWINDOW == 9 (0x7f4b15848400) [pid = 2212] [serial = 7] [outer = (nil)] [url = about:blank] 14:10:02 INFO - --DOMWINDOW == 8 (0x7f4b15847c00) [pid = 2212] [serial = 6] [outer = (nil)] [url = about:blank] 14:10:04 INFO - --DOMWINDOW == 7 (0x7f4b25940400) [pid = 2212] [serial = 4] [outer = (nil)] [url = about:blank] 14:10:04 INFO - --DOMWINDOW == 6 (0x7f4b257e6800) [pid = 2212] [serial = 1] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 14:10:04 INFO - --DOMWINDOW == 5 (0x7f4b12051800) [pid = 2212] [serial = 14] [outer = (nil)] [url = chrome://mochikit/content/browser-harness.xul] 14:10:04 INFO - --DOMWINDOW == 4 (0x7f4afa9ebc00) [pid = 2212] [serial = 2900] [outer = (nil)] [url = about:blank] 14:10:04 INFO - --DOMWINDOW == 3 (0x7f4afce38800) [pid = 2212] [serial = 2901] [outer = (nil)] [url = about:blank] 14:10:04 INFO - --DOMWINDOW == 2 (0x7f4b123d3800) [pid = 2212] [serial = 15] [outer = (nil)] [url = about:blank] 14:10:04 INFO - --DOMWINDOW == 1 (0x7f4b2593f800) [pid = 2212] [serial = 3] [outer = (nil)] [url = chrome://browser/content/browser.xul] 14:10:04 INFO - --DOMWINDOW == 0 (0x7f4b196d8400) [pid = 2212] [serial = 5] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 14:10:05 INFO - [2212] WARNING: OOPDeinit() without successful OOPInit(): file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/crashreporter/nsExceptionHandler.cpp, line 2792 14:10:05 INFO - nsStringStats 14:10:05 INFO - => mAllocCount: 3126108 14:10:05 INFO - => mReallocCount: 239847 14:10:05 INFO - => mFreeCount: 3126108 14:10:05 INFO - => mShareCount: 4543831 14:10:05 INFO - => mAdoptCount: 217247 14:10:05 INFO - => mAdoptFreeCount: 217247 14:10:05 INFO - => Process ID: 2212, Thread ID: 139961258903360 14:10:05 INFO - TEST-INFO | Main app process: exit 0 14:10:05 INFO - runtests.py | Application ran for: 0:24:39.357321 14:10:05 INFO - zombiecheck | Reading PID log: /tmp/tmp9QnLROpidlog 14:10:05 INFO - Stopping web server 14:10:05 INFO - Stopping web socket server 14:10:05 INFO - Stopping ssltunnel 14:10:05 INFO - TEST-INFO | leakcheck | default process: leak threshold set at 0 bytes 14:10:05 INFO - TEST-INFO | leakcheck | plugin process: leak threshold set at 0 bytes 14:10:05 INFO - TEST-INFO | leakcheck | tab process: leak threshold set at 10000 bytes 14:10:05 INFO - TEST-INFO | leakcheck | geckomediaplugin process: leak threshold set at 20000 bytes 14:10:05 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, default process 2212 14:10:05 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 14:10:05 INFO - | | Per-Inst Leaked| Total Rem| 14:10:05 INFO - 0 |TOTAL | 21 0|224172381 0| 14:10:05 INFO - nsTraceRefcnt::DumpStatistics: 1531 entries 14:10:05 INFO - TEST-PASS | leakcheck | default process: no leaks detected! 14:10:05 INFO - runtests.py | Running tests: end. 14:10:05 INFO - 461 INFO checking window state 14:10:05 INFO - 462 INFO TEST-START | Shutdown 14:10:05 INFO - 463 INFO Browser Chrome Test Summary 14:10:05 INFO - 464 INFO Passed: 2938 14:10:05 INFO - 465 INFO Failed: 0 14:10:05 INFO - 466 INFO Todo: 1 14:10:05 INFO - 467 INFO *** End BrowserChrome Test Results *** 14:10:05 INFO - dir: devtools/shared/worker/tests/browser 14:10:05 INFO - Setting pipeline to PAUSED ... 14:10:05 INFO - Pipeline is PREROLLING ... 14:10:05 INFO - Pipeline is PREROLLED ... 14:10:05 INFO - Setting pipeline to PLAYING ... 14:10:05 INFO - New clock: GstSystemClock 14:10:05 INFO - Got EOS from element "pipeline0". 14:10:05 INFO - Execution ended after 32865123 ns. 14:10:05 INFO - Setting pipeline to PAUSED ... 14:10:05 INFO - Setting pipeline to READY ... 14:10:05 INFO - Setting pipeline to NULL ... 14:10:05 INFO - Freeing pipeline ... 14:10:09 INFO - pk12util: PKCS12 IMPORT SUCCESSFUL 14:10:10 INFO - MochitestServer : launching [u'/builds/slave/test/build/tests/bin/xpcshell', '-g', '/builds/slave/test/build/application/firefox', '-v', '170', '-f', '/builds/slave/test/build/tests/bin/components/httpd.js', '-e', "const _PROFILE_PATH = '/tmp/tmp5YUEHq.mozrunner'; const _SERVER_PORT = '8888'; const _SERVER_ADDR = '127.0.0.1'; const _TEST_PREFIX = undefined; const _DISPLAY_RESULTS = false;", '-f', '/builds/slave/test/build/tests/mochitest/server.js'] 14:10:10 INFO - runtests.py | Server pid: 2335 14:10:11 INFO - runtests.py | Websocket server pid: 2353 14:10:12 INFO - runtests.py | SSL tunnel pid: 2356 14:10:12 INFO - runtests.py | Running tests: start. 14:10:13 INFO - runtests.py | Application pid: 2363 14:10:13 INFO - TEST-INFO | started process Main app process 14:10:13 INFO - ### XPCOM_MEM_BLOAT_LOG defined -- logging bloat/leaks to /tmp/tmp5YUEHq.mozrunner/runtests_leaks.log 14:10:16 INFO - ++DOCSHELL 0x7f7cd6e84000 == 1 [pid = 2363] [id = 1] 14:10:16 INFO - ++DOMWINDOW == 1 (0x7f7cd6ed4400) [pid = 2363] [serial = 1] [outer = (nil)] 14:10:16 INFO - [2363] WARNING: Hardware Vsync support not yet implemented. Falling back to software timers: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/gfx/thebes/gfxPlatform.cpp, line 2084 14:10:16 INFO - ++DOMWINDOW == 2 (0x7f7cd6ed7800) [pid = 2363] [serial = 2] [outer = 0x7f7cd6ed4400] 14:10:17 INFO - LoadPlugin() /tmp/tmp5YUEHq.mozrunner/plugins/libnptestjava.so returned 7f7cd170c7c0 14:10:17 INFO - LoadPlugin() /tmp/tmp5YUEHq.mozrunner/plugins/libnpsecondtest.so returned 7f7cd170cbb0 14:10:17 INFO - LoadPlugin() /tmp/tmp5YUEHq.mozrunner/plugins/libnptest.so returned 7f7cd170cee0 14:10:17 INFO - LoadPlugin() /tmp/tmp5YUEHq.mozrunner/plugins/libnpswftest.so returned 7f7cd170cfd0 14:10:17 INFO - LoadPlugin() /tmp/tmp5YUEHq.mozrunner/plugins/libnpthirdtest.so returned 7f7cdb2e3340 14:10:17 INFO - LoadPlugin() /usr/lib/mozilla/plugins/librhythmbox-itms-detection-plugin.so returned 7f7cdb2e36a0 14:10:17 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-cone-plugin.so returned 7f7cd17a7520 14:10:17 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-mully-plugin.so returned 7f7cd17ac4c0 14:10:17 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-gmp-plugin.so returned 7f7cd17ac7c0 14:10:17 INFO - LoadPlugin() /usr/lib/mozilla/plugins/libtotem-narrowspace-plugin.so returned 7f7cd17acaf0 14:10:17 INFO - ++DOCSHELL 0x7f7ccae42000 == 2 [pid = 2363] [id = 2] 14:10:17 INFO - ++DOMWINDOW == 3 (0x7f7cd703d800) [pid = 2363] [serial = 3] [outer = (nil)] 14:10:17 INFO - ++DOMWINDOW == 4 (0x7f7cd703e400) [pid = 2363] [serial = 4] [outer = 0x7f7cd703d800] 14:10:17 INFO - ++DOMWINDOW == 5 (0x7f7ccad80400) [pid = 2363] [serial = 5] [outer = 0x7f7cd6ed4400] 14:10:19 INFO - [2363] WARNING: Failed to retarget HTML data delivery to the parser thread.: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/parser/html/nsHtml5StreamParser.cpp, line 966 14:10:19 INFO - ++DOCSHELL 0x7f7cc6869800 == 3 [pid = 2363] [id = 3] 14:10:19 INFO - ++DOMWINDOW == 6 (0x7f7cc6af2000) [pid = 2363] [serial = 6] [outer = (nil)] 14:10:19 INFO - ++DOCSHELL 0x7f7cc686a000 == 4 [pid = 2363] [id = 4] 14:10:19 INFO - ++DOMWINDOW == 7 (0x7f7cc6af2800) [pid = 2363] [serial = 7] [outer = (nil)] 14:10:20 INFO - [2363] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 14:10:20 INFO - ++DOCSHELL 0x7f7cc4db0800 == 5 [pid = 2363] [id = 5] 14:10:20 INFO - ++DOMWINDOW == 8 (0x7f7cc4e5dc00) [pid = 2363] [serial = 8] [outer = (nil)] 14:10:20 INFO - [2363] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/base/nsFrameLoader.cpp, line 272 14:10:21 INFO - ++DOMWINDOW == 9 (0x7f7cc41fa400) [pid = 2363] [serial = 9] [outer = 0x7f7cc4e5dc00] 14:10:21 INFO - ++DOMWINDOW == 10 (0x7f7cc3c38400) [pid = 2363] [serial = 10] [outer = 0x7f7cc6af2000] 14:10:21 INFO - ++DOMWINDOW == 11 (0x7f7cc3c38c00) [pid = 2363] [serial = 11] [outer = 0x7f7cc6af2800] 14:10:21 INFO - ++DOMWINDOW == 12 (0x7f7cc3c3a800) [pid = 2363] [serial = 12] [outer = 0x7f7cc4e5dc00] 14:10:22 INFO - ++DOMWINDOW == 13 (0x7f7cc31f3400) [pid = 2363] [serial = 13] [outer = 0x7f7cc4e5dc00] 14:10:22 INFO - ++DOCSHELL 0x7f7cc2e1e000 == 6 [pid = 2363] [id = 6] 14:10:22 INFO - ++DOMWINDOW == 14 (0x7f7cc2e11c00) [pid = 2363] [serial = 14] [outer = (nil)] 14:10:22 INFO - ++DOMWINDOW == 15 (0x7f7cc39a6400) [pid = 2363] [serial = 15] [outer = 0x7f7cc2e11c00] 14:10:25 INFO - ++DOCSHELL 0x7f7cbdf32800 == 7 [pid = 2363] [id = 7] 14:10:25 INFO - ++DOMWINDOW == 16 (0x7f7cbe240c00) [pid = 2363] [serial = 16] [outer = (nil)] 14:10:25 INFO - ++DOMWINDOW == 17 (0x7f7cbe242c00) [pid = 2363] [serial = 17] [outer = 0x7f7cbe240c00] 14:10:25 INFO - ++DOCSHELL 0x7f7cbdf3b800 == 8 [pid = 2363] [id = 8] 14:10:25 INFO - ++DOMWINDOW == 18 (0x7f7cc372a400) [pid = 2363] [serial = 18] [outer = (nil)] 14:10:25 INFO - ++DOMWINDOW == 19 (0x7f7cc372c800) [pid = 2363] [serial = 19] [outer = 0x7f7cc372a400] 14:10:25 INFO - 468 INFO TEST-START | devtools/shared/worker/tests/browser/browser_worker-01.js 14:10:25 INFO - ++DOMWINDOW == 20 (0x7f7cbda51c00) [pid = 2363] [serial = 20] [outer = 0x7f7cc372a400] 14:10:26 INFO - [2363] WARNING: GetDefaultCharsetForLocale: need to add multi locale support: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/intl/locale/unix/nsUNIXCharset.cpp, line 101 14:10:26 INFO - console.warn: `workerify` should only be used in tests or measuring performance. 14:10:26 INFO - This creates an object URL on the browser window, and should not be used in production. 14:10:27 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 14:10:27 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 14:10:27 INFO - console.warn: `workerify` should only be used in tests or measuring performance. 14:10:27 INFO - This creates an object URL on the browser window, and should not be used in production. 14:10:27 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 14:10:27 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 14:10:27 INFO - MEMORY STAT vsizeMaxContiguous not supported in this build configuration. 14:10:27 INFO - MEMORY STAT | vsize 928MB | residentFast 257MB | heapAllocated 89MB 14:10:27 INFO - 469 INFO TEST-OK | devtools/shared/worker/tests/browser/browser_worker-01.js | took 1955ms 14:10:27 INFO - ++DOCSHELL 0x7f7cbc448800 == 9 [pid = 2363] [id = 9] 14:10:27 INFO - ++DOMWINDOW == 21 (0x7f7cbd321000) [pid = 2363] [serial = 21] [outer = (nil)] 14:10:27 INFO - ++DOMWINDOW == 22 (0x7f7cbda59c00) [pid = 2363] [serial = 22] [outer = 0x7f7cbd321000] 14:10:27 INFO - ++DOCSHELL 0x7f7cbd29e000 == 10 [pid = 2363] [id = 10] 14:10:27 INFO - ++DOMWINDOW == 23 (0x7f7cc2e50c00) [pid = 2363] [serial = 23] [outer = (nil)] 14:10:27 INFO - 470 INFO TEST-START | devtools/shared/worker/tests/browser/browser_worker-02.js 14:10:27 INFO - [2363] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/res/SubstitutingProtocolHandler.cpp, line 260 14:10:27 INFO - [2363] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/protocol/res/SubstitutingProtocolHandler.cpp, line 260 14:10:27 INFO - [2363] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/base/nsIOService.cpp, line 774 14:10:27 INFO - [2363] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/netwerk/base/nsNetUtil.inl, line 179 14:10:27 INFO - [2363] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/workers/ScriptLoader.cpp, line 195 14:10:27 INFO - [2363] WARNING: NS_ENSURE_SUCCESS(rv, rv) failed with result 0x80040111: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/workers/WorkerPrivate.cpp, line 4347 14:10:27 INFO - ++DOMWINDOW == 24 (0x7f7cc3272800) [pid = 2363] [serial = 24] [outer = 0x7f7cc2e50c00] 14:10:27 INFO - ++DOMWINDOW == 25 (0x7f7cc31f4800) [pid = 2363] [serial = 25] [outer = 0x7f7cc2e50c00] 14:10:27 INFO - ++DOCSHELL 0x7f7cbdae0800 == 11 [pid = 2363] [id = 11] 14:10:28 INFO - ++DOMWINDOW == 26 (0x7f7cbd3c2400) [pid = 2363] [serial = 26] [outer = (nil)] 14:10:28 INFO - ++DOMWINDOW == 27 (0x7f7cc372d800) [pid = 2363] [serial = 27] [outer = 0x7f7cbd3c2400] 14:10:28 INFO - [2363] WARNING: Could not get disk status from nsIDiskSpaceWatcher: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/uriloader/prefetch/nsOfflineCacheUpdateService.cpp, line 319 14:10:28 INFO - [2363] WARNING: 'aRv.Failed()', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/workers/WorkerPrivate.cpp, line 5458 14:10:28 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 14:10:28 INFO - MEMORY STAT | vsize 938MB | residentFast 260MB | heapAllocated 91MB 14:10:28 INFO - 471 INFO TEST-OK | devtools/shared/worker/tests/browser/browser_worker-02.js | took 510ms 14:10:28 INFO - ++DOCSHELL 0x7f7cbd2ad800 == 12 [pid = 2363] [id = 12] 14:10:28 INFO - ++DOMWINDOW == 28 (0x7f7cc34a4000) [pid = 2363] [serial = 28] [outer = (nil)] 14:10:28 INFO - ++DOMWINDOW == 29 (0x7f7cc39cbc00) [pid = 2363] [serial = 29] [outer = 0x7f7cc34a4000] 14:10:28 INFO - 472 INFO TEST-START | devtools/shared/worker/tests/browser/browser_worker-03.js 14:10:28 INFO - console.warn: `workerify` should only be used in tests or measuring performance. 14:10:28 INFO - This creates an object URL on the browser window, and should not be used in production. 14:10:28 INFO - console.warn: `workerify` should only be used in tests or measuring performance. 14:10:28 INFO - This creates an object URL on the browser window, and should not be used in production. 14:10:28 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 14:10:28 INFO - console.warn: `workerify` should only be used in tests or measuring performance. 14:10:28 INFO - This creates an object URL on the browser window, and should not be used in production. 14:10:28 INFO - [2363] WARNING: 'aRv.Failed()', file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/workers/WorkerPrivate.cpp, line 5458 14:10:28 INFO - console.warn: `workerify` should only be used in tests or measuring performance. 14:10:28 INFO - This creates an object URL on the browser window, and should not be used in production. 14:10:28 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 14:10:29 INFO - MEMORY STAT | vsize 943MB | residentFast 264MB | heapAllocated 93MB 14:10:29 INFO - 473 INFO TEST-OK | devtools/shared/worker/tests/browser/browser_worker-03.js | took 456ms 14:10:29 INFO - ++DOCSHELL 0x7f7cd27da800 == 13 [pid = 2363] [id = 13] 14:10:29 INFO - ++DOMWINDOW == 30 (0x7f7cc6a0c000) [pid = 2363] [serial = 30] [outer = (nil)] 14:10:29 INFO - ++DOMWINDOW == 31 (0x7f7cc8c05c00) [pid = 2363] [serial = 31] [outer = 0x7f7cc6a0c000] 14:10:29 INFO - ++DOMWINDOW == 32 (0x7f7ccad20800) [pid = 2363] [serial = 32] [outer = 0x7f7cc6af2000] 14:10:29 INFO - ++DOMWINDOW == 33 (0x7f7ccad22400) [pid = 2363] [serial = 33] [outer = 0x7f7cc6af2800] 14:10:29 INFO - --DOCSHELL 0x7f7cbd29e000 == 12 [pid = 2363] [id = 10] 14:10:29 INFO - ++DOMWINDOW == 34 (0x7f7cbd855400) [pid = 2363] [serial = 34] [outer = 0x7f7cc6af2000] 14:10:29 INFO - ++DOMWINDOW == 35 (0x7f7cc3188000) [pid = 2363] [serial = 35] [outer = 0x7f7cc6af2800] 14:10:31 INFO - --DOCSHELL 0x7f7cbdae0800 == 11 [pid = 2363] [id = 11] 14:10:31 INFO - --DOCSHELL 0x7f7cc4db0800 == 10 [pid = 2363] [id = 5] 14:10:31 INFO - --DOCSHELL 0x7f7cbdf32800 == 9 [pid = 2363] [id = 7] 14:10:31 INFO - --DOCSHELL 0x7f7cbdf3b800 == 8 [pid = 2363] [id = 8] 14:10:32 INFO - --DOCSHELL 0x7f7cbc448800 == 7 [pid = 2363] [id = 9] 14:10:32 INFO - --DOCSHELL 0x7f7cbd2ad800 == 6 [pid = 2363] [id = 12] 14:10:32 INFO - --DOMWINDOW == 34 (0x7f7cc3c38400) [pid = 2363] [serial = 10] [outer = 0x7f7cc6af2000] [url = about:blank] 14:10:32 INFO - --DOMWINDOW == 33 (0x7f7cc3c38c00) [pid = 2363] [serial = 11] [outer = 0x7f7cc6af2800] [url = about:blank] 14:10:32 INFO - --DOMWINDOW == 32 (0x7f7ccad22400) [pid = 2363] [serial = 33] [outer = 0x7f7cc6af2800] [url = about:blank] 14:10:32 INFO - --DOMWINDOW == 31 (0x7f7ccad20800) [pid = 2363] [serial = 32] [outer = 0x7f7cc6af2000] [url = about:blank] 14:10:33 INFO - --DOMWINDOW == 30 (0x7f7cc3c3a800) [pid = 2363] [serial = 12] [outer = (nil)] [url = about:blank] 14:10:33 INFO - --DOMWINDOW == 29 (0x7f7cbd3c2400) [pid = 2363] [serial = 26] [outer = (nil)] [url = about:blank] 14:10:33 INFO - --DOMWINDOW == 28 (0x7f7cc4e5dc00) [pid = 2363] [serial = 8] [outer = (nil)] [url = about:blank] 14:10:33 INFO - --DOMWINDOW == 27 (0x7f7cc41fa400) [pid = 2363] [serial = 9] [outer = (nil)] [url = about:blank] 14:10:33 INFO - --DOMWINDOW == 26 (0x7f7cc2e50c00) [pid = 2363] [serial = 23] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,<window%20id='win'/>] 14:10:33 INFO - --DOMWINDOW == 25 (0x7f7cbda59c00) [pid = 2363] [serial = 22] [outer = (nil)] [url = about:blank] 14:10:33 INFO - --DOMWINDOW == 24 (0x7f7cbd321000) [pid = 2363] [serial = 21] [outer = (nil)] [url = about:blank] 14:10:33 INFO - --DOMWINDOW == 23 (0x7f7cd6ed7800) [pid = 2363] [serial = 2] [outer = (nil)] [url = about:blank] 14:10:33 INFO - --DOMWINDOW == 22 (0x7f7cc39cbc00) [pid = 2363] [serial = 29] [outer = (nil)] [url = about:blank] 14:10:33 INFO - --DOMWINDOW == 21 (0x7f7cbda51c00) [pid = 2363] [serial = 20] [outer = (nil)] [url = about:newtab] 14:10:33 INFO - --DOMWINDOW == 20 (0x7f7cc3272800) [pid = 2363] [serial = 24] [outer = (nil)] [url = about:blank] 14:10:33 INFO - --DOMWINDOW == 19 (0x7f7cbe240c00) [pid = 2363] [serial = 16] [outer = (nil)] [url = about:blank] 14:10:33 INFO - --DOMWINDOW == 18 (0x7f7cbe242c00) [pid = 2363] [serial = 17] [outer = (nil)] [url = about:blank] 14:10:33 INFO - --DOMWINDOW == 17 (0x7f7cc372a400) [pid = 2363] [serial = 18] [outer = (nil)] [url = about:newtab] 14:10:33 INFO - --DOMWINDOW == 16 (0x7f7cc372c800) [pid = 2363] [serial = 19] [outer = (nil)] [url = about:blank] 14:10:33 INFO - --DOMWINDOW == 15 (0x7f7cc34a4000) [pid = 2363] [serial = 28] [outer = (nil)] [url = about:blank] 14:10:33 INFO - --DOMWINDOW == 14 (0x7f7cc31f4800) [pid = 2363] [serial = 25] [outer = (nil)] [url = data:application/vnd.mozilla.xul+xml;charset=utf-8,<window%20id='win'/>] 14:10:33 INFO - --DOMWINDOW == 13 (0x7f7cc31f3400) [pid = 2363] [serial = 13] [outer = (nil)] [url = about:blank] 14:10:33 INFO - --DOMWINDOW == 12 (0x7f7cc372d800) [pid = 2363] [serial = 27] [outer = (nil)] [url = about:blank] 14:10:34 INFO - JavaScript error: , line 0: NS_ERROR_UNEXPECTED: 14:10:34 INFO - [2363] WARNING: A control runnable was posted to a worker that is already shutting down!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/workers/WorkerPrivate.cpp, line 2326 14:10:38 INFO - Completed ShutdownLeaks collections in process 2363 14:10:38 INFO - JavaScript error: resource://gre/modules/PerformanceStats.jsm, line 208: NS_ERROR_NOT_AVAILABLE: Component returned failure code: 0x80040111 (NS_ERROR_NOT_AVAILABLE) [nsIPerformanceStatsService.isMonitoringJank] 14:10:38 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 14:10:39 INFO - --DOCSHELL 0x7f7cc2e1e000 == 5 [pid = 2363] [id = 6] 14:10:39 INFO - --DOCSHELL 0x7f7cd6e84000 == 4 [pid = 2363] [id = 1] 14:10:39 INFO - [2363] WARNING: A runnable was posted to a worker that is already shutting down!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/workers/WorkerPrivate.cpp, line 2253 14:10:39 INFO - [2363] WARNING: Failed to dispatch offline status change event!: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/dom/workers/WorkerPrivate.cpp, line 3019 14:10:39 INFO - --DOCSHELL 0x7f7cc6869800 == 3 [pid = 2363] [id = 3] 14:10:39 INFO - --DOCSHELL 0x7f7cc686a000 == 2 [pid = 2363] [id = 4] 14:10:39 INFO - --DOCSHELL 0x7f7cd27da800 == 1 [pid = 2363] [id = 13] 14:10:39 INFO - --DOCSHELL 0x7f7ccae42000 == 0 [pid = 2363] [id = 2] 14:10:40 INFO - JavaScript error: resource://gre/modules/PerformanceStats.jsm, line 492: Error: forget() called twice 14:10:40 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 14:10:40 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 14:10:40 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 14:10:40 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 14:10:40 INFO - ###!!! [Parent][OnMaybeDequeueOne] Error: Channel closing: too late to send/recv, messages will be lost 14:10:40 INFO - JavaScript error: , line 0: NS_ERROR_UNEXPECTED: 14:10:40 INFO - [2363] WARNING: NS_ENSURE_TRUE(context) failed: file /builds/slave/m-in-l64-d-0000000000000000000/build/src/xpcom/threads/nsThread.cpp, line 769 14:10:42 INFO - --DOMWINDOW == 11 (0x7f7cc3188000) [pid = 2363] [serial = 35] [outer = 0x7f7cc6af2800] [url = about:blank] 14:10:42 INFO - --DOMWINDOW == 10 (0x7f7cbd855400) [pid = 2363] [serial = 34] [outer = 0x7f7cc6af2000] [url = about:blank] 14:10:42 INFO - --DOMWINDOW == 9 (0x7f7cc6af2800) [pid = 2363] [serial = 7] [outer = (nil)] [url = about:blank] 14:10:42 INFO - --DOMWINDOW == 8 (0x7f7cc6af2000) [pid = 2363] [serial = 6] [outer = (nil)] [url = about:blank] 14:10:43 INFO - --DOMWINDOW == 7 (0x7f7cd703e400) [pid = 2363] [serial = 4] [outer = (nil)] [url = about:blank] 14:10:43 INFO - --DOMWINDOW == 6 (0x7f7cd6ed4400) [pid = 2363] [serial = 1] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 14:10:43 INFO - --DOMWINDOW == 5 (0x7f7cc39a6400) [pid = 2363] [serial = 15] [outer = (nil)] [url = about:blank] 14:10:43 INFO - --DOMWINDOW == 4 (0x7f7cc6a0c000) [pid = 2363] [serial = 30] [outer = (nil)] [url = about:blank] 14:10:43 INFO - --DOMWINDOW == 3 (0x7f7cc8c05c00) [pid = 2363] [serial = 31] [outer = (nil)] [url = about:blank] 14:10:43 INFO - --DOMWINDOW == 2 (0x7f7cc2e11c00) [pid = 2363] [serial = 14] [outer = (nil)] [url = chrome://mochikit/content/browser-harness.xul] 14:10:43 INFO - --DOMWINDOW == 1 (0x7f7cd703d800) [pid = 2363] [serial = 3] [outer = (nil)] [url = chrome://browser/content/browser.xul] 14:10:43 INFO - --DOMWINDOW == 0 (0x7f7ccad80400) [pid = 2363] [serial = 5] [outer = (nil)] [url = resource://gre-resources/hiddenWindow.html] 14:10:43 INFO - [2363] WARNING: OOPDeinit() without successful OOPInit(): file /builds/slave/m-in-l64-d-0000000000000000000/build/src/toolkit/crashreporter/nsExceptionHandler.cpp, line 2792 14:10:43 INFO - nsStringStats 14:10:43 INFO - => mAllocCount: 100396 14:10:43 INFO - => mReallocCount: 8278 14:10:43 INFO - => mFreeCount: 100396 14:10:43 INFO - => mShareCount: 93073 14:10:43 INFO - => mAdoptCount: 6164 14:10:43 INFO - => mAdoptFreeCount: 6164 14:10:43 INFO - => Process ID: 2363, Thread ID: 140174688880448 14:10:43 INFO - TEST-INFO | Main app process: exit 0 14:10:43 INFO - runtests.py | Application ran for: 0:00:30.469739 14:10:43 INFO - zombiecheck | Reading PID log: /tmp/tmpYZ_IUYpidlog 14:10:43 INFO - Stopping web server 14:10:43 INFO - Stopping web socket server 14:10:43 INFO - Stopping ssltunnel 14:10:43 INFO - TEST-INFO | leakcheck | default process: leak threshold set at 0 bytes 14:10:43 INFO - TEST-INFO | leakcheck | plugin process: leak threshold set at 0 bytes 14:10:43 INFO - TEST-INFO | leakcheck | tab process: leak threshold set at 10000 bytes 14:10:43 INFO - TEST-INFO | leakcheck | geckomediaplugin process: leak threshold set at 20000 bytes 14:10:43 INFO - == BloatView: ALL (cumulative) LEAK AND BLOAT STATISTICS, default process 2363 14:10:43 INFO - |<----------------Class--------------->|<-----Bytes------>|<----Objects---->| 14:10:43 INFO - | | Per-Inst Leaked| Total Rem| 14:10:43 INFO - 0 |TOTAL | 37 0| 918281 0| 14:10:43 INFO - nsTraceRefcnt::DumpStatistics: 1279 entries 14:10:43 INFO - TEST-PASS | leakcheck | default process: no leaks detected! 14:10:43 INFO - runtests.py | Running tests: end. 14:10:43 INFO - 474 INFO checking window state 14:10:43 INFO - 475 INFO Console message: [JavaScript Error: "NS_ERROR_UNEXPECTED: "] 14:10:43 INFO - 476 INFO TEST-START | Shutdown 14:10:43 INFO - 477 INFO Browser Chrome Test Summary 14:10:43 INFO - 478 INFO Passed: 12 14:10:43 INFO - 479 INFO Failed: 0 14:10:43 INFO - 480 INFO Todo: 0 14:10:43 INFO - 481 INFO *** End BrowserChrome Test Results *** 14:10:43 INFO - TEST-INFO | checking window state 14:10:43 INFO - Browser Chrome Test Summary 14:10:43 INFO - Passed: 3422 14:10:43 INFO - Failed: 0 14:10:43 INFO - Todo: 2 14:10:43 INFO - *** End BrowserChrome Test Results *** 14:10:43 INFO - SUITE-END | took 1684s 14:10:45 INFO - Return code: 0 14:10:45 INFO - TinderboxPrint: mochitest-mochitest-devtools-chrome-chunked<br/>3422/0/2 14:10:45 INFO - # TBPL SUCCESS # 14:10:45 INFO - The mochitest suite: mochitest-devtools-chrome-chunked ran with return status: SUCCESS 14:10:45 INFO - Running post-action listener: _package_coverage_data 14:10:45 INFO - Running post-action listener: _resource_record_post_action 14:10:45 INFO - Running post-run listener: _resource_record_post_run 14:10:46 INFO - Total resource usage - Wall time: 1710s; CPU: 99.0%; Read bytes: 10821632; Write bytes: 407920640; Read time: 804; Write time: 163648 14:10:46 INFO - install - Wall time: 23s; CPU: 100.0%; Read bytes: 0; Write bytes: 4829184; Read time: 0; Write time: 880 14:10:46 INFO - run-tests - Wall time: 1688s; CPU: 99.0%; Read bytes: 8605696; Write bytes: 403091456; Read time: 736; Write time: 162768 14:10:46 INFO - Running post-run listener: _upload_blobber_files 14:10:46 INFO - Blob upload gear active. 14:10:46 INFO - Preparing to upload files from /builds/slave/test/build/blobber_upload_dir. 14:10:46 INFO - Files from /builds/slave/test/build/blobber_upload_dir are to be uploaded with <mozilla-inbound> branch at the following location(s): https://blobupload.elasticbeanstalk.com 14:10:46 INFO - Running command: ['/builds/slave/test/build/venv/bin/python', '/builds/slave/test/build/venv/bin/blobberc.py', '-u', 'https://blobupload.elasticbeanstalk.com', '-a', '/builds/slave/test/oauth.txt', '-b', 'mozilla-inbound', '-d', '/builds/slave/test/build/blobber_upload_dir', '--output-manifest', '/builds/slave/test/build/uploaded_files.json'] 14:10:46 INFO - Copy/paste: /builds/slave/test/build/venv/bin/python /builds/slave/test/build/venv/bin/blobberc.py -u https://blobupload.elasticbeanstalk.com -a /builds/slave/test/oauth.txt -b mozilla-inbound -d /builds/slave/test/build/blobber_upload_dir --output-manifest /builds/slave/test/build/uploaded_files.json 14:10:47 INFO - (blobuploader) - INFO - Open directory for files ... 14:10:47 INFO - (blobuploader) - INFO - Uploading /builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_raw.log ... 14:10:47 INFO - (blobuploader) - INFO - Using https://blobupload.elasticbeanstalk.com 14:10:47 INFO - (blobuploader) - INFO - Uploading, attempt #1. 14:10:49 INFO - (blobuploader) - INFO - TinderboxPrint: <a href='http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-inbound/sha512/9cfdee01b923b17f78d012276f4c8c3fbd9438f83dfd50925c36194318129b45b579a989699973451af2ee3ad81c2dd5e9fcedeb4fd4149d63744149daf29fb4'>mochitest-devtools-chrome-chunked_raw.log</a>: uploaded 14:10:49 INFO - (blobuploader) - INFO - Blobserver returned 202. File uploaded! 14:10:49 INFO - (blobuploader) - INFO - Done attempting. 14:10:49 INFO - (blobuploader) - INFO - Uploading /builds/slave/test/build/blobber_upload_dir/mochitest-devtools-chrome-chunked_errorsummary.log ... 14:10:49 INFO - (blobuploader) - INFO - Using https://blobupload.elasticbeanstalk.com 14:10:49 INFO - (blobuploader) - INFO - Uploading, attempt #1. 14:10:50 INFO - (blobuploader) - INFO - TinderboxPrint: <a href='http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-inbound/sha512/a9cd45bfcaf37c9236a3a294366d061f1fd86358c80285cd5e73fdb871e43146c3493972f51d463448c2d9c5953492836e73932cf8957e3df89010c9d6b5645d'>mochitest-devtools-chrome-chunked_errorsummary.log</a>: uploaded 14:10:50 INFO - (blobuploader) - INFO - Blobserver returned 202. File uploaded! 14:10:50 INFO - (blobuploader) - INFO - Done attempting. 14:10:50 INFO - (blobuploader) - INFO - Iteration through files over. 14:10:50 INFO - Return code: 0 14:10:50 INFO - rmtree: /builds/slave/test/build/uploaded_files.json 14:10:50 INFO - retry: Calling remove with args: ('/builds/slave/test/build/uploaded_files.json',), kwargs: {}, attempt #1 14:10:50 INFO - Setting buildbot property blobber_files to {"mochitest-devtools-chrome-chunked_raw.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-inbound/sha512/9cfdee01b923b17f78d012276f4c8c3fbd9438f83dfd50925c36194318129b45b579a989699973451af2ee3ad81c2dd5e9fcedeb4fd4149d63744149daf29fb4", "mochitest-devtools-chrome-chunked_errorsummary.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-inbound/sha512/a9cd45bfcaf37c9236a3a294366d061f1fd86358c80285cd5e73fdb871e43146c3493972f51d463448c2d9c5953492836e73932cf8957e3df89010c9d6b5645d"} 14:10:50 INFO - Writing buildbot properties ['blobber_files'] to /builds/slave/test/properties/blobber_files 14:10:50 INFO - Writing to file /builds/slave/test/properties/blobber_files 14:10:50 INFO - Contents: 14:10:50 INFO - blobber_files:{"mochitest-devtools-chrome-chunked_raw.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-inbound/sha512/9cfdee01b923b17f78d012276f4c8c3fbd9438f83dfd50925c36194318129b45b579a989699973451af2ee3ad81c2dd5e9fcedeb4fd4149d63744149daf29fb4", "mochitest-devtools-chrome-chunked_errorsummary.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-inbound/sha512/a9cd45bfcaf37c9236a3a294366d061f1fd86358c80285cd5e73fdb871e43146c3493972f51d463448c2d9c5953492836e73932cf8957e3df89010c9d6b5645d"} 14:10:50 INFO - Copying logs to upload dir... 14:10:50 INFO - mkdir: /builds/slave/test/build/upload/logs program finished with exit code 0 elapsedTime=1789.063040 ========= master_lag: 6.09 ========= ========= Finished '/tools/buildbot/bin/python scripts/scripts/desktop_unittest.py ...' (results: 0, elapsed: 29 mins, 55 secs) (at 2015-11-06 14:10:56.618308) ========= ========= Started set props: build_url blobber_files symbols_url (results: 0, elapsed: 9 secs) (at 2015-11-06 14:10:56.619499) ========= bash -c 'for file in `ls -1`; do cat $file; done' in dir /builds/slave/test/properties (timeout 1200 secs) watching logfiles {} argv: ['bash', '-c', 'for file in `ls -1`; do cat $file; done'] environment: HOME=/home/cltbld LANG=en_US.UTF-8 LOGNAME=cltbld MAIL=/var/mail/cltbld NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games PWD=/builds/slave/test/properties SHELL=/bin/bash SHLVL=1 TERM=linux TMOUT=86400 USER=cltbld XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634 _=/tools/buildbot/bin/python using PTY: False blobber_files:{"mochitest-devtools-chrome-chunked_raw.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-inbound/sha512/9cfdee01b923b17f78d012276f4c8c3fbd9438f83dfd50925c36194318129b45b579a989699973451af2ee3ad81c2dd5e9fcedeb4fd4149d63744149daf29fb4", "mochitest-devtools-chrome-chunked_errorsummary.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-inbound/sha512/a9cd45bfcaf37c9236a3a294366d061f1fd86358c80285cd5e73fdb871e43146c3493972f51d463448c2d9c5953492836e73932cf8957e3df89010c9d6b5645d"} build_url:https://queue.taskcluster.net/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.tar.bz2 symbols_url:https://queue.taskcluster.net/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.crashreporter-symbols.zip program finished with exit code 0 elapsedTime=0.035940 build_url: 'https://queue.taskcluster.net/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.tar.bz2' blobber_files: '{"mochitest-devtools-chrome-chunked_raw.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-inbound/sha512/9cfdee01b923b17f78d012276f4c8c3fbd9438f83dfd50925c36194318129b45b579a989699973451af2ee3ad81c2dd5e9fcedeb4fd4149d63744149daf29fb4", "mochitest-devtools-chrome-chunked_errorsummary.log": "http://mozilla-releng-blobs.s3.amazonaws.com/blobs/mozilla-inbound/sha512/a9cd45bfcaf37c9236a3a294366d061f1fd86358c80285cd5e73fdb871e43146c3493972f51d463448c2d9c5953492836e73932cf8957e3df89010c9d6b5645d"}' symbols_url: 'https://queue.taskcluster.net/v1/task/c19VwvpWT6ucOjAUE6HYJg/artifacts/public/build/firefox-45.0a1.en-US.linux-x86_64.crashreporter-symbols.zip' ========= master_lag: 9.03 ========= ========= Finished set props: build_url blobber_files symbols_url (results: 0, elapsed: 9 secs) (at 2015-11-06 14:11:05.688691) ========= ========= Started 'rm -f ...' (results: 0, elapsed: 14 secs) (at 2015-11-06 14:11:05.688987) ========= rm -f oauth.txt in dir /builds/slave/test/. (timeout 1200 secs) watching logfiles {} argv: ['rm', '-f', 'oauth.txt'] environment: HOME=/home/cltbld LANG=en_US.UTF-8 LOGNAME=cltbld MAIL=/var/mail/cltbld NODE_PATH=/usr/lib/nodejs:/usr/lib/node_modules:/usr/share/javascript PATH=/usr/local/bin:/usr/local/bin:/usr/bin:/bin:/usr/local/games:/usr/games PWD=/builds/slave/test SHELL=/bin/bash SHLVL=1 TERM=linux TMOUT=86400 USER=cltbld XDG_SESSION_COOKIE=9ca12473fbb1d023794ffd180000023c-1446846014.505692-1164810634 _=/tools/buildbot/bin/python using PTY: False program finished with exit code 0 elapsedTime=0.021601 ========= master_lag: 14.85 ========= ========= Finished 'rm -f ...' (results: 0, elapsed: 14 secs) (at 2015-11-06 14:11:20.563507) ========= ========= Started reboot skipped (results: 3, elapsed: 1 secs) (at 2015-11-06 14:11:20.563928) ========= ========= Finished reboot skipped (results: 3, elapsed: 1 secs) (at 2015-11-06 14:11:21.711314) ========= ========= Total master_lag: 31.31 =========